From 5a83c325a003a662df879b1fe3e0d2b27d4ad340 Mon Sep 17 00:00:00 2001 From: WP Git Updater Bot Date: Thu, 1 Apr 2021 13:39:23 +0000 Subject: [PATCH] chore(plugins): Update woocommerce-admin from 1.8.3 to 2.2.0 --- plugins/woocommerce-admin/dist/app/index.js | 35611 ++++----- .../dist/app/index.min.asset.php | 1 + .../woocommerce-admin/dist/app/index.min.js | 2 +- plugins/woocommerce-admin/dist/app/style.css | 2 +- .../woocommerce-admin/dist/app/style.rtl.css | 2 +- .../beta-features-tracking-modal/style.css | 1 + .../style.rtl.css | 1 + plugins/woocommerce-admin/dist/chunks/0.js | 1101 +- .../woocommerce-admin/dist/chunks/0.min.js | 2 +- .../woocommerce-admin/dist/chunks/0.style.css | 2 +- .../dist/chunks/0.style.rtl.css | 2 +- plugins/woocommerce-admin/dist/chunks/1.js | 2826 +- .../woocommerce-admin/dist/chunks/1.min.js | 3 +- .../dist/chunks/10.style.css | 2 +- .../dist/chunks/10.style.rtl.css | 2 +- .../chunks/{17.style.css => 14.style.css} | 0 .../{17.style.rtl.css => 14.style.rtl.css} | 0 .../dist/chunks/{6.style.css => 15.style.css} | 0 .../{6.style.rtl.css => 15.style.rtl.css} | 0 plugins/woocommerce-admin/dist/chunks/2.js | 1733 +- .../woocommerce-admin/dist/chunks/2.min.js | 2 +- .../chunks/{23.style.css => 20.style.css} | 0 .../{23.style.rtl.css => 20.style.rtl.css} | 0 .../chunks/{30.style.css => 28.style.css} | 2 +- .../{30.style.rtl.css => 28.style.rtl.css} | 2 +- .../dist/chunks/29.style.css | 1 + .../dist/chunks/29.style.rtl.css | 1 + plugins/woocommerce-admin/dist/chunks/3.js | 1928 +- .../woocommerce-admin/dist/chunks/3.min.js | 3 +- .../woocommerce-admin/dist/chunks/3.style.css | 1 + .../dist/chunks/3.style.rtl.css | 1 + .../dist/chunks/31.style.css | 1 - .../dist/chunks/31.style.rtl.css | 1 - .../dist/chunks/32.style.css | 1 + .../dist/chunks/32.style.rtl.css | 1 + .../dist/chunks/34.style.css | 2 +- .../dist/chunks/34.style.rtl.css | 2 +- .../dist/chunks/36.style.css | 2 +- .../dist/chunks/36.style.rtl.css | 2 +- .../dist/chunks/38.style.css | 1 - .../dist/chunks/38.style.rtl.css | 1 - plugins/woocommerce-admin/dist/chunks/4.js | 1913 +- .../woocommerce-admin/dist/chunks/4.min.js | 2 +- .../dist/chunks/{11.style.css => 4.style.css} | 2 +- .../{11.style.rtl.css => 4.style.rtl.css} | 2 +- .../dist/chunks/46.style.css | 1 + .../dist/chunks/46.style.rtl.css | 1 + .../dist/chunks/47.style.css | 2 +- .../dist/chunks/47.style.rtl.css | 2 +- .../dist/chunks/48.style.css | 2 +- .../dist/chunks/48.style.rtl.css | 2 +- .../dist/chunks/49.style.css | 2 +- .../dist/chunks/49.style.rtl.css | 2 +- plugins/woocommerce-admin/dist/chunks/5.js | 1792 +- .../woocommerce-admin/dist/chunks/5.min.js | 2 +- plugins/woocommerce-admin/dist/chunks/52.js | 1625 + .../woocommerce-admin/dist/chunks/52.min.js | 1 + plugins/woocommerce-admin/dist/chunks/53.js | 1986 +- .../woocommerce-admin/dist/chunks/53.min.js | 2 +- plugins/woocommerce-admin/dist/chunks/54.js | 2553 +- .../woocommerce-admin/dist/chunks/54.min.js | 2 +- plugins/woocommerce-admin/dist/chunks/6.js | 4530 +- .../woocommerce-admin/dist/chunks/6.min.js | 2 +- plugins/woocommerce-admin/dist/chunks/7.js | 1194 - .../woocommerce-admin/dist/chunks/7.min.js | 1 - .../woocommerce-admin/dist/chunks/7.style.css | 1 + .../dist/chunks/7.style.rtl.css | 1 + plugins/woocommerce-admin/dist/chunks/8.js | 968 - .../woocommerce-admin/dist/chunks/8.min.js | 1 - plugins/woocommerce-admin/dist/chunks/9.js | 2788 - .../woocommerce-admin/dist/chunks/9.min.js | 1 - .../dist/chunks/{12.style.css => 9.style.css} | 2 +- .../{12.style.rtl.css => 9.style.rtl.css} | 2 +- .../dist/chunks/activity-panels-help.js | 275 +- .../dist/chunks/activity-panels-help.min.js | 2 +- .../dist/chunks/activity-panels-inbox.js | 1554 +- .../dist/chunks/activity-panels-inbox.min.js | 2 +- .../chunks/analytics-report-categories.js | 726 +- .../chunks/analytics-report-categories.min.js | 2 +- .../dist/chunks/analytics-report-coupons.js | 660 +- .../chunks/analytics-report-coupons.min.js | 2 +- .../dist/chunks/analytics-report-customers.js | 520 +- .../chunks/analytics-report-customers.min.js | 2 +- .../dist/chunks/analytics-report-downloads.js | 740 +- .../chunks/analytics-report-downloads.min.js | 2 +- .../dist/chunks/analytics-report-orders.js | 345 +- .../chunks/analytics-report-orders.min.js | 2 +- .../dist/chunks/analytics-report-products.js | 890 +- .../chunks/analytics-report-products.min.js | 2 +- .../dist/chunks/analytics-report-revenue.js | 580 +- .../chunks/analytics-report-revenue.min.js | 2 +- .../dist/chunks/analytics-report-stock.js | 145 +- .../dist/chunks/analytics-report-stock.min.js | 2 +- .../dist/chunks/analytics-report-taxes.js | 808 +- .../dist/chunks/analytics-report-taxes.min.js | 2 +- .../chunks/analytics-report-variations.js | 1361 +- .../chunks/analytics-report-variations.min.js | 2 +- .../dist/chunks/analytics-report.js | 218 +- .../dist/chunks/analytics-report.min.js | 2 +- .../dist/chunks/analytics-settings.js | 1198 +- .../dist/chunks/analytics-settings.min.js | 2 +- .../dist/chunks/customizable-dashboard.js | 737 +- .../dist/chunks/customizable-dashboard.min.js | 2 +- .../dist/chunks/dashboard-charts.js | 564 +- .../dist/chunks/dashboard-charts.min.js | 2 +- .../dist/chunks/dashboard.js | 74 +- .../dist/chunks/dashboard.min.js | 2 +- .../dist/chunks/homescreen.js | 9171 +-- .../dist/chunks/homescreen.min.js | 2 +- .../dist/chunks/leaderboards.js | 243 +- .../dist/chunks/leaderboards.min.js | 2 +- .../dist/chunks/marketing-overview.js | 1766 +- .../dist/chunks/marketing-overview.min.js | 2 +- .../dist/chunks/profile-wizard.js | 4288 +- .../dist/chunks/profile-wizard.min.js | 2 +- .../dist/chunks/store-alerts.js | 843 +- .../dist/chunks/store-alerts.min.js | 2 +- .../dist/chunks/store-performance.js | 249 +- .../dist/chunks/store-performance.min.js | 2 +- .../dist/chunks/task-list.js | 2458 +- .../dist/chunks/task-list.min.js | 2 +- .../dist/chunks/wcpay-usage-modal.js | 1104 +- .../dist/chunks/wcpay-usage-modal.min.js | 2 +- .../dist/components/ie-rtl.css | 16 +- .../woocommerce-admin/dist/components/ie.css | 16 +- .../dist/components/index.js | 62400 +++++++--------- .../dist/components/index.min.asset.php | 1 + .../dist/components/index.min.js | 2 +- .../dist/components/style-rtl.css | 360 +- .../dist/components/style.css | 360 +- .../dist/csv-export/index.js | 2929 +- .../dist/csv-export/index.min.asset.php | 1 + .../dist/csv-export/index.min.js | 2 +- .../woocommerce-admin/dist/currency/index.js | 3066 +- .../dist/currency/index.min.asset.php | 1 + .../dist/currency/index.min.js | 2 +- .../dist/customer-effort-score/index.js | 11613 +-- .../customer-effort-score/index.min.asset.php | 1 + .../dist/customer-effort-score/index.min.js | 3 +- .../dist/customer-effort-score/style-rtl.css | 22 +- .../dist/customer-effort-score/style.css | 22 +- plugins/woocommerce-admin/dist/data/index.js | 10668 ++- .../dist/data/index.min.asset.php | 1 + .../woocommerce-admin/dist/data/index.min.js | 2 +- plugins/woocommerce-admin/dist/date/index.js | 2754 +- .../dist/date/index.min.asset.php | 1 + .../woocommerce-admin/dist/date/index.min.js | 2 +- .../dist/ie/index.min.asset.php | 1 + plugins/woocommerce-admin/dist/ie/style.css | 2 +- .../woocommerce-admin/dist/ie/style.rtl.css | 2 +- .../dist/navigation-opt-out/style.css | 1 + .../dist/navigation-opt-out/style.rtl.css | 1 + .../dist/navigation/index.js | 6650 +- .../dist/navigation/index.min.asset.php | 1 + .../dist/navigation/index.min.js | 2 +- .../dist/navigation/style-rtl.css | 123 - .../dist/navigation/style.css | 123 - .../woocommerce-admin/dist/notices/index.js | 2848 +- .../dist/notices/index.min.asset.php | 1 + .../dist/notices/index.min.js | 2 +- .../woocommerce-admin/dist/number/index.js | 3401 +- .../dist/number/index.min.asset.php | 1 + .../dist/number/index.min.js | 2 +- .../woocommerce-admin/dist/tracks/index.js | 5173 +- .../dist/tracks/index.min.asset.php | 1 + .../dist/tracks/index.min.js | 2 +- .../beta-features-tracking-modal.js | 523 + ...beta-features-tracking-modal.min.asset.php | 1 + .../beta-features-tracking-modal.min.js | 1 + .../wp-admin-scripts/marketing-coupons.js | 16225 ++-- .../marketing-coupons.min.asset.php | 1 + .../wp-admin-scripts/marketing-coupons.min.js | 2 +- .../wp-admin-scripts/navigation-opt-out.js | 1532 + .../navigation-opt-out.min.asset.php | 1 + .../navigation-opt-out.min.js | 1 + .../onboarding-homepage-notice.js | 2565 +- .../onboarding-homepage-notice.min.asset.php | 1 + .../onboarding-homepage-notice.min.js | 2 +- .../onboarding-product-import-notice.js | 1360 +- ...arding-product-import-notice.min.asset.php | 1 + .../onboarding-product-import-notice.min.js | 2 +- .../onboarding-product-notice.js | 1366 +- .../onboarding-product-notice.min.asset.php | 1 + .../onboarding-product-notice.min.js | 2 +- .../wp-admin-scripts/onboarding-tax-notice.js | 2505 +- .../onboarding-tax-notice.min.asset.php | 1 + .../onboarding-tax-notice.min.js | 2 +- .../print-shipping-label-banner.js | 14839 ++-- .../print-shipping-label-banner.min.asset.php | 1 + .../print-shipping-label-banner.min.js | 3 +- .../admin_notes/dashboard-widget-setup.png | Bin 0 -> 5430 bytes .../images/admin_notes/openbox+purple.png | Bin 0 -> 15847 bytes .../images/onboarding/mailpoet.png | Bin 0 -> 11836 bytes .../images/onboarding/mercadopago.png | Bin 0 -> 6507 bytes .../images/onboarding/paystack.png | Bin 0 -> 55073 bytes .../includes/connect-existing-pages.php | 6 +- .../emails/html-merchant-notification.php | 69 + .../emails/plain-merchant-notification.php | 23 + .../includes/feature-config.php | 4 +- .../languages/woocommerce-admin.pot | 2550 +- plugins/woocommerce-admin/readme.txt | 217 +- plugins/woocommerce-admin/src/API/Init.php | 3 + .../src/API/NavigationFavorites.php | 327 + .../woocommerce-admin/src/API/NoteActions.php | 84 +- plugins/woocommerce-admin/src/API/Notes.php | 27 + .../src/API/OnboardingProfile.php | 35 +- .../src/API/OnboardingTasks.php | 89 +- plugins/woocommerce-admin/src/API/Options.php | 15 +- plugins/woocommerce-admin/src/API/Plugins.php | 46 +- .../src/API/ProductAttributeTerms.php | 151 + .../src/API/ProductAttributes.php | 243 + .../woocommerce-admin/src/API/Products.php | 4 +- .../src/API/Reports/Controller.php | 2 +- .../src/API/Reports/Customers/DataStore.php | 32 +- .../src/API/Reports/DataStore.php | 48 +- .../src/API/Reports/Orders/Controller.php | 14 +- .../src/API/Reports/Orders/DataStore.php | 27 +- .../API/Reports/Revenue/Stats/Controller.php | 2 + .../src/API/Templates/digital_product.csv | 2 + .../src/API/Templates/physical_product.csv | 2 + .../src/API/Templates/variable_product.csv | 2 + .../src/Composer/Package.php | 50 +- plugins/woocommerce-admin/src/Events.php | 61 +- .../woocommerce-admin/src/FeaturePlugin.php | 23 +- .../src/Features/Coupons.php | 8 +- .../src/Features/CouponsMovedTrait.php | 4 +- .../Features/CustomerEffortScoreTracks.php | 319 +- .../src/Features/Features.php | 330 + .../src/Features/Homescreen.php | 29 +- .../src/Features/Marketing.php | 3 +- .../src/Features/Navigation/CoreMenu.php | 260 +- .../src/Features/Navigation/Favorites.php | 131 + .../src/Features/Navigation/Init.php | 148 +- .../src/Features/Navigation/Menu.php | 270 +- .../src/Features/Navigation/Screen.php | 19 +- .../src/Features/Onboarding.php | 212 +- .../src/Features/OnboardingSetUpShipping.php | 139 - .../src/Features/OnboardingTasks.php | 101 +- .../src/Features/Settings.php | 179 + .../src/Features/ShippingLabelBanner.php | 16 +- plugins/woocommerce-admin/src/Install.php | 35 +- plugins/woocommerce-admin/src/Loader.php | 364 +- .../src/Notes/AddFirstProduct.php | 89 + .../src/Notes/AddingAndManangingProducts.php | 77 + .../src/Notes/ChooseNiche.php | 6 +- .../src/Notes/ChoosingTheme.php | 52 + .../src/Notes/CouponPageMoved.php | 4 +- .../src/Notes/CustomizingProductCatalog.php | 80 + .../woocommerce-admin/src/Notes/DataStore.php | 1 + .../src/Notes/DeprecatedNotes.php | 64 +- .../src/Notes/DrawAttention.php | 37 +- .../src/Notes/FirstDownlaodableProduct.php | 68 + .../GettingStartedInEcommerceWebinar.php | 82 + .../src/Notes/GivingFeedbackNotes.php | 6 +- .../src/Notes/HistoricalData.php | 92 - .../src/Notes/HomeScreenFeedback.php | 82 - .../Notes/InsightFirstProductAndPayment.php | 66 + .../Notes/LearnMoreAboutVariableProducts.php | 83 + .../ManageStoreActivityFromHomeScreen.php | 66 + .../woocommerce-admin/src/Notes/Marketing.php | 5 + .../MerchantEmailNotifications.php | 140 + .../NotificationEmail.php | 207 + .../src/Notes/NavigationFeedback.php | 7 +- .../src/Notes/NavigationFeedbackFollowUp.php | 7 +- .../src/Notes/NavigationNudge.php | 86 + .../src/Notes/NeedSomeInspiration.php | 8 +- plugins/woocommerce-admin/src/Notes/Note.php | 4 + plugins/woocommerce-admin/src/Notes/Notes.php | 100 + .../src/Notes/OnboardingEmailMarketing.php | 2 +- .../src/Notes/OnboardingTraits.php | 61 + .../src/Notes/ReviewShippingSettings.php | 60 - .../WelcomeToWooCommerceForStoreUsers.php | 58 + .../src/Notes/WooCommercePayments.php | 2 + .../ComparisonOperation.php | 4 + .../GetRuleProcessor.php | 2 + .../OptionRuleProcessor.php | 5 +- .../ProductCountRuleProcessor.php | 7 +- .../src/RemoteInboxNotifications/README.md | 43 + .../RemoteInboxNotificationsEngine.php | 22 +- .../StoredStateSetupForProducts.php | 10 + .../WooCommerceAdminUpdatedRuleProcessor.php | 36 + .../src/Schedulers/CustomersScheduler.php | 1 + plugins/woocommerce-admin/src/Survey.php | 38 + plugins/woocommerce-admin/vendor/autoload.php | 2 +- .../vendor/autoload_packages.php | 7 +- .../automattic/jetpack-autoloader/README.md | 2 +- .../jetpack-autoloader/composer.json | 18 +- .../src/AutoloadFileWriter.php | 105 + .../src/AutoloadGenerator.php | 185 +- .../src/AutoloadProcessor.php | 2 - .../src/CustomAutoloaderPlugin.php | 88 +- .../jetpack-autoloader/src/autoload.php | 5 +- .../src/class-autoloader-handler.php | 189 +- .../src/class-autoloader-locator.php | 2 +- .../src/class-autoloader.php | 115 + .../src/class-container.php | 141 + .../src/class-hook-manager.php | 68 + .../src/class-latest-autoloader-guard.php | 78 + ...-handler.php => class-manifest-reader.php} | 24 +- .../src/class-path-processor.php | 186 + .../src/class-php-autoloader.php | 82 + .../src/class-plugin-locator.php | 145 + .../src/class-plugins-handler.php | 201 +- .../src/class-version-selector.php | 10 +- .../jetpack-autoloader/src/functions.php | 66 - .../vendor/composer/InstalledVersions.php | 316 + .../vendor/composer/autoload_real.php | 8 +- .../vendor/composer/autoload_static.php | 8 +- .../vendor/composer/installed.json | 55 +- .../vendor/composer/installed.php | 56 + .../workflows/continuous-integration.yml | 70 + .../installers/.github/workflows/lint.yml | 30 + .../installers/.github/workflows/phpstan.yml | 51 + .../vendor/composer/installers/composer.json | 21 +- .../composer/installers/phpstan.neon.dist | 10 + .../src/Composer/Installers/BaseInstaller.php | 12 +- .../Composer/Installers/CakePHPInstaller.php | 11 +- .../Composer/Installers/CockpitInstaller.php | 4 +- .../src/Composer/Installers/Installer.php | 32 +- .../Composer/Installers/MoodleInstaller.php | 1 + .../src/Composer/Installers/OxidInstaller.php | 2 +- .../Installers/ProcessWireInstaller.php | 22 + .../Composer/Installers/StarbugInstaller.php | 12 + .../Composer/Installers/SyDESInstaller.php | 4 +- .../src/Composer/Installers/TaoInstaller.php | 18 + .../composer/jetpack_autoload_classmap.php | 2 +- .../vendor/composer/jetpack_autoload_psr4.php | 6 +- .../vendor/composer/platform_check.php | 26 + .../jetpack-autoloader/autoload_functions.php | 74 - .../class-autoloader-handler.php | 191 +- .../class-autoloader-locator.php | 4 +- .../jetpack-autoloader/class-autoloader.php | 123 + .../jetpack-autoloader/class-container.php | 149 + .../jetpack-autoloader/class-hook-manager.php | 76 + .../class-latest-autoloader-guard.php | 86 + ...-handler.php => class-manifest-reader.php} | 26 +- .../class-path-processor.php | 194 + .../class-php-autoloader.php | 90 + .../class-plugin-locator.php | 153 + .../class-plugins-handler.php | 203 +- .../class-version-loader.php | 2 +- .../class-version-selector.php | 12 +- .../woocommerce-admin/woocommerce-admin.php | 15 +- 343 files changed, 129768 insertions(+), 130445 deletions(-) create mode 100644 plugins/woocommerce-admin/dist/app/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/beta-features-tracking-modal/style.css create mode 100644 plugins/woocommerce-admin/dist/beta-features-tracking-modal/style.rtl.css rename plugins/woocommerce-admin/dist/chunks/{17.style.css => 14.style.css} (100%) rename plugins/woocommerce-admin/dist/chunks/{17.style.rtl.css => 14.style.rtl.css} (100%) rename plugins/woocommerce-admin/dist/chunks/{6.style.css => 15.style.css} (100%) rename plugins/woocommerce-admin/dist/chunks/{6.style.rtl.css => 15.style.rtl.css} (100%) rename plugins/woocommerce-admin/dist/chunks/{23.style.css => 20.style.css} (100%) rename plugins/woocommerce-admin/dist/chunks/{23.style.rtl.css => 20.style.rtl.css} (100%) rename plugins/woocommerce-admin/dist/chunks/{30.style.css => 28.style.css} (95%) rename plugins/woocommerce-admin/dist/chunks/{30.style.rtl.css => 28.style.rtl.css} (95%) create mode 100644 plugins/woocommerce-admin/dist/chunks/29.style.css create mode 100644 plugins/woocommerce-admin/dist/chunks/29.style.rtl.css create mode 100644 plugins/woocommerce-admin/dist/chunks/3.style.css create mode 100644 plugins/woocommerce-admin/dist/chunks/3.style.rtl.css delete mode 100644 plugins/woocommerce-admin/dist/chunks/31.style.css delete mode 100644 plugins/woocommerce-admin/dist/chunks/31.style.rtl.css create mode 100644 plugins/woocommerce-admin/dist/chunks/32.style.css create mode 100644 plugins/woocommerce-admin/dist/chunks/32.style.rtl.css delete mode 100644 plugins/woocommerce-admin/dist/chunks/38.style.css delete mode 100644 plugins/woocommerce-admin/dist/chunks/38.style.rtl.css rename plugins/woocommerce-admin/dist/chunks/{11.style.css => 4.style.css} (67%) rename plugins/woocommerce-admin/dist/chunks/{11.style.rtl.css => 4.style.rtl.css} (68%) create mode 100644 plugins/woocommerce-admin/dist/chunks/46.style.css create mode 100644 plugins/woocommerce-admin/dist/chunks/46.style.rtl.css create mode 100644 plugins/woocommerce-admin/dist/chunks/52.js create mode 100644 plugins/woocommerce-admin/dist/chunks/52.min.js delete mode 100644 plugins/woocommerce-admin/dist/chunks/7.js delete mode 100644 plugins/woocommerce-admin/dist/chunks/7.min.js create mode 100644 plugins/woocommerce-admin/dist/chunks/7.style.css create mode 100644 plugins/woocommerce-admin/dist/chunks/7.style.rtl.css delete mode 100644 plugins/woocommerce-admin/dist/chunks/8.js delete mode 100644 plugins/woocommerce-admin/dist/chunks/8.min.js delete mode 100644 plugins/woocommerce-admin/dist/chunks/9.js delete mode 100644 plugins/woocommerce-admin/dist/chunks/9.min.js rename plugins/woocommerce-admin/dist/chunks/{12.style.css => 9.style.css} (71%) rename plugins/woocommerce-admin/dist/chunks/{12.style.rtl.css => 9.style.rtl.css} (71%) create mode 100644 plugins/woocommerce-admin/dist/components/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/csv-export/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/currency/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/customer-effort-score/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/data/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/date/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/ie/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/navigation-opt-out/style.css create mode 100644 plugins/woocommerce-admin/dist/navigation-opt-out/style.rtl.css create mode 100644 plugins/woocommerce-admin/dist/navigation/index.min.asset.php delete mode 100644 plugins/woocommerce-admin/dist/navigation/style-rtl.css delete mode 100644 plugins/woocommerce-admin/dist/navigation/style.css create mode 100644 plugins/woocommerce-admin/dist/notices/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/number/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/tracks/index.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/beta-features-tracking-modal.js create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/beta-features-tracking-modal.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/beta-features-tracking-modal.min.js create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/marketing-coupons.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/navigation-opt-out.js create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/navigation-opt-out.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/navigation-opt-out.min.js create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/onboarding-homepage-notice.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/onboarding-product-import-notice.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/onboarding-product-notice.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/onboarding-tax-notice.min.asset.php create mode 100644 plugins/woocommerce-admin/dist/wp-admin-scripts/print-shipping-label-banner.min.asset.php create mode 100644 plugins/woocommerce-admin/images/admin_notes/dashboard-widget-setup.png create mode 100644 plugins/woocommerce-admin/images/admin_notes/openbox+purple.png create mode 100644 plugins/woocommerce-admin/images/onboarding/mailpoet.png create mode 100644 plugins/woocommerce-admin/images/onboarding/mercadopago.png create mode 100644 plugins/woocommerce-admin/images/onboarding/paystack.png create mode 100644 plugins/woocommerce-admin/includes/emails/html-merchant-notification.php create mode 100644 plugins/woocommerce-admin/includes/emails/plain-merchant-notification.php create mode 100644 plugins/woocommerce-admin/src/API/NavigationFavorites.php create mode 100644 plugins/woocommerce-admin/src/API/ProductAttributeTerms.php create mode 100644 plugins/woocommerce-admin/src/API/ProductAttributes.php create mode 100644 plugins/woocommerce-admin/src/API/Templates/digital_product.csv create mode 100644 plugins/woocommerce-admin/src/API/Templates/physical_product.csv create mode 100644 plugins/woocommerce-admin/src/API/Templates/variable_product.csv create mode 100644 plugins/woocommerce-admin/src/Features/Features.php create mode 100644 plugins/woocommerce-admin/src/Features/Navigation/Favorites.php delete mode 100644 plugins/woocommerce-admin/src/Features/OnboardingSetUpShipping.php create mode 100644 plugins/woocommerce-admin/src/Features/Settings.php create mode 100644 plugins/woocommerce-admin/src/Notes/AddFirstProduct.php create mode 100644 plugins/woocommerce-admin/src/Notes/AddingAndManangingProducts.php create mode 100644 plugins/woocommerce-admin/src/Notes/ChoosingTheme.php create mode 100644 plugins/woocommerce-admin/src/Notes/CustomizingProductCatalog.php create mode 100644 plugins/woocommerce-admin/src/Notes/FirstDownlaodableProduct.php create mode 100644 plugins/woocommerce-admin/src/Notes/GettingStartedInEcommerceWebinar.php delete mode 100644 plugins/woocommerce-admin/src/Notes/HistoricalData.php delete mode 100644 plugins/woocommerce-admin/src/Notes/HomeScreenFeedback.php create mode 100644 plugins/woocommerce-admin/src/Notes/InsightFirstProductAndPayment.php create mode 100644 plugins/woocommerce-admin/src/Notes/LearnMoreAboutVariableProducts.php create mode 100644 plugins/woocommerce-admin/src/Notes/ManageStoreActivityFromHomeScreen.php create mode 100644 plugins/woocommerce-admin/src/Notes/MerchantEmailNotifications/MerchantEmailNotifications.php create mode 100644 plugins/woocommerce-admin/src/Notes/MerchantEmailNotifications/NotificationEmail.php create mode 100644 plugins/woocommerce-admin/src/Notes/NavigationNudge.php create mode 100644 plugins/woocommerce-admin/src/Notes/OnboardingTraits.php delete mode 100644 plugins/woocommerce-admin/src/Notes/ReviewShippingSettings.php create mode 100644 plugins/woocommerce-admin/src/Notes/WelcomeToWooCommerceForStoreUsers.php create mode 100644 plugins/woocommerce-admin/src/RemoteInboxNotifications/WooCommerceAdminUpdatedRuleProcessor.php create mode 100644 plugins/woocommerce-admin/src/Survey.php create mode 100644 plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/AutoloadFileWriter.php create mode 100644 plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/class-autoloader.php create mode 100644 plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/class-container.php create mode 100644 plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/class-hook-manager.php create mode 100644 plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/class-latest-autoloader-guard.php rename plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/{class-manifest-handler.php => class-manifest-reader.php} (76%) create mode 100644 plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/class-path-processor.php create mode 100644 plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/class-php-autoloader.php create mode 100644 plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/class-plugin-locator.php delete mode 100644 plugins/woocommerce-admin/vendor/automattic/jetpack-autoloader/src/functions.php create mode 100644 plugins/woocommerce-admin/vendor/composer/InstalledVersions.php create mode 100644 plugins/woocommerce-admin/vendor/composer/installed.php create mode 100644 plugins/woocommerce-admin/vendor/composer/installers/.github/workflows/continuous-integration.yml create mode 100644 plugins/woocommerce-admin/vendor/composer/installers/.github/workflows/lint.yml create mode 100644 plugins/woocommerce-admin/vendor/composer/installers/.github/workflows/phpstan.yml create mode 100644 plugins/woocommerce-admin/vendor/composer/installers/phpstan.neon.dist create mode 100644 plugins/woocommerce-admin/vendor/composer/installers/src/Composer/Installers/ProcessWireInstaller.php create mode 100644 plugins/woocommerce-admin/vendor/composer/installers/src/Composer/Installers/StarbugInstaller.php create mode 100644 plugins/woocommerce-admin/vendor/composer/platform_check.php delete mode 100644 plugins/woocommerce-admin/vendor/jetpack-autoloader/autoload_functions.php create mode 100644 plugins/woocommerce-admin/vendor/jetpack-autoloader/class-autoloader.php create mode 100644 plugins/woocommerce-admin/vendor/jetpack-autoloader/class-container.php create mode 100644 plugins/woocommerce-admin/vendor/jetpack-autoloader/class-hook-manager.php create mode 100644 plugins/woocommerce-admin/vendor/jetpack-autoloader/class-latest-autoloader-guard.php rename plugins/woocommerce-admin/vendor/jetpack-autoloader/{class-manifest-handler.php => class-manifest-reader.php} (75%) create mode 100644 plugins/woocommerce-admin/vendor/jetpack-autoloader/class-path-processor.php create mode 100644 plugins/woocommerce-admin/vendor/jetpack-autoloader/class-php-autoloader.php create mode 100644 plugins/woocommerce-admin/vendor/jetpack-autoloader/class-plugin-locator.php diff --git a/plugins/woocommerce-admin/dist/app/index.js b/plugins/woocommerce-admin/dist/app/index.js index 3452aa55..6ff11d11 100644 --- a/plugins/woocommerce-admin/dist/app/index.js +++ b/plugins/woocommerce-admin/dist/app/index.js @@ -35,7 +35,7 @@ this["wc"] = this["wc"] || {}; this["wc"]["app"] = /******/ /******/ // object to store loaded CSS chunks /******/ var installedCssChunks = { -/******/ 24: 0 +/******/ 21: 0 /******/ } /******/ var isCssRtlEnabled = function() { /******/ return document.dir === 'rtl'; @@ -45,14 +45,14 @@ this["wc"] = this["wc"] || {}; this["wc"]["app"] = /******/ // undefined = chunk not loaded, null = chunk preloaded/prefetched /******/ // Promise = chunk loading, 0 = chunk loaded /******/ var installedChunks = { -/******/ 24: 0 +/******/ 21: 0 /******/ }; /******/ /******/ /******/ /******/ // script path function /******/ function webpackJsonpScriptSrc(chunkId) { -/******/ return __webpack_require__.p + "chunks/" + ({"10":"activity-panels-help","11":"activity-panels-inbox","12":"analytics-report","13":"analytics-report-categories","14":"analytics-report-coupons","15":"analytics-report-customers","16":"analytics-report-downloads","17":"analytics-report-orders","18":"analytics-report-products","19":"analytics-report-revenue","20":"analytics-report-stock","21":"analytics-report-taxes","22":"analytics-report-variations","23":"analytics-settings","29":"customizable-dashboard","30":"dashboard","31":"dashboard-charts","34":"homescreen","36":"leaderboards","38":"marketing-overview","47":"profile-wizard","48":"store-alerts","49":"store-performance","50":"task-list","52":"wcpay-usage-modal"}[chunkId]||chunkId) + ".js" +/******/ return __webpack_require__.p + "chunks/" + ({"7":"activity-panels-help","8":"activity-panels-inbox","9":"analytics-report","10":"analytics-report-categories","11":"analytics-report-coupons","12":"analytics-report-customers","13":"analytics-report-downloads","14":"analytics-report-orders","15":"analytics-report-products","16":"analytics-report-revenue","17":"analytics-report-stock","18":"analytics-report-taxes","19":"analytics-report-variations","20":"analytics-settings","27":"customizable-dashboard","28":"dashboard","29":"dashboard-charts","32":"homescreen","34":"leaderboards","36":"marketing-overview","46":"profile-wizard","47":"store-alerts","48":"store-performance","49":"task-list","51":"wcpay-usage-modal"}[chunkId]||chunkId) + ".js" /******/ } /******/ /******/ function jsonpScriptSrc(chunkId) { @@ -95,7 +95,7 @@ this["wc"] = this["wc"] || {}; this["wc"]["app"] = /******/ /******/ /******/ // mini-css-extract-plugin CSS loading -/******/ var cssChunks = {"0":1,"6":1,"10":1,"11":1,"12":1,"17":1,"23":1,"30":1,"31":1,"34":1,"36":1,"38":1,"47":1,"48":1,"49":1}; +/******/ var cssChunks = {"0":1,"4":1,"7":1,"9":1,"10":1,"14":1,"15":1,"20":1,"28":1,"29":1,"32":1,"34":1,"36":1,"46":1,"47":1,"48":1,"49":1}; /******/ if(installedCssChunks[chunkId]) promises.push(installedCssChunks[chunkId]); /******/ else if(installedCssChunks[chunkId] !== 0 && cssChunks[chunkId]) { /******/ promises.push(installedCssChunks[chunkId] = new Promise(function(resolve, reject) { @@ -259,14 +259,14 @@ this["wc"] = this["wc"] || {}; this["wc"]["app"] = /******/ /******/ /******/ // Load entry module and return exports -/******/ return __webpack_require__(__webpack_require__.s = 367); +/******/ return __webpack_require__(__webpack_require__.s = 417); /******/ }) /************************************************************************/ /******/ ([ /* 0 */ /***/ (function(module, exports) { -(function() { module.exports = this["wp"]["element"]; }()); +(function() { module.exports = window["wp"]["element"]; }()); /***/ }), /* 1 */ @@ -282,7 +282,7 @@ this["wc"] = this["wc"] || {}; this["wc"]["app"] = if (false) { var throwOnDirectAccess, ReactIs; } else { // By explicitly using `prop-types` you are opting into new production behavior. // http://fb.me/prop-types-in-prod - module.exports = __webpack_require__(120)(); + module.exports = __webpack_require__(215)(); } @@ -290,16 +290,220 @@ if (false) { var throwOnDirectAccess, ReactIs; } else { /* 2 */ /***/ (function(module, exports) { -(function() { module.exports = this["lodash"]; }()); +(function() { module.exports = window["wp"]["i18n"]; }()); /***/ }), /* 3 */ -/***/ (function(module, exports) { +/***/ (function(module, exports, __webpack_require__) { + +/* WEBPACK VAR INJECTION */(function(global) {var check = function (it) { + return it && it.Math == Math && it; +}; -(function() { module.exports = this["wp"]["i18n"]; }()); +// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028 +module.exports = + /* global globalThis -- safe */ + check(typeof globalThis == 'object' && globalThis) || + check(typeof window == 'object' && window) || + check(typeof self == 'object' && self) || + check(typeof global == 'object' && global) || + // eslint-disable-next-line no-new-func -- fallback + (function () { return this; })() || Function('return this')(); + +/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(96))) /***/ }), /* 4 */ +/***/ (function(module, exports) { + +(function() { module.exports = window["wp"]["components"]; }()); + +/***/ }), +/* 5 */ +/***/ (function(module, exports) { + +(function() { module.exports = window["lodash"]; }()); + +/***/ }), +/* 6 */ +/***/ (function(module, exports) { + +module.exports = function (exec) { + try { + return !!exec(); + } catch (error) { + return true; + } +}; + + +/***/ }), +/* 7 */ +/***/ (function(module, exports) { + +function _defineProperty(obj, key, value) { + if (key in obj) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true + }); + } else { + obj[key] = value; + } + + return obj; +} + +module.exports = _defineProperty; + +/***/ }), +/* 8 */ +/***/ (function(module, exports, __webpack_require__) { + +var global = __webpack_require__(3); +var shared = __webpack_require__(58); +var has = __webpack_require__(11); +var uid = __webpack_require__(55); +var NATIVE_SYMBOL = __webpack_require__(62); +var USE_SYMBOL_AS_UID = __webpack_require__(93); + +var WellKnownSymbolsStore = shared('wks'); +var Symbol = global.Symbol; +var createWellKnownSymbol = USE_SYMBOL_AS_UID ? Symbol : Symbol && Symbol.withoutSetter || uid; + +module.exports = function (name) { + if (!has(WellKnownSymbolsStore, name) || !(NATIVE_SYMBOL || typeof WellKnownSymbolsStore[name] == 'string')) { + if (NATIVE_SYMBOL && has(Symbol, name)) { + WellKnownSymbolsStore[name] = Symbol[name]; + } else { + WellKnownSymbolsStore[name] = createWellKnownSymbol('Symbol.' + name); + } + } return WellKnownSymbolsStore[name]; +}; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports, __webpack_require__) { + +var isObject = __webpack_require__(10); + +module.exports = function (it) { + if (!isObject(it)) { + throw TypeError(String(it) + ' is not an object'); + } return it; +}; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports) { + +module.exports = function (it) { + return typeof it === 'object' ? it !== null : typeof it === 'function'; +}; + + +/***/ }), +/* 11 */ +/***/ (function(module, exports) { + +var hasOwnProperty = {}.hasOwnProperty; + +module.exports = function (it, key) { + return hasOwnProperty.call(it, key); +}; + + +/***/ }), +/* 12 */ +/***/ (function(module, exports, __webpack_require__) { + +var global = __webpack_require__(3); +var getOwnPropertyDescriptor = __webpack_require__(33).f; +var createNonEnumerableProperty = __webpack_require__(19); +var redefine = __webpack_require__(27); +var setGlobal = __webpack_require__(46); +var copyConstructorProperties = __webpack_require__(103); +var isForced = __webpack_require__(74); + +/* + options.target - name of the target object + options.global - target is the global object + options.stat - export as static methods of target + options.proto - export as prototype methods of target + options.real - real prototype method for the `pure` version + options.forced - export even if the native feature is available + options.bind - bind methods to the target, required for the `pure` version + options.wrap - wrap constructors to preventing global pollution, required for the `pure` version + options.unsafe - use the simple assignment of property instead of delete + defineProperty + options.sham - add a flag to not completely full polyfills + options.enumerable - export as enumerable property + options.noTargetGet - prevent calling a getter on target +*/ +module.exports = function (options, source) { + var TARGET = options.target; + var GLOBAL = options.global; + var STATIC = options.stat; + var FORCED, target, key, targetProperty, sourceProperty, descriptor; + if (GLOBAL) { + target = global; + } else if (STATIC) { + target = global[TARGET] || setGlobal(TARGET, {}); + } else { + target = (global[TARGET] || {}).prototype; + } + if (target) for (key in source) { + sourceProperty = source[key]; + if (options.noTargetGet) { + descriptor = getOwnPropertyDescriptor(target, key); + targetProperty = descriptor && descriptor.value; + } else targetProperty = target[key]; + FORCED = isForced(GLOBAL ? key : TARGET + (STATIC ? '.' : '#') + key, options.forced); + // contained in target + if (!FORCED && targetProperty !== undefined) { + if (typeof sourceProperty === typeof targetProperty) continue; + copyConstructorProperties(sourceProperty, targetProperty); + } + // add a flag to not completely full polyfills + if (options.sham || (targetProperty && targetProperty.sham)) { + createNonEnumerableProperty(sourceProperty, 'sham', true); + } + // extend global + redefine(target, key, sourceProperty, options); + } +}; + + +/***/ }), +/* 13 */ +/***/ (function(module, exports, __webpack_require__) { + +var fails = __webpack_require__(6); + +// Detect IE8's incomplete defineProperty implementation +module.exports = !fails(function () { + return Object.defineProperty({}, 1, { get: function () { return 7; } })[1] != 7; +}); + + +/***/ }), +/* 14 */ +/***/ (function(module, exports) { + +function _getPrototypeOf(o) { + module.exports = _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { + return o.__proto__ || Object.getPrototypeOf(o); + }; + return _getPrototypeOf(o); +} + +module.exports = _getPrototypeOf; + +/***/ }), +/* 15 */ /***/ (function(module, exports, __webpack_require__) { /*! @@ -357,8888 +561,8679 @@ if (false) { var throwOnDirectAccess, ReactIs; } else { /***/ }), -/* 5 */ +/* 16 */ /***/ (function(module, exports) { -function _defineProperty(obj, key, value) { - if (key in obj) { - Object.defineProperty(obj, key, { - value: value, - enumerable: true, - configurable: true, - writable: true - }); - } else { - obj[key] = value; - } +(function() { module.exports = window["regeneratorRuntime"]; }()); - return obj; -} +/***/ }), +/* 17 */ +/***/ (function(module, exports, __webpack_require__) { + +var DESCRIPTORS = __webpack_require__(13); +var IE8_DOM_DEFINE = __webpack_require__(72); +var anObject = __webpack_require__(9); +var toPrimitive = __webpack_require__(40); + +var nativeDefineProperty = Object.defineProperty; + +// `Object.defineProperty` method +// https://tc39.es/ecma262/#sec-object.defineproperty +exports.f = DESCRIPTORS ? nativeDefineProperty : function defineProperty(O, P, Attributes) { + anObject(O); + P = toPrimitive(P, true); + anObject(Attributes); + if (IE8_DOM_DEFINE) try { + return nativeDefineProperty(O, P, Attributes); + } catch (error) { /* empty */ } + if ('get' in Attributes || 'set' in Attributes) throw TypeError('Accessors not supported'); + if ('value' in Attributes) O[P] = Attributes.value; + return O; +}; -module.exports = _defineProperty; /***/ }), -/* 6 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 18 */ +/***/ (function(module, exports) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _defineProperty; }); -function _defineProperty(obj, key, value) { - if (key in obj) { - Object.defineProperty(obj, key, { - value: value, - enumerable: true, - configurable: true, - writable: true - }); - } else { - obj[key] = value; +function _assertThisInitialized(self) { + if (self === void 0) { + throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } - return obj; + return self; } -/***/ }), -/* 7 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +module.exports = _assertThisInitialized; -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _extends; }); -function _extends() { - _extends = Object.assign || function (target) { - for (var i = 1; i < arguments.length; i++) { - var source = arguments[i]; +/***/ }), +/* 19 */ +/***/ (function(module, exports, __webpack_require__) { - for (var key in source) { - if (Object.prototype.hasOwnProperty.call(source, key)) { - target[key] = source[key]; - } - } - } +var DESCRIPTORS = __webpack_require__(13); +var definePropertyModule = __webpack_require__(17); +var createPropertyDescriptor = __webpack_require__(39); - return target; - }; +module.exports = DESCRIPTORS ? function (object, key, value) { + return definePropertyModule.f(object, key, createPropertyDescriptor(1, value)); +} : function (object, key, value) { + object[key] = value; + return object; +}; - return _extends.apply(this, arguments); -} /***/ }), -/* 8 */ +/* 20 */ /***/ (function(module, exports) { -(function() { module.exports = this["React"]; }()); +(function() { module.exports = window["React"]; }()); /***/ }), -/* 9 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 21 */ +/***/ (function(module, exports, __webpack_require__) { + +// toObject with fallback for non-array-like ES3 strings +var IndexedObject = __webpack_require__(71); +var requireObjectCoercible = __webpack_require__(32); + +module.exports = function (it) { + return IndexedObject(requireObjectCoercible(it)); +}; -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _getPrototypeOf; }); -function _getPrototypeOf(o) { - _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { - return o.__proto__ || Object.getPrototypeOf(o); - }; - return _getPrototypeOf(o); -} /***/ }), -/* 10 */ +/* 22 */ /***/ (function(module, exports) { -function _getPrototypeOf(o) { - module.exports = _getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function _getPrototypeOf(o) { - return o.__proto__ || Object.getPrototypeOf(o); - }; - return _getPrototypeOf(o); +function _classCallCheck(instance, Constructor) { + if (!(instance instanceof Constructor)) { + throw new TypeError("Cannot call a class as a function"); + } } -module.exports = _getPrototypeOf; +module.exports = _classCallCheck; /***/ }), -/* 11 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _objectWithoutProperties; }); -/* harmony import */ var _babel_runtime_helpers_esm_objectWithoutPropertiesLoose__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(54); - -function _objectWithoutProperties(source, excluded) { - if (source == null) return {}; - var target = Object(_babel_runtime_helpers_esm_objectWithoutPropertiesLoose__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(source, excluded); - var key, i; - - if (Object.getOwnPropertySymbols) { - var sourceSymbolKeys = Object.getOwnPropertySymbols(source); +/* 23 */ +/***/ (function(module, exports) { - for (i = 0; i < sourceSymbolKeys.length; i++) { - key = sourceSymbolKeys[i]; - if (excluded.indexOf(key) >= 0) continue; - if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; - target[key] = source[key]; - } +function _defineProperties(target, props) { + for (var i = 0; i < props.length; i++) { + var descriptor = props[i]; + descriptor.enumerable = descriptor.enumerable || false; + descriptor.configurable = true; + if ("value" in descriptor) descriptor.writable = true; + Object.defineProperty(target, descriptor.key, descriptor); } +} - return target; +function _createClass(Constructor, protoProps, staticProps) { + if (protoProps) _defineProperties(Constructor.prototype, protoProps); + if (staticProps) _defineProperties(Constructor, staticProps); + return Constructor; } +module.exports = _createClass; + /***/ }), -/* 12 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 24 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _assertThisInitialized; }); -function _assertThisInitialized(self) { - if (self === void 0) { - throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); +var setPrototypeOf = __webpack_require__(204); + +function _inherits(subClass, superClass) { + if (typeof superClass !== "function" && superClass !== null) { + throw new TypeError("Super expression must either be null or a function"); } - return self; + subClass.prototype = Object.create(superClass && superClass.prototype, { + constructor: { + value: subClass, + writable: true, + configurable: true + } + }); + if (superClass) setPrototypeOf(subClass, superClass); } +module.exports = _inherits; + /***/ }), -/* 13 */ -/***/ (function(module, exports) { +/* 25 */ +/***/ (function(module, exports, __webpack_require__) { -function _assertThisInitialized(self) { - if (self === void 0) { - throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); +var _typeof = __webpack_require__(108); + +var assertThisInitialized = __webpack_require__(18); + +function _possibleConstructorReturn(self, call) { + if (call && (_typeof(call) === "object" || typeof call === "function")) { + return call; } - return self; + return assertThisInitialized(self); } -module.exports = _assertThisInitialized; +module.exports = _possibleConstructorReturn; /***/ }), -/* 14 */ +/* 26 */ +/***/ (function(module, exports) { + +(function() { module.exports = window["wp"]["data"]; }()); + +/***/ }), +/* 27 */ /***/ (function(module, exports, __webpack_require__) { -module.exports = __webpack_require__(119); +var global = __webpack_require__(3); +var createNonEnumerableProperty = __webpack_require__(19); +var has = __webpack_require__(11); +var setGlobal = __webpack_require__(46); +var inspectSource = __webpack_require__(68); +var InternalStateModule = __webpack_require__(45); + +var getInternalState = InternalStateModule.get; +var enforceInternalState = InternalStateModule.enforce; +var TEMPLATE = String(String).split('String'); + +(module.exports = function (O, key, value, options) { + var unsafe = options ? !!options.unsafe : false; + var simple = options ? !!options.enumerable : false; + var noTargetGet = options ? !!options.noTargetGet : false; + var state; + if (typeof value == 'function') { + if (typeof key == 'string' && !has(value, 'name')) { + createNonEnumerableProperty(value, 'name', key); + } + state = enforceInternalState(value); + if (!state.source) { + state.source = TEMPLATE.join(typeof key == 'string' ? key : ''); + } + } + if (O === global) { + if (simple) O[key] = value; + else setGlobal(key, value); + return; + } else if (!unsafe) { + delete O[key]; + } else if (!noTargetGet && O[key]) { + simple = true; + } + if (simple) O[key] = value; + else createNonEnumerableProperty(O, key, value); +// add fake Function#toString for correct work wrapped methods / constructors with methods like LoDash isNative +})(Function.prototype, 'toString', function toString() { + return typeof this == 'function' && getInternalState(this).source || inspectSource(this); +}); /***/ }), -/* 15 */ +/* 28 */ /***/ (function(module, exports) { -function _defineProperties(target, props) { - for (var i = 0; i < props.length; i++) { - var descriptor = props[i]; - descriptor.enumerable = descriptor.enumerable || false; - descriptor.configurable = true; - if ("value" in descriptor) descriptor.writable = true; - Object.defineProperty(target, descriptor.key, descriptor); - } -} - -function _createClass(Constructor, protoProps, staticProps) { - if (protoProps) _defineProperties(Constructor.prototype, protoProps); - if (staticProps) _defineProperties(Constructor, staticProps); - return Constructor; -} - -module.exports = _createClass; +(function() { module.exports = window["wp"]["primitives"]; }()); /***/ }), -/* 16 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 29 */ +/***/ (function(module, exports) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _classCallCheck; }); -function _classCallCheck(instance, Constructor) { - if (!(instance instanceof Constructor)) { - throw new TypeError("Cannot call a class as a function"); - } -} +(function() { module.exports = window["moment"]; }()); /***/ }), -/* 17 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 30 */ +/***/ (function(module, exports) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _createClass; }); -function _defineProperties(target, props) { - for (var i = 0; i < props.length; i++) { - var descriptor = props[i]; - descriptor.enumerable = descriptor.enumerable || false; - descriptor.configurable = true; - if ("value" in descriptor) descriptor.writable = true; - Object.defineProperty(target, descriptor.key, descriptor); - } -} +var toString = {}.toString; + +module.exports = function (it) { + return toString.call(it).slice(8, -1); +}; -function _createClass(Constructor, protoProps, staticProps) { - if (protoProps) _defineProperties(Constructor.prototype, protoProps); - if (staticProps) _defineProperties(Constructor, staticProps); - return Constructor; -} /***/ }), -/* 18 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 31 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; +var path = __webpack_require__(81); +var global = __webpack_require__(3); -// EXPORTS -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ _inherits; }); +var aFunction = function (variable) { + return typeof variable == 'function' ? variable : undefined; +}; -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js -function _setPrototypeOf(o, p) { - _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { - o.__proto__ = p; - return o; - }; +module.exports = function (namespace, method) { + return arguments.length < 2 ? aFunction(path[namespace]) || aFunction(global[namespace]) + : path[namespace] && path[namespace][method] || global[namespace] && global[namespace][method]; +}; - return _setPrototypeOf(o, p); -} -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/inherits.js -function _inherits(subClass, superClass) { - if (typeof superClass !== "function" && superClass !== null) { - throw new TypeError("Super expression must either be null or a function"); - } +/***/ }), +/* 32 */ +/***/ (function(module, exports) { + +// `RequireObjectCoercible` abstract operation +// https://tc39.es/ecma262/#sec-requireobjectcoercible +module.exports = function (it) { + if (it == undefined) throw TypeError("Can't call method on " + it); + return it; +}; - subClass.prototype = Object.create(superClass && superClass.prototype, { - constructor: { - value: subClass, - writable: true, - configurable: true - } - }); - if (superClass) _setPrototypeOf(subClass, superClass); -} /***/ }), -/* 19 */ -/***/ (function(module, exports) { +/* 33 */ +/***/ (function(module, exports, __webpack_require__) { + +var DESCRIPTORS = __webpack_require__(13); +var propertyIsEnumerableModule = __webpack_require__(76); +var createPropertyDescriptor = __webpack_require__(39); +var toIndexedObject = __webpack_require__(21); +var toPrimitive = __webpack_require__(40); +var has = __webpack_require__(11); +var IE8_DOM_DEFINE = __webpack_require__(72); + +var nativeGetOwnPropertyDescriptor = Object.getOwnPropertyDescriptor; + +// `Object.getOwnPropertyDescriptor` method +// https://tc39.es/ecma262/#sec-object.getownpropertydescriptor +exports.f = DESCRIPTORS ? nativeGetOwnPropertyDescriptor : function getOwnPropertyDescriptor(O, P) { + O = toIndexedObject(O); + P = toPrimitive(P, true); + if (IE8_DOM_DEFINE) try { + return nativeGetOwnPropertyDescriptor(O, P); + } catch (error) { /* empty */ } + if (has(O, P)) return createPropertyDescriptor(!propertyIsEnumerableModule.f.call(O, P), O[P]); +}; -(function() { module.exports = this["moment"]; }()); /***/ }), -/* 20 */ -/***/ (function(module, exports) { +/* 34 */ +/***/ (function(module, exports, __webpack_require__) { -function _classCallCheck(instance, Constructor) { - if (!(instance instanceof Constructor)) { - throw new TypeError("Cannot call a class as a function"); - } -} +var toInteger = __webpack_require__(42); + +var min = Math.min; + +// `ToLength` abstract operation +// https://tc39.es/ecma262/#sec-tolength +module.exports = function (argument) { + return argument > 0 ? min(toInteger(argument), 0x1FFFFFFFFFFFFF) : 0; // 2 ** 53 - 1 == 9007199254740991 +}; -module.exports = _classCallCheck; /***/ }), -/* 21 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 35 */ +/***/ (function(module, exports) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _possibleConstructorReturn; }); -/* harmony import */ var _babel_runtime_helpers_esm_typeof__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(41); -/* harmony import */ var _babel_runtime_helpers_esm_assertThisInitialized__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(12); +(function() { module.exports = window["wp"]["dataControls"]; }()); +/***/ }), +/* 36 */ +/***/ (function(module, exports) { -function _possibleConstructorReturn(self, call) { - if (call && (Object(_babel_runtime_helpers_esm_typeof__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(call) === "object" || typeof call === "function")) { - return call; - } +module.exports = {}; - return Object(_babel_runtime_helpers_esm_assertThisInitialized__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])(self); -} /***/ }), -/* 22 */ +/* 37 */ /***/ (function(module, exports, __webpack_require__) { -var setPrototypeOf = __webpack_require__(135); - -function _inherits(subClass, superClass) { - if (typeof superClass !== "function" && superClass !== null) { - throw new TypeError("Super expression must either be null or a function"); - } +var requireObjectCoercible = __webpack_require__(32); - subClass.prototype = Object.create(superClass && superClass.prototype, { - constructor: { - value: subClass, - writable: true, - configurable: true - } - }); - if (superClass) setPrototypeOf(subClass, superClass); -} +// `ToObject` abstract operation +// https://tc39.es/ecma262/#sec-toobject +module.exports = function (argument) { + return Object(requireObjectCoercible(argument)); +}; -module.exports = _inherits; /***/ }), -/* 23 */ +/* 38 */ /***/ (function(module, exports, __webpack_require__) { -var _typeof = __webpack_require__(52); +var $ = __webpack_require__(12); +var toObject = __webpack_require__(37); +var nativeKeys = __webpack_require__(54); +var fails = __webpack_require__(6); -var assertThisInitialized = __webpack_require__(13); +var FAILS_ON_PRIMITIVES = fails(function () { nativeKeys(1); }); -function _possibleConstructorReturn(self, call) { - if (call && (_typeof(call) === "object" || typeof call === "function")) { - return call; +// `Object.keys` method +// https://tc39.es/ecma262/#sec-object.keys +$({ target: 'Object', stat: true, forced: FAILS_ON_PRIMITIVES }, { + keys: function keys(it) { + return nativeKeys(toObject(it)); } +}); - return assertThisInitialized(self); -} - -module.exports = _possibleConstructorReturn; /***/ }), -/* 24 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 39 */ +/***/ (function(module, exports) { -"use strict"; +module.exports = function (bitmap, value) { + return { + enumerable: !(bitmap & 1), + configurable: !(bitmap & 2), + writable: !(bitmap & 4), + value: value + }; +}; -// EXPORTS -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ _slicedToArray; }); -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/arrayWithHoles.js -function _arrayWithHoles(arr) { - if (Array.isArray(arr)) return arr; -} -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/iterableToArrayLimit.js -function _iterableToArrayLimit(arr, i) { - if (typeof Symbol === "undefined" || !(Symbol.iterator in Object(arr))) return; - var _arr = []; - var _n = true; - var _d = false; - var _e = undefined; +/***/ }), +/* 40 */ +/***/ (function(module, exports, __webpack_require__) { - try { - for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { - _arr.push(_s.value); +var isObject = __webpack_require__(10); + +// `ToPrimitive` abstract operation +// https://tc39.es/ecma262/#sec-toprimitive +// instead of the ES6 spec version, we didn't implement @@toPrimitive case +// and the second argument - flag - preferred type is a string +module.exports = function (input, PREFERRED_STRING) { + if (!isObject(input)) return input; + var fn, val; + if (PREFERRED_STRING && typeof (fn = input.toString) == 'function' && !isObject(val = fn.call(input))) return val; + if (typeof (fn = input.valueOf) == 'function' && !isObject(val = fn.call(input))) return val; + if (!PREFERRED_STRING && typeof (fn = input.toString) == 'function' && !isObject(val = fn.call(input))) return val; + throw TypeError("Can't convert object to primitive value"); +}; - if (i && _arr.length === i) break; - } - } catch (err) { - _d = true; - _e = err; - } finally { - try { - if (!_n && _i["return"] != null) _i["return"](); - } finally { - if (_d) throw _e; - } - } - return _arr; -} -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js -var unsupportedIterableToArray = __webpack_require__(59); +/***/ }), +/* 41 */ +/***/ (function(module, exports, __webpack_require__) { -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/nonIterableRest.js -function _nonIterableRest() { - throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); -} -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/slicedToArray.js +"use strict"; +var $ = __webpack_require__(12); +var $filter = __webpack_require__(75).filter; +var arrayMethodHasSpeciesSupport = __webpack_require__(89); +var HAS_SPECIES_SUPPORT = arrayMethodHasSpeciesSupport('filter'); +// `Array.prototype.filter` method +// https://tc39.es/ecma262/#sec-array.prototype.filter +// with adding support of @@species +$({ target: 'Array', proto: true, forced: !HAS_SPECIES_SUPPORT }, { + filter: function filter(callbackfn /* , thisArg */) { + return $filter(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined); + } +}); -function _slicedToArray(arr, i) { - return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || Object(unsupportedIterableToArray["a" /* default */])(arr, i) || _nonIterableRest(); -} /***/ }), -/* 25 */ +/* 42 */ /***/ (function(module, exports) { -(function() { module.exports = this["wp"]["data"]; }()); +var ceil = Math.ceil; +var floor = Math.floor; + +// `ToInteger` abstract operation +// https://tc39.es/ecma262/#sec-tointeger +module.exports = function (argument) { + return isNaN(argument = +argument) ? 0 : (argument > 0 ? floor : ceil)(argument); +}; + /***/ }), -/* 26 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 43 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; +var arrayWithHoles = __webpack_require__(181); -// EXPORTS -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ _toConsumableArray; }); +var iterableToArrayLimit = __webpack_require__(182); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/arrayLikeToArray.js -var arrayLikeToArray = __webpack_require__(49); +var unsupportedIterableToArray = __webpack_require__(132); -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/arrayWithoutHoles.js +var nonIterableRest = __webpack_require__(183); -function _arrayWithoutHoles(arr) { - if (Array.isArray(arr)) return Object(arrayLikeToArray["a" /* default */])(arr); -} -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/iterableToArray.js -function _iterableToArray(iter) { - if (typeof Symbol !== "undefined" && Symbol.iterator in Object(iter)) return Array.from(iter); +function _slicedToArray(arr, i) { + return arrayWithHoles(arr) || iterableToArrayLimit(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest(); } -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/unsupportedIterableToArray.js -var unsupportedIterableToArray = __webpack_require__(59); -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/nonIterableSpread.js -function _nonIterableSpread() { - throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); -} -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/toConsumableArray.js +module.exports = _slicedToArray; + +/***/ }), +/* 44 */ +/***/ (function(module, exports, __webpack_require__) { +var arrayWithoutHoles = __webpack_require__(178); +var iterableToArray = __webpack_require__(179); +var unsupportedIterableToArray = __webpack_require__(132); + +var nonIterableSpread = __webpack_require__(180); function _toConsumableArray(arr) { - return _arrayWithoutHoles(arr) || _iterableToArray(arr) || Object(unsupportedIterableToArray["a" /* default */])(arr) || _nonIterableSpread(); + return arrayWithoutHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableSpread(); } -/***/ }), -/* 27 */ -/***/ (function(module, exports) { - -(function() { module.exports = this["wp"]["dataControls"]; }()); +module.exports = _toConsumableArray; /***/ }), -/* 28 */ +/* 45 */ /***/ (function(module, exports, __webpack_require__) { -var arrayWithoutHoles = __webpack_require__(93); +var NATIVE_WEAK_MAP = __webpack_require__(106); +var global = __webpack_require__(3); +var isObject = __webpack_require__(10); +var createNonEnumerableProperty = __webpack_require__(19); +var objectHas = __webpack_require__(11); +var shared = __webpack_require__(47); +var sharedKey = __webpack_require__(51); +var hiddenKeys = __webpack_require__(36); -var iterableToArray = __webpack_require__(94); +var WeakMap = global.WeakMap; +var set, get, has; -var unsupportedIterableToArray = __webpack_require__(63); +var enforce = function (it) { + return has(it) ? get(it) : set(it, {}); +}; -var nonIterableSpread = __webpack_require__(95); +var getterFor = function (TYPE) { + return function (it) { + var state; + if (!isObject(it) || (state = get(it)).type !== TYPE) { + throw TypeError('Incompatible receiver, ' + TYPE + ' required'); + } return state; + }; +}; -function _toConsumableArray(arr) { - return arrayWithoutHoles(arr) || iterableToArray(arr) || unsupportedIterableToArray(arr) || nonIterableSpread(); +if (NATIVE_WEAK_MAP) { + var store = shared.state || (shared.state = new WeakMap()); + var wmget = store.get; + var wmhas = store.has; + var wmset = store.set; + set = function (it, metadata) { + metadata.facade = it; + wmset.call(store, it, metadata); + return metadata; + }; + get = function (it) { + return wmget.call(store, it) || {}; + }; + has = function (it) { + return wmhas.call(store, it); + }; +} else { + var STATE = sharedKey('state'); + hiddenKeys[STATE] = true; + set = function (it, metadata) { + metadata.facade = it; + createNonEnumerableProperty(it, STATE, metadata); + return metadata; + }; + get = function (it) { + return objectHas(it, STATE) ? it[STATE] : {}; + }; + has = function (it) { + return objectHas(it, STATE); + }; } -module.exports = _toConsumableArray; +module.exports = { + set: set, + get: get, + has: has, + enforce: enforce, + getterFor: getterFor +}; + /***/ }), -/* 29 */ -/***/ (function(module, exports) { +/* 46 */ +/***/ (function(module, exports, __webpack_require__) { + +var global = __webpack_require__(3); +var createNonEnumerableProperty = __webpack_require__(19); + +module.exports = function (key, value) { + try { + createNonEnumerableProperty(global, key, value); + } catch (error) { + global[key] = value; + } return value; +}; -(function() { module.exports = this["wc"]["navigation"]; }()); /***/ }), -/* 30 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 47 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return rgba; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return color; }); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(2); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(lodash__WEBPACK_IMPORTED_MODULE_0__); -/* harmony import */ var tinycolor2__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(106); -/* harmony import */ var tinycolor2__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(tinycolor2__WEBPACK_IMPORTED_MODULE_1__); -/* harmony import */ var _colors_values__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(86); -/** - * External dependencies - */ +var global = __webpack_require__(3); +var setGlobal = __webpack_require__(46); +var SHARED = '__core-js_shared__'; +var store = global[SHARED] || setGlobal(SHARED, {}); -/** - * Internal dependencies - */ +module.exports = store; -/** - * Generating a CSS complient rgba() color value. - * - * @param {string} hexValue The hex value to convert to rgba(). - * @param {number} alpha The alpha value for opacity. - * @return {string} The converted rgba() color value. - * - * @example - * rgba( '#000000', 0.5 ) - * // rgba(0, 0, 0, 0.5) - */ +/***/ }), +/* 48 */ +/***/ (function(module, exports) { -function rgba() { - var hexValue = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : ''; - var alpha = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 1; +// IE8- don't enum bug keys +module.exports = [ + 'constructor', + 'hasOwnProperty', + 'isPrototypeOf', + 'propertyIsEnumerable', + 'toLocaleString', + 'toString', + 'valueOf' +]; - var _tinycolor$toRgb = tinycolor2__WEBPACK_IMPORTED_MODULE_1___default()(hexValue).toRgb(), - r = _tinycolor$toRgb.r, - g = _tinycolor$toRgb.g, - b = _tinycolor$toRgb.b; - return "rgba(".concat(r, ", ").concat(g, ", ").concat(b, ", ").concat(alpha, ")"); -} -/** - * Retrieves a color from the color palette. - * - * @param {string} value The value to retrieve. - * @return {string} The color (or fallback, if not found). - * - * @example - * color( 'blue.wordpress.700' ) - * // #00669b - */ +/***/ }), +/* 49 */ +/***/ (function(module, exports, __webpack_require__) { -function color(value) { - var fallbackColor = '#000'; - return Object(lodash__WEBPACK_IMPORTED_MODULE_0__["get"])(_colors_values__WEBPACK_IMPORTED_MODULE_2__[/* COLORS */ "a"], value, fallbackColor); +var global = __webpack_require__(3); +var DOMIterables = __webpack_require__(128); +var forEach = __webpack_require__(149); +var createNonEnumerableProperty = __webpack_require__(19); + +for (var COLLECTION_NAME in DOMIterables) { + var Collection = global[COLLECTION_NAME]; + var CollectionPrototype = Collection && Collection.prototype; + // some Chrome versions have non-configurable methods on DOMTokenList + if (CollectionPrototype && CollectionPrototype.forEach !== forEach) try { + createNonEnumerableProperty(CollectionPrototype, 'forEach', forEach); + } catch (error) { + CollectionPrototype.forEach = forEach; + } } -//# sourceMappingURL=colors.js.map + /***/ }), -/* 31 */ -/***/ (function(module, exports, __webpack_require__) { +/* 50 */ +/***/ (function(module, exports) { -var arrayWithHoles = __webpack_require__(100); +(function() { module.exports = window["wc"]["navigation"]; }()); -var iterableToArrayLimit = __webpack_require__(101); +/***/ }), +/* 51 */ +/***/ (function(module, exports, __webpack_require__) { -var unsupportedIterableToArray = __webpack_require__(63); +var shared = __webpack_require__(58); +var uid = __webpack_require__(55); -var nonIterableRest = __webpack_require__(102); +var keys = shared('keys'); -function _slicedToArray(arr, i) { - return arrayWithHoles(arr) || iterableToArrayLimit(arr, i) || unsupportedIterableToArray(arr, i) || nonIterableRest(); -} +module.exports = function (key) { + return keys[key] || (keys[key] = uid(key)); +}; -module.exports = _slicedToArray; /***/ }), -/* 32 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 52 */ +/***/ (function(module, exports, __webpack_require__) { "use strict"; -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/defineProperty.js -var defineProperty = __webpack_require__(5); -var defineProperty_default = /*#__PURE__*/__webpack_require__.n(defineProperty); - -// EXTERNAL MODULE: external "React" -var external_React_ = __webpack_require__(8); +var $ = __webpack_require__(12); +var $map = __webpack_require__(75).map; +var arrayMethodHasSpeciesSupport = __webpack_require__(89); -// EXTERNAL MODULE: ./node_modules/@emotion/memoize/dist/memoize.browser.esm.js -var memoize_browser_esm = __webpack_require__(73); +var HAS_SPECIES_SUPPORT = arrayMethodHasSpeciesSupport('map'); -// CONCATENATED MODULE: ./node_modules/@emotion/is-prop-valid/dist/is-prop-valid.browser.esm.js +// `Array.prototype.map` method +// https://tc39.es/ecma262/#sec-array.prototype.map +// with adding support of @@species +$({ target: 'Array', proto: true, forced: !HAS_SPECIES_SUPPORT }, { + map: function map(callbackfn /* , thisArg */) { + return $map(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined); + } +}); -var reactPropsRegex = /^((children|dangerouslySetInnerHTML|key|ref|autoFocus|defaultValue|defaultChecked|innerHTML|suppressContentEditableWarning|suppressHydrationWarning|valueLink|accept|acceptCharset|accessKey|action|allow|allowUserMedia|allowPaymentRequest|allowFullScreen|allowTransparency|alt|async|autoComplete|autoPlay|capture|cellPadding|cellSpacing|challenge|charSet|checked|cite|classID|className|cols|colSpan|content|contentEditable|contextMenu|controls|controlsList|coords|crossOrigin|data|dateTime|decoding|default|defer|dir|disabled|disablePictureInPicture|download|draggable|encType|form|formAction|formEncType|formMethod|formNoValidate|formTarget|frameBorder|headers|height|hidden|high|href|hrefLang|htmlFor|httpEquiv|id|inputMode|integrity|is|keyParams|keyType|kind|label|lang|list|loading|loop|low|marginHeight|marginWidth|max|maxLength|media|mediaGroup|method|min|minLength|multiple|muted|name|nonce|noValidate|open|optimum|pattern|placeholder|playsInline|poster|preload|profile|radioGroup|readOnly|referrerPolicy|rel|required|reversed|role|rows|rowSpan|sandbox|scope|scoped|scrolling|seamless|selected|shape|size|sizes|slot|span|spellCheck|src|srcDoc|srcLang|srcSet|start|step|style|summary|tabIndex|target|title|type|useMap|value|width|wmode|wrap|about|datatype|inlist|prefix|property|resource|typeof|vocab|autoCapitalize|autoCorrect|autoSave|color|inert|itemProp|itemScope|itemType|itemID|itemRef|on|results|security|unselectable|accentHeight|accumulate|additive|alignmentBaseline|allowReorder|alphabetic|amplitude|arabicForm|ascent|attributeName|attributeType|autoReverse|azimuth|baseFrequency|baselineShift|baseProfile|bbox|begin|bias|by|calcMode|capHeight|clip|clipPathUnits|clipPath|clipRule|colorInterpolation|colorInterpolationFilters|colorProfile|colorRendering|contentScriptType|contentStyleType|cursor|cx|cy|d|decelerate|descent|diffuseConstant|direction|display|divisor|dominantBaseline|dur|dx|dy|edgeMode|elevation|enableBackground|end|exponent|externalResourcesRequired|fill|fillOpacity|fillRule|filter|filterRes|filterUnits|floodColor|floodOpacity|focusable|fontFamily|fontSize|fontSizeAdjust|fontStretch|fontStyle|fontVariant|fontWeight|format|from|fr|fx|fy|g1|g2|glyphName|glyphOrientationHorizontal|glyphOrientationVertical|glyphRef|gradientTransform|gradientUnits|hanging|horizAdvX|horizOriginX|ideographic|imageRendering|in|in2|intercept|k|k1|k2|k3|k4|kernelMatrix|kernelUnitLength|kerning|keyPoints|keySplines|keyTimes|lengthAdjust|letterSpacing|lightingColor|limitingConeAngle|local|markerEnd|markerMid|markerStart|markerHeight|markerUnits|markerWidth|mask|maskContentUnits|maskUnits|mathematical|mode|numOctaves|offset|opacity|operator|order|orient|orientation|origin|overflow|overlinePosition|overlineThickness|panose1|paintOrder|pathLength|patternContentUnits|patternTransform|patternUnits|pointerEvents|points|pointsAtX|pointsAtY|pointsAtZ|preserveAlpha|preserveAspectRatio|primitiveUnits|r|radius|refX|refY|renderingIntent|repeatCount|repeatDur|requiredExtensions|requiredFeatures|restart|result|rotate|rx|ry|scale|seed|shapeRendering|slope|spacing|specularConstant|specularExponent|speed|spreadMethod|startOffset|stdDeviation|stemh|stemv|stitchTiles|stopColor|stopOpacity|strikethroughPosition|strikethroughThickness|string|stroke|strokeDasharray|strokeDashoffset|strokeLinecap|strokeLinejoin|strokeMiterlimit|strokeOpacity|strokeWidth|surfaceScale|systemLanguage|tableValues|targetX|targetY|textAnchor|textDecoration|textRendering|textLength|to|transform|u1|u2|underlinePosition|underlineThickness|unicode|unicodeBidi|unicodeRange|unitsPerEm|vAlphabetic|vHanging|vIdeographic|vMathematical|values|vectorEffect|version|vertAdvY|vertOriginX|vertOriginY|viewBox|viewTarget|visibility|widths|wordSpacing|writingMode|x|xHeight|x1|x2|xChannelSelector|xlinkActuate|xlinkArcrole|xlinkHref|xlinkRole|xlinkShow|xlinkTitle|xlinkType|xmlBase|xmlns|xmlnsXlink|xmlLang|xmlSpace|y|y1|y2|yChannelSelector|z|zoomAndPan|for|class|autofocus)|(([Dd][Aa][Tt][Aa]|[Aa][Rr][Ii][Aa]|x)-.*))$/; // https://esbench.com/bench/5bfee68a4cd7e6009ef61d23 +/***/ }), +/* 53 */ +/***/ (function(module, exports, __webpack_require__) { -var index = Object(memoize_browser_esm["a" /* default */])(function (prop) { - return reactPropsRegex.test(prop) || prop.charCodeAt(0) === 111 - /* o */ - && prop.charCodeAt(1) === 110 - /* n */ - && prop.charCodeAt(2) < 91; -} -/* Z+1 */ -); +"use strict"; -/* harmony default export */ var is_prop_valid_browser_esm = (index); +var $ = __webpack_require__(12); +var global = __webpack_require__(3); +var getBuiltIn = __webpack_require__(31); +var IS_PURE = __webpack_require__(57); +var DESCRIPTORS = __webpack_require__(13); +var NATIVE_SYMBOL = __webpack_require__(62); +var USE_SYMBOL_AS_UID = __webpack_require__(93); +var fails = __webpack_require__(6); +var has = __webpack_require__(11); +var isArray = __webpack_require__(84); +var isObject = __webpack_require__(10); +var anObject = __webpack_require__(9); +var toObject = __webpack_require__(37); +var toIndexedObject = __webpack_require__(21); +var toPrimitive = __webpack_require__(40); +var createPropertyDescriptor = __webpack_require__(39); +var nativeObjectCreate = __webpack_require__(69); +var objectKeys = __webpack_require__(54); +var getOwnPropertyNamesModule = __webpack_require__(56); +var getOwnPropertyNamesExternal = __webpack_require__(147); +var getOwnPropertySymbolsModule = __webpack_require__(79); +var getOwnPropertyDescriptorModule = __webpack_require__(33); +var definePropertyModule = __webpack_require__(17); +var propertyIsEnumerableModule = __webpack_require__(76); +var createNonEnumerableProperty = __webpack_require__(19); +var redefine = __webpack_require__(27); +var shared = __webpack_require__(58); +var sharedKey = __webpack_require__(51); +var hiddenKeys = __webpack_require__(36); +var uid = __webpack_require__(55); +var wellKnownSymbol = __webpack_require__(8); +var wrappedWellKnownSymbolModule = __webpack_require__(119); +var defineWellKnownSymbol = __webpack_require__(148); +var setToStringTag = __webpack_require__(90); +var InternalStateModule = __webpack_require__(45); +var $forEach = __webpack_require__(75).forEach; + +var HIDDEN = sharedKey('hidden'); +var SYMBOL = 'Symbol'; +var PROTOTYPE = 'prototype'; +var TO_PRIMITIVE = wellKnownSymbol('toPrimitive'); +var setInternalState = InternalStateModule.set; +var getInternalState = InternalStateModule.getterFor(SYMBOL); +var ObjectPrototype = Object[PROTOTYPE]; +var $Symbol = global.Symbol; +var $stringify = getBuiltIn('JSON', 'stringify'); +var nativeGetOwnPropertyDescriptor = getOwnPropertyDescriptorModule.f; +var nativeDefineProperty = definePropertyModule.f; +var nativeGetOwnPropertyNames = getOwnPropertyNamesExternal.f; +var nativePropertyIsEnumerable = propertyIsEnumerableModule.f; +var AllSymbols = shared('symbols'); +var ObjectPrototypeSymbols = shared('op-symbols'); +var StringToSymbolRegistry = shared('string-to-symbol-registry'); +var SymbolToStringRegistry = shared('symbol-to-string-registry'); +var WellKnownSymbolsStore = shared('wks'); +var QObject = global.QObject; +// Don't use setters in Qt Script, https://github.com/zloirock/core-js/issues/173 +var USE_SETTER = !QObject || !QObject[PROTOTYPE] || !QObject[PROTOTYPE].findChild; + +// fallback for old Android, https://code.google.com/p/v8/issues/detail?id=687 +var setSymbolDescriptor = DESCRIPTORS && fails(function () { + return nativeObjectCreate(nativeDefineProperty({}, 'a', { + get: function () { return nativeDefineProperty(this, 'a', { value: 7 }).a; } + })).a != 7; +}) ? function (O, P, Attributes) { + var ObjectPrototypeDescriptor = nativeGetOwnPropertyDescriptor(ObjectPrototype, P); + if (ObjectPrototypeDescriptor) delete ObjectPrototype[P]; + nativeDefineProperty(O, P, Attributes); + if (ObjectPrototypeDescriptor && O !== ObjectPrototype) { + nativeDefineProperty(ObjectPrototype, P, ObjectPrototypeDescriptor); + } +} : nativeDefineProperty; + +var wrap = function (tag, description) { + var symbol = AllSymbols[tag] = nativeObjectCreate($Symbol[PROTOTYPE]); + setInternalState(symbol, { + type: SYMBOL, + tag: tag, + description: description + }); + if (!DESCRIPTORS) symbol.description = description; + return symbol; +}; -// EXTERNAL MODULE: ./node_modules/@emotion/core/dist/core.browser.esm.js + 6 modules -var core_browser_esm = __webpack_require__(48); +var isSymbol = USE_SYMBOL_AS_UID ? function (it) { + return typeof it == 'symbol'; +} : function (it) { + return Object(it) instanceof $Symbol; +}; -// EXTERNAL MODULE: ./node_modules/@emotion/utils/dist/utils.browser.esm.js -var utils_browser_esm = __webpack_require__(38); +var $defineProperty = function defineProperty(O, P, Attributes) { + if (O === ObjectPrototype) $defineProperty(ObjectPrototypeSymbols, P, Attributes); + anObject(O); + var key = toPrimitive(P, true); + anObject(Attributes); + if (has(AllSymbols, key)) { + if (!Attributes.enumerable) { + if (!has(O, HIDDEN)) nativeDefineProperty(O, HIDDEN, createPropertyDescriptor(1, {})); + O[HIDDEN][key] = true; + } else { + if (has(O, HIDDEN) && O[HIDDEN][key]) O[HIDDEN][key] = false; + Attributes = nativeObjectCreate(Attributes, { enumerable: createPropertyDescriptor(0, false) }); + } return setSymbolDescriptor(O, key, Attributes); + } return nativeDefineProperty(O, key, Attributes); +}; -// EXTERNAL MODULE: ./node_modules/@emotion/serialize/dist/serialize.browser.esm.js + 2 modules -var serialize_browser_esm = __webpack_require__(37); +var $defineProperties = function defineProperties(O, Properties) { + anObject(O); + var properties = toIndexedObject(Properties); + var keys = objectKeys(properties).concat($getOwnPropertySymbols(properties)); + $forEach(keys, function (key) { + if (!DESCRIPTORS || $propertyIsEnumerable.call(properties, key)) $defineProperty(O, key, properties[key]); + }); + return O; +}; -// CONCATENATED MODULE: ./node_modules/@emotion/styled-base/dist/styled-base.browser.esm.js +var $create = function create(O, Properties) { + return Properties === undefined ? nativeObjectCreate(O) : $defineProperties(nativeObjectCreate(O), Properties); +}; +var $propertyIsEnumerable = function propertyIsEnumerable(V) { + var P = toPrimitive(V, true); + var enumerable = nativePropertyIsEnumerable.call(this, P); + if (this === ObjectPrototype && has(AllSymbols, P) && !has(ObjectPrototypeSymbols, P)) return false; + return enumerable || !has(this, P) || !has(AllSymbols, P) || has(this, HIDDEN) && this[HIDDEN][P] ? enumerable : true; +}; +var $getOwnPropertyDescriptor = function getOwnPropertyDescriptor(O, P) { + var it = toIndexedObject(O); + var key = toPrimitive(P, true); + if (it === ObjectPrototype && has(AllSymbols, key) && !has(ObjectPrototypeSymbols, key)) return; + var descriptor = nativeGetOwnPropertyDescriptor(it, key); + if (descriptor && has(AllSymbols, key) && !(has(it, HIDDEN) && it[HIDDEN][key])) { + descriptor.enumerable = true; + } + return descriptor; +}; +var $getOwnPropertyNames = function getOwnPropertyNames(O) { + var names = nativeGetOwnPropertyNames(toIndexedObject(O)); + var result = []; + $forEach(names, function (key) { + if (!has(AllSymbols, key) && !has(hiddenKeys, key)) result.push(key); + }); + return result; +}; +var $getOwnPropertySymbols = function getOwnPropertySymbols(O) { + var IS_OBJECT_PROTOTYPE = O === ObjectPrototype; + var names = nativeGetOwnPropertyNames(IS_OBJECT_PROTOTYPE ? ObjectPrototypeSymbols : toIndexedObject(O)); + var result = []; + $forEach(names, function (key) { + if (has(AllSymbols, key) && (!IS_OBJECT_PROTOTYPE || has(ObjectPrototype, key))) { + result.push(AllSymbols[key]); + } + }); + return result; +}; +// `Symbol` constructor +// https://tc39.es/ecma262/#sec-symbol-constructor +if (!NATIVE_SYMBOL) { + $Symbol = function Symbol() { + if (this instanceof $Symbol) throw TypeError('Symbol is not a constructor'); + var description = !arguments.length || arguments[0] === undefined ? undefined : String(arguments[0]); + var tag = uid(description); + var setter = function (value) { + if (this === ObjectPrototype) setter.call(ObjectPrototypeSymbols, value); + if (has(this, HIDDEN) && has(this[HIDDEN], tag)) this[HIDDEN][tag] = false; + setSymbolDescriptor(this, tag, createPropertyDescriptor(1, value)); + }; + if (DESCRIPTORS && USE_SETTER) setSymbolDescriptor(ObjectPrototype, tag, { configurable: true, set: setter }); + return wrap(tag, description); + }; + redefine($Symbol[PROTOTYPE], 'toString', function toString() { + return getInternalState(this).tag; + }); -var testOmitPropsOnStringTag = is_prop_valid_browser_esm; + redefine($Symbol, 'withoutSetter', function (description) { + return wrap(uid(description), description); + }); -var testOmitPropsOnComponent = function testOmitPropsOnComponent(key) { - return key !== 'theme' && key !== 'innerRef'; -}; + propertyIsEnumerableModule.f = $propertyIsEnumerable; + definePropertyModule.f = $defineProperty; + getOwnPropertyDescriptorModule.f = $getOwnPropertyDescriptor; + getOwnPropertyNamesModule.f = getOwnPropertyNamesExternal.f = $getOwnPropertyNames; + getOwnPropertySymbolsModule.f = $getOwnPropertySymbols; -var getDefaultShouldForwardProp = function getDefaultShouldForwardProp(tag) { - return typeof tag === 'string' && // 96 is one less than the char code - // for "a" so this is checking that - // it's a lowercase character - tag.charCodeAt(0) > 96 ? testOmitPropsOnStringTag : testOmitPropsOnComponent; -}; + wrappedWellKnownSymbolModule.f = function (name) { + return wrap(wellKnownSymbol(name), name); + }; -function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; } + if (DESCRIPTORS) { + // https://github.com/tc39/proposal-Symbol-description + nativeDefineProperty($Symbol[PROTOTYPE], 'description', { + configurable: true, + get: function description() { + return getInternalState(this).description; + } + }); + if (!IS_PURE) { + redefine(ObjectPrototype, 'propertyIsEnumerable', $propertyIsEnumerable, { unsafe: true }); + } + } +} -function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(source, true).forEach(function (key) { defineProperty_default()(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(source).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } -var ILLEGAL_ESCAPE_SEQUENCE_ERROR = "You have illegal escape sequence in your template literal, most likely inside content's property value.\nBecause you write your CSS inside a JavaScript string you actually have to do double escaping, so for example \"content: '\\00d7';\" should become \"content: '\\\\00d7';\".\nYou can read more about this here:\nhttps://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Template_literals#ES2018_revision_of_illegal_escape_sequences"; +$({ global: true, wrap: true, forced: !NATIVE_SYMBOL, sham: !NATIVE_SYMBOL }, { + Symbol: $Symbol +}); -var styled_base_browser_esm_createStyled = function createStyled(tag, options) { - if (false) {} +$forEach(objectKeys(WellKnownSymbolsStore), function (name) { + defineWellKnownSymbol(name); +}); - var identifierName; - var shouldForwardProp; - var targetClassName; +$({ target: SYMBOL, stat: true, forced: !NATIVE_SYMBOL }, { + // `Symbol.for` method + // https://tc39.es/ecma262/#sec-symbol.for + 'for': function (key) { + var string = String(key); + if (has(StringToSymbolRegistry, string)) return StringToSymbolRegistry[string]; + var symbol = $Symbol(string); + StringToSymbolRegistry[string] = symbol; + SymbolToStringRegistry[symbol] = string; + return symbol; + }, + // `Symbol.keyFor` method + // https://tc39.es/ecma262/#sec-symbol.keyfor + keyFor: function keyFor(sym) { + if (!isSymbol(sym)) throw TypeError(sym + ' is not a symbol'); + if (has(SymbolToStringRegistry, sym)) return SymbolToStringRegistry[sym]; + }, + useSetter: function () { USE_SETTER = true; }, + useSimple: function () { USE_SETTER = false; } +}); - if (options !== undefined) { - identifierName = options.label; - targetClassName = options.target; - shouldForwardProp = tag.__emotion_forwardProp && options.shouldForwardProp ? function (propName) { - return tag.__emotion_forwardProp(propName) && // $FlowFixMe - options.shouldForwardProp(propName); - } : options.shouldForwardProp; - } +$({ target: 'Object', stat: true, forced: !NATIVE_SYMBOL, sham: !DESCRIPTORS }, { + // `Object.create` method + // https://tc39.es/ecma262/#sec-object.create + create: $create, + // `Object.defineProperty` method + // https://tc39.es/ecma262/#sec-object.defineproperty + defineProperty: $defineProperty, + // `Object.defineProperties` method + // https://tc39.es/ecma262/#sec-object.defineproperties + defineProperties: $defineProperties, + // `Object.getOwnPropertyDescriptor` method + // https://tc39.es/ecma262/#sec-object.getownpropertydescriptors + getOwnPropertyDescriptor: $getOwnPropertyDescriptor +}); - var isReal = tag.__emotion_real === tag; - var baseTag = isReal && tag.__emotion_base || tag; +$({ target: 'Object', stat: true, forced: !NATIVE_SYMBOL }, { + // `Object.getOwnPropertyNames` method + // https://tc39.es/ecma262/#sec-object.getownpropertynames + getOwnPropertyNames: $getOwnPropertyNames, + // `Object.getOwnPropertySymbols` method + // https://tc39.es/ecma262/#sec-object.getownpropertysymbols + getOwnPropertySymbols: $getOwnPropertySymbols +}); - if (typeof shouldForwardProp !== 'function' && isReal) { - shouldForwardProp = tag.__emotion_forwardProp; +// Chrome 38 and 39 `Object.getOwnPropertySymbols` fails on primitives +// https://bugs.chromium.org/p/v8/issues/detail?id=3443 +$({ target: 'Object', stat: true, forced: fails(function () { getOwnPropertySymbolsModule.f(1); }) }, { + getOwnPropertySymbols: function getOwnPropertySymbols(it) { + return getOwnPropertySymbolsModule.f(toObject(it)); } +}); - var defaultShouldForwardProp = shouldForwardProp || getDefaultShouldForwardProp(baseTag); - var shouldUseAs = !defaultShouldForwardProp('as'); - return function () { - var args = arguments; - var styles = isReal && tag.__emotion_styles !== undefined ? tag.__emotion_styles.slice(0) : []; +// `JSON.stringify` method behavior with symbols +// https://tc39.es/ecma262/#sec-json.stringify +if ($stringify) { + var FORCED_JSON_STRINGIFY = !NATIVE_SYMBOL || fails(function () { + var symbol = $Symbol(); + // MS Edge converts symbol values to JSON as {} + return $stringify([symbol]) != '[null]' + // WebKit converts symbol values to JSON as null + || $stringify({ a: symbol }) != '{}' + // V8 throws on boxed symbols + || $stringify(Object(symbol)) != '{}'; + }); - if (identifierName !== undefined) { - styles.push("label:" + identifierName + ";"); + $({ target: 'JSON', stat: true, forced: FORCED_JSON_STRINGIFY }, { + // eslint-disable-next-line no-unused-vars -- required for `.length` + stringify: function stringify(it, replacer, space) { + var args = [it]; + var index = 1; + var $replacer; + while (arguments.length > index) args.push(arguments[index++]); + $replacer = replacer; + if (!isObject(replacer) && it === undefined || isSymbol(it)) return; // IE8 returns string on undefined + if (!isArray(replacer)) replacer = function (key, value) { + if (typeof $replacer == 'function') value = $replacer.call(this, key, value); + if (!isSymbol(value)) return value; + }; + args[1] = replacer; + return $stringify.apply(null, args); } + }); +} - if (args[0] == null || args[0].raw === undefined) { - styles.push.apply(styles, args); - } else { - if (false) {} +// `Symbol.prototype[@@toPrimitive]` method +// https://tc39.es/ecma262/#sec-symbol.prototype-@@toprimitive +if (!$Symbol[PROTOTYPE][TO_PRIMITIVE]) { + createNonEnumerableProperty($Symbol[PROTOTYPE], TO_PRIMITIVE, $Symbol[PROTOTYPE].valueOf); +} +// `Symbol.prototype[@@toStringTag]` property +// https://tc39.es/ecma262/#sec-symbol.prototype-@@tostringtag +setToStringTag($Symbol, SYMBOL); - styles.push(args[0][0]); - var len = args.length; - var i = 1; +hiddenKeys[HIDDEN] = true; - for (; i < len; i++) { - if (false) {} - styles.push(args[i], args[0][i]); - } - } // $FlowFixMe: we need to cast StatelessFunctionalComponent to our PrivateStyledComponent class +/***/ }), +/* 54 */ +/***/ (function(module, exports, __webpack_require__) { +var internalObjectKeys = __webpack_require__(73); +var enumBugKeys = __webpack_require__(48); - var Styled = Object(core_browser_esm["c" /* withEmotionCache */])(function (props, context, ref) { - return Object(external_React_["createElement"])(core_browser_esm["a" /* ThemeContext */].Consumer, null, function (theme) { - var finalTag = shouldUseAs && props.as || baseTag; - var className = ''; - var classInterpolations = []; - var mergedProps = props; +// `Object.keys` method +// https://tc39.es/ecma262/#sec-object.keys +module.exports = Object.keys || function keys(O) { + return internalObjectKeys(O, enumBugKeys); +}; - if (props.theme == null) { - mergedProps = {}; - for (var key in props) { - mergedProps[key] = props[key]; - } +/***/ }), +/* 55 */ +/***/ (function(module, exports) { - mergedProps.theme = theme; - } +var id = 0; +var postfix = Math.random(); - if (typeof props.className === 'string') { - className = Object(utils_browser_esm["a" /* getRegisteredStyles */])(context.registered, classInterpolations, props.className); - } else if (props.className != null) { - className = props.className + " "; - } +module.exports = function (key) { + return 'Symbol(' + String(key === undefined ? '' : key) + ')_' + (++id + postfix).toString(36); +}; - var serialized = Object(serialize_browser_esm["a" /* serializeStyles */])(styles.concat(classInterpolations), context.registered, mergedProps); - var rules = Object(utils_browser_esm["b" /* insertStyles */])(context, serialized, typeof finalTag === 'string'); - className += context.key + "-" + serialized.name; - if (targetClassName !== undefined) { - className += " " + targetClassName; - } +/***/ }), +/* 56 */ +/***/ (function(module, exports, __webpack_require__) { - var finalShouldForwardProp = shouldUseAs && shouldForwardProp === undefined ? getDefaultShouldForwardProp(finalTag) : defaultShouldForwardProp; - var newProps = {}; +var internalObjectKeys = __webpack_require__(73); +var enumBugKeys = __webpack_require__(48); - for (var _key in props) { - if (shouldUseAs && _key === 'as') continue; +var hiddenKeys = enumBugKeys.concat('length', 'prototype'); - if ( // $FlowFixMe - finalShouldForwardProp(_key)) { - newProps[_key] = props[_key]; - } - } +// `Object.getOwnPropertyNames` method +// https://tc39.es/ecma262/#sec-object.getownpropertynames +exports.f = Object.getOwnPropertyNames || function getOwnPropertyNames(O) { + return internalObjectKeys(O, hiddenKeys); +}; - newProps.className = className; - newProps.ref = ref || props.innerRef; - if (false) {} +/***/ }), +/* 57 */ +/***/ (function(module, exports) { - var ele = Object(external_React_["createElement"])(finalTag, newProps); +module.exports = false; - return ele; - }); - }); - Styled.displayName = identifierName !== undefined ? identifierName : "Styled(" + (typeof baseTag === 'string' ? baseTag : baseTag.displayName || baseTag.name || 'Component') + ")"; - Styled.defaultProps = tag.defaultProps; - Styled.__emotion_real = Styled; - Styled.__emotion_base = baseTag; - Styled.__emotion_styles = styles; - Styled.__emotion_forwardProp = shouldForwardProp; - Object.defineProperty(Styled, 'toString', { - value: function value() { - if (targetClassName === undefined && "production" !== 'production') { - return 'NO_COMPONENT_SELECTOR'; - } // $FlowFixMe: coerce undefined to string - - - return "." + targetClassName; - } - }); - Styled.withComponent = function (nextTag, nextOptions) { - return createStyled(nextTag, nextOptions !== undefined ? _objectSpread({}, options || {}, {}, nextOptions) : options).apply(void 0, styles); - }; +/***/ }), +/* 58 */ +/***/ (function(module, exports, __webpack_require__) { - return Styled; - }; -}; +var IS_PURE = __webpack_require__(57); +var store = __webpack_require__(47); -/* harmony default export */ var styled_base_browser_esm = __webpack_exports__["a"] = (styled_base_browser_esm_createStyled); +(module.exports = function (key, value) { + return store[key] || (store[key] = value !== undefined ? value : {}); +})('versions', []).push({ + version: '3.9.1', + mode: IS_PURE ? 'pure' : 'global', + copyright: '© 2021 Denis Pushkarev (zloirock.ru)' +}); /***/ }), -/* 33 */ +/* 59 */ /***/ (function(module, exports) { -(function() { module.exports = this["wp"]["url"]; }()); +(function() { module.exports = window["wc"]["data"]; }()); /***/ }), -/* 34 */ -/***/ (function(module, exports) { +/* 60 */ +/***/ (function(module, exports, __webpack_require__) { + +var $ = __webpack_require__(12); +var fails = __webpack_require__(6); +var toIndexedObject = __webpack_require__(21); +var nativeGetOwnPropertyDescriptor = __webpack_require__(33).f; +var DESCRIPTORS = __webpack_require__(13); + +var FAILS_ON_PRIMITIVES = fails(function () { nativeGetOwnPropertyDescriptor(1); }); +var FORCED = !DESCRIPTORS || FAILS_ON_PRIMITIVES; + +// `Object.getOwnPropertyDescriptor` method +// https://tc39.es/ecma262/#sec-object.getownpropertydescriptor +$({ target: 'Object', stat: true, forced: FORCED, sham: !DESCRIPTORS }, { + getOwnPropertyDescriptor: function getOwnPropertyDescriptor(it, key) { + return nativeGetOwnPropertyDescriptor(toIndexedObject(it), key); + } +}); -(function() { module.exports = this["wc"]["data"]; }()); /***/ }), -/* 35 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 61 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return ADMIN_URL; }); -/* unused harmony export COUNTRIES */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return CURRENCY; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return LOCALE; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return ORDER_STATUSES; }); -/* unused harmony export SITE_TITLE */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return WC_ASSET_URL; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "g", function() { return getSetting; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "h", function() { return setSetting; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "f", function() { return getAdminLink; }); -/* harmony import */ var _babel_runtime_helpers_typeof__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(52); -/* harmony import */ var _babel_runtime_helpers_typeof__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_babel_runtime_helpers_typeof__WEBPACK_IMPORTED_MODULE_0__); -/* harmony import */ var _wordpress_i18n__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(3); -/* harmony import */ var _wordpress_i18n__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_1__); +var $ = __webpack_require__(12); +var DESCRIPTORS = __webpack_require__(13); +var ownKeys = __webpack_require__(86); +var toIndexedObject = __webpack_require__(21); +var getOwnPropertyDescriptorModule = __webpack_require__(33); +var createProperty = __webpack_require__(102); + +// `Object.getOwnPropertyDescriptors` method +// https://tc39.es/ecma262/#sec-object.getownpropertydescriptors +$({ target: 'Object', stat: true, sham: !DESCRIPTORS }, { + getOwnPropertyDescriptors: function getOwnPropertyDescriptors(object) { + var O = toIndexedObject(object); + var getOwnPropertyDescriptor = getOwnPropertyDescriptorModule.f; + var keys = ownKeys(O); + var result = {}; + var index = 0; + var key, descriptor; + while (keys.length > index) { + descriptor = getOwnPropertyDescriptor(O, key = keys[index++]); + if (descriptor !== undefined) createProperty(result, key, descriptor); + } + return result; + } +}); -/** - * External dependencies - */ - // Remove mutable data from settings object to prevent access. Data stores should be used instead. +/***/ }), +/* 62 */ +/***/ (function(module, exports, __webpack_require__) { -var mutableSources = ['wcAdminSettings', 'preloadSettings']; -var settings = (typeof wcSettings === "undefined" ? "undefined" : _babel_runtime_helpers_typeof__WEBPACK_IMPORTED_MODULE_0___default()(wcSettings)) === 'object' ? wcSettings : {}; -var SOURCE = Object.keys(settings).reduce(function (source, key) { - if (!mutableSources.includes(key)) { - source[key] = settings[key]; +var IS_NODE = __webpack_require__(77); +var V8_VERSION = __webpack_require__(63); +var fails = __webpack_require__(6); + +module.exports = !!Object.getOwnPropertySymbols && !fails(function () { + /* global Symbol -- required for testing */ + return !Symbol.sham && + // Chrome 38 Symbol has incorrect toString conversion + // Chrome 38-40 symbols are not inherited from DOM collections prototypes to instances + (IS_NODE ? V8_VERSION === 38 : V8_VERSION > 37 && V8_VERSION < 41); +}); + + +/***/ }), +/* 63 */ +/***/ (function(module, exports, __webpack_require__) { + +var global = __webpack_require__(3); +var userAgent = __webpack_require__(87); + +var process = global.process; +var versions = process && process.versions; +var v8 = versions && versions.v8; +var match, version; + +if (v8) { + match = v8.split('.'); + version = match[0] + match[1]; +} else if (userAgent) { + match = userAgent.match(/Edge\/(\d+)/); + if (!match || match[1] >= 74) { + match = userAgent.match(/Chrome\/(\d+)/); + if (match) version = match[1]; } +} - return source; -}, {}); -var ADMIN_URL = SOURCE.adminUrl; -var COUNTRIES = SOURCE.countries; -var CURRENCY = SOURCE.currency; -var LOCALE = SOURCE.locale; -var ORDER_STATUSES = SOURCE.orderStatuses; -var SITE_TITLE = SOURCE.siteTitle; -var WC_ASSET_URL = SOURCE.wcAssetUrl; -/** - * Retrieves a setting value from the setting state. - * - * @param {string} name The identifier for the setting. - * @param {*} [fallback=false] The value to use as a fallback - * if the setting is not in the - * state. - * @param {Function} [filter=( val ) => val] A callback for filtering the - * value before it's returned. - * Receives both the found value - * (if it exists for the key) and - * the provided fallback arg. - * - * @return {*} The value present in the settings state for the given - * name. - */ +module.exports = version && +version; -function getSetting(name) { - var fallback = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; - var filter = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : function (val) { - return val; - }; - if (mutableSources.includes(name)) { - throw new Error(Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_1__["__"])('Mutable settings should be accessed via data store.')); +/***/ }), +/* 64 */ +/***/ (function(module, exports, __webpack_require__) { + +var $ = __webpack_require__(12); +var getBuiltIn = __webpack_require__(31); +var aFunction = __webpack_require__(70); +var anObject = __webpack_require__(9); +var isObject = __webpack_require__(10); +var create = __webpack_require__(69); +var bind = __webpack_require__(212); +var fails = __webpack_require__(6); + +var nativeConstruct = getBuiltIn('Reflect', 'construct'); + +// `Reflect.construct` method +// https://tc39.es/ecma262/#sec-reflect.construct +// MS Edge supports only 2 arguments and argumentsList argument is optional +// FF Nightly sets third argument as `new.target`, but does not create `this` from it +var NEW_TARGET_BUG = fails(function () { + function F() { /* empty */ } + return !(nativeConstruct(function () { /* empty */ }, [], F) instanceof F); +}); +var ARGS_BUG = !fails(function () { + nativeConstruct(function () { /* empty */ }); +}); +var FORCED = NEW_TARGET_BUG || ARGS_BUG; + +$({ target: 'Reflect', stat: true, forced: FORCED, sham: FORCED }, { + construct: function construct(Target, args /* , newTarget */) { + aFunction(Target); + anObject(args); + var newTarget = arguments.length < 3 ? Target : aFunction(arguments[2]); + if (ARGS_BUG && !NEW_TARGET_BUG) return nativeConstruct(Target, args, newTarget); + if (Target == newTarget) { + // w/o altered newTarget, optimization for 0-4 arguments + switch (args.length) { + case 0: return new Target(); + case 1: return new Target(args[0]); + case 2: return new Target(args[0], args[1]); + case 3: return new Target(args[0], args[1], args[2]); + case 4: return new Target(args[0], args[1], args[2], args[3]); + } + // w/o altered newTarget, lot of arguments case + var $args = [null]; + $args.push.apply($args, args); + return new (bind.apply(Target, $args))(); + } + // with altered newTarget, not support built-in constructors + var proto = newTarget.prototype; + var instance = create(isObject(proto) ? proto : Object.prototype); + var result = Function.apply.call(Target, instance, args); + return isObject(result) ? result : instance; } +}); - var value = SOURCE.hasOwnProperty(name) ? SOURCE[name] : fallback; - return filter(value, fallback); -} -/** - * Sets a value to a property on the settings state. - * - * NOTE: This feature is to be removed in favour of data stores when a full migration - * is complete. - * - * @deprecated - * - * @param {string} name The setting property key for the - * setting being mutated. - * @param {*} value The value to set. - * @param {Function} [filter=( val ) => val] Allows for providing a callback - * to sanitize the setting (eg. - * ensure it's a number) - */ -function setSetting(name, value) { - var filter = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : function (val) { - return val; - }; +/***/ }), +/* 65 */ +/***/ (function(module, exports) { - if (mutableSources.includes(name)) { - throw new Error(Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_1__["__"])('Mutable settings should be mutated via data store.')); - } +(function() { module.exports = window["wp"]["compose"]; }()); - SOURCE[name] = filter(value); -} -/** - * Returns a string with the site's wp-admin URL appended. JS version of `admin_url`. - * - * @param {string} path Relative path. - * @return {string} Full admin URL. - */ +/***/ }), +/* 66 */ +/***/ (function(module, exports, __webpack_require__) { -function getAdminLink(path) { - return (ADMIN_URL || '') + path; -} +"use strict"; -/***/ }), -/* 36 */ -/***/ (function(module, exports) { +var $ = __webpack_require__(12); +var fails = __webpack_require__(6); +var isArray = __webpack_require__(84); +var isObject = __webpack_require__(10); +var toObject = __webpack_require__(37); +var toLength = __webpack_require__(34); +var createProperty = __webpack_require__(102); +var arraySpeciesCreate = __webpack_require__(109); +var arrayMethodHasSpeciesSupport = __webpack_require__(89); +var wellKnownSymbol = __webpack_require__(8); +var V8_VERSION = __webpack_require__(63); + +var IS_CONCAT_SPREADABLE = wellKnownSymbol('isConcatSpreadable'); +var MAX_SAFE_INTEGER = 0x1FFFFFFFFFFFFF; +var MAXIMUM_ALLOWED_INDEX_EXCEEDED = 'Maximum allowed index exceeded'; + +// We can't use this feature detection in V8 since it causes +// deoptimization and serious performance degradation +// https://github.com/zloirock/core-js/issues/679 +var IS_CONCAT_SPREADABLE_SUPPORT = V8_VERSION >= 51 || !fails(function () { + var array = []; + array[IS_CONCAT_SPREADABLE] = false; + return array.concat()[0] !== array; +}); -function _extends() { - module.exports = _extends = Object.assign || function (target) { - for (var i = 1; i < arguments.length; i++) { - var source = arguments[i]; +var SPECIES_SUPPORT = arrayMethodHasSpeciesSupport('concat'); - for (var key in source) { - if (Object.prototype.hasOwnProperty.call(source, key)) { - target[key] = source[key]; - } +var isConcatSpreadable = function (O) { + if (!isObject(O)) return false; + var spreadable = O[IS_CONCAT_SPREADABLE]; + return spreadable !== undefined ? !!spreadable : isArray(O); +}; + +var FORCED = !IS_CONCAT_SPREADABLE_SUPPORT || !SPECIES_SUPPORT; + +// `Array.prototype.concat` method +// https://tc39.es/ecma262/#sec-array.prototype.concat +// with adding support of @@isConcatSpreadable and @@species +$({ target: 'Array', proto: true, forced: FORCED }, { + // eslint-disable-next-line no-unused-vars -- required for `.length` + concat: function concat(arg) { + var O = toObject(this); + var A = arraySpeciesCreate(O, 0); + var n = 0; + var i, k, length, len, E; + for (i = -1, length = arguments.length; i < length; i++) { + E = i === -1 ? O : arguments[i]; + if (isConcatSpreadable(E)) { + len = toLength(E.length); + if (n + len > MAX_SAFE_INTEGER) throw TypeError(MAXIMUM_ALLOWED_INDEX_EXCEEDED); + for (k = 0; k < len; k++, n++) if (k in E) createProperty(A, n, E[k]); + } else { + if (n >= MAX_SAFE_INTEGER) throw TypeError(MAXIMUM_ALLOWED_INDEX_EXCEEDED); + createProperty(A, n++, E); } } + A.length = n; + return A; + } +}); - return target; - }; - return _extends.apply(this, arguments); -} +/***/ }), +/* 67 */ +/***/ (function(module, exports, __webpack_require__) { + +var global = __webpack_require__(3); +var isObject = __webpack_require__(10); + +var document = global.document; +// typeof document.createElement is 'object' in old IE +var EXISTS = isObject(document) && isObject(document.createElement); + +module.exports = function (it) { + return EXISTS ? document.createElement(it) : {}; +}; -module.exports = _extends; /***/ }), -/* 37 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 68 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; +var store = __webpack_require__(47); -// EXPORTS -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ serialize_browser_esm_serializeStyles; }); - -// CONCATENATED MODULE: ./node_modules/@emotion/hash/dist/hash.browser.esm.js -/* eslint-disable */ -// Inspired by https://github.com/garycourt/murmurhash-js -// Ported from https://github.com/aappleby/smhasher/blob/61a0530f28277f2e850bfc39600ce61d02b518de/src/MurmurHash2.cpp#L37-L86 -function murmur2(str) { - // 'm' and 'r' are mixing constants generated offline. - // They're not really 'magic', they just happen to work well. - // const m = 0x5bd1e995; - // const r = 24; - // Initialize the hash - var h = 0; // Mix 4 bytes at a time into the hash - - var k, - i = 0, - len = str.length; - - for (; len >= 4; ++i, len -= 4) { - k = str.charCodeAt(i) & 0xff | (str.charCodeAt(++i) & 0xff) << 8 | (str.charCodeAt(++i) & 0xff) << 16 | (str.charCodeAt(++i) & 0xff) << 24; - k = - /* Math.imul(k, m): */ - (k & 0xffff) * 0x5bd1e995 + ((k >>> 16) * 0xe995 << 16); - k ^= - /* k >>> r: */ - k >>> 24; - h = - /* Math.imul(k, m): */ - (k & 0xffff) * 0x5bd1e995 + ((k >>> 16) * 0xe995 << 16) ^ - /* Math.imul(h, m): */ - (h & 0xffff) * 0x5bd1e995 + ((h >>> 16) * 0xe995 << 16); - } // Handle the last few bytes of the input array - - - switch (len) { - case 3: - h ^= (str.charCodeAt(i + 2) & 0xff) << 16; - - case 2: - h ^= (str.charCodeAt(i + 1) & 0xff) << 8; - - case 1: - h ^= str.charCodeAt(i) & 0xff; - h = - /* Math.imul(h, m): */ - (h & 0xffff) * 0x5bd1e995 + ((h >>> 16) * 0xe995 << 16); - } // Do a few final mixes of the hash to ensure the last few - // bytes are well-incorporated. - - - h ^= h >>> 13; - h = - /* Math.imul(h, m): */ - (h & 0xffff) * 0x5bd1e995 + ((h >>> 16) * 0xe995 << 16); - return ((h ^ h >>> 15) >>> 0).toString(36); +var functionToString = Function.toString; + +// this helper broken in `3.4.1-3.4.4`, so we can't use `shared` helper +if (typeof store.inspectSource != 'function') { + store.inspectSource = function (it) { + return functionToString.call(it); + }; } -/* harmony default export */ var hash_browser_esm = (murmur2); - -// CONCATENATED MODULE: ./node_modules/@emotion/unitless/dist/unitless.browser.esm.js -var unitlessKeys = { - animationIterationCount: 1, - borderImageOutset: 1, - borderImageSlice: 1, - borderImageWidth: 1, - boxFlex: 1, - boxFlexGroup: 1, - boxOrdinalGroup: 1, - columnCount: 1, - columns: 1, - flex: 1, - flexGrow: 1, - flexPositive: 1, - flexShrink: 1, - flexNegative: 1, - flexOrder: 1, - gridRow: 1, - gridRowEnd: 1, - gridRowSpan: 1, - gridRowStart: 1, - gridColumn: 1, - gridColumnEnd: 1, - gridColumnSpan: 1, - gridColumnStart: 1, - msGridRow: 1, - msGridRowSpan: 1, - msGridColumn: 1, - msGridColumnSpan: 1, - fontWeight: 1, - lineHeight: 1, - opacity: 1, - order: 1, - orphans: 1, - tabSize: 1, - widows: 1, - zIndex: 1, - zoom: 1, - WebkitLineClamp: 1, - // SVG-related properties - fillOpacity: 1, - floodOpacity: 1, - stopOpacity: 1, - strokeDasharray: 1, - strokeDashoffset: 1, - strokeMiterlimit: 1, - strokeOpacity: 1, - strokeWidth: 1 -}; +module.exports = store.inspectSource; -/* harmony default export */ var unitless_browser_esm = (unitlessKeys); -// EXTERNAL MODULE: ./node_modules/@emotion/memoize/dist/memoize.browser.esm.js -var memoize_browser_esm = __webpack_require__(73); +/***/ }), +/* 69 */ +/***/ (function(module, exports, __webpack_require__) { -// CONCATENATED MODULE: ./node_modules/@emotion/serialize/dist/serialize.browser.esm.js +var anObject = __webpack_require__(9); +var defineProperties = __webpack_require__(104); +var enumBugKeys = __webpack_require__(48); +var hiddenKeys = __webpack_require__(36); +var html = __webpack_require__(98); +var documentCreateElement = __webpack_require__(67); +var sharedKey = __webpack_require__(51); +var GT = '>'; +var LT = '<'; +var PROTOTYPE = 'prototype'; +var SCRIPT = 'script'; +var IE_PROTO = sharedKey('IE_PROTO'); +var EmptyConstructor = function () { /* empty */ }; +var scriptTag = function (content) { + return LT + SCRIPT + GT + content + LT + '/' + SCRIPT + GT; +}; -var ILLEGAL_ESCAPE_SEQUENCE_ERROR = "You have illegal escape sequence in your template literal, most likely inside content's property value.\nBecause you write your CSS inside a JavaScript string you actually have to do double escaping, so for example \"content: '\\00d7';\" should become \"content: '\\\\00d7';\".\nYou can read more about this here:\nhttps://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Template_literals#ES2018_revision_of_illegal_escape_sequences"; -var UNDEFINED_AS_OBJECT_KEY_ERROR = "You have passed in falsy value as style object's key (can happen when in example you pass unexported component as computed key)."; -var hyphenateRegex = /[A-Z]|^ms/g; -var animationRegex = /_EMO_([^_]+?)_([^]*?)_EMO_/g; +// Create object with fake `null` prototype: use ActiveX Object with cleared prototype +var NullProtoObjectViaActiveX = function (activeXDocument) { + activeXDocument.write(scriptTag('')); + activeXDocument.close(); + var temp = activeXDocument.parentWindow.Object; + activeXDocument = null; // avoid memory leak + return temp; +}; -var isCustomProperty = function isCustomProperty(property) { - return property.charCodeAt(1) === 45; +// Create object with fake `null` prototype: use iframe Object with cleared prototype +var NullProtoObjectViaIFrame = function () { + // Thrash, waste and sodomy: IE GC bug + var iframe = documentCreateElement('iframe'); + var JS = 'java' + SCRIPT + ':'; + var iframeDocument; + iframe.style.display = 'none'; + html.appendChild(iframe); + // https://github.com/zloirock/core-js/issues/475 + iframe.src = String(JS); + iframeDocument = iframe.contentWindow.document; + iframeDocument.open(); + iframeDocument.write(scriptTag('document.F=Object')); + iframeDocument.close(); + return iframeDocument.F; }; -var isProcessableValue = function isProcessableValue(value) { - return value != null && typeof value !== 'boolean'; +// Check for document.domain and active x support +// No need to use active x approach when document.domain is not set +// see https://github.com/es-shims/es5-shim/issues/150 +// variation of https://github.com/kitcambridge/es5-shim/commit/4f738ac066346 +// avoid IE GC bug +var activeXDocument; +var NullProtoObject = function () { + try { + /* global ActiveXObject -- old IE */ + activeXDocument = document.domain && new ActiveXObject('htmlfile'); + } catch (error) { /* ignore */ } + NullProtoObject = activeXDocument ? NullProtoObjectViaActiveX(activeXDocument) : NullProtoObjectViaIFrame(); + var length = enumBugKeys.length; + while (length--) delete NullProtoObject[PROTOTYPE][enumBugKeys[length]]; + return NullProtoObject(); }; -var processStyleName = Object(memoize_browser_esm["a" /* default */])(function (styleName) { - return isCustomProperty(styleName) ? styleName : styleName.replace(hyphenateRegex, '-$&').toLowerCase(); -}); +hiddenKeys[IE_PROTO] = true; + +// `Object.create` method +// https://tc39.es/ecma262/#sec-object.create +module.exports = Object.create || function create(O, Properties) { + var result; + if (O !== null) { + EmptyConstructor[PROTOTYPE] = anObject(O); + result = new EmptyConstructor(); + EmptyConstructor[PROTOTYPE] = null; + // add "__proto__" for Object.getPrototypeOf polyfill + result[IE_PROTO] = O; + } else result = NullProtoObject(); + return Properties === undefined ? result : defineProperties(result, Properties); +}; -var serialize_browser_esm_processStyleValue = function processStyleValue(key, value) { - switch (key) { - case 'animation': - case 'animationName': - { - if (typeof value === 'string') { - return value.replace(animationRegex, function (match, p1, p2) { - cursor = { - name: p1, - styles: p2, - next: cursor - }; - return p1; - }); - } - } - } - if (unitless_browser_esm[key] !== 1 && !isCustomProperty(key) && typeof value === 'number' && value !== 0) { - return value + 'px'; - } +/***/ }), +/* 70 */ +/***/ (function(module, exports) { - return value; +module.exports = function (it) { + if (typeof it != 'function') { + throw TypeError(String(it) + ' is not a function'); + } return it; }; -if (false) { var hyphenatedCache, hyphenPattern, msPattern, oldProcessStyleValue, contentValues, contentValuePattern; } -var shouldWarnAboutInterpolatingClassNameFromCss = true; - -function handleInterpolation(mergedProps, registered, interpolation, couldBeSelectorInterpolation) { - if (interpolation == null) { - return ''; - } - - if (interpolation.__emotion_styles !== undefined) { - if (false) {} +/***/ }), +/* 71 */ +/***/ (function(module, exports, __webpack_require__) { - return interpolation; - } +var fails = __webpack_require__(6); +var classof = __webpack_require__(30); - switch (typeof interpolation) { - case 'boolean': - { - return ''; - } +var split = ''.split; - case 'object': - { - if (interpolation.anim === 1) { - cursor = { - name: interpolation.name, - styles: interpolation.styles, - next: cursor - }; - return interpolation.name; - } +// fallback for non-array-like ES3 and non-enumerable old V8 strings +module.exports = fails(function () { + // throws an error in rhino, see https://github.com/mozilla/rhino/issues/346 + // eslint-disable-next-line no-prototype-builtins -- safe + return !Object('z').propertyIsEnumerable(0); +}) ? function (it) { + return classof(it) == 'String' ? split.call(it, '') : Object(it); +} : Object; - if (interpolation.styles !== undefined) { - var next = interpolation.next; - - if (next !== undefined) { - // not the most efficient thing ever but this is a pretty rare case - // and there will be very few iterations of this generally - while (next !== undefined) { - cursor = { - name: next.name, - styles: next.styles, - next: cursor - }; - next = next.next; - } - } - var styles = interpolation.styles + ";"; +/***/ }), +/* 72 */ +/***/ (function(module, exports, __webpack_require__) { - if (false) {} +var DESCRIPTORS = __webpack_require__(13); +var fails = __webpack_require__(6); +var createElement = __webpack_require__(67); - return styles; - } +// Thank's IE8 for his funny defineProperty +module.exports = !DESCRIPTORS && !fails(function () { + return Object.defineProperty(createElement('div'), 'a', { + get: function () { return 7; } + }).a != 7; +}); - return createStringFromObject(mergedProps, registered, interpolation); - } - case 'function': - { - if (mergedProps !== undefined) { - var previousCursor = cursor; - var result = interpolation(mergedProps); - cursor = previousCursor; - return handleInterpolation(mergedProps, registered, result, couldBeSelectorInterpolation); - } else if (false) {} +/***/ }), +/* 73 */ +/***/ (function(module, exports, __webpack_require__) { - break; - } +var has = __webpack_require__(11); +var toIndexedObject = __webpack_require__(21); +var indexOf = __webpack_require__(83).indexOf; +var hiddenKeys = __webpack_require__(36); - case 'string': - if (false) { var replaced, matched; } +module.exports = function (object, names) { + var O = toIndexedObject(object); + var i = 0; + var result = []; + var key; + for (key in O) !has(hiddenKeys, key) && has(O, key) && result.push(key); + // Don't enum bug & hidden keys + while (names.length > i) if (has(O, key = names[i++])) { + ~indexOf(result, key) || result.push(key); + } + return result; +}; - break; - } // finalize string values (regular strings and functions interpolated into css calls) +/***/ }), +/* 74 */ +/***/ (function(module, exports, __webpack_require__) { - if (registered == null) { - return interpolation; - } +var fails = __webpack_require__(6); - var cached = registered[interpolation]; +var replacement = /#|\.prototype\./; - if (false) {} +var isForced = function (feature, detection) { + var value = data[normalize(feature)]; + return value == POLYFILL ? true + : value == NATIVE ? false + : typeof detection == 'function' ? fails(detection) + : !!detection; +}; - return cached !== undefined && !couldBeSelectorInterpolation ? cached : interpolation; -} +var normalize = isForced.normalize = function (string) { + return String(string).replace(replacement, '.').toLowerCase(); +}; -function createStringFromObject(mergedProps, registered, obj) { - var string = ''; +var data = isForced.data = {}; +var NATIVE = isForced.NATIVE = 'N'; +var POLYFILL = isForced.POLYFILL = 'P'; - if (Array.isArray(obj)) { - for (var i = 0; i < obj.length; i++) { - string += handleInterpolation(mergedProps, registered, obj[i], false); - } - } else { - for (var _key in obj) { - var value = obj[_key]; - - if (typeof value !== 'object') { - if (registered != null && registered[value] !== undefined) { - string += _key + "{" + registered[value] + "}"; - } else if (isProcessableValue(value)) { - string += processStyleName(_key) + ":" + serialize_browser_esm_processStyleValue(_key, value) + ";"; - } - } else { - if (_key === 'NO_COMPONENT_SELECTOR' && "production" !== 'production') { - throw new Error('Component selectors can only be used in conjunction with babel-plugin-emotion.'); - } +module.exports = isForced; - if (Array.isArray(value) && typeof value[0] === 'string' && (registered == null || registered[value[0]] === undefined)) { - for (var _i = 0; _i < value.length; _i++) { - if (isProcessableValue(value[_i])) { - string += processStyleName(_key) + ":" + serialize_browser_esm_processStyleValue(_key, value[_i]) + ";"; - } - } - } else { - var interpolated = handleInterpolation(mergedProps, registered, value, false); - - switch (_key) { - case 'animation': - case 'animationName': - { - string += processStyleName(_key) + ":" + interpolated + ";"; - break; - } - default: - { - if (false) {} +/***/ }), +/* 75 */ +/***/ (function(module, exports, __webpack_require__) { - string += _key + "{" + interpolated + "}"; - } - } +var bind = __webpack_require__(94); +var IndexedObject = __webpack_require__(71); +var toObject = __webpack_require__(37); +var toLength = __webpack_require__(34); +var arraySpeciesCreate = __webpack_require__(109); + +var push = [].push; + +// `Array.prototype.{ forEach, map, filter, some, every, find, findIndex, filterOut }` methods implementation +var createMethod = function (TYPE) { + var IS_MAP = TYPE == 1; + var IS_FILTER = TYPE == 2; + var IS_SOME = TYPE == 3; + var IS_EVERY = TYPE == 4; + var IS_FIND_INDEX = TYPE == 6; + var IS_FILTER_OUT = TYPE == 7; + var NO_HOLES = TYPE == 5 || IS_FIND_INDEX; + return function ($this, callbackfn, that, specificCreate) { + var O = toObject($this); + var self = IndexedObject(O); + var boundFunction = bind(callbackfn, that, 3); + var length = toLength(self.length); + var index = 0; + var create = specificCreate || arraySpeciesCreate; + var target = IS_MAP ? create($this, length) : IS_FILTER || IS_FILTER_OUT ? create($this, 0) : undefined; + var value, result; + for (;length > index; index++) if (NO_HOLES || index in self) { + value = self[index]; + result = boundFunction(value, index, O); + if (TYPE) { + if (IS_MAP) target[index] = result; // map + else if (result) switch (TYPE) { + case 3: return true; // some + case 5: return value; // find + case 6: return index; // findIndex + case 2: push.call(target, value); // filter + } else switch (TYPE) { + case 4: return false; // every + case 7: push.call(target, value); // filterOut } } } - } + return IS_FIND_INDEX ? -1 : IS_SOME || IS_EVERY ? IS_EVERY : target; + }; +}; - return string; -} +module.exports = { + // `Array.prototype.forEach` method + // https://tc39.es/ecma262/#sec-array.prototype.foreach + forEach: createMethod(0), + // `Array.prototype.map` method + // https://tc39.es/ecma262/#sec-array.prototype.map + map: createMethod(1), + // `Array.prototype.filter` method + // https://tc39.es/ecma262/#sec-array.prototype.filter + filter: createMethod(2), + // `Array.prototype.some` method + // https://tc39.es/ecma262/#sec-array.prototype.some + some: createMethod(3), + // `Array.prototype.every` method + // https://tc39.es/ecma262/#sec-array.prototype.every + every: createMethod(4), + // `Array.prototype.find` method + // https://tc39.es/ecma262/#sec-array.prototype.find + find: createMethod(5), + // `Array.prototype.findIndex` method + // https://tc39.es/ecma262/#sec-array.prototype.findIndex + findIndex: createMethod(6), + // `Array.prototype.filterOut` method + // https://github.com/tc39/proposal-array-filtering + filterOut: createMethod(7) +}; -var labelPattern = /label:\s*([^\s;\n{]+)\s*;/g; -var sourceMapPattern; -if (false) {} // this is the cursor for keyframes -// keyframes are stored on the SerializedStyles object as a linked list +/***/ }), +/* 76 */ +/***/ (function(module, exports, __webpack_require__) { +"use strict"; -var cursor; -var serialize_browser_esm_serializeStyles = function serializeStyles(args, registered, mergedProps) { - if (args.length === 1 && typeof args[0] === 'object' && args[0] !== null && args[0].styles !== undefined) { - return args[0]; - } +var nativePropertyIsEnumerable = {}.propertyIsEnumerable; +var getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor; - var stringMode = true; - var styles = ''; - cursor = undefined; - var strings = args[0]; +// Nashorn ~ JDK8 bug +var NASHORN_BUG = getOwnPropertyDescriptor && !nativePropertyIsEnumerable.call({ 1: 2 }, 1); - if (strings == null || strings.raw === undefined) { - stringMode = false; - styles += handleInterpolation(mergedProps, registered, strings, false); - } else { - if (false) {} +// `Object.prototype.propertyIsEnumerable` method implementation +// https://tc39.es/ecma262/#sec-object.prototype.propertyisenumerable +exports.f = NASHORN_BUG ? function propertyIsEnumerable(V) { + var descriptor = getOwnPropertyDescriptor(this, V); + return !!descriptor && descriptor.enumerable; +} : nativePropertyIsEnumerable; - styles += strings[0]; - } // we start at 1 since we've already handled the first arg +/***/ }), +/* 77 */ +/***/ (function(module, exports, __webpack_require__) { - for (var i = 1; i < args.length; i++) { - styles += handleInterpolation(mergedProps, registered, args[i], styles.charCodeAt(styles.length - 1) === 46); +var classof = __webpack_require__(30); +var global = __webpack_require__(3); - if (stringMode) { - if (false) {} +module.exports = classof(global.process) == 'process'; - styles += strings[i]; - } - } - var sourceMap; +/***/ }), +/* 78 */ +/***/ (function(module, exports) { - if (false) {} // using a global regex with .exec is stateful so lastIndex has to be reset each time +(function() { module.exports = window["wp"]["url"]; }()); +/***/ }), +/* 79 */ +/***/ (function(module, exports) { - labelPattern.lastIndex = 0; - var identifierName = ''; - var match; // https://esbench.com/bench/5b809c2cf2949800a0f61fb5 +exports.f = Object.getOwnPropertySymbols; - while ((match = labelPattern.exec(styles)) !== null) { - identifierName += '-' + // $FlowFixMe we know it's not null - match[1]; - } - var name = hash_browser_esm(styles) + identifierName; +/***/ }), +/* 80 */ +/***/ (function(module, exports) { - if (false) {} +function _extends() { + module.exports = _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; - return { - name: name, - styles: styles, - next: cursor - }; -}; + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } + return target; + }; + return _extends.apply(this, arguments); +} +module.exports = _extends; /***/ }), -/* 38 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return getRegisteredStyles; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return insertStyles; }); -var isBrowser = "object" !== 'undefined'; -function getRegisteredStyles(registered, registeredStyles, classNames) { - var rawClassName = ''; - classNames.split(' ').forEach(function (className) { - if (registered[className] !== undefined) { - registeredStyles.push(registered[className]); - } else { - rawClassName += className + " "; - } - }); - return rawClassName; -} -var insertStyles = function insertStyles(cache, serialized, isStringTag) { - var className = cache.key + "-" + serialized.name; - - if ( // we only need to add the styles to the registered cache if the - // class name could be used further down - // the tree but if it's a string tag, we know it won't - // so we don't have to add it to registered cache. - // this improves memory usage since we can avoid storing the whole style string - (isStringTag === false || // we need to always store it if we're in compat mode and - // in node since emotion-server relies on whether a style is in - // the registered cache to know whether a style is global or not - // also, note that this check will be dead code eliminated in the browser - isBrowser === false && cache.compat !== undefined) && cache.registered[className] === undefined) { - cache.registered[className] = serialized.styles; - } +/* 81 */ +/***/ (function(module, exports, __webpack_require__) { - if (cache.inserted[serialized.name] === undefined) { - var current = serialized; +var global = __webpack_require__(3); - do { - var maybeStyles = cache.insert("." + className, current, cache.sheet, true); +module.exports = global; - current = current.next; - } while (current !== undefined); - } -}; +/***/ }), +/* 82 */ +/***/ (function(module, exports, __webpack_require__) { +var wellKnownSymbol = __webpack_require__(8); +var TO_STRING_TAG = wellKnownSymbol('toStringTag'); +var test = {}; -/***/ }), -/* 39 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +test[TO_STRING_TAG] = 'z'; -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _taggedTemplateLiteral; }); -function _taggedTemplateLiteral(strings, raw) { - if (!raw) { - raw = strings.slice(0); - } +module.exports = String(test) === '[object z]'; - return Object.freeze(Object.defineProperties(strings, { - raw: { - value: Object.freeze(raw) - } - })); -} /***/ }), -/* 40 */, -/* 41 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 83 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _typeof; }); -function _typeof(obj) { - "@babel/helpers - typeof"; +var toIndexedObject = __webpack_require__(21); +var toLength = __webpack_require__(34); +var toAbsoluteIndex = __webpack_require__(97); + +// `Array.prototype.{ indexOf, includes }` methods implementation +var createMethod = function (IS_INCLUDES) { + return function ($this, el, fromIndex) { + var O = toIndexedObject($this); + var length = toLength(O.length); + var index = toAbsoluteIndex(fromIndex, length); + var value; + // Array#includes uses SameValueZero equality algorithm + // eslint-disable-next-line no-self-compare -- NaN check + if (IS_INCLUDES && el != el) while (length > index) { + value = O[index++]; + // eslint-disable-next-line no-self-compare -- NaN check + if (value != value) return true; + // Array#indexOf ignores holes, Array#includes - not + } else for (;length > index; index++) { + if ((IS_INCLUDES || index in O) && O[index] === el) return IS_INCLUDES || index || 0; + } return !IS_INCLUDES && -1; + }; +}; - if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { - _typeof = function _typeof(obj) { - return typeof obj; - }; - } else { - _typeof = function _typeof(obj) { - return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; - }; - } +module.exports = { + // `Array.prototype.includes` method + // https://tc39.es/ecma262/#sec-array.prototype.includes + includes: createMethod(true), + // `Array.prototype.indexOf` method + // https://tc39.es/ecma262/#sec-array.prototype.indexof + indexOf: createMethod(false) +}; - return _typeof(obj); -} /***/ }), -/* 42 */ -/***/ (function(module, exports) { +/* 84 */ +/***/ (function(module, exports, __webpack_require__) { -(function() { module.exports = this["wc"]["date"]; }()); +var classof = __webpack_require__(30); -/***/ }), -/* 43 */, -/* 44 */ -/***/ (function(module, exports) { +// `IsArray` abstract operation +// https://tc39.es/ecma262/#sec-isarray +module.exports = Array.isArray || function isArray(arg) { + return classof(arg) == 'Array'; +}; -(function() { module.exports = this["wp"]["apiFetch"]; }()); /***/ }), -/* 45 */, -/* 46 */, -/* 47 */ +/* 85 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; -/* unused harmony export logged */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return deprecated; }); -/* harmony import */ var _wordpress_hooks__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(51); -/* harmony import */ var _wordpress_hooks__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_wordpress_hooks__WEBPACK_IMPORTED_MODULE_0__); -/** - * WordPress dependencies - */ - -/** - * Object map tracking messages which have been logged, for use in ensuring a - * message is only logged once. - * - * @type {Object} - */ - -var logged = Object.create(null); -/** - * Logs a message to notify developers about a deprecated feature. +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return ADMIN_URL; }); +/* unused harmony export COUNTRIES */ +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return CURRENCY; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return LOCALE; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return ORDER_STATUSES; }); +/* unused harmony export SITE_TITLE */ +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return WC_ASSET_URL; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "g", function() { return getSetting; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "h", function() { return setSetting; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "f", function() { return getAdminLink; }); +/* harmony import */ var _babel_runtime_helpers_typeof__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(108); +/* harmony import */ var _babel_runtime_helpers_typeof__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_babel_runtime_helpers_typeof__WEBPACK_IMPORTED_MODULE_0__); +/* harmony import */ var core_js_modules_es_object_keys_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(38); +/* harmony import */ var core_js_modules_es_object_keys_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_object_keys_js__WEBPACK_IMPORTED_MODULE_1__); +/* harmony import */ var core_js_modules_es_array_includes_js__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(107); +/* harmony import */ var core_js_modules_es_array_includes_js__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_array_includes_js__WEBPACK_IMPORTED_MODULE_2__); +/* harmony import */ var _wordpress_i18n__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(2); +/* harmony import */ var _wordpress_i18n__WEBPACK_IMPORTED_MODULE_3___default = /*#__PURE__*/__webpack_require__.n(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_3__); + + + + +/** + * External dependencies + */ + // Remove mutable data from settings object to prevent access. Data stores should be used instead. + +var mutableSources = ['wcAdminSettings', 'preloadSettings']; +var settings = (typeof wcSettings === "undefined" ? "undefined" : _babel_runtime_helpers_typeof__WEBPACK_IMPORTED_MODULE_0___default()(wcSettings)) === 'object' ? wcSettings : {}; +var SOURCE = Object.keys(settings).reduce(function (source, key) { + if (!mutableSources.includes(key)) { + source[key] = settings[key]; + } + + return source; +}, {}); +var ADMIN_URL = SOURCE.adminUrl; +var COUNTRIES = SOURCE.countries; +var CURRENCY = SOURCE.currency; +var LOCALE = SOURCE.locale; +var ORDER_STATUSES = SOURCE.orderStatuses; +var SITE_TITLE = SOURCE.siteTitle; +var WC_ASSET_URL = SOURCE.wcAssetUrl; +/** + * Retrieves a setting value from the setting state. * - * @param {string} feature Name of the deprecated feature. - * @param {?Object} options Personalisation options - * @param {?string} options.version Version in which the feature will be removed. - * @param {?string} options.alternative Feature to use instead - * @param {?string} options.plugin Plugin name if it's a plugin feature - * @param {?string} options.link Link to documentation - * @param {?string} options.hint Additional message to help transition away from the deprecated feature. + * @param {string} name The identifier for the setting. + * @param {*} [fallback=false] The value to use as a fallback + * if the setting is not in the + * state. + * @param {Function} [filter=( val ) => val] A callback for filtering the + * value before it's returned. + * Receives both the found value + * (if it exists for the key) and + * the provided fallback arg. * - * @example - * ```js - * import deprecated from '@wordpress/deprecated'; + * @return {*} The value present in the settings state for the given + * name. + */ + +function getSetting(name) { + var fallback = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + var filter = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : function (val) { + return val; + }; + + if (mutableSources.includes(name)) { + throw new Error(Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_3__["__"])('Mutable settings should be accessed via data store.')); + } + + var value = SOURCE.hasOwnProperty(name) ? SOURCE[name] : fallback; + return filter(value, fallback); +} +/** + * Sets a value to a property on the settings state. + * + * NOTE: This feature is to be removed in favour of data stores when a full migration + * is complete. * - * deprecated( 'Eating meat', { - * version: 'the future', - * alternative: 'vegetables', - * plugin: 'the earth', - * hint: 'You may find it beneficial to transition gradually.', - * } ); + * @deprecated * - * // Logs: 'Eating meat is deprecated and will be removed from the earth in the future. Please use vegetables instead. Note: You may find it beneficial to transition gradually.' - * ``` + * @param {string} name The setting property key for the + * setting being mutated. + * @param {*} value The value to set. + * @param {Function} [filter=( val ) => val] Allows for providing a callback + * to sanitize the setting (eg. + * ensure it's a number) */ -function deprecated(feature) { - var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {}; - var version = options.version, - alternative = options.alternative, - plugin = options.plugin, - link = options.link, - hint = options.hint; - var pluginMessage = plugin ? " from ".concat(plugin) : ''; - var versionMessage = version ? " and will be removed".concat(pluginMessage, " in version ").concat(version) : ''; - var useInsteadMessage = alternative ? " Please use ".concat(alternative, " instead.") : ''; - var linkMessage = link ? " See: ".concat(link) : ''; - var hintMessage = hint ? " Note: ".concat(hint) : ''; - var message = "".concat(feature, " is deprecated").concat(versionMessage, ".").concat(useInsteadMessage).concat(linkMessage).concat(hintMessage); // Skip if already logged. - - if (message in logged) { - return; - } - /** - * Fires whenever a deprecated feature is encountered - * - * @param {string} feature Name of the deprecated feature. - * @param {?Object} options Personalisation options - * @param {?string} options.version Version in which the feature will be removed. - * @param {?string} options.alternative Feature to use instead - * @param {?string} options.plugin Plugin name if it's a plugin feature - * @param {?string} options.link Link to documentation - * @param {?string} options.hint Additional message to help transition away from the deprecated feature. - * @param {?string} message Message sent to console.warn - */ +function setSetting(name, value) { + var filter = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : function (val) { + return val; + }; + if (mutableSources.includes(name)) { + throw new Error(Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_3__["__"])('Mutable settings should be mutated via data store.')); + } - Object(_wordpress_hooks__WEBPACK_IMPORTED_MODULE_0__["doAction"])('deprecated', feature, options, message); // eslint-disable-next-line no-console + SOURCE[name] = filter(value); +} +/** + * Returns a string with the site's wp-admin URL appended. JS version of `admin_url`. + * + * @param {string} path Relative path. + * @return {string} Full admin URL. + */ - console.warn(message); - logged[message] = true; +function getAdminLink(path) { + return (ADMIN_URL || '') + path; } -//# sourceMappingURL=index.js.map /***/ }), -/* 48 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 86 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; +var getBuiltIn = __webpack_require__(31); +var getOwnPropertyNamesModule = __webpack_require__(56); +var getOwnPropertySymbolsModule = __webpack_require__(79); +var anObject = __webpack_require__(9); -// EXPORTS -__webpack_require__.d(__webpack_exports__, "a", function() { return /* reexport */ ThemeContext; }); -__webpack_require__.d(__webpack_exports__, "c", function() { return /* reexport */ emotion_element_57a3a7a3_browser_esm_withEmotionCache; }); -__webpack_require__.d(__webpack_exports__, "b", function() { return /* reexport */ css_browser_esm; }); +// all object keys, includes non-enumerable and symbols +module.exports = getBuiltIn('Reflect', 'ownKeys') || function ownKeys(it) { + var keys = getOwnPropertyNamesModule.f(anObject(it)); + var getOwnPropertySymbols = getOwnPropertySymbolsModule.f; + return getOwnPropertySymbols ? keys.concat(getOwnPropertySymbols(it)) : keys; +}; -// UNUSED EXPORTS: CacheProvider, ClassNames, Global, createElement, jsx, keyframes -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/inheritsLoose.js -var inheritsLoose = __webpack_require__(53); +/***/ }), +/* 87 */ +/***/ (function(module, exports, __webpack_require__) { -// EXTERNAL MODULE: external "React" -var external_React_ = __webpack_require__(8); +var getBuiltIn = __webpack_require__(31); -// CONCATENATED MODULE: ./node_modules/@emotion/sheet/dist/sheet.browser.esm.js -/* +module.exports = getBuiltIn('navigator', 'userAgent') || ''; -Based off glamor's StyleSheet, thanks Sunil ❤️ -high performance StyleSheet for css-in-js systems +/***/ }), +/* 88 */ +/***/ (function(module, exports, __webpack_require__) { -- uses multiple style tags behind the scenes for millions of rules -- uses `insertRule` for appending in production for *much* faster performance +"use strict"; -// usage +var $ = __webpack_require__(12); +var exec = __webpack_require__(91); -import { StyleSheet } from '@emotion/sheet' +// `RegExp.prototype.exec` method +// https://tc39.es/ecma262/#sec-regexp.prototype.exec +$({ target: 'RegExp', proto: true, forced: /./.exec !== exec }, { + exec: exec +}); -let styleSheet = new StyleSheet({ key: '', container: document.head }) -styleSheet.insert('#box { border: 1px solid red; }') -- appends a css rule into the stylesheet +/***/ }), +/* 89 */ +/***/ (function(module, exports, __webpack_require__) { -styleSheet.flush() -- empties the stylesheet of all its contents +var fails = __webpack_require__(6); +var wellKnownSymbol = __webpack_require__(8); +var V8_VERSION = __webpack_require__(63); -*/ -// $FlowFixMe -function sheetForTag(tag) { - if (tag.sheet) { - // $FlowFixMe - return tag.sheet; - } // this weirdness brought to you by firefox +var SPECIES = wellKnownSymbol('species'); - /* istanbul ignore next */ +module.exports = function (METHOD_NAME) { + // We can't use this feature detection in V8 since it causes + // deoptimization and serious performance degradation + // https://github.com/zloirock/core-js/issues/677 + return V8_VERSION >= 51 || !fails(function () { + var array = []; + var constructor = array.constructor = {}; + constructor[SPECIES] = function () { + return { foo: 1 }; + }; + return array[METHOD_NAME](Boolean).foo !== 1; + }); +}; - for (var i = 0; i < document.styleSheets.length; i++) { - if (document.styleSheets[i].ownerNode === tag) { - // $FlowFixMe - return document.styleSheets[i]; - } - } -} +/***/ }), +/* 90 */ +/***/ (function(module, exports, __webpack_require__) { + +var defineProperty = __webpack_require__(17).f; +var has = __webpack_require__(11); +var wellKnownSymbol = __webpack_require__(8); -function createStyleElement(options) { - var tag = document.createElement('style'); - tag.setAttribute('data-emotion', options.key); +var TO_STRING_TAG = wellKnownSymbol('toStringTag'); - if (options.nonce !== undefined) { - tag.setAttribute('nonce', options.nonce); +module.exports = function (it, TAG, STATIC) { + if (it && !has(it = STATIC ? it : it.prototype, TO_STRING_TAG)) { + defineProperty(it, TO_STRING_TAG, { configurable: true, value: TAG }); } +}; - tag.appendChild(document.createTextNode('')); - return tag; -} -var StyleSheet = -/*#__PURE__*/ -function () { - function StyleSheet(options) { - this.isSpeedy = options.speedy === undefined ? "production" === 'production' : options.speedy; - this.tags = []; - this.ctr = 0; - this.nonce = options.nonce; // key is the value of the data-emotion attribute, it's used to identify different sheets +/***/ }), +/* 91 */ +/***/ (function(module, exports, __webpack_require__) { - this.key = options.key; - this.container = options.container; - this.before = null; - } +"use strict"; - var _proto = StyleSheet.prototype; +var regexpFlags = __webpack_require__(114); +var stickyHelpers = __webpack_require__(137); - _proto.insert = function insert(rule) { - // the max length is how many rules we have per style tag, it's 65000 in speedy mode - // it's 1 in dev because we insert source maps that map a single rule to a location - // and you can only have one source map per style tag - if (this.ctr % (this.isSpeedy ? 65000 : 1) === 0) { - var _tag = createStyleElement(this); +var nativeExec = RegExp.prototype.exec; +// This always refers to the native implementation, because the +// String#replace polyfill uses ./fix-regexp-well-known-symbol-logic.js, +// which loads this file before patching the method. +var nativeReplace = String.prototype.replace; - var before; +var patchedExec = nativeExec; - if (this.tags.length === 0) { - before = this.before; - } else { - before = this.tags[this.tags.length - 1].nextSibling; - } +var UPDATES_LAST_INDEX_WRONG = (function () { + var re1 = /a/; + var re2 = /b*/g; + nativeExec.call(re1, 'a'); + nativeExec.call(re2, 'a'); + return re1.lastIndex !== 0 || re2.lastIndex !== 0; +})(); - this.container.insertBefore(_tag, before); - this.tags.push(_tag); - } +var UNSUPPORTED_Y = stickyHelpers.UNSUPPORTED_Y || stickyHelpers.BROKEN_CARET; - var tag = this.tags[this.tags.length - 1]; +// nonparticipating capturing group, copied from es5-shim's String#split patch. +// eslint-disable-next-line regexp/no-assertion-capturing-group, regexp/no-empty-group -- required for testing +var NPCG_INCLUDED = /()??/.exec('')[1] !== undefined; - if (this.isSpeedy) { - var sheet = sheetForTag(tag); +var PATCH = UPDATES_LAST_INDEX_WRONG || NPCG_INCLUDED || UNSUPPORTED_Y; - try { - // this is a really hot path - // we check the second character first because having "i" - // as the second character will happen less often than - // having "@" as the first character - var isImportRule = rule.charCodeAt(1) === 105 && rule.charCodeAt(0) === 64; // this is the ultrafast version, works across browsers - // the big drawback is that the css won't be editable in devtools - - sheet.insertRule(rule, // we need to insert @import rules before anything else - // otherwise there will be an error - // technically this means that the @import rules will - // _usually_(not always since there could be multiple style tags) - // be the first ones in prod and generally later in dev - // this shouldn't really matter in the real world though - // @import is generally only used for font faces from google fonts and etc. - // so while this could be technically correct then it would be slower and larger - // for a tiny bit of correctness that won't matter in the real world - isImportRule ? 0 : sheet.cssRules.length); - } catch (e) { - if (false) {} +if (PATCH) { + patchedExec = function exec(str) { + var re = this; + var lastIndex, reCopy, match, i; + var sticky = UNSUPPORTED_Y && re.sticky; + var flags = regexpFlags.call(re); + var source = re.source; + var charsAdded = 0; + var strCopy = str; + + if (sticky) { + flags = flags.replace('y', ''); + if (flags.indexOf('g') === -1) { + flags += 'g'; } - } else { - tag.appendChild(document.createTextNode(rule)); - } - this.ctr++; - }; + strCopy = String(str).slice(re.lastIndex); + // Support anchored sticky behavior. + if (re.lastIndex > 0 && (!re.multiline || re.multiline && str[re.lastIndex - 1] !== '\n')) { + source = '(?: ' + source + ')'; + strCopy = ' ' + strCopy; + charsAdded++; + } + // ^(? + rx + ) is needed, in combination with some str slicing, to + // simulate the 'y' flag. + reCopy = new RegExp('^(?:' + source + ')', flags); + } + + if (NPCG_INCLUDED) { + reCopy = new RegExp('^' + source + '$(?!\\s)', flags); + } + if (UPDATES_LAST_INDEX_WRONG) lastIndex = re.lastIndex; + + match = nativeExec.call(sticky ? reCopy : re, strCopy); + + if (sticky) { + if (match) { + match.input = match.input.slice(charsAdded); + match[0] = match[0].slice(charsAdded); + match.index = re.lastIndex; + re.lastIndex += match[0].length; + } else re.lastIndex = 0; + } else if (UPDATES_LAST_INDEX_WRONG && match) { + re.lastIndex = re.global ? match.index + match[0].length : lastIndex; + } + if (NPCG_INCLUDED && match && match.length > 1) { + // Fix browsers whose `exec` methods don't consistently return `undefined` + // for NPCG, like IE8. NOTE: This doesn' work for /(.?)?/ + nativeReplace.call(match[0], reCopy, function () { + for (i = 1; i < arguments.length - 2; i++) { + if (arguments[i] === undefined) match[i] = undefined; + } + }); + } - _proto.flush = function flush() { - // $FlowFixMe - this.tags.forEach(function (tag) { - return tag.parentNode.removeChild(tag); - }); - this.tags = []; - this.ctr = 0; + return match; }; +} - return StyleSheet; -}(); - +module.exports = patchedExec; -// CONCATENATED MODULE: ./node_modules/@emotion/stylis/dist/stylis.browser.esm.js -function stylis_min (W) { - function M(d, c, e, h, a) { - for (var m = 0, b = 0, v = 0, n = 0, q, g, x = 0, K = 0, k, u = k = q = 0, l = 0, r = 0, I = 0, t = 0, B = e.length, J = B - 1, y, f = '', p = '', F = '', G = '', C; l < B;) { - g = e.charCodeAt(l); - l === J && 0 !== b + n + v + m && (0 !== b && (g = 47 === b ? 10 : 47), n = v = m = 0, B++, J++); +/***/ }), +/* 92 */ +/***/ (function(module, exports) { - if (0 === b + n + v + m) { - if (l === J && (0 < r && (f = f.replace(N, '')), 0 < f.trim().length)) { - switch (g) { - case 32: - case 9: - case 59: - case 13: - case 10: - break; +(function() { module.exports = window["wc"]["tracks"]; }()); - default: - f += e.charAt(l); - } +/***/ }), +/* 93 */ +/***/ (function(module, exports, __webpack_require__) { - g = 59; - } +var NATIVE_SYMBOL = __webpack_require__(62); - switch (g) { - case 123: - f = f.trim(); - q = f.charCodeAt(0); - k = 1; +module.exports = NATIVE_SYMBOL + /* global Symbol -- safe */ + && !Symbol.sham + && typeof Symbol.iterator == 'symbol'; - for (t = ++l; l < B;) { - switch (g = e.charCodeAt(l)) { - case 123: - k++; - break; - case 125: - k--; - break; +/***/ }), +/* 94 */ +/***/ (function(module, exports, __webpack_require__) { - case 47: - switch (g = e.charCodeAt(l + 1)) { - case 42: - case 47: - a: { - for (u = l + 1; u < J; ++u) { - switch (e.charCodeAt(u)) { - case 47: - if (42 === g && 42 === e.charCodeAt(u - 1) && l + 2 !== u) { - l = u + 1; - break a; - } +var aFunction = __webpack_require__(70); - break; +// optional / simple context binding +module.exports = function (fn, that, length) { + aFunction(fn); + if (that === undefined) return fn; + switch (length) { + case 0: return function () { + return fn.call(that); + }; + case 1: return function (a) { + return fn.call(that, a); + }; + case 2: return function (a, b) { + return fn.call(that, a, b); + }; + case 3: return function (a, b, c) { + return fn.call(that, a, b, c); + }; + } + return function (/* ...args */) { + return fn.apply(that, arguments); + }; +}; - case 10: - if (47 === g) { - l = u + 1; - break a; - } - } - } +/***/ }), +/* 95 */ +/***/ (function(module, exports) { - l = u; - } +(function() { module.exports = window["wp"]["apiFetch"]; }()); - } +/***/ }), +/* 96 */ +/***/ (function(module, exports) { - break; +var g; - case 91: - g++; +// This works in non-strict mode +g = (function() { + return this; +})(); - case 40: - g++; +try { + // This works if eval is allowed (see CSP) + g = g || new Function("return this")(); +} catch (e) { + // This works if the window reference is available + if (typeof window === "object") g = window; +} - case 34: - case 39: - for (; l++ < J && e.charCodeAt(l) !== g;) { - } +// g can still be undefined, but nothing to do about it... +// We return undefined, instead of nothing here, so it's +// easier to handle this case. if(!global) { ...} - } +module.exports = g; - if (0 === k) break; - l++; - } - k = e.substring(t, l); - 0 === q && (q = (f = f.replace(ca, '').trim()).charCodeAt(0)); +/***/ }), +/* 97 */ +/***/ (function(module, exports, __webpack_require__) { - switch (q) { - case 64: - 0 < r && (f = f.replace(N, '')); - g = f.charCodeAt(1); +var toInteger = __webpack_require__(42); - switch (g) { - case 100: - case 109: - case 115: - case 45: - r = c; - break; +var max = Math.max; +var min = Math.min; - default: - r = O; - } +// Helper for a popular repeating case of the spec: +// Let integer be ? ToInteger(index). +// If integer < 0, let result be max((length + integer), 0); else let result be min(integer, length). +module.exports = function (index, length) { + var integer = toInteger(index); + return integer < 0 ? max(integer + length, 0) : min(integer, length); +}; - k = M(c, r, k, g, a + 1); - t = k.length; - 0 < A && (r = X(O, f, I), C = H(3, k, r, c, D, z, t, g, a, h), f = r.join(''), void 0 !== C && 0 === (t = (k = C.trim()).length) && (g = 0, k = '')); - if (0 < t) switch (g) { - case 115: - f = f.replace(da, ea); - - case 100: - case 109: - case 45: - k = f + '{' + k + '}'; - break; - - case 107: - f = f.replace(fa, '$1 $2'); - k = f + '{' + k + '}'; - k = 1 === w || 2 === w && L('@' + k, 3) ? '@-webkit-' + k + '@' + k : '@' + k; - break; - - default: - k = f + k, 112 === h && (k = (p += k, '')); - } else k = ''; - break; - - default: - k = M(c, X(c, f, I), k, h, a + 1); - } - F += k; - k = I = r = u = q = 0; - f = ''; - g = e.charCodeAt(++l); - break; +/***/ }), +/* 98 */ +/***/ (function(module, exports, __webpack_require__) { - case 125: - case 59: - f = (0 < r ? f.replace(N, '') : f).trim(); - if (1 < (t = f.length)) switch (0 === u && (q = f.charCodeAt(0), 45 === q || 96 < q && 123 > q) && (t = (f = f.replace(' ', ':')).length), 0 < A && void 0 !== (C = H(1, f, c, d, D, z, p.length, h, a, h)) && 0 === (t = (f = C.trim()).length) && (f = '\x00\x00'), q = f.charCodeAt(0), g = f.charCodeAt(1), q) { - case 0: - break; - - case 64: - if (105 === g || 99 === g) { - G += f + e.charAt(l); - break; - } +var getBuiltIn = __webpack_require__(31); - default: - 58 !== f.charCodeAt(t - 1) && (p += P(f, q, g, f.charCodeAt(2))); - } - I = r = u = q = 0; - f = ''; - g = e.charCodeAt(++l); - } - } +module.exports = getBuiltIn('document', 'documentElement'); - switch (g) { - case 13: - case 10: - 47 === b ? b = 0 : 0 === 1 + q && 107 !== h && 0 < f.length && (r = 1, f += '\x00'); - 0 < A * Y && H(0, f, c, d, D, z, p.length, h, a, h); - z = 1; - D++; - break; - case 59: - case 125: - if (0 === b + n + v + m) { - z++; - break; - } +/***/ }), +/* 99 */, +/* 100 */ +/***/ (function(module, exports, __webpack_require__) { - default: - z++; - y = e.charAt(l); - - switch (g) { - case 9: - case 32: - if (0 === n + m + b) switch (x) { - case 44: - case 58: - case 9: - case 32: - y = ''; - break; - - default: - 32 !== g && (y = ' '); - } - break; +var TO_STRING_TAG_SUPPORT = __webpack_require__(82); +var redefine = __webpack_require__(27); +var toString = __webpack_require__(131); - case 0: - y = '\\0'; - break; +// `Object.prototype.toString` method +// https://tc39.es/ecma262/#sec-object.prototype.tostring +if (!TO_STRING_TAG_SUPPORT) { + redefine(Object.prototype, 'toString', toString, { unsafe: true }); +} - case 12: - y = '\\f'; - break; - case 11: - y = '\\v'; - break; +/***/ }), +/* 101 */ +/***/ (function(module, exports) { - case 38: - 0 === n + b + m && (r = I = 1, y = '\f' + y); - break; +(function() { module.exports = window["wc"]["date"]; }()); - case 108: - if (0 === n + b + m + E && 0 < u) switch (l - u) { - case 2: - 112 === x && 58 === e.charCodeAt(l - 3) && (E = x); +/***/ }), +/* 102 */ +/***/ (function(module, exports, __webpack_require__) { - case 8: - 111 === K && (E = K); - } - break; +"use strict"; - case 58: - 0 === n + b + m && (u = l); - break; +var toPrimitive = __webpack_require__(40); +var definePropertyModule = __webpack_require__(17); +var createPropertyDescriptor = __webpack_require__(39); - case 44: - 0 === b + v + n + m && (r = 1, y += '\r'); - break; +module.exports = function (object, key, value) { + var propertyKey = toPrimitive(key); + if (propertyKey in object) definePropertyModule.f(object, propertyKey, createPropertyDescriptor(0, value)); + else object[propertyKey] = value; +}; - case 34: - case 39: - 0 === b && (n = n === g ? 0 : 0 === n ? g : n); - break; - case 91: - 0 === n + b + v && m++; - break; +/***/ }), +/* 103 */ +/***/ (function(module, exports, __webpack_require__) { - case 93: - 0 === n + b + v && m--; - break; +var has = __webpack_require__(11); +var ownKeys = __webpack_require__(86); +var getOwnPropertyDescriptorModule = __webpack_require__(33); +var definePropertyModule = __webpack_require__(17); - case 41: - 0 === n + b + m && v--; - break; +module.exports = function (target, source) { + var keys = ownKeys(source); + var defineProperty = definePropertyModule.f; + var getOwnPropertyDescriptor = getOwnPropertyDescriptorModule.f; + for (var i = 0; i < keys.length; i++) { + var key = keys[i]; + if (!has(target, key)) defineProperty(target, key, getOwnPropertyDescriptor(source, key)); + } +}; - case 40: - if (0 === n + b + m) { - if (0 === q) switch (2 * x + 3 * K) { - case 533: - break; - default: - q = 1; - } - v++; - } +/***/ }), +/* 104 */ +/***/ (function(module, exports, __webpack_require__) { - break; +var DESCRIPTORS = __webpack_require__(13); +var definePropertyModule = __webpack_require__(17); +var anObject = __webpack_require__(9); +var objectKeys = __webpack_require__(54); + +// `Object.defineProperties` method +// https://tc39.es/ecma262/#sec-object.defineproperties +module.exports = DESCRIPTORS ? Object.defineProperties : function defineProperties(O, Properties) { + anObject(O); + var keys = objectKeys(Properties); + var length = keys.length; + var index = 0; + var key; + while (length > index) definePropertyModule.f(O, key = keys[index++], Properties[key]); + return O; +}; - case 64: - 0 === b + v + n + m + u + k && (k = 1); - break; - case 42: - case 47: - if (!(0 < n + m + v)) switch (b) { - case 0: - switch (2 * g + 3 * e.charCodeAt(l + 1)) { - case 235: - b = 47; - break; +/***/ }), +/* 105 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { - case 220: - t = l, b = 42; - } +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Navigation; }); +/* unused harmony export NavigationBackButton */ +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return NavigationGroup; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return NavigationMenu; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return NavigationItem; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return Text; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "f", function() { return useSlot; }); +/* harmony import */ var _wordpress_components__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(4); +/* harmony import */ var _wordpress_components__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_wordpress_components__WEBPACK_IMPORTED_MODULE_0__); +/** + * External dependencies + */ - break; +/** + * Prioritize exports of non-experimental components over experimental. + */ - case 42: - 47 === g && 42 === x && t + 2 !== l && (33 === e.charCodeAt(t + 2) && (p += e.substring(t, l + 1)), y = '', b = 0); - } - } +var Navigation = _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["Navigation"] || _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["__experimentalNavigation"]; +var NavigationBackButton = _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["NavigationBackButton"] || _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["__experimentalNavigationBackButton"]; +var NavigationGroup = _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["NavigationGroup"] || _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["__experimentalNavigationGroup"]; +var NavigationMenu = _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["NavigationMenu"] || _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["__experimentalNavigationMenu"]; +var NavigationItem = _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["NavigationItem"] || _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["__experimentalNavigationItem"]; +var Text = _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["Text"] || _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["__experimentalText"]; +var useSlot = _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["useSlot"] || _wordpress_components__WEBPACK_IMPORTED_MODULE_0__["__experimentalUseSlot"]; - 0 === b && (f += y); - } +/***/ }), +/* 106 */ +/***/ (function(module, exports, __webpack_require__) { - K = x; - x = g; - l++; - } +var global = __webpack_require__(3); +var inspectSource = __webpack_require__(68); - t = p.length; +var WeakMap = global.WeakMap; - if (0 < t) { - r = c; - if (0 < A && (C = H(2, p, r, d, D, z, t, h, a, h), void 0 !== C && 0 === (p = C).length)) return G + p + F; - p = r.join(',') + '{' + p + '}'; +module.exports = typeof WeakMap === 'function' && /native code/.test(inspectSource(WeakMap)); - if (0 !== w * E) { - 2 !== w || L(p, 2) || (E = 0); - switch (E) { - case 111: - p = p.replace(ha, ':-moz-$1') + p; - break; +/***/ }), +/* 107 */ +/***/ (function(module, exports, __webpack_require__) { - case 112: - p = p.replace(Q, '::-webkit-input-$1') + p.replace(Q, '::-moz-$1') + p.replace(Q, ':-ms-input-$1') + p; - } +"use strict"; - E = 0; - } - } +var $ = __webpack_require__(12); +var $includes = __webpack_require__(83).includes; +var addToUnscopables = __webpack_require__(118); - return G + p + F; +// `Array.prototype.includes` method +// https://tc39.es/ecma262/#sec-array.prototype.includes +$({ target: 'Array', proto: true }, { + includes: function includes(el /* , fromIndex = 0 */) { + return $includes(this, el, arguments.length > 1 ? arguments[1] : undefined); } +}); - function X(d, c, e) { - var h = c.trim().split(ia); - c = h; - var a = h.length, - m = d.length; - - switch (m) { - case 0: - case 1: - var b = 0; - - for (d = 0 === m ? '' : d[0] + ' '; b < a; ++b) { - c[b] = Z(d, c[b], e).trim(); - } - - break; +// https://tc39.es/ecma262/#sec-array.prototype-@@unscopables +addToUnscopables('includes'); - default: - var v = b = 0; - for (c = []; b < a; ++b) { - for (var n = 0; n < m; ++n) { - c[v++] = Z(d[n] + ' ', h[b], e).trim(); - } - } +/***/ }), +/* 108 */ +/***/ (function(module, exports) { - } +function _typeof(obj) { + "@babel/helpers - typeof"; - return c; + if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { + module.exports = _typeof = function _typeof(obj) { + return typeof obj; + }; + } else { + module.exports = _typeof = function _typeof(obj) { + return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; + }; } - function Z(d, c, e) { - var h = c.charCodeAt(0); - 33 > h && (h = (c = c.trim()).charCodeAt(0)); + return _typeof(obj); +} - switch (h) { - case 38: - return c.replace(F, '$1' + d.trim()); +module.exports = _typeof; - case 58: - return d.trim() + c.replace(F, '$1' + d.trim()); +/***/ }), +/* 109 */ +/***/ (function(module, exports, __webpack_require__) { - default: - if (0 < 1 * e && 0 < c.indexOf('\f')) return c.replace(F, (58 === d.charCodeAt(0) ? '' : '$1') + d.trim()); - } +var isObject = __webpack_require__(10); +var isArray = __webpack_require__(84); +var wellKnownSymbol = __webpack_require__(8); + +var SPECIES = wellKnownSymbol('species'); + +// `ArraySpeciesCreate` abstract operation +// https://tc39.es/ecma262/#sec-arrayspeciescreate +module.exports = function (originalArray, length) { + var C; + if (isArray(originalArray)) { + C = originalArray.constructor; + // cross-realm fallback + if (typeof C == 'function' && (C === Array || isArray(C.prototype))) C = undefined; + else if (isObject(C)) { + C = C[SPECIES]; + if (C === null) C = undefined; + } + } return new (C === undefined ? Array : C)(length === 0 ? 0 : length); +}; - return d + c; - } - function P(d, c, e, h) { - var a = d + ';', - m = 2 * c + 3 * e + 4 * h; +/***/ }), +/* 110 */ +/***/ (function(module, exports) { - if (944 === m) { - d = a.indexOf(':', 9) + 1; - var b = a.substring(d, a.length - 1).trim(); - b = a.substring(0, d).trim() + b + ';'; - return 1 === w || 2 === w && L(b, 1) ? '-webkit-' + b + b : b; - } +module.exports = {}; - if (0 === w || 2 === w && !L(a, 1)) return a; - switch (m) { - case 1015: - return 97 === a.charCodeAt(10) ? '-webkit-' + a + a : a; +/***/ }), +/* 111 */ +/***/ (function(module, exports, __webpack_require__) { - case 951: - return 116 === a.charCodeAt(3) ? '-webkit-' + a + a : a; +"use strict"; - case 963: - return 110 === a.charCodeAt(5) ? '-webkit-' + a + a : a; +// TODO: Remove from `core-js@4` since it's moved to entry points +__webpack_require__(88); +var redefine = __webpack_require__(27); +var fails = __webpack_require__(6); +var wellKnownSymbol = __webpack_require__(8); +var regexpExec = __webpack_require__(91); +var createNonEnumerableProperty = __webpack_require__(19); + +var SPECIES = wellKnownSymbol('species'); + +var REPLACE_SUPPORTS_NAMED_GROUPS = !fails(function () { + // #replace needs built-in support for named groups. + // #match works fine because it just return the exec results, even if it has + // a "grops" property. + var re = /./; + re.exec = function () { + var result = []; + result.groups = { a: '7' }; + return result; + }; + return ''.replace(re, '$') !== '7'; +}); - case 1009: - if (100 !== a.charCodeAt(4)) break; +// IE <= 11 replaces $0 with the whole match, as if it was $& +// https://stackoverflow.com/questions/6024666/getting-ie-to-replace-a-regex-with-the-literal-string-0 +var REPLACE_KEEPS_$0 = (function () { + return 'a'.replace(/./, '$0') === '$0'; +})(); - case 969: - case 942: - return '-webkit-' + a + a; +var REPLACE = wellKnownSymbol('replace'); +// Safari <= 13.0.3(?) substitutes nth capture where n>m with an empty string +var REGEXP_REPLACE_SUBSTITUTES_UNDEFINED_CAPTURE = (function () { + if (/./[REPLACE]) { + return /./[REPLACE]('a', '$0') === ''; + } + return false; +})(); - case 978: - return '-webkit-' + a + '-moz-' + a + a; +// Chrome 51 has a buggy "split" implementation when RegExp#exec !== nativeExec +// Weex JS has frozen built-in prototypes, so use try / catch wrapper +var SPLIT_WORKS_WITH_OVERWRITTEN_EXEC = !fails(function () { + // eslint-disable-next-line regexp/no-empty-group -- required for testing + var re = /(?:)/; + var originalExec = re.exec; + re.exec = function () { return originalExec.apply(this, arguments); }; + var result = 'ab'.split(re); + return result.length !== 2 || result[0] !== 'a' || result[1] !== 'b'; +}); - case 1019: - case 983: - return '-webkit-' + a + '-moz-' + a + '-ms-' + a + a; +module.exports = function (KEY, length, exec, sham) { + var SYMBOL = wellKnownSymbol(KEY); - case 883: - if (45 === a.charCodeAt(8)) return '-webkit-' + a + a; - if (0 < a.indexOf('image-set(', 11)) return a.replace(ja, '$1-webkit-$2') + a; - break; + var DELEGATES_TO_SYMBOL = !fails(function () { + // String methods call symbol-named RegEp methods + var O = {}; + O[SYMBOL] = function () { return 7; }; + return ''[KEY](O) != 7; + }); - case 932: - if (45 === a.charCodeAt(4)) switch (a.charCodeAt(5)) { - case 103: - return '-webkit-box-' + a.replace('-grow', '') + '-webkit-' + a + '-ms-' + a.replace('grow', 'positive') + a; + var DELEGATES_TO_EXEC = DELEGATES_TO_SYMBOL && !fails(function () { + // Symbol-named RegExp methods call .exec + var execCalled = false; + var re = /a/; - case 115: - return '-webkit-' + a + '-ms-' + a.replace('shrink', 'negative') + a; + if (KEY === 'split') { + // We can't use real regex here since it causes deoptimization + // and serious performance degradation in V8 + // https://github.com/zloirock/core-js/issues/306 + re = {}; + // RegExp[@@split] doesn't call the regex's exec method, but first creates + // a new one. We need to return the patched regex when creating the new one. + re.constructor = {}; + re.constructor[SPECIES] = function () { return re; }; + re.flags = ''; + re[SYMBOL] = /./[SYMBOL]; + } - case 98: - return '-webkit-' + a + '-ms-' + a.replace('basis', 'preferred-size') + a; - } - return '-webkit-' + a + '-ms-' + a + a; + re.exec = function () { execCalled = true; return null; }; - case 964: - return '-webkit-' + a + '-ms-flex-' + a + a; + re[SYMBOL](''); + return !execCalled; + }); - case 1023: - if (99 !== a.charCodeAt(8)) break; - b = a.substring(a.indexOf(':', 15)).replace('flex-', '').replace('space-between', 'justify'); - return '-webkit-box-pack' + b + '-webkit-' + a + '-ms-flex-pack' + b + a; + if ( + !DELEGATES_TO_SYMBOL || + !DELEGATES_TO_EXEC || + (KEY === 'replace' && !( + REPLACE_SUPPORTS_NAMED_GROUPS && + REPLACE_KEEPS_$0 && + !REGEXP_REPLACE_SUBSTITUTES_UNDEFINED_CAPTURE + )) || + (KEY === 'split' && !SPLIT_WORKS_WITH_OVERWRITTEN_EXEC) + ) { + var nativeRegExpMethod = /./[SYMBOL]; + var methods = exec(SYMBOL, ''[KEY], function (nativeMethod, regexp, str, arg2, forceStringMethod) { + if (regexp.exec === regexpExec) { + if (DELEGATES_TO_SYMBOL && !forceStringMethod) { + // The native String method already delegates to @@method (this + // polyfilled function), leasing to infinite recursion. + // We avoid it by directly calling the native @@method method. + return { done: true, value: nativeRegExpMethod.call(regexp, str, arg2) }; + } + return { done: true, value: nativeMethod.call(str, regexp, arg2) }; + } + return { done: false }; + }, { + REPLACE_KEEPS_$0: REPLACE_KEEPS_$0, + REGEXP_REPLACE_SUBSTITUTES_UNDEFINED_CAPTURE: REGEXP_REPLACE_SUBSTITUTES_UNDEFINED_CAPTURE + }); + var stringMethod = methods[0]; + var regexMethod = methods[1]; + + redefine(String.prototype, KEY, stringMethod); + redefine(RegExp.prototype, SYMBOL, length == 2 + // 21.2.5.8 RegExp.prototype[@@replace](string, replaceValue) + // 21.2.5.11 RegExp.prototype[@@split](string, limit) + ? function (string, arg) { return regexMethod.call(string, this, arg); } + // 21.2.5.6 RegExp.prototype[@@match](string) + // 21.2.5.9 RegExp.prototype[@@search](string) + : function (string) { return regexMethod.call(string, this); } + ); + } - case 1005: - return ka.test(a) ? a.replace(aa, ':-webkit-') + a.replace(aa, ':-moz-') + a : a; + if (sham) createNonEnumerableProperty(RegExp.prototype[SYMBOL], 'sham', true); +}; - case 1e3: - b = a.substring(13).trim(); - c = b.indexOf('-') + 1; - switch (b.charCodeAt(0) + b.charCodeAt(c)) { - case 226: - b = a.replace(G, 'tb'); - break; +/***/ }), +/* 112 */ +/***/ (function(module, exports, __webpack_require__) { - case 232: - b = a.replace(G, 'tb-rl'); - break; +var classof = __webpack_require__(30); +var regexpExec = __webpack_require__(91); - case 220: - b = a.replace(G, 'lr'); - break; +// `RegExpExec` abstract operation +// https://tc39.es/ecma262/#sec-regexpexec +module.exports = function (R, S) { + var exec = R.exec; + if (typeof exec === 'function') { + var result = exec.call(R, S); + if (typeof result !== 'object') { + throw TypeError('RegExp exec method returned something other than an Object or null'); + } + return result; + } - default: - return a; - } + if (classof(R) !== 'RegExp') { + throw TypeError('RegExp#exec called on incompatible receiver'); + } - return '-webkit-' + a + '-ms-' + b + a; + return regexpExec.call(R, S); +}; - case 1017: - if (-1 === a.indexOf('sticky', 9)) break; - case 975: - c = (a = d).length - 10; - b = (33 === a.charCodeAt(c) ? a.substring(0, c) : a).substring(d.indexOf(':', 7) + 1).trim(); - switch (m = b.charCodeAt(0) + (b.charCodeAt(7) | 0)) { - case 203: - if (111 > b.charCodeAt(8)) break; +/***/ }), +/* 113 */ +/***/ (function(module, exports, __webpack_require__) { - case 115: - a = a.replace(b, '-webkit-' + b) + ';' + a; - break; +var TO_STRING_TAG_SUPPORT = __webpack_require__(82); +var classofRaw = __webpack_require__(30); +var wellKnownSymbol = __webpack_require__(8); - case 207: - case 102: - a = a.replace(b, '-webkit-' + (102 < m ? 'inline-' : '') + 'box') + ';' + a.replace(b, '-webkit-' + b) + ';' + a.replace(b, '-ms-' + b + 'box') + ';' + a; - } +var TO_STRING_TAG = wellKnownSymbol('toStringTag'); +// ES3 wrong here +var CORRECT_ARGUMENTS = classofRaw(function () { return arguments; }()) == 'Arguments'; - return a + ';'; +// fallback for IE11 Script Access Denied error +var tryGet = function (it, key) { + try { + return it[key]; + } catch (error) { /* empty */ } +}; - case 938: - if (45 === a.charCodeAt(5)) switch (a.charCodeAt(6)) { - case 105: - return b = a.replace('-items', ''), '-webkit-' + a + '-webkit-box-' + b + '-ms-flex-' + b + a; +// getting tag from ES6+ `Object.prototype.toString` +module.exports = TO_STRING_TAG_SUPPORT ? classofRaw : function (it) { + var O, tag, result; + return it === undefined ? 'Undefined' : it === null ? 'Null' + // @@toStringTag case + : typeof (tag = tryGet(O = Object(it), TO_STRING_TAG)) == 'string' ? tag + // builtinTag case + : CORRECT_ARGUMENTS ? classofRaw(O) + // ES3 arguments fallback + : (result = classofRaw(O)) == 'Object' && typeof O.callee == 'function' ? 'Arguments' : result; +}; - case 115: - return '-webkit-' + a + '-ms-flex-item-' + a.replace(ba, '') + a; - default: - return '-webkit-' + a + '-ms-flex-line-pack' + a.replace('align-content', '').replace(ba, '') + a; - } - break; +/***/ }), +/* 114 */ +/***/ (function(module, exports, __webpack_require__) { - case 973: - case 989: - if (45 !== a.charCodeAt(3) || 122 === a.charCodeAt(4)) break; +"use strict"; - case 931: - case 953: - if (!0 === la.test(d)) return 115 === (b = d.substring(d.indexOf(':') + 1)).charCodeAt(0) ? P(d.replace('stretch', 'fill-available'), c, e, h).replace(':fill-available', ':stretch') : a.replace(b, '-webkit-' + b) + a.replace(b, '-moz-' + b.replace('fill-', '')) + a; - break; +var anObject = __webpack_require__(9); + +// `RegExp.prototype.flags` getter implementation +// https://tc39.es/ecma262/#sec-get-regexp.prototype.flags +module.exports = function () { + var that = anObject(this); + var result = ''; + if (that.global) result += 'g'; + if (that.ignoreCase) result += 'i'; + if (that.multiline) result += 'm'; + if (that.dotAll) result += 's'; + if (that.unicode) result += 'u'; + if (that.sticky) result += 'y'; + return result; +}; - case 962: - if (a = '-webkit-' + a + (102 === a.charCodeAt(5) ? '-ms-' + a : '') + a, 211 === e + h && 105 === a.charCodeAt(13) && 0 < a.indexOf('transform', 10)) return a.substring(0, a.indexOf(';', 27) + 1).replace(ma, '$1-webkit-$2') + a; - } - return a; - } +/***/ }), +/* 115 */, +/* 116 */ +/***/ (function(module, exports, __webpack_require__) { - function L(d, c) { - var e = d.indexOf(1 === c ? ':' : '{'), - h = d.substring(0, 3 !== c ? e : 10); - e = d.substring(e + 1, d.length - 1); - return R(2 !== c ? h : h.replace(na, '$1'), e, c); - } +var objectWithoutPropertiesLoose = __webpack_require__(233); - function ea(d, c) { - var e = P(c, c.charCodeAt(0), c.charCodeAt(1), c.charCodeAt(2)); - return e !== c + ';' ? e.replace(oa, ' or ($1)').substring(4) : '(' + c + ')'; - } +function _objectWithoutProperties(source, excluded) { + if (source == null) return {}; + var target = objectWithoutPropertiesLoose(source, excluded); + var key, i; - function H(d, c, e, h, a, m, b, v, n, q) { - for (var g = 0, x = c, w; g < A; ++g) { - switch (w = S[g].call(B, d, x, e, h, a, m, b, v, n, q)) { - case void 0: - case !1: - case !0: - case null: - break; + if (Object.getOwnPropertySymbols) { + var sourceSymbolKeys = Object.getOwnPropertySymbols(source); - default: - x = w; - } + for (i = 0; i < sourceSymbolKeys.length; i++) { + key = sourceSymbolKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; + target[key] = source[key]; } - - if (x !== c) return x; } - function T(d) { - switch (d) { - case void 0: - case null: - A = S.length = 0; - break; - - default: - if ('function' === typeof d) S[A++] = d;else if ('object' === typeof d) for (var c = 0, e = d.length; c < e; ++c) { - T(d[c]); - } else Y = !!d | 0; - } - - return T; - } - - function U(d) { - d = d.prefix; - void 0 !== d && (R = null, d ? 'function' !== typeof d ? w = 1 : (w = 2, R = d) : w = 0); - return U; - } - - function B(d, c) { - var e = d; - 33 > e.charCodeAt(0) && (e = e.trim()); - V = e; - e = [V]; - - if (0 < A) { - var h = H(-1, c, e, e, D, z, 0, 0, 0, 0); - void 0 !== h && 'string' === typeof h && (c = h); - } - - var a = M(O, e, c, 0, 0); - 0 < A && (h = H(-2, a, e, e, D, z, a.length, 0, 0, 0), void 0 !== h && (a = h)); - V = ''; - E = 0; - z = D = 1; - return a; - } - - var ca = /^\0+/g, - N = /[\0\r\f]/g, - aa = /: */g, - ka = /zoo|gra/, - ma = /([,: ])(transform)/g, - ia = /,\r+?/g, - F = /([\t\r\n ])*\f?&/g, - fa = /@(k\w+)\s*(\S*)\s*/, - Q = /::(place)/g, - ha = /:(read-only)/g, - G = /[svh]\w+-[tblr]{2}/, - da = /\(\s*(.*)\s*\)/g, - oa = /([\s\S]*?);/g, - ba = /-self|flex-/g, - na = /[^]*?(:[rp][el]a[\w-]+)[^]*/, - la = /stretch|:\s*\w+\-(?:conte|avail)/, - ja = /([^-])(image-set\()/, - z = 1, - D = 1, - E = 0, - w = 1, - O = [], - S = [], - A = 0, - R = null, - Y = 0, - V = ''; - B.use = T; - B.set = U; - void 0 !== W && U(W); - return B; + return target; } -/* harmony default export */ var stylis_browser_esm = (stylis_min); - -// CONCATENATED MODULE: ./node_modules/@emotion/weak-memoize/dist/weak-memoize.browser.esm.js -var weakMemoize = function weakMemoize(func) { - // $FlowFixMe flow doesn't include all non-primitive types as allowed for weakmaps - var cache = new WeakMap(); - return function (arg) { - if (cache.has(arg)) { - // $FlowFixMe - return cache.get(arg); - } - - var ret = func(arg); - cache.set(arg, ret); - return ret; - }; -}; - -/* harmony default export */ var weak_memoize_browser_esm = (weakMemoize); - -// CONCATENATED MODULE: ./node_modules/@emotion/cache/dist/cache.browser.esm.js +module.exports = _objectWithoutProperties; +/***/ }), +/* 117 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _extends; }); +function _extends() { + _extends = Object.assign || function (target) { + for (var i = 1; i < arguments.length; i++) { + var source = arguments[i]; + for (var key in source) { + if (Object.prototype.hasOwnProperty.call(source, key)) { + target[key] = source[key]; + } + } + } -// https://github.com/thysultan/stylis.js/tree/master/plugins/rule-sheet -// inlined to avoid umd wrapper and peerDep warnings/installing stylis -// since we use stylis after closure compiler -var delimiter = '/*|*/'; -var needle = delimiter + '}'; + return target; + }; -function toSheet(block) { - if (block) { - Sheet.current.insert(block + '}'); - } + return _extends.apply(this, arguments); } -var Sheet = { - current: null -}; -var ruleSheet = function ruleSheet(context, content, selectors, parents, line, column, length, ns, depth, at) { - switch (context) { - // property - case 1: - { - switch (content.charCodeAt(0)) { - case 64: - { - // @import - Sheet.current.insert(content + ';'); - return ''; - } - // charcode for l - - case 108: - { - // charcode for b - // this ignores label - if (content.charCodeAt(2) === 98) { - return ''; - } - } - } +/***/ }), +/* 118 */ +/***/ (function(module, exports, __webpack_require__) { - break; - } - // selector +var wellKnownSymbol = __webpack_require__(8); +var create = __webpack_require__(69); +var definePropertyModule = __webpack_require__(17); - case 2: - { - if (ns === 0) return content + delimiter; - break; - } - // at-rule - - case 3: - { - switch (ns) { - // @font-face, @page - case 102: - case 112: - { - Sheet.current.insert(selectors[0] + content); - return ''; - } +var UNSCOPABLES = wellKnownSymbol('unscopables'); +var ArrayPrototype = Array.prototype; - default: - { - return content + (at === 0 ? delimiter : ''); - } - } - } +// Array.prototype[@@unscopables] +// https://tc39.es/ecma262/#sec-array.prototype-@@unscopables +if (ArrayPrototype[UNSCOPABLES] == undefined) { + definePropertyModule.f(ArrayPrototype, UNSCOPABLES, { + configurable: true, + value: create(null) + }); +} - case -2: - { - content.split(needle).forEach(toSheet); - } - } +// add a key to Array.prototype[@@unscopables] +module.exports = function (key) { + ArrayPrototype[UNSCOPABLES][key] = true; }; -var cache_browser_esm_createCache = function createCache(options) { - if (options === undefined) options = {}; - var key = options.key || 'css'; - var stylisOptions; - if (options.prefix !== undefined) { - stylisOptions = { - prefix: options.prefix - }; - } - - var stylis = new stylis_browser_esm(stylisOptions); - - if (false) {} - - var inserted = {}; // $FlowFixMe +/***/ }), +/* 119 */ +/***/ (function(module, exports, __webpack_require__) { - var container; +var wellKnownSymbol = __webpack_require__(8); - { - container = options.container || document.head; - var nodes = document.querySelectorAll("style[data-emotion-" + key + "]"); - Array.prototype.forEach.call(nodes, function (node) { - var attrib = node.getAttribute("data-emotion-" + key); // $FlowFixMe +exports.f = wellKnownSymbol; - attrib.split(' ').forEach(function (id) { - inserted[id] = true; - }); - if (node.parentNode !== container) { - container.appendChild(node); - } - }); - } +/***/ }), +/* 120 */, +/* 121 */ +/***/ (function(module, exports, __webpack_require__) { - var _insert; +"use strict"; - { - stylis.use(options.stylisPlugins)(ruleSheet); +var charAt = __webpack_require__(125).charAt; - _insert = function insert(selector, serialized, sheet, shouldCache) { - var name = serialized.name; - Sheet.current = sheet; +// `AdvanceStringIndex` abstract operation +// https://tc39.es/ecma262/#sec-advancestringindex +module.exports = function (S, index, unicode) { + return index + (unicode ? charAt(S, index).length : 1); +}; - if (false) { var map; } - stylis(selector, serialized.styles); +/***/ }), +/* 122 */ +/***/ (function(module, exports, __webpack_require__) { - if (shouldCache) { - cache.inserted[name] = true; - } - }; - } +"use strict"; - if (false) { var commentEnd, commentStart; } +var fails = __webpack_require__(6); - var cache = { - key: key, - sheet: new StyleSheet({ - key: key, - container: container, - nonce: options.nonce, - speedy: options.speedy - }), - nonce: options.nonce, - inserted: inserted, - registered: {}, - insert: _insert - }; - return cache; +module.exports = function (METHOD_NAME, argument) { + var method = [][METHOD_NAME]; + return !!method && fails(function () { + // eslint-disable-next-line no-useless-call,no-throw-literal -- required for testing + method.call(null, argument || function () { throw 1; }, 1); + }); }; -/* harmony default export */ var cache_browser_esm = (cache_browser_esm_createCache); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/inheritsLoose.js -var helpers_inheritsLoose = __webpack_require__(130); +/***/ }), +/* 123 */ +/***/ (function(module, exports, __webpack_require__) { -// EXTERNAL MODULE: ./node_modules/@emotion/utils/dist/utils.browser.esm.js -var utils_browser_esm = __webpack_require__(38); +"use strict"; -// EXTERNAL MODULE: ./node_modules/@emotion/serialize/dist/serialize.browser.esm.js + 2 modules -var serialize_browser_esm = __webpack_require__(37); +var toIndexedObject = __webpack_require__(21); +var addToUnscopables = __webpack_require__(118); +var Iterators = __webpack_require__(110); +var InternalStateModule = __webpack_require__(45); +var defineIterator = __webpack_require__(167); + +var ARRAY_ITERATOR = 'Array Iterator'; +var setInternalState = InternalStateModule.set; +var getInternalState = InternalStateModule.getterFor(ARRAY_ITERATOR); + +// `Array.prototype.entries` method +// https://tc39.es/ecma262/#sec-array.prototype.entries +// `Array.prototype.keys` method +// https://tc39.es/ecma262/#sec-array.prototype.keys +// `Array.prototype.values` method +// https://tc39.es/ecma262/#sec-array.prototype.values +// `Array.prototype[@@iterator]` method +// https://tc39.es/ecma262/#sec-array.prototype-@@iterator +// `CreateArrayIterator` internal method +// https://tc39.es/ecma262/#sec-createarrayiterator +module.exports = defineIterator(Array, 'Array', function (iterated, kind) { + setInternalState(this, { + type: ARRAY_ITERATOR, + target: toIndexedObject(iterated), // target + index: 0, // next index + kind: kind // kind + }); +// `%ArrayIteratorPrototype%.next` method +// https://tc39.es/ecma262/#sec-%arrayiteratorprototype%.next +}, function () { + var state = getInternalState(this); + var target = state.target; + var kind = state.kind; + var index = state.index++; + if (!target || index >= target.length) { + state.target = undefined; + return { value: undefined, done: true }; + } + if (kind == 'keys') return { value: index, done: false }; + if (kind == 'values') return { value: target[index], done: false }; + return { value: [index, target[index]], done: false }; +}, 'values'); -// CONCATENATED MODULE: ./node_modules/@emotion/core/dist/emotion-element-57a3a7a3.browser.esm.js +// argumentsList[@@iterator] is %ArrayProto_values% +// https://tc39.es/ecma262/#sec-createunmappedargumentsobject +// https://tc39.es/ecma262/#sec-createmappedargumentsobject +Iterators.Arguments = Iterators.Array; +// https://tc39.es/ecma262/#sec-array.prototype-@@unscopables +addToUnscopables('keys'); +addToUnscopables('values'); +addToUnscopables('entries'); +/***/ }), +/* 124 */ +/***/ (function(module, exports) { +function _arrayLikeToArray(arr, len) { + if (len == null || len > arr.length) len = arr.length; + for (var i = 0, arr2 = new Array(len); i < len; i++) { + arr2[i] = arr[i]; + } -var emotion_element_57a3a7a3_browser_esm_hasOwnProperty = Object.prototype.hasOwnProperty; + return arr2; +} -var EmotionCacheContext = /*#__PURE__*/Object(external_React_["createContext"])( // we're doing this to avoid preconstruct's dead code elimination in this one case -// because this module is primarily intended for the browser and node -// but it's also required in react native and similar environments sometimes -// and we could have a special build just for that -// but this is much easier and the native packages -// might use a different theme context in the future anyway -typeof HTMLElement !== 'undefined' ? cache_browser_esm() : null); -var ThemeContext = /*#__PURE__*/Object(external_React_["createContext"])({}); -var CacheProvider = EmotionCacheContext.Provider; +module.exports = _arrayLikeToArray; -var emotion_element_57a3a7a3_browser_esm_withEmotionCache = function withEmotionCache(func) { - var render = function render(props, ref) { - return /*#__PURE__*/Object(external_React_["createElement"])(EmotionCacheContext.Consumer, null, function (cache) { - return func(props, cache, ref); - }); - }; // $FlowFixMe +/***/ }), +/* 125 */ +/***/ (function(module, exports, __webpack_require__) { +var toInteger = __webpack_require__(42); +var requireObjectCoercible = __webpack_require__(32); + +// `String.prototype.{ codePointAt, at }` methods implementation +var createMethod = function (CONVERT_TO_STRING) { + return function ($this, pos) { + var S = String(requireObjectCoercible($this)); + var position = toInteger(pos); + var size = S.length; + var first, second; + if (position < 0 || position >= size) return CONVERT_TO_STRING ? '' : undefined; + first = S.charCodeAt(position); + return first < 0xD800 || first > 0xDBFF || position + 1 === size + || (second = S.charCodeAt(position + 1)) < 0xDC00 || second > 0xDFFF + ? CONVERT_TO_STRING ? S.charAt(position) : first + : CONVERT_TO_STRING ? S.slice(position, position + 2) : (first - 0xD800 << 10) + (second - 0xDC00) + 0x10000; + }; +}; - return /*#__PURE__*/Object(external_React_["forwardRef"])(render); +module.exports = { + // `String.prototype.codePointAt` method + // https://tc39.es/ecma262/#sec-string.prototype.codepointat + codeAt: createMethod(false), + // `String.prototype.at` method + // https://github.com/mathiasbynens/String.prototype.at + charAt: createMethod(true) }; -// thus we only need to replace what is a valid character for JS, but not for CSS -var sanitizeIdentifier = function sanitizeIdentifier(identifier) { - return identifier.replace(/\$/g, '-'); -}; +/***/ }), +/* 126 */ +/***/ (function(module, exports) { -var typePropName = '__EMOTION_TYPE_PLEASE_DO_NOT_USE__'; -var labelPropName = '__EMOTION_LABEL_PLEASE_DO_NOT_USE__'; -var createEmotionProps = function createEmotionProps(type, props) { - if (false) {} +(function() { module.exports = window["wp"]["keycodes"]; }()); - var newProps = {}; +/***/ }), +/* 127 */ +/***/ (function(module, exports, __webpack_require__) { - for (var key in props) { - if (emotion_element_57a3a7a3_browser_esm_hasOwnProperty.call(props, key)) { - newProps[key] = props[key]; - } - } +"use strict"; - newProps[typePropName] = type; // TODO: check if this still works with all of those different JSX functions +var fixRegExpWellKnownSymbolLogic = __webpack_require__(111); +var anObject = __webpack_require__(9); +var toLength = __webpack_require__(34); +var toInteger = __webpack_require__(42); +var requireObjectCoercible = __webpack_require__(32); +var advanceStringIndex = __webpack_require__(121); +var getSubstitution = __webpack_require__(161); +var regExpExec = __webpack_require__(112); - if (false) { var match, error; } +var max = Math.max; +var min = Math.min; - return newProps; +var maybeToString = function (it) { + return it === undefined ? it : String(it); }; -var emotion_element_57a3a7a3_browser_esm_render = function render(cache, props, theme, ref) { - var cssProp = theme === null ? props.css : props.css(theme); // so that using `css` from `emotion` and passing the result to the css prop works - // not passing the registered cache to serializeStyles because it would - // make certain babel optimisations not possible - - if (typeof cssProp === 'string' && cache.registered[cssProp] !== undefined) { - cssProp = cache.registered[cssProp]; - } +// @@replace logic +fixRegExpWellKnownSymbolLogic('replace', 2, function (REPLACE, nativeReplace, maybeCallNative, reason) { + var REGEXP_REPLACE_SUBSTITUTES_UNDEFINED_CAPTURE = reason.REGEXP_REPLACE_SUBSTITUTES_UNDEFINED_CAPTURE; + var REPLACE_KEEPS_$0 = reason.REPLACE_KEEPS_$0; + var UNSAFE_SUBSTITUTE = REGEXP_REPLACE_SUBSTITUTES_UNDEFINED_CAPTURE ? '$' : '$0'; + + return [ + // `String.prototype.replace` method + // https://tc39.es/ecma262/#sec-string.prototype.replace + function replace(searchValue, replaceValue) { + var O = requireObjectCoercible(this); + var replacer = searchValue == undefined ? undefined : searchValue[REPLACE]; + return replacer !== undefined + ? replacer.call(searchValue, O, replaceValue) + : nativeReplace.call(String(O), searchValue, replaceValue); + }, + // `RegExp.prototype[@@replace]` method + // https://tc39.es/ecma262/#sec-regexp.prototype-@@replace + function (regexp, replaceValue) { + if ( + (!REGEXP_REPLACE_SUBSTITUTES_UNDEFINED_CAPTURE && REPLACE_KEEPS_$0) || + (typeof replaceValue === 'string' && replaceValue.indexOf(UNSAFE_SUBSTITUTE) === -1) + ) { + var res = maybeCallNative(nativeReplace, regexp, this, replaceValue); + if (res.done) return res.value; + } - var type = props[typePropName]; - var registeredStyles = [cssProp]; - var className = ''; + var rx = anObject(regexp); + var S = String(this); - if (typeof props.className === 'string') { - className = Object(utils_browser_esm["a" /* getRegisteredStyles */])(cache.registered, registeredStyles, props.className); - } else if (props.className != null) { - className = props.className + " "; - } + var functionalReplace = typeof replaceValue === 'function'; + if (!functionalReplace) replaceValue = String(replaceValue); - var serialized = Object(serialize_browser_esm["a" /* serializeStyles */])(registeredStyles); + var global = rx.global; + if (global) { + var fullUnicode = rx.unicode; + rx.lastIndex = 0; + } + var results = []; + while (true) { + var result = regExpExec(rx, S); + if (result === null) break; - if (false) { var labelFromStack; } + results.push(result); + if (!global) break; - var rules = Object(utils_browser_esm["b" /* insertStyles */])(cache, serialized, typeof type === 'string'); - className += cache.key + "-" + serialized.name; - var newProps = {}; + var matchStr = String(result[0]); + if (matchStr === '') rx.lastIndex = advanceStringIndex(S, toLength(rx.lastIndex), fullUnicode); + } - for (var key in props) { - if (emotion_element_57a3a7a3_browser_esm_hasOwnProperty.call(props, key) && key !== 'css' && key !== typePropName && ( true || false)) { - newProps[key] = props[key]; + var accumulatedResult = ''; + var nextSourcePosition = 0; + for (var i = 0; i < results.length; i++) { + result = results[i]; + + var matched = String(result[0]); + var position = max(min(toInteger(result.index), S.length), 0); + var captures = []; + // NOTE: This is equivalent to + // captures = result.slice(1).map(maybeToString) + // but for some reason `nativeSlice.call(result, 1, result.length)` (called in + // the slice polyfill when slicing native arrays) "doesn't work" in safari 9 and + // causes a crash (https://pastebin.com/N21QzeQA) when trying to debug it. + for (var j = 1; j < result.length; j++) captures.push(maybeToString(result[j])); + var namedCaptures = result.groups; + if (functionalReplace) { + var replacerArgs = [matched].concat(captures, position, S); + if (namedCaptures !== undefined) replacerArgs.push(namedCaptures); + var replacement = String(replaceValue.apply(undefined, replacerArgs)); + } else { + replacement = getSubstitution(matched, S, position, captures, namedCaptures, replaceValue); + } + if (position >= nextSourcePosition) { + accumulatedResult += S.slice(nextSourcePosition, position) + replacement; + nextSourcePosition = position + matched.length; + } + } + return accumulatedResult + S.slice(nextSourcePosition); } - } - - newProps.ref = ref; - newProps.className = className; - var ele = /*#__PURE__*/Object(external_React_["createElement"])(type, newProps); + ]; +}); - return ele; -}; // eslint-disable-next-line no-undef +/***/ }), +/* 128 */ +/***/ (function(module, exports) { -var Emotion = /* #__PURE__ */emotion_element_57a3a7a3_browser_esm_withEmotionCache(function (props, cache, ref) { - if (typeof props.css === 'function') { - return /*#__PURE__*/Object(external_React_["createElement"])(ThemeContext.Consumer, null, function (theme) { - return emotion_element_57a3a7a3_browser_esm_render(cache, props, theme, ref); - }); - } +// iterable DOM collections +// flag - `iterable` interface - 'entries', 'keys', 'values', 'forEach' methods +module.exports = { + CSSRuleList: 0, + CSSStyleDeclaration: 0, + CSSValueList: 0, + ClientRectList: 0, + DOMRectList: 0, + DOMStringList: 0, + DOMTokenList: 1, + DataTransferItemList: 0, + FileList: 0, + HTMLAllCollection: 0, + HTMLCollection: 0, + HTMLFormElement: 0, + HTMLSelectElement: 0, + MediaList: 0, + MimeTypeArray: 0, + NamedNodeMap: 0, + NodeList: 1, + PaintRequestList: 0, + Plugin: 0, + PluginArray: 0, + SVGLengthList: 0, + SVGNumberList: 0, + SVGPathSegList: 0, + SVGPointList: 0, + SVGStringList: 0, + SVGTransformList: 0, + SourceBufferList: 0, + StyleSheetList: 0, + TextTrackCueList: 0, + TextTrackList: 0, + TouchList: 0 +}; - return emotion_element_57a3a7a3_browser_esm_render(cache, props, null, ref); -}); -if (false) {} +/***/ }), +/* 129 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { +"use strict"; +// EXPORTS +__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ _inheritsLoose; }); -// CONCATENATED MODULE: ./node_modules/@emotion/css/dist/css.browser.esm.js - - -function css_browser_esm_css() { - for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { - args[_key] = arguments[_key]; - } +// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/setPrototypeOf.js +function _setPrototypeOf(o, p) { + _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { + o.__proto__ = p; + return o; + }; - return Object(serialize_browser_esm["a" /* serializeStyles */])(args); + return _setPrototypeOf(o, p); } +// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/inheritsLoose.js -/* harmony default export */ var css_browser_esm = (css_browser_esm_css); - -// CONCATENATED MODULE: ./node_modules/@emotion/core/dist/core.browser.esm.js +function _inheritsLoose(subClass, superClass) { + subClass.prototype = Object.create(superClass.prototype); + subClass.prototype.constructor = subClass; + _setPrototypeOf(subClass, superClass); +} +/***/ }), +/* 130 */ +/***/ (function(module, exports, __webpack_require__) { +var DESCRIPTORS = __webpack_require__(13); +var defineProperty = __webpack_require__(17).f; +var FunctionPrototype = Function.prototype; +var FunctionPrototypeToString = FunctionPrototype.toString; +var nameRE = /^\s*function ([^ (]*)/; +var NAME = 'name'; +// Function instances `.name` property +// https://tc39.es/ecma262/#sec-function-instances-name +if (DESCRIPTORS && !(NAME in FunctionPrototype)) { + defineProperty(FunctionPrototype, NAME, { + configurable: true, + get: function () { + try { + return FunctionPrototypeToString.call(this).match(nameRE)[1]; + } catch (error) { + return ''; + } + } + }); +} +/***/ }), +/* 131 */ +/***/ (function(module, exports, __webpack_require__) { +"use strict"; +var TO_STRING_TAG_SUPPORT = __webpack_require__(82); +var classof = __webpack_require__(113); +// `Object.prototype.toString` method implementation +// https://tc39.es/ecma262/#sec-object.prototype.tostring +module.exports = TO_STRING_TAG_SUPPORT ? {}.toString : function toString() { + return '[object ' + classof(this) + ']'; +}; -var core_browser_esm_jsx = function jsx(type, props) { - var args = arguments; +/***/ }), +/* 132 */ +/***/ (function(module, exports, __webpack_require__) { - if (props == null || !emotion_element_57a3a7a3_browser_esm_hasOwnProperty.call(props, 'css')) { - // $FlowFixMe - return external_React_["createElement"].apply(undefined, args); - } +var arrayLikeToArray = __webpack_require__(124); - var argsLength = args.length; - var createElementArgArray = new Array(argsLength); - createElementArgArray[0] = Emotion; - createElementArgArray[1] = createEmotionProps(type, props); +function _unsupportedIterableToArray(o, minLen) { + if (!o) return; + if (typeof o === "string") return arrayLikeToArray(o, minLen); + var n = Object.prototype.toString.call(o).slice(8, -1); + if (n === "Object" && o.constructor) n = o.constructor.name; + if (n === "Map" || n === "Set") return Array.from(o); + if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return arrayLikeToArray(o, minLen); +} - for (var i = 2; i < argsLength; i++) { - createElementArgArray[i] = args[i]; - } // $FlowFixMe +module.exports = _unsupportedIterableToArray; +/***/ }), +/* 133 */ +/***/ (function(module, exports) { - return external_React_["createElement"].apply(null, createElementArgArray); -}; +(function() { module.exports = window["wp"]["htmlEntities"]; }()); -var warnedAboutCssPropForGlobal = false; -var Global = /* #__PURE__ */emotion_element_57a3a7a3_browser_esm_withEmotionCache(function (props, cache) { - if (false) {} +/***/ }), +/* 134 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { - var styles = props.styles; +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _objectWithoutPropertiesLoose; }); +function _objectWithoutPropertiesLoose(source, excluded) { + if (source == null) return {}; + var target = {}; + var sourceKeys = Object.keys(source); + var key, i; - if (typeof styles === 'function') { - return /*#__PURE__*/Object(external_React_["createElement"])(ThemeContext.Consumer, null, function (theme) { - var serialized = Object(serialize_browser_esm["a" /* serializeStyles */])([styles(theme)]); - return /*#__PURE__*/Object(external_React_["createElement"])(core_browser_esm_InnerGlobal, { - serialized: serialized, - cache: cache - }); - }); + for (i = 0; i < sourceKeys.length; i++) { + key = sourceKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + target[key] = source[key]; } - var serialized = Object(serialize_browser_esm["a" /* serializeStyles */])([styles]); - return /*#__PURE__*/Object(external_React_["createElement"])(core_browser_esm_InnerGlobal, { - serialized: serialized, - cache: cache - }); -}); + return target; +} -// maintain place over rerenders. -// initial render from browser, insertBefore context.sheet.tags[0] or if a style hasn't been inserted there yet, appendChild -// initial client-side render from SSR, use place of hydrating tag -var core_browser_esm_InnerGlobal = /*#__PURE__*/function (_React$Component) { - Object(inheritsLoose["a" /* default */])(InnerGlobal, _React$Component); +/***/ }), +/* 135 */ +/***/ (function(module, exports) { - function InnerGlobal(props, context, updater) { - return _React$Component.call(this, props, context, updater) || this; +function asyncGeneratorStep(gen, resolve, reject, _next, _throw, key, arg) { + try { + var info = gen[key](arg); + var value = info.value; + } catch (error) { + reject(error); + return; } - var _proto = InnerGlobal.prototype; - - _proto.componentDidMount = function componentDidMount() { - this.sheet = new StyleSheet({ - key: this.props.cache.key + "-global", - nonce: this.props.cache.sheet.nonce, - container: this.props.cache.sheet.container - }); // $FlowFixMe + if (info.done) { + resolve(value); + } else { + Promise.resolve(value).then(_next, _throw); + } +} - var node = document.querySelector("style[data-emotion-" + this.props.cache.key + "=\"" + this.props.serialized.name + "\"]"); +function _asyncToGenerator(fn) { + return function () { + var self = this, + args = arguments; + return new Promise(function (resolve, reject) { + var gen = fn.apply(self, args); - if (node !== null) { - this.sheet.tags.push(node); - } + function _next(value) { + asyncGeneratorStep(gen, resolve, reject, _next, _throw, "next", value); + } - if (this.props.cache.sheet.tags.length) { - this.sheet.before = this.props.cache.sheet.tags[0]; - } + function _throw(err) { + asyncGeneratorStep(gen, resolve, reject, _next, _throw, "throw", err); + } - this.insertStyles(); + _next(undefined); + }); }; +} - _proto.componentDidUpdate = function componentDidUpdate(prevProps) { - if (prevProps.serialized.name !== this.props.serialized.name) { - this.insertStyles(); - } - }; +module.exports = _asyncToGenerator; - _proto.insertStyles = function insertStyles$1() { - if (this.props.serialized.next !== undefined) { - // insert keyframes - Object(utils_browser_esm["b" /* insertStyles */])(this.props.cache, this.props.serialized.next, true); - } +/***/ }), +/* 136 */ +/***/ (function(module, exports) { - if (this.sheet.tags.length) { - // if this doesn't exist then it will be null so the style element will be appended - var element = this.sheet.tags[this.sheet.tags.length - 1].nextElementSibling; - this.sheet.before = element; - this.sheet.flush(); - } +module.exports = function (it, Constructor, name) { + if (!(it instanceof Constructor)) { + throw TypeError('Incorrect ' + (name ? name + ' ' : '') + 'invocation'); + } return it; +}; - this.props.cache.insert("", this.props.serialized, this.sheet, false); - }; - _proto.componentWillUnmount = function componentWillUnmount() { - this.sheet.flush(); - }; +/***/ }), +/* 137 */ +/***/ (function(module, exports, __webpack_require__) { - _proto.render = function render() { +"use strict"; - return null; - }; - return InnerGlobal; -}(external_React_["Component"]); +var fails = __webpack_require__(6); -var core_browser_esm_keyframes = function keyframes() { - var insertable = css_browser_esm.apply(void 0, arguments); - var name = "animation-" + insertable.name; // $FlowFixMe +// babel-minify transpiles RegExp('a', 'y') -> /a/y and it causes SyntaxError, +// so we use an intermediate function. +function RE(s, f) { + return RegExp(s, f); +} - return { - name: name, - styles: "@keyframes " + name + "{" + insertable.styles + "}", - anim: 1, - toString: function toString() { - return "_EMO_" + this.name + "_" + this.styles + "_EMO_"; - } - }; -}; +exports.UNSUPPORTED_Y = fails(function () { + // babel-minify transpiles RegExp('a', 'y') -> /a/y and it causes SyntaxError + var re = RE('a', 'y'); + re.lastIndex = 2; + return re.exec('abcd') != null; +}); -var classnames = function classnames(args) { - var len = args.length; - var i = 0; - var cls = ''; +exports.BROKEN_CARET = fails(function () { + // https://bugzilla.mozilla.org/show_bug.cgi?id=773687 + var re = RE('^r', 'gy'); + re.lastIndex = 2; + return re.exec('str') != null; +}); - for (; i < len; i++) { - var arg = args[i]; - if (arg == null) continue; - var toAdd = void 0; - switch (typeof arg) { - case 'boolean': - break; +/***/ }), +/* 138 */, +/* 139 */ +/***/ (function(module, exports, __webpack_require__) { - case 'object': - { - if (Array.isArray(arg)) { - toAdd = classnames(arg); - } else { - toAdd = ''; +"use strict"; - for (var k in arg) { - if (arg[k] && k) { - toAdd && (toAdd += ' '); - toAdd += k; - } - } - } +var $ = __webpack_require__(12); +var IndexedObject = __webpack_require__(71); +var toIndexedObject = __webpack_require__(21); +var arrayMethodIsStrict = __webpack_require__(122); - break; - } +var nativeJoin = [].join; - default: - { - toAdd = arg; - } - } +var ES3_STRINGS = IndexedObject != Object; +var STRICT_METHOD = arrayMethodIsStrict('join', ','); - if (toAdd) { - cls && (cls += ' '); - cls += toAdd; - } +// `Array.prototype.join` method +// https://tc39.es/ecma262/#sec-array.prototype.join +$({ target: 'Array', proto: true, forced: ES3_STRINGS || !STRICT_METHOD }, { + join: function join(separator) { + return nativeJoin.call(toIndexedObject(this), separator === undefined ? ',' : separator); } +}); - return cls; -}; -function merge(registered, css, className) { - var registeredStyles = []; - var rawClassName = Object(utils_browser_esm["a" /* getRegisteredStyles */])(registered, registeredStyles, className); +/***/ }), +/* 140 */ +/***/ (function(module, exports, __webpack_require__) { - if (registeredStyles.length < 2) { - return className; - } +"use strict"; - return rawClassName + css(registeredStyles); -} +var $ = __webpack_require__(12); +var notARegExp = __webpack_require__(207); +var requireObjectCoercible = __webpack_require__(32); +var correctIsRegExpLogic = __webpack_require__(208); -var ClassNames = emotion_element_57a3a7a3_browser_esm_withEmotionCache(function (props, context) { - return /*#__PURE__*/Object(external_React_["createElement"])(ThemeContext.Consumer, null, function (theme) { - var hasRendered = false; +// `String.prototype.includes` method +// https://tc39.es/ecma262/#sec-string.prototype.includes +$({ target: 'String', proto: true, forced: !correctIsRegExpLogic('includes') }, { + includes: function includes(searchString /* , position = 0 */) { + return !!~String(requireObjectCoercible(this)) + .indexOf(notARegExp(searchString), arguments.length > 1 ? arguments[1] : undefined); + } +}); - var css = function css() { - if (hasRendered && "production" !== 'production') { - throw new Error('css can only be used during render'); - } - for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { - args[_key] = arguments[_key]; - } +/***/ }), +/* 141 */ +/***/ (function(module, exports) { - var serialized = Object(serialize_browser_esm["a" /* serializeStyles */])(args, context.registered); +(function() { module.exports = window["wp"]["hooks"]; }()); - { - Object(utils_browser_esm["b" /* insertStyles */])(context, serialized, false); - } +/***/ }), +/* 142 */ +/***/ (function(module, exports, __webpack_require__) { - return context.key + "-" + serialized.name; - }; +"use strict"; - var cx = function cx() { - if (hasRendered && "production" !== 'production') { - throw new Error('cx can only be used during render'); - } +var redefine = __webpack_require__(27); +var anObject = __webpack_require__(9); +var fails = __webpack_require__(6); +var flags = __webpack_require__(114); - for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) { - args[_key2] = arguments[_key2]; - } +var TO_STRING = 'toString'; +var RegExpPrototype = RegExp.prototype; +var nativeToString = RegExpPrototype[TO_STRING]; - return merge(context.registered, css, classnames(args)); - }; +var NOT_GENERIC = fails(function () { return nativeToString.call({ source: 'a', flags: 'b' }) != '/a/b'; }); +// FF44- RegExp#toString has a wrong name +var INCORRECT_NAME = nativeToString.name != TO_STRING; - var content = { - css: css, - cx: cx, - theme: theme - }; - var ele = props.children(content); - hasRendered = true; +// `RegExp.prototype.toString` method +// https://tc39.es/ecma262/#sec-regexp.prototype.tostring +if (NOT_GENERIC || INCORRECT_NAME) { + redefine(RegExp.prototype, TO_STRING, function toString() { + var R = anObject(this); + var p = String(R.source); + var rf = R.flags; + var f = String(rf === undefined && R instanceof RegExp && !('flags' in RegExpPrototype) ? flags.call(R) : rf); + return '/' + p + '/' + f; + }, { unsafe: true }); +} - return ele; - }); -}); +/***/ }), +/* 143 */ +/***/ (function(module, exports, __webpack_require__) { +/* eslint-disable no-proto -- safe */ +var anObject = __webpack_require__(9); +var aPossiblePrototype = __webpack_require__(160); + +// `Object.setPrototypeOf` method +// https://tc39.es/ecma262/#sec-object.setprototypeof +// Works with __proto__ only. Old v8 can't work with null proto objects. +module.exports = Object.setPrototypeOf || ('__proto__' in {} ? function () { + var CORRECT_SETTER = false; + var test = {}; + var setter; + try { + setter = Object.getOwnPropertyDescriptor(Object.prototype, '__proto__').set; + setter.call(test, []); + CORRECT_SETTER = test instanceof Array; + } catch (error) { /* empty */ } + return function setPrototypeOf(O, proto) { + anObject(O); + aPossiblePrototype(proto); + if (CORRECT_SETTER) setter.call(O, proto); + else O.__proto__ = proto; + return O; + }; +}() : undefined); /***/ }), -/* 49 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _arrayLikeToArray; }); -function _arrayLikeToArray(arr, len) { - if (len == null || len > arr.length) len = arr.length; +/* 144 */ +/***/ (function(module, exports, __webpack_require__) { - for (var i = 0, arr2 = new Array(len); i < len; i++) { - arr2[i] = arr[i]; - } +var isObject = __webpack_require__(10); +var classof = __webpack_require__(30); +var wellKnownSymbol = __webpack_require__(8); - return arr2; -} +var MATCH = wellKnownSymbol('match'); -/***/ }), -/* 50 */ -/***/ (function(module, exports) { +// `IsRegExp` abstract operation +// https://tc39.es/ecma262/#sec-isregexp +module.exports = function (it) { + var isRegExp; + return isObject(it) && ((isRegExp = it[MATCH]) !== undefined ? !!isRegExp : classof(it) == 'RegExp'); +}; -(function() { module.exports = this["wc"]["tracks"]; }()); /***/ }), -/* 51 */ +/* 145 */ /***/ (function(module, exports) { -(function() { module.exports = this["wp"]["hooks"]; }()); +(function() { module.exports = window["wc"]["components"]; }()); /***/ }), -/* 52 */ -/***/ (function(module, exports) { - -function _typeof(obj) { - "@babel/helpers - typeof"; +/* 146 */ +/***/ (function(module, exports, __webpack_require__) { - if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { - module.exports = _typeof = function _typeof(obj) { - return typeof obj; - }; - } else { - module.exports = _typeof = function _typeof(obj) { - return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; - }; +var global = __webpack_require__(3); +var DOMIterables = __webpack_require__(128); +var ArrayIteratorMethods = __webpack_require__(123); +var createNonEnumerableProperty = __webpack_require__(19); +var wellKnownSymbol = __webpack_require__(8); + +var ITERATOR = wellKnownSymbol('iterator'); +var TO_STRING_TAG = wellKnownSymbol('toStringTag'); +var ArrayValues = ArrayIteratorMethods.values; + +for (var COLLECTION_NAME in DOMIterables) { + var Collection = global[COLLECTION_NAME]; + var CollectionPrototype = Collection && Collection.prototype; + if (CollectionPrototype) { + // some Chrome versions have non-configurable methods on DOMTokenList + if (CollectionPrototype[ITERATOR] !== ArrayValues) try { + createNonEnumerableProperty(CollectionPrototype, ITERATOR, ArrayValues); + } catch (error) { + CollectionPrototype[ITERATOR] = ArrayValues; + } + if (!CollectionPrototype[TO_STRING_TAG]) { + createNonEnumerableProperty(CollectionPrototype, TO_STRING_TAG, COLLECTION_NAME); + } + if (DOMIterables[COLLECTION_NAME]) for (var METHOD_NAME in ArrayIteratorMethods) { + // some Chrome versions have non-configurable methods on DOMTokenList + if (CollectionPrototype[METHOD_NAME] !== ArrayIteratorMethods[METHOD_NAME]) try { + createNonEnumerableProperty(CollectionPrototype, METHOD_NAME, ArrayIteratorMethods[METHOD_NAME]); + } catch (error) { + CollectionPrototype[METHOD_NAME] = ArrayIteratorMethods[METHOD_NAME]; + } + } } - - return _typeof(obj); } -module.exports = _typeof; /***/ }), -/* 53 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 147 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _inheritsLoose; }); -function _inheritsLoose(subClass, superClass) { - subClass.prototype = Object.create(superClass.prototype); - subClass.prototype.constructor = subClass; - subClass.__proto__ = superClass; -} +var toIndexedObject = __webpack_require__(21); +var nativeGetOwnPropertyNames = __webpack_require__(56).f; -/***/ }), -/* 54 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +var toString = {}.toString; -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _objectWithoutPropertiesLoose; }); -function _objectWithoutPropertiesLoose(source, excluded) { - if (source == null) return {}; - var target = {}; - var sourceKeys = Object.keys(source); - var key, i; +var windowNames = typeof window == 'object' && window && Object.getOwnPropertyNames + ? Object.getOwnPropertyNames(window) : []; - for (i = 0; i < sourceKeys.length; i++) { - key = sourceKeys[i]; - if (excluded.indexOf(key) >= 0) continue; - target[key] = source[key]; +var getWindowNames = function (it) { + try { + return nativeGetOwnPropertyNames(it); + } catch (error) { + return windowNames.slice(); } +}; - return target; -} +// fallback for IE11 buggy Object.getOwnPropertyNames with iframe and window +module.exports.f = function getOwnPropertyNames(it) { + return windowNames && toString.call(it) == '[object Window]' + ? getWindowNames(it) + : nativeGetOwnPropertyNames(toIndexedObject(it)); +}; -/***/ }), -/* 55 */, -/* 56 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { -"use strict"; +/***/ }), +/* 148 */ +/***/ (function(module, exports, __webpack_require__) { -// EXPORTS -__webpack_require__.d(__webpack_exports__, "c", function() { return /* binding */ context_useSlot; }); -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ Consumer; }); +var path = __webpack_require__(81); +var has = __webpack_require__(11); +var wrappedWellKnownSymbolModule = __webpack_require__(119); +var defineProperty = __webpack_require__(17).f; -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/slicedToArray.js + 3 modules -var slicedToArray = __webpack_require__(24); +module.exports = function (NAME) { + var Symbol = path.Symbol || (path.Symbol = {}); + if (!has(Symbol, NAME)) defineProperty(Symbol, NAME, { + value: wrappedWellKnownSymbolModule.f(NAME) + }); +}; -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/toConsumableArray.js + 3 modules -var toConsumableArray = __webpack_require__(26); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/classCallCheck.js -var classCallCheck = __webpack_require__(16); +/***/ }), +/* 149 */ +/***/ (function(module, exports, __webpack_require__) { -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/createClass.js -var createClass = __webpack_require__(17); +"use strict"; -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js -var assertThisInitialized = __webpack_require__(12); +var $forEach = __webpack_require__(75).forEach; +var arrayMethodIsStrict = __webpack_require__(122); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/inherits.js + 1 modules -var inherits = __webpack_require__(18); +var STRICT_METHOD = arrayMethodIsStrict('forEach'); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js -var possibleConstructorReturn = __webpack_require__(21); +// `Array.prototype.forEach` method implementation +// https://tc39.es/ecma262/#sec-array.prototype.foreach +module.exports = !STRICT_METHOD ? function forEach(callbackfn /* , thisArg */) { + return $forEach(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined); +} : [].forEach; -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js -var getPrototypeOf = __webpack_require__(9); -// EXTERNAL MODULE: external {"this":["wp","element"]} -var external_this_wp_element_ = __webpack_require__(0); - -// EXTERNAL MODULE: external "lodash" -var external_lodash_ = __webpack_require__(2); +/***/ }), +/* 150 */ +/***/ (function(module, exports, __webpack_require__) { -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/typeof.js -var esm_typeof = __webpack_require__(41); +var anObject = __webpack_require__(9); +var aFunction = __webpack_require__(70); +var wellKnownSymbol = __webpack_require__(8); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js -var objectWithoutProperties = __webpack_require__(11); +var SPECIES = wellKnownSymbol('species'); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/defineProperty.js -var defineProperty = __webpack_require__(6); +// `SpeciesConstructor` abstract operation +// https://tc39.es/ecma262/#sec-speciesconstructor +module.exports = function (O, defaultConstructor) { + var C = anObject(O).constructor; + var S; + return C === undefined || (S = anObject(C)[SPECIES]) == undefined ? defaultConstructor : aFunction(S); +}; -// EXTERNAL MODULE: ./node_modules/@wordpress/is-shallow-equal/lib/index.js -var lib = __webpack_require__(66); -var lib_default = /*#__PURE__*/__webpack_require__.n(lib); -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/bubbles-virtually/slot-fill-context.js -var slot_fill_context = __webpack_require__(61); +/***/ }), +/* 151 */ +/***/ (function(module, exports, __webpack_require__) { -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/bubbles-virtually/slot-fill-provider.js +"use strict"; +var charAt = __webpack_require__(125).charAt; +var InternalStateModule = __webpack_require__(45); +var defineIterator = __webpack_require__(167); + +var STRING_ITERATOR = 'String Iterator'; +var setInternalState = InternalStateModule.set; +var getInternalState = InternalStateModule.getterFor(STRING_ITERATOR); + +// `String.prototype[@@iterator]` method +// https://tc39.es/ecma262/#sec-string.prototype-@@iterator +defineIterator(String, 'String', function (iterated) { + setInternalState(this, { + type: STRING_ITERATOR, + string: String(iterated), + index: 0 + }); +// `%StringIteratorPrototype%.next` method +// https://tc39.es/ecma262/#sec-%stringiteratorprototype%.next +}, function next() { + var state = getInternalState(this); + var string = state.string; + var index = state.index; + var point; + if (index >= string.length) return { value: undefined, done: true }; + point = charAt(string, index); + state.index += point.length; + return { value: point, done: false }; +}); +/***/ }), +/* 152 */ +/***/ (function(module, exports, __webpack_require__) { +var redefine = __webpack_require__(27); +module.exports = function (target, src, options) { + for (var key in src) redefine(target, key, src[key], options); + return target; +}; -function _toPropertyKey(arg) { var key = _toPrimitive(arg, "string"); return Object(esm_typeof["a" /* default */])(key) === "symbol" ? key : String(key); } +/***/ }), +/* 153 */ +/***/ (function(module, exports, __webpack_require__) { -function _toPrimitive(input, hint) { if (Object(esm_typeof["a" /* default */])(input) !== "object" || input === null) return input; var prim = input[Symbol.toPrimitive]; if (prim !== undefined) { var res = prim.call(input, hint || "default"); if (Object(esm_typeof["a" /* default */])(res) !== "object") return res; throw new TypeError("@@toPrimitive must return a primitive value."); } return (hint === "string" ? String : Number)(input); } +"use strict"; -function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; } +var getBuiltIn = __webpack_require__(31); +var definePropertyModule = __webpack_require__(17); +var wellKnownSymbol = __webpack_require__(8); +var DESCRIPTORS = __webpack_require__(13); -function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(defineProperty["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } +var SPECIES = wellKnownSymbol('species'); -/** - * WordPress dependencies - */ +module.exports = function (CONSTRUCTOR_NAME) { + var Constructor = getBuiltIn(CONSTRUCTOR_NAME); + var defineProperty = definePropertyModule.f; + if (DESCRIPTORS && Constructor && !Constructor[SPECIES]) { + defineProperty(Constructor, SPECIES, { + configurable: true, + get: function () { return this; } + }); + } +}; -/** - * Internal dependencies - */ +/***/ }), +/* 154 */ +/***/ (function(module, exports, __webpack_require__) { +var anObject = __webpack_require__(9); +var isArrayIteratorMethod = __webpack_require__(171); +var toLength = __webpack_require__(34); +var bind = __webpack_require__(94); +var getIteratorMethod = __webpack_require__(155); +var iteratorClose = __webpack_require__(172); -function useSlotRegistry() { - var _useState = Object(external_this_wp_element_["useState"])({}), - _useState2 = Object(slicedToArray["a" /* default */])(_useState, 2), - slots = _useState2[0], - setSlots = _useState2[1]; +var Result = function (stopped, result) { + this.stopped = stopped; + this.result = result; +}; - var _useState3 = Object(external_this_wp_element_["useState"])({}), - _useState4 = Object(slicedToArray["a" /* default */])(_useState3, 2), - fills = _useState4[0], - setFills = _useState4[1]; +module.exports = function (iterable, unboundFunction, options) { + var that = options && options.that; + var AS_ENTRIES = !!(options && options.AS_ENTRIES); + var IS_ITERATOR = !!(options && options.IS_ITERATOR); + var INTERRUPTED = !!(options && options.INTERRUPTED); + var fn = bind(unboundFunction, that, 1 + AS_ENTRIES + INTERRUPTED); + var iterator, iterFn, index, length, result, next, step; + + var stop = function (condition) { + if (iterator) iteratorClose(iterator); + return new Result(true, condition); + }; - var registerSlot = Object(external_this_wp_element_["useCallback"])(function (name, ref, fillProps) { - setSlots(function (prevSlots) { - var slot = prevSlots[name] || {}; - return _objectSpread(_objectSpread({}, prevSlots), {}, Object(defineProperty["a" /* default */])({}, name, _objectSpread(_objectSpread({}, slot), {}, { - ref: ref || slot.ref, - fillProps: fillProps || slot.fillProps || {} - }))); - }); - }, []); - var unregisterSlot = Object(external_this_wp_element_["useCallback"])(function (name, ref) { - setSlots(function (prevSlots) { - var slot = prevSlots[name], - nextSlots = Object(objectWithoutProperties["a" /* default */])(prevSlots, [name].map(_toPropertyKey)); // Make sure we're not unregistering a slot registered by another element - // See https://github.com/WordPress/gutenberg/pull/19242#issuecomment-590295412 + var callFn = function (value) { + if (AS_ENTRIES) { + anObject(value); + return INTERRUPTED ? fn(value[0], value[1], stop) : fn(value[0], value[1]); + } return INTERRUPTED ? fn(value, stop) : fn(value); + }; + if (IS_ITERATOR) { + iterator = iterable; + } else { + iterFn = getIteratorMethod(iterable); + if (typeof iterFn != 'function') throw TypeError('Target is not iterable'); + // optimisation for array iterators + if (isArrayIteratorMethod(iterFn)) { + for (index = 0, length = toLength(iterable.length); length > index; index++) { + result = callFn(iterable[index]); + if (result && result instanceof Result) return result; + } return new Result(false); + } + iterator = iterFn.call(iterable); + } - if ((slot === null || slot === void 0 ? void 0 : slot.ref) === ref) { - return nextSlots; - } + next = iterator.next; + while (!(step = next.call(iterator)).done) { + try { + result = callFn(step.value); + } catch (error) { + iteratorClose(iterator); + throw error; + } + if (typeof result == 'object' && result && result instanceof Result) return result; + } return new Result(false); +}; - return prevSlots; - }); - }, []); - var updateSlot = Object(external_this_wp_element_["useCallback"])(function (name, fillProps) { - var slot = slots[name]; - if (!slot) { - return; - } +/***/ }), +/* 155 */ +/***/ (function(module, exports, __webpack_require__) { - if (!lib_default()(slot.fillProps, fillProps)) { - slot.fillProps = fillProps; - var slotFills = fills[name]; +var classof = __webpack_require__(113); +var Iterators = __webpack_require__(110); +var wellKnownSymbol = __webpack_require__(8); - if (slotFills) { - // Force update fills - slotFills.map(function (fill) { - return fill.current.rerender(); - }); - } - } - }, [slots, fills]); - var registerFill = Object(external_this_wp_element_["useCallback"])(function (name, ref) { - setFills(function (prevFills) { - return _objectSpread(_objectSpread({}, prevFills), {}, Object(defineProperty["a" /* default */])({}, name, [].concat(Object(toConsumableArray["a" /* default */])(prevFills[name] || []), [ref]))); - }); - }, []); - var unregisterFill = Object(external_this_wp_element_["useCallback"])(function (name, ref) { - setFills(function (prevFills) { - if (prevFills[name]) { - return _objectSpread(_objectSpread({}, prevFills), {}, Object(defineProperty["a" /* default */])({}, name, prevFills[name].filter(function (fillRef) { - return fillRef !== ref; - }))); - } +var ITERATOR = wellKnownSymbol('iterator'); - return prevFills; - }); - }, []); // Memoizing the return value so it can be directly passed to Provider value +module.exports = function (it) { + if (it != undefined) return it[ITERATOR] + || it['@@iterator'] + || Iterators[classof(it)]; +}; - var registry = Object(external_this_wp_element_["useMemo"])(function () { - return { - slots: slots, - fills: fills, - registerSlot: registerSlot, - updateSlot: updateSlot, - unregisterSlot: unregisterSlot, - registerFill: registerFill, - unregisterFill: unregisterFill - }; - }, [slots, fills, registerSlot, updateSlot, unregisterSlot, registerFill, unregisterFill]); - return registry; -} -function slot_fill_provider_SlotFillProvider(_ref) { - var children = _ref.children; - var registry = useSlotRegistry(); - return Object(external_this_wp_element_["createElement"])(slot_fill_context["a" /* default */].Provider, { - value: registry - }, children); -} -//# sourceMappingURL=slot-fill-provider.js.map -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/context.js +/***/ }), +/* 156 */ +/***/ (function(module, exports, __webpack_require__) { +var isObject = __webpack_require__(10); +var setPrototypeOf = __webpack_require__(143); +// makes subclassing work correct for wrapped built-ins +module.exports = function ($this, dummy, Wrapper) { + var NewTarget, NewTargetPrototype; + if ( + // it can work only with native `setPrototypeOf` + setPrototypeOf && + // we haven't completely correct pre-ES6 way for getting `new.target`, so use this + typeof (NewTarget = dummy.constructor) == 'function' && + NewTarget !== Wrapper && + isObject(NewTargetPrototype = NewTarget.prototype) && + NewTargetPrototype !== Wrapper.prototype + ) setPrototypeOf($this, NewTargetPrototype); + return $this; +}; +/***/ }), +/* 157 */ +/***/ (function(module, exports, __webpack_require__) { +var global = __webpack_require__(3); +var fails = __webpack_require__(6); +var bind = __webpack_require__(94); +var html = __webpack_require__(98); +var createElement = __webpack_require__(67); +var IS_IOS = __webpack_require__(158); +var IS_NODE = __webpack_require__(77); + +var location = global.location; +var set = global.setImmediate; +var clear = global.clearImmediate; +var process = global.process; +var MessageChannel = global.MessageChannel; +var Dispatch = global.Dispatch; +var counter = 0; +var queue = {}; +var ONREADYSTATECHANGE = 'onreadystatechange'; +var defer, channel, port; + +var run = function (id) { + // eslint-disable-next-line no-prototype-builtins -- safe + if (queue.hasOwnProperty(id)) { + var fn = queue[id]; + delete queue[id]; + fn(); + } +}; +var runner = function (id) { + return function () { + run(id); + }; +}; +var listener = function (event) { + run(event.data); +}; +var post = function (id) { + // old engines have not location.origin + global.postMessage(id + '', location.protocol + '//' + location.host); +}; +// Node.js 0.9+ & IE10+ has setImmediate, otherwise: +if (!set || !clear) { + set = function setImmediate(fn) { + var args = []; + var i = 1; + while (arguments.length > i) args.push(arguments[i++]); + queue[++counter] = function () { + // eslint-disable-next-line no-new-func -- spec requirement + (typeof fn == 'function' ? fn : Function(fn)).apply(undefined, args); + }; + defer(counter); + return counter; + }; + clear = function clearImmediate(id) { + delete queue[id]; + }; + // Node.js 0.8- + if (IS_NODE) { + defer = function (id) { + process.nextTick(runner(id)); + }; + // Sphere (JS game engine) Dispatch API + } else if (Dispatch && Dispatch.now) { + defer = function (id) { + Dispatch.now(runner(id)); + }; + // Browsers with MessageChannel, includes WebWorkers + // except iOS - https://github.com/zloirock/core-js/issues/624 + } else if (MessageChannel && !IS_IOS) { + channel = new MessageChannel(); + port = channel.port2; + channel.port1.onmessage = listener; + defer = bind(port.postMessage, port, 1); + // Browsers with postMessage, skip WebWorkers + // IE8 has postMessage, but it's sync & typeof its postMessage is 'object' + } else if ( + global.addEventListener && + typeof postMessage == 'function' && + !global.importScripts && + location && location.protocol !== 'file:' && + !fails(post) + ) { + defer = post; + global.addEventListener('message', listener, false); + // IE8- + } else if (ONREADYSTATECHANGE in createElement('script')) { + defer = function (id) { + html.appendChild(createElement('script'))[ONREADYSTATECHANGE] = function () { + html.removeChild(this); + run(id); + }; + }; + // Rest old browsers + } else { + defer = function (id) { + setTimeout(runner(id), 0); + }; + } +} -function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(getPrototypeOf["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(possibleConstructorReturn["a" /* default */])(this, result); }; } +module.exports = { + set: set, + clear: clear +}; -function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } } -/** - * External dependencies - */ +/***/ }), +/* 158 */ +/***/ (function(module, exports, __webpack_require__) { -/** - * WordPress dependencies - */ +var userAgent = __webpack_require__(87); +module.exports = /(iphone|ipod|ipad).*applewebkit/i.test(userAgent); -/** - * Internal dependencies - */ +/***/ }), +/* 159 */ +/***/ (function(module, exports, __webpack_require__) { -var SlotFillContext = Object(external_this_wp_element_["createContext"])({ - registerSlot: function registerSlot() {}, - unregisterSlot: function unregisterSlot() {}, - registerFill: function registerFill() {}, - unregisterFill: function unregisterFill() {}, - getSlot: function getSlot() {}, - getFills: function getFills() {}, - subscribe: function subscribe() {} -}); -var Provider = SlotFillContext.Provider, - Consumer = SlotFillContext.Consumer; +"use strict"; -var context_SlotFillProvider = /*#__PURE__*/function (_Component) { - Object(inherits["a" /* default */])(SlotFillProvider, _Component); +var aFunction = __webpack_require__(70); - var _super = _createSuper(SlotFillProvider); +var PromiseCapability = function (C) { + var resolve, reject; + this.promise = new C(function ($$resolve, $$reject) { + if (resolve !== undefined || reject !== undefined) throw TypeError('Bad Promise constructor'); + resolve = $$resolve; + reject = $$reject; + }); + this.resolve = aFunction(resolve); + this.reject = aFunction(reject); +}; - function SlotFillProvider() { - var _this; +// 25.4.1.5 NewPromiseCapability(C) +module.exports.f = function (C) { + return new PromiseCapability(C); +}; - Object(classCallCheck["a" /* default */])(this, SlotFillProvider); - - _this = _super.apply(this, arguments); - _this.registerSlot = _this.registerSlot.bind(Object(assertThisInitialized["a" /* default */])(_this)); - _this.registerFill = _this.registerFill.bind(Object(assertThisInitialized["a" /* default */])(_this)); - _this.unregisterSlot = _this.unregisterSlot.bind(Object(assertThisInitialized["a" /* default */])(_this)); - _this.unregisterFill = _this.unregisterFill.bind(Object(assertThisInitialized["a" /* default */])(_this)); - _this.getSlot = _this.getSlot.bind(Object(assertThisInitialized["a" /* default */])(_this)); - _this.getFills = _this.getFills.bind(Object(assertThisInitialized["a" /* default */])(_this)); - _this.hasFills = _this.hasFills.bind(Object(assertThisInitialized["a" /* default */])(_this)); - _this.subscribe = _this.subscribe.bind(Object(assertThisInitialized["a" /* default */])(_this)); - _this.slots = {}; - _this.fills = {}; - _this.listeners = []; - _this.contextValue = { - registerSlot: _this.registerSlot, - unregisterSlot: _this.unregisterSlot, - registerFill: _this.registerFill, - unregisterFill: _this.unregisterFill, - getSlot: _this.getSlot, - getFills: _this.getFills, - hasFills: _this.hasFills, - subscribe: _this.subscribe - }; - return _this; - } - Object(createClass["a" /* default */])(SlotFillProvider, [{ - key: "registerSlot", - value: function registerSlot(name, slot) { - var previousSlot = this.slots[name]; - this.slots[name] = slot; - this.triggerListeners(); // Sometimes the fills are registered after the initial render of slot - // But before the registerSlot call, we need to rerender the slot +/***/ }), +/* 160 */ +/***/ (function(module, exports, __webpack_require__) { - this.forceUpdateSlot(name); // If a new instance of a slot is being mounted while another with the - // same name exists, force its update _after_ the new slot has been - // assigned into the instance, such that its own rendering of children - // will be empty (the new Slot will subsume all fills for this name). +var isObject = __webpack_require__(10); - if (previousSlot) { - previousSlot.forceUpdate(); - } - } - }, { - key: "registerFill", - value: function registerFill(name, instance) { - this.fills[name] = [].concat(Object(toConsumableArray["a" /* default */])(this.fills[name] || []), [instance]); - this.forceUpdateSlot(name); - } - }, { - key: "unregisterSlot", - value: function unregisterSlot(name, instance) { - // If a previous instance of a Slot by this name unmounts, do nothing, - // as the slot and its fills should only be removed for the current - // known instance. - if (this.slots[name] !== instance) { - return; - } +module.exports = function (it) { + if (!isObject(it) && it !== null) { + throw TypeError("Can't set " + String(it) + ' as a prototype'); + } return it; +}; - delete this.slots[name]; - this.triggerListeners(); - } - }, { - key: "unregisterFill", - value: function unregisterFill(name, instance) { - this.fills[name] = Object(external_lodash_["without"])(this.fills[name], instance); - this.resetFillOccurrence(name); - this.forceUpdateSlot(name); - } - }, { - key: "getSlot", - value: function getSlot(name) { - return this.slots[name]; - } - }, { - key: "getFills", - value: function getFills(name, slotInstance) { - // Fills should only be returned for the current instance of the slot - // in which they occupy. - if (this.slots[name] !== slotInstance) { - return []; - } - return Object(external_lodash_["sortBy"])(this.fills[name], 'occurrence'); - } - }, { - key: "hasFills", - value: function hasFills(name) { - return this.fills[name] && !!this.fills[name].length; - } - }, { - key: "resetFillOccurrence", - value: function resetFillOccurrence(name) { - Object(external_lodash_["forEach"])(this.fills[name], function (instance) { - instance.occurrence = undefined; - }); - } - }, { - key: "forceUpdateSlot", - value: function forceUpdateSlot(name) { - var slot = this.getSlot(name); +/***/ }), +/* 161 */ +/***/ (function(module, exports, __webpack_require__) { - if (slot) { - slot.forceUpdate(); - } - } - }, { - key: "triggerListeners", - value: function triggerListeners() { - this.listeners.forEach(function (listener) { - return listener(); - }); +var toObject = __webpack_require__(37); + +var floor = Math.floor; +var replace = ''.replace; +var SUBSTITUTION_SYMBOLS = /\$([$&'`]|\d{1,2}|<[^>]*>)/g; +var SUBSTITUTION_SYMBOLS_NO_NAMED = /\$([$&'`]|\d{1,2})/g; + +// https://tc39.es/ecma262/#sec-getsubstitution +module.exports = function (matched, str, position, captures, namedCaptures, replacement) { + var tailPos = position + matched.length; + var m = captures.length; + var symbols = SUBSTITUTION_SYMBOLS_NO_NAMED; + if (namedCaptures !== undefined) { + namedCaptures = toObject(namedCaptures); + symbols = SUBSTITUTION_SYMBOLS; + } + return replace.call(replacement, symbols, function (match, ch) { + var capture; + switch (ch.charAt(0)) { + case '$': return '$'; + case '&': return matched; + case '`': return str.slice(0, position); + case "'": return str.slice(tailPos); + case '<': + capture = namedCaptures[ch.slice(1, -1)]; + break; + default: // \d\d? + var n = +ch; + if (n === 0) return match; + if (n > m) { + var f = floor(n / 10); + if (f === 0) return match; + if (f <= m) return captures[f - 1] === undefined ? ch.charAt(1) : captures[f - 1] + ch.charAt(1); + return match; + } + capture = captures[n - 1]; } - }, { - key: "subscribe", - value: function subscribe(listener) { - var _this2 = this; + return capture === undefined ? '' : capture; + }); +}; - this.listeners.push(listener); - return function () { - _this2.listeners = Object(external_lodash_["without"])(_this2.listeners, listener); - }; - } - }, { - key: "render", - value: function render() { - return Object(external_this_wp_element_["createElement"])(Provider, { - value: this.contextValue - }, Object(external_this_wp_element_["createElement"])(slot_fill_provider_SlotFillProvider, null, this.props.children)); - } - }]); - return SlotFillProvider; -}(external_this_wp_element_["Component"]); -/** - * React hook returning the active slot given a name. - * - * @param {string} name Slot name. - * @return {Object} Slot object. - */ +/***/ }), +/* 162 */, +/* 163 */ +/***/ (function(module, exports, __webpack_require__) { +"use strict"; -var context_useSlot = function useSlot(name) { - var _useContext = Object(external_this_wp_element_["useContext"])(SlotFillContext), - getSlot = _useContext.getSlot, - subscribe = _useContext.subscribe; - var _useState = Object(external_this_wp_element_["useState"])(getSlot(name)), - _useState2 = Object(slicedToArray["a" /* default */])(_useState, 2), - slot = _useState2[0], - setSlot = _useState2[1]; +var stringify = __webpack_require__(227); +var parse = __webpack_require__(228); +var formats = __webpack_require__(169); - Object(external_this_wp_element_["useEffect"])(function () { - setSlot(getSlot(name)); - var unsubscribe = subscribe(function () { - setSlot(getSlot(name)); - }); - return unsubscribe; - }, [name]); - return slot; +module.exports = { + formats: formats, + parse: parse, + stringify: stringify }; -/* harmony default export */ var context = __webpack_exports__["b"] = (context_SlotFillProvider); -//# sourceMappingURL=context.js.map /***/ }), -/* 57 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; +/* 164 */ +/***/ (function(module, exports) { -// EXPORTS -__webpack_require__.d(__webpack_exports__, "e", function() { return /* binding */ TAB; }); -__webpack_require__.d(__webpack_exports__, "b", function() { return /* binding */ ESCAPE; }); -__webpack_require__.d(__webpack_exports__, "c", function() { return /* binding */ LEFT; }); -__webpack_require__.d(__webpack_exports__, "f", function() { return /* binding */ UP; }); -__webpack_require__.d(__webpack_exports__, "d", function() { return /* binding */ RIGHT; }); -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ DOWN; }); +(function() { module.exports = window["ReactDOM"]; }()); -// UNUSED EXPORTS: BACKSPACE, ENTER, SPACE, DELETE, F10, ALT, CTRL, COMMAND, SHIFT, ZERO, modifiers, rawShortcut, displayShortcutList, displayShortcut, shortcutAriaLabel, isKeyboardEvent +/***/ }), +/* 165 */ +/***/ (function(module, exports, __webpack_require__) { -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/defineProperty.js -var defineProperty = __webpack_require__(6); +"use strict"; -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/toConsumableArray.js + 3 modules -var toConsumableArray = __webpack_require__(26); +var $ = __webpack_require__(12); +var IS_PURE = __webpack_require__(57); +var global = __webpack_require__(3); +var getBuiltIn = __webpack_require__(31); +var NativePromise = __webpack_require__(193); +var redefine = __webpack_require__(27); +var redefineAll = __webpack_require__(152); +var setToStringTag = __webpack_require__(90); +var setSpecies = __webpack_require__(153); +var isObject = __webpack_require__(10); +var aFunction = __webpack_require__(70); +var anInstance = __webpack_require__(136); +var inspectSource = __webpack_require__(68); +var iterate = __webpack_require__(154); +var checkCorrectnessOfIteration = __webpack_require__(166); +var speciesConstructor = __webpack_require__(150); +var task = __webpack_require__(157).set; +var microtask = __webpack_require__(194); +var promiseResolve = __webpack_require__(196); +var hostReportErrors = __webpack_require__(197); +var newPromiseCapabilityModule = __webpack_require__(159); +var perform = __webpack_require__(198); +var InternalStateModule = __webpack_require__(45); +var isForced = __webpack_require__(74); +var wellKnownSymbol = __webpack_require__(8); +var IS_NODE = __webpack_require__(77); +var V8_VERSION = __webpack_require__(63); + +var SPECIES = wellKnownSymbol('species'); +var PROMISE = 'Promise'; +var getInternalState = InternalStateModule.get; +var setInternalState = InternalStateModule.set; +var getInternalPromiseState = InternalStateModule.getterFor(PROMISE); +var PromiseConstructor = NativePromise; +var TypeError = global.TypeError; +var document = global.document; +var process = global.process; +var $fetch = getBuiltIn('fetch'); +var newPromiseCapability = newPromiseCapabilityModule.f; +var newGenericPromiseCapability = newPromiseCapability; +var DISPATCH_EVENT = !!(document && document.createEvent && global.dispatchEvent); +var NATIVE_REJECTION_EVENT = typeof PromiseRejectionEvent == 'function'; +var UNHANDLED_REJECTION = 'unhandledrejection'; +var REJECTION_HANDLED = 'rejectionhandled'; +var PENDING = 0; +var FULFILLED = 1; +var REJECTED = 2; +var HANDLED = 1; +var UNHANDLED = 2; +var Internal, OwnPromiseCapability, PromiseWrapper, nativeThen; + +var FORCED = isForced(PROMISE, function () { + var GLOBAL_CORE_JS_PROMISE = inspectSource(PromiseConstructor) !== String(PromiseConstructor); + if (!GLOBAL_CORE_JS_PROMISE) { + // V8 6.6 (Node 10 and Chrome 66) have a bug with resolving custom thenables + // https://bugs.chromium.org/p/chromium/issues/detail?id=830565 + // We can't detect it synchronously, so just check versions + if (V8_VERSION === 66) return true; + // Unhandled rejections tracking support, NodeJS Promise without it fails @@species test + if (!IS_NODE && !NATIVE_REJECTION_EVENT) return true; + } + // We need Promise#finally in the pure version for preventing prototype pollution + if (IS_PURE && !PromiseConstructor.prototype['finally']) return true; + // We can't use @@species feature detection in V8 since it causes + // deoptimization and performance degradation + // https://github.com/zloirock/core-js/issues/679 + if (V8_VERSION >= 51 && /native code/.test(PromiseConstructor)) return false; + // Detect correctness of subclassing with @@species support + var promise = PromiseConstructor.resolve(1); + var FakePromise = function (exec) { + exec(function () { /* empty */ }, function () { /* empty */ }); + }; + var constructor = promise.constructor = {}; + constructor[SPECIES] = FakePromise; + return !(promise.then(function () { /* empty */ }) instanceof FakePromise); +}); -// EXTERNAL MODULE: external "lodash" -var external_lodash_ = __webpack_require__(2); +var INCORRECT_ITERATION = FORCED || !checkCorrectnessOfIteration(function (iterable) { + PromiseConstructor.all(iterable)['catch'](function () { /* empty */ }); +}); -// EXTERNAL MODULE: external {"this":["wp","i18n"]} -var external_this_wp_i18n_ = __webpack_require__(3); +// helpers +var isThenable = function (it) { + var then; + return isObject(it) && typeof (then = it.then) == 'function' ? then : false; +}; -// CONCATENATED MODULE: ./node_modules/@wordpress/components/node_modules/@wordpress/keycodes/build-module/platform.js -/** - * External dependencies - */ +var notify = function (state, isReject) { + if (state.notified) return; + state.notified = true; + var chain = state.reactions; + microtask(function () { + var value = state.value; + var ok = state.state == FULFILLED; + var index = 0; + // variable length - can't use forEach + while (chain.length > index) { + var reaction = chain[index++]; + var handler = ok ? reaction.ok : reaction.fail; + var resolve = reaction.resolve; + var reject = reaction.reject; + var domain = reaction.domain; + var result, then, exited; + try { + if (handler) { + if (!ok) { + if (state.rejection === UNHANDLED) onHandleUnhandled(state); + state.rejection = HANDLED; + } + if (handler === true) result = value; + else { + if (domain) domain.enter(); + result = handler(value); // can throw + if (domain) { + domain.exit(); + exited = true; + } + } + if (result === reaction.promise) { + reject(TypeError('Promise-chain cycle')); + } else if (then = isThenable(result)) { + then.call(result, resolve, reject); + } else resolve(result); + } else reject(value); + } catch (error) { + if (domain && !exited) domain.exit(); + reject(error); + } + } + state.reactions = []; + state.notified = false; + if (isReject && !state.rejection) onUnhandled(state); + }); +}; -/** - * Return true if platform is MacOS. - * - * @param {Object} _window window object by default; used for DI testing. - * - * @return {boolean} True if MacOS; false otherwise. - */ +var dispatchEvent = function (name, promise, reason) { + var event, handler; + if (DISPATCH_EVENT) { + event = document.createEvent('Event'); + event.promise = promise; + event.reason = reason; + event.initEvent(name, false, true); + global.dispatchEvent(event); + } else event = { promise: promise, reason: reason }; + if (!NATIVE_REJECTION_EVENT && (handler = global['on' + name])) handler(event); + else if (name === UNHANDLED_REJECTION) hostReportErrors('Unhandled promise rejection', reason); +}; -function isAppleOS() { - var _window = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : window; +var onUnhandled = function (state) { + task.call(global, function () { + var promise = state.facade; + var value = state.value; + var IS_UNHANDLED = isUnhandled(state); + var result; + if (IS_UNHANDLED) { + result = perform(function () { + if (IS_NODE) { + process.emit('unhandledRejection', value, promise); + } else dispatchEvent(UNHANDLED_REJECTION, promise, value); + }); + // Browsers should not trigger `rejectionHandled` event if it was handled here, NodeJS - should + state.rejection = IS_NODE || isUnhandled(state) ? UNHANDLED : HANDLED; + if (result.error) throw result.value; + } + }); +}; - var platform = _window.navigator.platform; - return platform.indexOf('Mac') !== -1 || Object(external_lodash_["includes"])(['iPad', 'iPhone'], platform); -} -//# sourceMappingURL=platform.js.map -// CONCATENATED MODULE: ./node_modules/@wordpress/components/node_modules/@wordpress/keycodes/build-module/index.js +var isUnhandled = function (state) { + return state.rejection !== HANDLED && !state.parent; +}; +var onHandleUnhandled = function (state) { + task.call(global, function () { + var promise = state.facade; + if (IS_NODE) { + process.emit('rejectionHandled', promise); + } else dispatchEvent(REJECTION_HANDLED, promise, state.value); + }); +}; +var bind = function (fn, state, unwrap) { + return function (value) { + fn(state, value, unwrap); + }; +}; -/** - * Note: The order of the modifier keys in many of the [foo]Shortcut() - * functions in this file are intentional and should not be changed. They're - * designed to fit with the standard menu keyboard shortcuts shown in the - * user's platform. - * - * For example, on MacOS menu shortcuts will place Shift before Command, but - * on Windows Control will usually come first. So don't provide your own - * shortcut combos directly to keyboardShortcut(). - */ +var internalReject = function (state, value, unwrap) { + if (state.done) return; + state.done = true; + if (unwrap) state = unwrap; + state.value = value; + state.state = REJECTED; + notify(state, true); +}; -/** - * External dependencies - */ +var internalResolve = function (state, value, unwrap) { + if (state.done) return; + state.done = true; + if (unwrap) state = unwrap; + try { + if (state.facade === value) throw TypeError("Promise can't be resolved itself"); + var then = isThenable(value); + if (then) { + microtask(function () { + var wrapper = { done: false }; + try { + then.call(value, + bind(internalResolve, wrapper, state), + bind(internalReject, wrapper, state) + ); + } catch (error) { + internalReject(wrapper, error, state); + } + }); + } else { + state.value = value; + state.state = FULFILLED; + notify(state, false); + } + } catch (error) { + internalReject({ done: false }, error, state); + } +}; -/** - * WordPress dependencies - */ +// constructor polyfill +if (FORCED) { + // 25.4.3.1 Promise(executor) + PromiseConstructor = function Promise(executor) { + anInstance(this, PromiseConstructor, PROMISE); + aFunction(executor); + Internal.call(this); + var state = getInternalState(this); + try { + executor(bind(internalResolve, state), bind(internalReject, state)); + } catch (error) { + internalReject(state, error); + } + }; + // eslint-disable-next-line no-unused-vars -- required for `.length` + Internal = function Promise(executor) { + setInternalState(this, { + type: PROMISE, + done: false, + notified: false, + parent: false, + reactions: [], + rejection: false, + state: PENDING, + value: undefined + }); + }; + Internal.prototype = redefineAll(PromiseConstructor.prototype, { + // `Promise.prototype.then` method + // https://tc39.es/ecma262/#sec-promise.prototype.then + then: function then(onFulfilled, onRejected) { + var state = getInternalPromiseState(this); + var reaction = newPromiseCapability(speciesConstructor(this, PromiseConstructor)); + reaction.ok = typeof onFulfilled == 'function' ? onFulfilled : true; + reaction.fail = typeof onRejected == 'function' && onRejected; + reaction.domain = IS_NODE ? process.domain : undefined; + state.parent = true; + state.reactions.push(reaction); + if (state.state != PENDING) notify(state, false); + return reaction.promise; + }, + // `Promise.prototype.catch` method + // https://tc39.es/ecma262/#sec-promise.prototype.catch + 'catch': function (onRejected) { + return this.then(undefined, onRejected); + } + }); + OwnPromiseCapability = function () { + var promise = new Internal(); + var state = getInternalState(promise); + this.promise = promise; + this.resolve = bind(internalResolve, state); + this.reject = bind(internalReject, state); + }; + newPromiseCapabilityModule.f = newPromiseCapability = function (C) { + return C === PromiseConstructor || C === PromiseWrapper + ? new OwnPromiseCapability(C) + : newGenericPromiseCapability(C); + }; + if (!IS_PURE && typeof NativePromise == 'function') { + nativeThen = NativePromise.prototype.then; + + // wrap native Promise#then for native async functions + redefine(NativePromise.prototype, 'then', function then(onFulfilled, onRejected) { + var that = this; + return new PromiseConstructor(function (resolve, reject) { + nativeThen.call(that, resolve, reject); + }).then(onFulfilled, onRejected); + // https://github.com/zloirock/core-js/issues/640 + }, { unsafe: true }); + + // wrap fetch result + if (typeof $fetch == 'function') $({ global: true, enumerable: true, forced: true }, { + // eslint-disable-next-line no-unused-vars -- required for `.length` + fetch: function fetch(input /* , init */) { + return promiseResolve(PromiseConstructor, $fetch.apply(global, arguments)); + } + }); + } +} -/** - * Internal dependencies - */ +$({ global: true, wrap: true, forced: FORCED }, { + Promise: PromiseConstructor +}); +setToStringTag(PromiseConstructor, PROMISE, false, true); +setSpecies(PROMISE); -/** - * @typedef {'primary'|'primaryShift'|'primaryAlt'|'secondary'|'access'|'ctrl'|'alt'|'ctrlShift'|'shift'|'shiftAlt'} WPKeycodeModifier - */ +PromiseWrapper = getBuiltIn(PROMISE); -/** - * An object of handler functions for each of the possible modifier - * combinations. A handler will return a value for a given key. - * - * @typedef {Recordany>} WPKeycodeHandlerByModifier - */ +// statics +$({ target: PROMISE, stat: true, forced: FORCED }, { + // `Promise.reject` method + // https://tc39.es/ecma262/#sec-promise.reject + reject: function reject(r) { + var capability = newPromiseCapability(this); + capability.reject.call(undefined, r); + return capability.promise; + } +}); -/** - * Keycode for BACKSPACE key. - */ +$({ target: PROMISE, stat: true, forced: IS_PURE || FORCED }, { + // `Promise.resolve` method + // https://tc39.es/ecma262/#sec-promise.resolve + resolve: function resolve(x) { + return promiseResolve(IS_PURE && this === PromiseWrapper ? PromiseConstructor : this, x); + } +}); -var BACKSPACE = 8; -/** - * Keycode for TAB key. - */ - -var TAB = 9; -/** - * Keycode for ENTER key. - */ - -var ENTER = 13; -/** - * Keycode for ESCAPE key. - */ +$({ target: PROMISE, stat: true, forced: INCORRECT_ITERATION }, { + // `Promise.all` method + // https://tc39.es/ecma262/#sec-promise.all + all: function all(iterable) { + var C = this; + var capability = newPromiseCapability(C); + var resolve = capability.resolve; + var reject = capability.reject; + var result = perform(function () { + var $promiseResolve = aFunction(C.resolve); + var values = []; + var counter = 0; + var remaining = 1; + iterate(iterable, function (promise) { + var index = counter++; + var alreadyCalled = false; + values.push(undefined); + remaining++; + $promiseResolve.call(C, promise).then(function (value) { + if (alreadyCalled) return; + alreadyCalled = true; + values[index] = value; + --remaining || resolve(values); + }, reject); + }); + --remaining || resolve(values); + }); + if (result.error) reject(result.value); + return capability.promise; + }, + // `Promise.race` method + // https://tc39.es/ecma262/#sec-promise.race + race: function race(iterable) { + var C = this; + var capability = newPromiseCapability(C); + var reject = capability.reject; + var result = perform(function () { + var $promiseResolve = aFunction(C.resolve); + iterate(iterable, function (promise) { + $promiseResolve.call(C, promise).then(capability.resolve, reject); + }); + }); + if (result.error) reject(result.value); + return capability.promise; + } +}); -var ESCAPE = 27; -/** - * Keycode for SPACE key. - */ -var SPACE = 32; -/** - * Keycode for LEFT key. - */ +/***/ }), +/* 166 */ +/***/ (function(module, exports, __webpack_require__) { -var LEFT = 37; -/** - * Keycode for UP key. - */ +var wellKnownSymbol = __webpack_require__(8); -var UP = 38; -/** - * Keycode for RIGHT key. - */ +var ITERATOR = wellKnownSymbol('iterator'); +var SAFE_CLOSING = false; -var RIGHT = 39; -/** - * Keycode for DOWN key. - */ +try { + var called = 0; + var iteratorWithReturn = { + next: function () { + return { done: !!called++ }; + }, + 'return': function () { + SAFE_CLOSING = true; + } + }; + iteratorWithReturn[ITERATOR] = function () { + return this; + }; + // eslint-disable-next-line no-throw-literal -- required for testing + Array.from(iteratorWithReturn, function () { throw 2; }); +} catch (error) { /* empty */ } -var DOWN = 40; -/** - * Keycode for DELETE key. - */ +module.exports = function (exec, SKIP_CLOSING) { + if (!SKIP_CLOSING && !SAFE_CLOSING) return false; + var ITERATION_SUPPORT = false; + try { + var object = {}; + object[ITERATOR] = function () { + return { + next: function () { + return { done: ITERATION_SUPPORT = true }; + } + }; + }; + exec(object); + } catch (error) { /* empty */ } + return ITERATION_SUPPORT; +}; -var DELETE = 46; -/** - * Keycode for F10 key. - */ -var F10 = 121; -/** - * Keycode for ALT key. - */ +/***/ }), +/* 167 */ +/***/ (function(module, exports, __webpack_require__) { -var ALT = 'alt'; -/** - * Keycode for CTRL key. - */ +"use strict"; -var CTRL = 'ctrl'; -/** - * Keycode for COMMAND/META key. - */ +var $ = __webpack_require__(12); +var createIteratorConstructor = __webpack_require__(199); +var getPrototypeOf = __webpack_require__(174); +var setPrototypeOf = __webpack_require__(143); +var setToStringTag = __webpack_require__(90); +var createNonEnumerableProperty = __webpack_require__(19); +var redefine = __webpack_require__(27); +var wellKnownSymbol = __webpack_require__(8); +var IS_PURE = __webpack_require__(57); +var Iterators = __webpack_require__(110); +var IteratorsCore = __webpack_require__(173); + +var IteratorPrototype = IteratorsCore.IteratorPrototype; +var BUGGY_SAFARI_ITERATORS = IteratorsCore.BUGGY_SAFARI_ITERATORS; +var ITERATOR = wellKnownSymbol('iterator'); +var KEYS = 'keys'; +var VALUES = 'values'; +var ENTRIES = 'entries'; + +var returnThis = function () { return this; }; + +module.exports = function (Iterable, NAME, IteratorConstructor, next, DEFAULT, IS_SET, FORCED) { + createIteratorConstructor(IteratorConstructor, NAME, next); + + var getIterationMethod = function (KIND) { + if (KIND === DEFAULT && defaultIterator) return defaultIterator; + if (!BUGGY_SAFARI_ITERATORS && KIND in IterablePrototype) return IterablePrototype[KIND]; + switch (KIND) { + case KEYS: return function keys() { return new IteratorConstructor(this, KIND); }; + case VALUES: return function values() { return new IteratorConstructor(this, KIND); }; + case ENTRIES: return function entries() { return new IteratorConstructor(this, KIND); }; + } return function () { return new IteratorConstructor(this); }; + }; -var COMMAND = 'meta'; -/** - * Keycode for SHIFT key. - */ + var TO_STRING_TAG = NAME + ' Iterator'; + var INCORRECT_VALUES_NAME = false; + var IterablePrototype = Iterable.prototype; + var nativeIterator = IterablePrototype[ITERATOR] + || IterablePrototype['@@iterator'] + || DEFAULT && IterablePrototype[DEFAULT]; + var defaultIterator = !BUGGY_SAFARI_ITERATORS && nativeIterator || getIterationMethod(DEFAULT); + var anyNativeIterator = NAME == 'Array' ? IterablePrototype.entries || nativeIterator : nativeIterator; + var CurrentIteratorPrototype, methods, KEY; + + // fix native + if (anyNativeIterator) { + CurrentIteratorPrototype = getPrototypeOf(anyNativeIterator.call(new Iterable())); + if (IteratorPrototype !== Object.prototype && CurrentIteratorPrototype.next) { + if (!IS_PURE && getPrototypeOf(CurrentIteratorPrototype) !== IteratorPrototype) { + if (setPrototypeOf) { + setPrototypeOf(CurrentIteratorPrototype, IteratorPrototype); + } else if (typeof CurrentIteratorPrototype[ITERATOR] != 'function') { + createNonEnumerableProperty(CurrentIteratorPrototype, ITERATOR, returnThis); + } + } + // Set @@toStringTag to native iterators + setToStringTag(CurrentIteratorPrototype, TO_STRING_TAG, true, true); + if (IS_PURE) Iterators[TO_STRING_TAG] = returnThis; + } + } -var SHIFT = 'shift'; -/** - * Keycode for ZERO key. - */ + // fix Array#{values, @@iterator}.name in V8 / FF + if (DEFAULT == VALUES && nativeIterator && nativeIterator.name !== VALUES) { + INCORRECT_VALUES_NAME = true; + defaultIterator = function values() { return nativeIterator.call(this); }; + } -var ZERO = 48; -/** - * Object that contains functions that return the available modifier - * depending on platform. - * - * - `primary`: takes a isApple function as a parameter. - * - `primaryShift`: takes a isApple function as a parameter. - * - `primaryAlt`: takes a isApple function as a parameter. - * - `secondary`: takes a isApple function as a parameter. - * - `access`: takes a isApple function as a parameter. - * - `ctrl` - * - `alt` - * - `ctrlShift` - * - `shift` - * - `shiftAlt` - */ + // define iterator + if ((!IS_PURE || FORCED) && IterablePrototype[ITERATOR] !== defaultIterator) { + createNonEnumerableProperty(IterablePrototype, ITERATOR, defaultIterator); + } + Iterators[NAME] = defaultIterator; -var modifiers = { - primary: function primary(_isApple) { - return _isApple() ? [COMMAND] : [CTRL]; - }, - primaryShift: function primaryShift(_isApple) { - return _isApple() ? [SHIFT, COMMAND] : [CTRL, SHIFT]; - }, - primaryAlt: function primaryAlt(_isApple) { - return _isApple() ? [ALT, COMMAND] : [CTRL, ALT]; - }, - secondary: function secondary(_isApple) { - return _isApple() ? [SHIFT, ALT, COMMAND] : [CTRL, SHIFT, ALT]; - }, - access: function access(_isApple) { - return _isApple() ? [CTRL, ALT] : [SHIFT, ALT]; - }, - ctrl: function ctrl() { - return [CTRL]; - }, - alt: function alt() { - return [ALT]; - }, - ctrlShift: function ctrlShift() { - return [CTRL, SHIFT]; - }, - shift: function shift() { - return [SHIFT]; - }, - shiftAlt: function shiftAlt() { - return [SHIFT, ALT]; + // export additional methods + if (DEFAULT) { + methods = { + values: getIterationMethod(VALUES), + keys: IS_SET ? defaultIterator : getIterationMethod(KEYS), + entries: getIterationMethod(ENTRIES) + }; + if (FORCED) for (KEY in methods) { + if (BUGGY_SAFARI_ITERATORS || INCORRECT_VALUES_NAME || !(KEY in IterablePrototype)) { + redefine(IterablePrototype, KEY, methods[KEY]); + } + } else $({ target: NAME, proto: true, forced: BUGGY_SAFARI_ITERATORS || INCORRECT_VALUES_NAME }, methods); } + + return methods; }; -/** - * An object that contains functions to get raw shortcuts. - * E.g. rawShortcut.primary( 'm' ) will return 'meta+m' on Mac. - * These are intended for user with the KeyboardShortcuts component or TinyMCE. - * - * @type {WPKeycodeHandlerByModifier} Keyed map of functions to raw shortcuts. - */ -var rawShortcut = Object(external_lodash_["mapValues"])(modifiers, function (modifier) { - return function (character) { - var _isApple = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : isAppleOS; - return [].concat(Object(toConsumableArray["a" /* default */])(modifier(_isApple)), [character.toLowerCase()]).join('+'); - }; -}); -/** - * Return an array of the parts of a keyboard shortcut chord for display - * E.g displayShortcutList.primary( 'm' ) will return [ '⌘', 'M' ] on Mac. - * - * @type {WPKeycodeHandlerByModifier} Keyed map of functions to shortcut - * sequences. - */ +/***/ }), +/* 168 */, +/* 169 */ +/***/ (function(module, exports, __webpack_require__) { + +"use strict"; -var displayShortcutList = Object(external_lodash_["mapValues"])(modifiers, function (modifier) { - return function (character) { - var _replacementKeyMap; - var _isApple = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : isAppleOS; +var replace = String.prototype.replace; +var percentTwenties = /%20/g; - var isApple = _isApple(); +var Format = { + RFC1738: 'RFC1738', + RFC3986: 'RFC3986' +}; - var replacementKeyMap = (_replacementKeyMap = {}, Object(defineProperty["a" /* default */])(_replacementKeyMap, ALT, isApple ? '⌥' : 'Alt'), Object(defineProperty["a" /* default */])(_replacementKeyMap, CTRL, isApple ? '⌃' : 'Ctrl'), Object(defineProperty["a" /* default */])(_replacementKeyMap, COMMAND, '⌘'), Object(defineProperty["a" /* default */])(_replacementKeyMap, SHIFT, isApple ? '⇧' : 'Shift'), _replacementKeyMap); - var modifierKeys = modifier(_isApple).reduce(function (accumulator, key) { - var replacementKey = Object(external_lodash_["get"])(replacementKeyMap, key, key); // If on the Mac, adhere to platform convention and don't show plus between keys. +module.exports = { + 'default': Format.RFC3986, + formatters: { + RFC1738: function (value) { + return replace.call(value, percentTwenties, '+'); + }, + RFC3986: function (value) { + return String(value); + } + }, + RFC1738: Format.RFC1738, + RFC3986: Format.RFC3986 +}; - if (isApple) { - return [].concat(Object(toConsumableArray["a" /* default */])(accumulator), [replacementKey]); - } - return [].concat(Object(toConsumableArray["a" /* default */])(accumulator), [replacementKey, '+']); - }, []); - var capitalizedCharacter = Object(external_lodash_["capitalize"])(character); - return [].concat(Object(toConsumableArray["a" /* default */])(modifierKeys), [capitalizedCharacter]); - }; -}); -/** - * An object that contains functions to display shortcuts. - * E.g. displayShortcut.primary( 'm' ) will return '⌘M' on Mac. - * - * @type {WPKeycodeHandlerByModifier} Keyed map of functions to display - * shortcuts. - */ +/***/ }), +/* 170 */ +/***/ (function(module, exports, __webpack_require__) { -var displayShortcut = Object(external_lodash_["mapValues"])(displayShortcutList, function (shortcutList) { - return function (character) { - var _isApple = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : isAppleOS; +"use strict"; - return shortcutList(character, _isApple).join(''); - }; +var fixRegExpWellKnownSymbolLogic = __webpack_require__(111); +var anObject = __webpack_require__(9); +var requireObjectCoercible = __webpack_require__(32); +var sameValue = __webpack_require__(214); +var regExpExec = __webpack_require__(112); + +// @@search logic +fixRegExpWellKnownSymbolLogic('search', 1, function (SEARCH, nativeSearch, maybeCallNative) { + return [ + // `String.prototype.search` method + // https://tc39.es/ecma262/#sec-string.prototype.search + function search(regexp) { + var O = requireObjectCoercible(this); + var searcher = regexp == undefined ? undefined : regexp[SEARCH]; + return searcher !== undefined ? searcher.call(regexp, O) : new RegExp(regexp)[SEARCH](String(O)); + }, + // `RegExp.prototype[@@search]` method + // https://tc39.es/ecma262/#sec-regexp.prototype-@@search + function (regexp) { + var res = maybeCallNative(nativeSearch, regexp, this); + if (res.done) return res.value; + + var rx = anObject(regexp); + var S = String(this); + + var previousLastIndex = rx.lastIndex; + if (!sameValue(previousLastIndex, 0)) rx.lastIndex = 0; + var result = regExpExec(rx, S); + if (!sameValue(rx.lastIndex, previousLastIndex)) rx.lastIndex = previousLastIndex; + return result === null ? -1 : result.index; + } + ]; }); -/** - * An object that contains functions to return an aria label for a keyboard shortcut. - * E.g. shortcutAriaLabel.primary( '.' ) will return 'Command + Period' on Mac. - * - * @type {WPKeycodeHandlerByModifier} Keyed map of functions to shortcut ARIA - * labels. - */ - -var shortcutAriaLabel = Object(external_lodash_["mapValues"])(modifiers, function (modifier) { - return function (character) { - var _replacementKeyMap2; - var _isApple = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : isAppleOS; - var isApple = _isApple(); +/***/ }), +/* 171 */ +/***/ (function(module, exports, __webpack_require__) { - var replacementKeyMap = (_replacementKeyMap2 = {}, Object(defineProperty["a" /* default */])(_replacementKeyMap2, SHIFT, 'Shift'), Object(defineProperty["a" /* default */])(_replacementKeyMap2, COMMAND, isApple ? 'Command' : 'Control'), Object(defineProperty["a" /* default */])(_replacementKeyMap2, CTRL, 'Control'), Object(defineProperty["a" /* default */])(_replacementKeyMap2, ALT, isApple ? 'Option' : 'Alt'), Object(defineProperty["a" /* default */])(_replacementKeyMap2, ',', Object(external_this_wp_i18n_["__"])('Comma')), Object(defineProperty["a" /* default */])(_replacementKeyMap2, '.', Object(external_this_wp_i18n_["__"])('Period')), Object(defineProperty["a" /* default */])(_replacementKeyMap2, '`', Object(external_this_wp_i18n_["__"])('Backtick')), _replacementKeyMap2); - return [].concat(Object(toConsumableArray["a" /* default */])(modifier(_isApple)), [character]).map(function (key) { - return Object(external_lodash_["capitalize"])(Object(external_lodash_["get"])(replacementKeyMap, key, key)); - }).join(isApple ? ' ' : ' + '); - }; -}); -/** - * From a given KeyboardEvent, returns an array of active modifier constants for - * the event. - * - * @param {KeyboardEvent} event Keyboard event. - * - * @return {Array} Active modifier constants. - */ +var wellKnownSymbol = __webpack_require__(8); +var Iterators = __webpack_require__(110); -function getEventModifiers(event) { - return [ALT, CTRL, COMMAND, SHIFT].filter(function (key) { - return event["".concat(key, "Key")]; - }); -} -/** - * An object that contains functions to check if a keyboard event matches a - * predefined shortcut combination. - * E.g. isKeyboardEvent.primary( event, 'm' ) will return true if the event - * signals pressing ⌘M. - * - * @type {WPKeycodeHandlerByModifier} Keyed map of functions to match events. - */ +var ITERATOR = wellKnownSymbol('iterator'); +var ArrayPrototype = Array.prototype; +// check on default Array iterator +module.exports = function (it) { + return it !== undefined && (Iterators.Array === it || ArrayPrototype[ITERATOR] === it); +}; -var isKeyboardEvent = Object(external_lodash_["mapValues"])(modifiers, function (getModifiers) { - return function (event, character) { - var _isApple = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : isAppleOS; - var mods = getModifiers(_isApple); - var eventMods = getEventModifiers(event); +/***/ }), +/* 172 */ +/***/ (function(module, exports, __webpack_require__) { - if (Object(external_lodash_["xor"])(mods, eventMods).length) { - return false; - } +var anObject = __webpack_require__(9); - if (!character) { - return Object(external_lodash_["includes"])(mods, event.key.toLowerCase()); - } +module.exports = function (iterator) { + var returnMethod = iterator['return']; + if (returnMethod !== undefined) { + return anObject(returnMethod.call(iterator)).value; + } +}; - return event.key === character; - }; -}); -//# sourceMappingURL=index.js.map /***/ }), -/* 58 */ +/* 173 */ /***/ (function(module, exports, __webpack_require__) { -var objectWithoutPropertiesLoose = __webpack_require__(150); +"use strict"; -function _objectWithoutProperties(source, excluded) { - if (source == null) return {}; - var target = objectWithoutPropertiesLoose(source, excluded); - var key, i; +var fails = __webpack_require__(6); +var getPrototypeOf = __webpack_require__(174); +var createNonEnumerableProperty = __webpack_require__(19); +var has = __webpack_require__(11); +var wellKnownSymbol = __webpack_require__(8); +var IS_PURE = __webpack_require__(57); - if (Object.getOwnPropertySymbols) { - var sourceSymbolKeys = Object.getOwnPropertySymbols(source); +var ITERATOR = wellKnownSymbol('iterator'); +var BUGGY_SAFARI_ITERATORS = false; - for (i = 0; i < sourceSymbolKeys.length; i++) { - key = sourceSymbolKeys[i]; - if (excluded.indexOf(key) >= 0) continue; - if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; - target[key] = source[key]; - } +var returnThis = function () { return this; }; + +// `%IteratorPrototype%` object +// https://tc39.es/ecma262/#sec-%iteratorprototype%-object +var IteratorPrototype, PrototypeOfArrayIteratorPrototype, arrayIterator; + +if ([].keys) { + arrayIterator = [].keys(); + // Safari 8 has buggy iterators w/o `next` + if (!('next' in arrayIterator)) BUGGY_SAFARI_ITERATORS = true; + else { + PrototypeOfArrayIteratorPrototype = getPrototypeOf(getPrototypeOf(arrayIterator)); + if (PrototypeOfArrayIteratorPrototype !== Object.prototype) IteratorPrototype = PrototypeOfArrayIteratorPrototype; } +} - return target; +var NEW_ITERATOR_PROTOTYPE = IteratorPrototype == undefined || fails(function () { + var test = {}; + // FF44- legacy iterators case + return IteratorPrototype[ITERATOR].call(test) !== test; +}); + +if (NEW_ITERATOR_PROTOTYPE) IteratorPrototype = {}; + +// 25.1.2.1.1 %IteratorPrototype%[@@iterator]() +if ((!IS_PURE || NEW_ITERATOR_PROTOTYPE) && !has(IteratorPrototype, ITERATOR)) { + createNonEnumerableProperty(IteratorPrototype, ITERATOR, returnThis); } -module.exports = _objectWithoutProperties; +module.exports = { + IteratorPrototype: IteratorPrototype, + BUGGY_SAFARI_ITERATORS: BUGGY_SAFARI_ITERATORS +}; + /***/ }), -/* 59 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 174 */ +/***/ (function(module, exports, __webpack_require__) { -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _unsupportedIterableToArray; }); -/* harmony import */ var _babel_runtime_helpers_esm_arrayLikeToArray__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(49); +var has = __webpack_require__(11); +var toObject = __webpack_require__(37); +var sharedKey = __webpack_require__(51); +var CORRECT_PROTOTYPE_GETTER = __webpack_require__(213); + +var IE_PROTO = sharedKey('IE_PROTO'); +var ObjectPrototype = Object.prototype; + +// `Object.getPrototypeOf` method +// https://tc39.es/ecma262/#sec-object.getprototypeof +module.exports = CORRECT_PROTOTYPE_GETTER ? Object.getPrototypeOf : function (O) { + O = toObject(O); + if (has(O, IE_PROTO)) return O[IE_PROTO]; + if (typeof O.constructor == 'function' && O instanceof O.constructor) { + return O.constructor.prototype; + } return O instanceof Object ? ObjectPrototype : null; +}; -function _unsupportedIterableToArray(o, minLen) { - if (!o) return; - if (typeof o === "string") return Object(_babel_runtime_helpers_esm_arrayLikeToArray__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(o, minLen); - var n = Object.prototype.toString.call(o).slice(8, -1); - if (n === "Object" && o.constructor) n = o.constructor.name; - if (n === "Map" || n === "Set") return Array.from(o); - if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return Object(_babel_runtime_helpers_esm_arrayLikeToArray__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(o, minLen); -} /***/ }), -/* 60 */, -/* 61 */ +/* 175 */, +/* 176 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; -/* WEBPACK VAR INJECTION */(function(process) {/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_0__); -/* harmony import */ var _wordpress_warning__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(72); -/** - * WordPress dependencies - */ +var isProduction = "production" === 'production'; +var prefix = 'Invariant failed'; +function invariant(condition, message) { + if (condition) { + return; + } + if (isProduction) { + throw new Error(prefix); + } + throw new Error(prefix + ": " + (message || '')); +} +/* harmony default export */ __webpack_exports__["a"] = (invariant); -var SlotFillContext = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_0__["createContext"])({ - slots: {}, - fills: {}, - registerSlot: function registerSlot() { - typeof process !== "undefined" && process.env && "production" !== "production" ? Object(_wordpress_warning__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])('Components must be wrapped within `SlotFillProvider`. ' + 'See https://developer.wordpress.org/block-editor/components/slot-fill/') : void 0; - }, - updateSlot: function updateSlot() {}, - unregisterSlot: function unregisterSlot() {}, - registerFill: function registerFill() {}, - unregisterFill: function unregisterFill() {} -}); -/* harmony default export */ __webpack_exports__["a"] = (SlotFillContext); -//# sourceMappingURL=slot-fill-context.js.map -/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(64))) /***/ }), -/* 62 */ -/***/ (function(module, exports) { +/* 177 */ +/***/ (function(module, exports, __webpack_require__) { -function _arrayLikeToArray(arr, len) { - if (len == null || len > arr.length) len = arr.length; +"use strict"; - for (var i = 0, arr2 = new Array(len); i < len; i++) { - arr2[i] = arr[i]; - } +var DESCRIPTORS = __webpack_require__(13); +var global = __webpack_require__(3); +var isForced = __webpack_require__(74); +var redefine = __webpack_require__(27); +var has = __webpack_require__(11); +var classof = __webpack_require__(30); +var inheritIfRequired = __webpack_require__(156); +var toPrimitive = __webpack_require__(40); +var fails = __webpack_require__(6); +var create = __webpack_require__(69); +var getOwnPropertyNames = __webpack_require__(56).f; +var getOwnPropertyDescriptor = __webpack_require__(33).f; +var defineProperty = __webpack_require__(17).f; +var trim = __webpack_require__(188).trim; + +var NUMBER = 'Number'; +var NativeNumber = global[NUMBER]; +var NumberPrototype = NativeNumber.prototype; + +// Opera ~12 has broken Object#toString +var BROKEN_CLASSOF = classof(create(NumberPrototype)) == NUMBER; + +// `ToNumber` abstract operation +// https://tc39.es/ecma262/#sec-tonumber +var toNumber = function (argument) { + var it = toPrimitive(argument, false); + var first, third, radix, maxCode, digits, length, index, code; + if (typeof it == 'string' && it.length > 2) { + it = trim(it); + first = it.charCodeAt(0); + if (first === 43 || first === 45) { + third = it.charCodeAt(2); + if (third === 88 || third === 120) return NaN; // Number('+0x1') should be NaN, old V8 fix + } else if (first === 48) { + switch (it.charCodeAt(1)) { + case 66: case 98: radix = 2; maxCode = 49; break; // fast equal of /^0b[01]+$/i + case 79: case 111: radix = 8; maxCode = 55; break; // fast equal of /^0o[0-7]+$/i + default: return +it; + } + digits = it.slice(2); + length = digits.length; + for (index = 0; index < length; index++) { + code = digits.charCodeAt(index); + // parseInt parses a string to a first unavailable symbol + // but ToNumber should return NaN if a string contains unavailable symbols + if (code < 48 || code > maxCode) return NaN; + } return parseInt(digits, radix); + } + } return +it; +}; - return arr2; +// `Number` constructor +// https://tc39.es/ecma262/#sec-number-constructor +if (isForced(NUMBER, !NativeNumber(' 0o1') || !NativeNumber('0b1') || NativeNumber('+0x1'))) { + var NumberWrapper = function Number(value) { + var it = arguments.length < 1 ? 0 : value; + var dummy = this; + return dummy instanceof NumberWrapper + // check on 1..constructor(foo) case + && (BROKEN_CLASSOF ? fails(function () { NumberPrototype.valueOf.call(dummy); }) : classof(dummy) != NUMBER) + ? inheritIfRequired(new NativeNumber(toNumber(it)), dummy, NumberWrapper) : toNumber(it); + }; + for (var keys = DESCRIPTORS ? getOwnPropertyNames(NativeNumber) : ( + // ES3: + 'MAX_VALUE,MIN_VALUE,NaN,NEGATIVE_INFINITY,POSITIVE_INFINITY,' + + // ES2015 (in case, if modules with ES2015 Number statics required before): + 'EPSILON,isFinite,isInteger,isNaN,isSafeInteger,MAX_SAFE_INTEGER,' + + 'MIN_SAFE_INTEGER,parseFloat,parseInt,isInteger,' + + // ESNext + 'fromString,range' + ).split(','), j = 0, key; keys.length > j; j++) { + if (has(NativeNumber, key = keys[j]) && !has(NumberWrapper, key)) { + defineProperty(NumberWrapper, key, getOwnPropertyDescriptor(NativeNumber, key)); + } + } + NumberWrapper.prototype = NumberPrototype; + NumberPrototype.constructor = NumberWrapper; + redefine(global, NUMBER, NumberWrapper); } -module.exports = _arrayLikeToArray; /***/ }), -/* 63 */ +/* 178 */ /***/ (function(module, exports, __webpack_require__) { -var arrayLikeToArray = __webpack_require__(62); +var arrayLikeToArray = __webpack_require__(124); -function _unsupportedIterableToArray(o, minLen) { - if (!o) return; - if (typeof o === "string") return arrayLikeToArray(o, minLen); - var n = Object.prototype.toString.call(o).slice(8, -1); - if (n === "Object" && o.constructor) n = o.constructor.name; - if (n === "Map" || n === "Set") return Array.from(o); - if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return arrayLikeToArray(o, minLen); +function _arrayWithoutHoles(arr) { + if (Array.isArray(arr)) return arrayLikeToArray(arr); } -module.exports = _unsupportedIterableToArray; +module.exports = _arrayWithoutHoles; /***/ }), -/* 64 */ +/* 179 */ /***/ (function(module, exports) { -// shim for using process in browser -var process = module.exports = {}; +function _iterableToArray(iter) { + if (typeof Symbol !== "undefined" && Symbol.iterator in Object(iter)) return Array.from(iter); +} -// cached from whatever global is present so that test runners that stub it -// don't break things. But we need to wrap it in a try catch in case it is -// wrapped in strict mode code which doesn't define any globals. It's inside a -// function because try/catches deoptimize in certain engines. +module.exports = _iterableToArray; -var cachedSetTimeout; -var cachedClearTimeout; +/***/ }), +/* 180 */ +/***/ (function(module, exports) { -function defaultSetTimout() { - throw new Error('setTimeout has not been defined'); -} -function defaultClearTimeout () { - throw new Error('clearTimeout has not been defined'); +function _nonIterableSpread() { + throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); } -(function () { - try { - if (typeof setTimeout === 'function') { - cachedSetTimeout = setTimeout; - } else { - cachedSetTimeout = defaultSetTimout; - } - } catch (e) { - cachedSetTimeout = defaultSetTimout; - } - try { - if (typeof clearTimeout === 'function') { - cachedClearTimeout = clearTimeout; - } else { - cachedClearTimeout = defaultClearTimeout; - } - } catch (e) { - cachedClearTimeout = defaultClearTimeout; - } -} ()) -function runTimeout(fun) { - if (cachedSetTimeout === setTimeout) { - //normal enviroments in sane situations - return setTimeout(fun, 0); - } - // if setTimeout wasn't available but was latter defined - if ((cachedSetTimeout === defaultSetTimout || !cachedSetTimeout) && setTimeout) { - cachedSetTimeout = setTimeout; - return setTimeout(fun, 0); - } - try { - // when when somebody has screwed with setTimeout but no I.E. maddness - return cachedSetTimeout(fun, 0); - } catch(e){ - try { - // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally - return cachedSetTimeout.call(null, fun, 0); - } catch(e){ - // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error - return cachedSetTimeout.call(this, fun, 0); - } - } +module.exports = _nonIterableSpread; + +/***/ }), +/* 181 */ +/***/ (function(module, exports) { +function _arrayWithHoles(arr) { + if (Array.isArray(arr)) return arr; } -function runClearTimeout(marker) { - if (cachedClearTimeout === clearTimeout) { - //normal enviroments in sane situations - return clearTimeout(marker); - } - // if clearTimeout wasn't available but was latter defined - if ((cachedClearTimeout === defaultClearTimeout || !cachedClearTimeout) && clearTimeout) { - cachedClearTimeout = clearTimeout; - return clearTimeout(marker); - } - try { - // when when somebody has screwed with setTimeout but no I.E. maddness - return cachedClearTimeout(marker); - } catch (e){ - try { - // When we are in I.E. but the script has been evaled so I.E. doesn't trust the global object when called normally - return cachedClearTimeout.call(null, marker); - } catch (e){ - // same as above but when it's a version of I.E. that must have the global object for 'this', hopfully our context correct otherwise it will throw a global error. - // Some versions of I.E. have different rules for clearTimeout vs setTimeout - return cachedClearTimeout.call(this, marker); - } - } +module.exports = _arrayWithHoles; +/***/ }), +/* 182 */ +/***/ (function(module, exports) { -} -var queue = []; -var draining = false; -var currentQueue; -var queueIndex = -1; +function _iterableToArrayLimit(arr, i) { + if (typeof Symbol === "undefined" || !(Symbol.iterator in Object(arr))) return; + var _arr = []; + var _n = true; + var _d = false; + var _e = undefined; -function cleanUpNextTick() { - if (!draining || !currentQueue) { - return; - } - draining = false; - if (currentQueue.length) { - queue = currentQueue.concat(queue); - } else { - queueIndex = -1; - } - if (queue.length) { - drainQueue(); - } -} + try { + for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { + _arr.push(_s.value); -function drainQueue() { - if (draining) { - return; + if (i && _arr.length === i) break; } - var timeout = runTimeout(cleanUpNextTick); - draining = true; - - var len = queue.length; - while(len) { - currentQueue = queue; - queue = []; - while (++queueIndex < len) { - if (currentQueue) { - currentQueue[queueIndex].run(); - } - } - queueIndex = -1; - len = queue.length; + } catch (err) { + _d = true; + _e = err; + } finally { + try { + if (!_n && _i["return"] != null) _i["return"](); + } finally { + if (_d) throw _e; } - currentQueue = null; - draining = false; - runClearTimeout(timeout); + } + + return _arr; } -process.nextTick = function (fun) { - var args = new Array(arguments.length - 1); - if (arguments.length > 1) { - for (var i = 1; i < arguments.length; i++) { - args[i - 1] = arguments[i]; - } - } - queue.push(new Item(fun, args)); - if (queue.length === 1 && !draining) { - runTimeout(drainQueue); - } -}; +module.exports = _iterableToArrayLimit; -// v8 likes predictible objects -function Item(fun, array) { - this.fun = fun; - this.array = array; -} -Item.prototype.run = function () { - this.fun.apply(null, this.array); -}; -process.title = 'browser'; -process.browser = true; -process.env = {}; -process.argv = []; -process.version = ''; // empty string to avoid regexp issues -process.versions = {}; +/***/ }), +/* 183 */ +/***/ (function(module, exports) { -function noop() {} +function _nonIterableRest() { + throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); +} -process.on = noop; -process.addListener = noop; -process.once = noop; -process.off = noop; -process.removeListener = noop; -process.removeAllListeners = noop; -process.emit = noop; -process.prependListener = noop; -process.prependOnceListener = noop; +module.exports = _nonIterableRest; -process.listeners = function (name) { return [] } +/***/ }), +/* 184 */, +/* 185 */, +/* 186 */ +/***/ (function(module, exports, __webpack_require__) { -process.binding = function (name) { - throw new Error('process.binding is not supported'); -}; +"use strict"; -process.cwd = function () { return '/' }; -process.chdir = function (dir) { - throw new Error('process.chdir is not supported'); -}; -process.umask = function() { return 0; }; +var fixRegExpWellKnownSymbolLogic = __webpack_require__(111); +var isRegExp = __webpack_require__(144); +var anObject = __webpack_require__(9); +var requireObjectCoercible = __webpack_require__(32); +var speciesConstructor = __webpack_require__(150); +var advanceStringIndex = __webpack_require__(121); +var toLength = __webpack_require__(34); +var callRegExpExec = __webpack_require__(112); +var regexpExec = __webpack_require__(91); +var fails = __webpack_require__(6); + +var arrayPush = [].push; +var min = Math.min; +var MAX_UINT32 = 0xFFFFFFFF; + +// babel-minify transpiles RegExp('x', 'y') -> /x/y and it causes SyntaxError +var SUPPORTS_Y = !fails(function () { return !RegExp(MAX_UINT32, 'y'); }); + +// @@split logic +fixRegExpWellKnownSymbolLogic('split', 2, function (SPLIT, nativeSplit, maybeCallNative) { + var internalSplit; + if ( + 'abbc'.split(/(b)*/)[1] == 'c' || + // eslint-disable-next-line regexp/no-empty-group -- required for testing + 'test'.split(/(?:)/, -1).length != 4 || + 'ab'.split(/(?:ab)*/).length != 2 || + '.'.split(/(.?)(.?)/).length != 4 || + // eslint-disable-next-line regexp/no-assertion-capturing-group, regexp/no-empty-group -- required for testing + '.'.split(/()()/).length > 1 || + ''.split(/.?/).length + ) { + // based on es5-shim implementation, need to rework it + internalSplit = function (separator, limit) { + var string = String(requireObjectCoercible(this)); + var lim = limit === undefined ? MAX_UINT32 : limit >>> 0; + if (lim === 0) return []; + if (separator === undefined) return [string]; + // If `separator` is not a regex, use native split + if (!isRegExp(separator)) { + return nativeSplit.call(string, separator, lim); + } + var output = []; + var flags = (separator.ignoreCase ? 'i' : '') + + (separator.multiline ? 'm' : '') + + (separator.unicode ? 'u' : '') + + (separator.sticky ? 'y' : ''); + var lastLastIndex = 0; + // Make `global` and avoid `lastIndex` issues by working with a copy + var separatorCopy = new RegExp(separator.source, flags + 'g'); + var match, lastIndex, lastLength; + while (match = regexpExec.call(separatorCopy, string)) { + lastIndex = separatorCopy.lastIndex; + if (lastIndex > lastLastIndex) { + output.push(string.slice(lastLastIndex, match.index)); + if (match.length > 1 && match.index < string.length) arrayPush.apply(output, match.slice(1)); + lastLength = match[0].length; + lastLastIndex = lastIndex; + if (output.length >= lim) break; + } + if (separatorCopy.lastIndex === match.index) separatorCopy.lastIndex++; // Avoid an infinite loop + } + if (lastLastIndex === string.length) { + if (lastLength || !separatorCopy.test('')) output.push(''); + } else output.push(string.slice(lastLastIndex)); + return output.length > lim ? output.slice(0, lim) : output; + }; + // Chakra, V8 + } else if ('0'.split(undefined, 0).length) { + internalSplit = function (separator, limit) { + return separator === undefined && limit === 0 ? [] : nativeSplit.call(this, separator, limit); + }; + } else internalSplit = nativeSplit; + + return [ + // `String.prototype.split` method + // https://tc39.es/ecma262/#sec-string.prototype.split + function split(separator, limit) { + var O = requireObjectCoercible(this); + var splitter = separator == undefined ? undefined : separator[SPLIT]; + return splitter !== undefined + ? splitter.call(separator, O, limit) + : internalSplit.call(String(O), separator, limit); + }, + // `RegExp.prototype[@@split]` method + // https://tc39.es/ecma262/#sec-regexp.prototype-@@split + // + // NOTE: This cannot be properly polyfilled in engines that don't support + // the 'y' flag. + function (regexp, limit) { + var res = maybeCallNative(internalSplit, regexp, this, limit, internalSplit !== nativeSplit); + if (res.done) return res.value; + + var rx = anObject(regexp); + var S = String(this); + var C = speciesConstructor(rx, RegExp); + + var unicodeMatching = rx.unicode; + var flags = (rx.ignoreCase ? 'i' : '') + + (rx.multiline ? 'm' : '') + + (rx.unicode ? 'u' : '') + + (SUPPORTS_Y ? 'y' : 'g'); + + // ^(? + rx + ) is needed, in combination with some S slicing, to + // simulate the 'y' flag. + var splitter = new C(SUPPORTS_Y ? rx : '^(?:' + rx.source + ')', flags); + var lim = limit === undefined ? MAX_UINT32 : limit >>> 0; + if (lim === 0) return []; + if (S.length === 0) return callRegExpExec(splitter, S) === null ? [S] : []; + var p = 0; + var q = 0; + var A = []; + while (q < S.length) { + splitter.lastIndex = SUPPORTS_Y ? q : 0; + var z = callRegExpExec(splitter, SUPPORTS_Y ? S : S.slice(q)); + var e; + if ( + z === null || + (e = min(toLength(splitter.lastIndex + (SUPPORTS_Y ? 0 : q)), S.length)) === p + ) { + q = advanceStringIndex(S, q, unicodeMatching); + } else { + A.push(S.slice(p, q)); + if (A.length === lim) return A; + for (var i = 1; i <= z.length - 1; i++) { + A.push(z[i]); + if (A.length === lim) return A; + } + q = p = e; + } + } + A.push(S.slice(p)); + return A; + } + ]; +}, !SUPPORTS_Y); /***/ }), -/* 65 */, -/* 66 */ +/* 187 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; +var $ = __webpack_require__(12); +var isObject = __webpack_require__(10); +var isArray = __webpack_require__(84); +var toAbsoluteIndex = __webpack_require__(97); +var toLength = __webpack_require__(34); +var toIndexedObject = __webpack_require__(21); +var createProperty = __webpack_require__(102); +var wellKnownSymbol = __webpack_require__(8); +var arrayMethodHasSpeciesSupport = __webpack_require__(89); + +var HAS_SPECIES_SUPPORT = arrayMethodHasSpeciesSupport('slice'); + +var SPECIES = wellKnownSymbol('species'); +var nativeSlice = [].slice; +var max = Math.max; + +// `Array.prototype.slice` method +// https://tc39.es/ecma262/#sec-array.prototype.slice +// fallback for not array-like ES3 strings and DOM objects +$({ target: 'Array', proto: true, forced: !HAS_SPECIES_SUPPORT }, { + slice: function slice(start, end) { + var O = toIndexedObject(this); + var length = toLength(O.length); + var k = toAbsoluteIndex(start, length); + var fin = toAbsoluteIndex(end === undefined ? length : end, length); + // inline `ArraySpeciesCreate` for usage native `Array#slice` where it's possible + var Constructor, result, n; + if (isArray(O)) { + Constructor = O.constructor; + // cross-realm fallback + if (typeof Constructor == 'function' && (Constructor === Array || isArray(Constructor.prototype))) { + Constructor = undefined; + } else if (isObject(Constructor)) { + Constructor = Constructor[SPECIES]; + if (Constructor === null) Constructor = undefined; + } + if (Constructor === Array || Constructor === undefined) { + return nativeSlice.call(O, k, fin); + } + } + result = new (Constructor === undefined ? Array : Constructor)(max(fin - k, 0)); + for (n = 0; k < fin; k++, n++) if (k in O) createProperty(result, n, O[k]); + result.length = n; + return result; + } +}); -/** - * Internal dependencies; - */ -var isShallowEqualObjects = __webpack_require__( 103 ); -var isShallowEqualArrays = __webpack_require__( 104 ); -var isArray = Array.isArray; +/***/ }), +/* 188 */ +/***/ (function(module, exports, __webpack_require__) { -/** - * @typedef {Record} ComparableObject - */ +var requireObjectCoercible = __webpack_require__(32); +var whitespaces = __webpack_require__(189); -/** - * Returns true if the two arrays or objects are shallow equal, or false - * otherwise. - * - * @param {any[]|ComparableObject} a First object or array to compare. - * @param {any[]|ComparableObject} b Second object or array to compare. - * - * @return {boolean} Whether the two values are shallow equal. - */ -function isShallowEqual( a, b ) { - if ( a && b ) { - if ( a.constructor === Object && b.constructor === Object ) { - return isShallowEqualObjects( a, b ); - } else if ( isArray( a ) && isArray( b ) ) { - return isShallowEqualArrays( a, b ); - } - } +var whitespace = '[' + whitespaces + ']'; +var ltrim = RegExp('^' + whitespace + whitespace + '*'); +var rtrim = RegExp(whitespace + whitespace + '*$'); - return a === b; -} +// `String.prototype.{ trim, trimStart, trimEnd, trimLeft, trimRight }` methods implementation +var createMethod = function (TYPE) { + return function ($this) { + var string = String(requireObjectCoercible($this)); + if (TYPE & 1) string = string.replace(ltrim, ''); + if (TYPE & 2) string = string.replace(rtrim, ''); + return string; + }; +}; -module.exports = isShallowEqual; -module.exports.isShallowEqualObjects = isShallowEqualObjects; -module.exports.isShallowEqualArrays = isShallowEqualArrays; +module.exports = { + // `String.prototype.{ trimLeft, trimStart }` methods + // https://tc39.es/ecma262/#sec-string.prototype.trimstart + start: createMethod(1), + // `String.prototype.{ trimRight, trimEnd }` methods + // https://tc39.es/ecma262/#sec-string.prototype.trimend + end: createMethod(2), + // `String.prototype.trim` method + // https://tc39.es/ecma262/#sec-string.prototype.trim + trim: createMethod(3) +}; /***/ }), -/* 67 */, -/* 68 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 189 */ +/***/ (function(module, exports) { -"use strict"; -/* unused harmony export Button */ -/* harmony import */ var _babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(7); -/* harmony import */ var _babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(11); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__); -/* harmony import */ var classnames__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(4); -/* harmony import */ var classnames__WEBPACK_IMPORTED_MODULE_3___default = /*#__PURE__*/__webpack_require__.n(classnames__WEBPACK_IMPORTED_MODULE_3__); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(2); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_4___default = /*#__PURE__*/__webpack_require__.n(lodash__WEBPACK_IMPORTED_MODULE_4__); -/* harmony import */ var _wordpress_deprecated__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(47); -/* harmony import */ var _tooltip__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(133); -/* harmony import */ var _icon__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(114); +// a string of all valid unicode whitespaces +module.exports = '\u0009\u000A\u000B\u000C\u000D\u0020\u00A0\u1680\u2000\u2001\u2002' + + '\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200A\u202F\u205F\u3000\u2028\u2029\uFEFF'; +/***/ }), +/* 190 */, +/* 191 */, +/* 192 */ +/***/ (function(module, exports, __webpack_require__) { +"use strict"; -function _createForOfIteratorHelper(o, allowArrayLike) { var it; if (typeof Symbol === "undefined" || o[Symbol.iterator] == null) { if (Array.isArray(o) || (it = _unsupportedIterableToArray(o)) || allowArrayLike && o && typeof o.length === "number") { if (it) o = it; var i = 0; var F = function F() {}; return { s: F, n: function n() { if (i >= o.length) return { done: true }; return { done: false, value: o[i++] }; }, e: function e(_e) { throw _e; }, f: F }; } throw new TypeError("Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); } var normalCompletion = true, didErr = false, err; return { s: function s() { it = o[Symbol.iterator](); }, n: function n() { var step = it.next(); normalCompletion = step.done; return step; }, e: function e(_e2) { didErr = true; err = _e2; }, f: function f() { try { if (!normalCompletion && it.return != null) it.return(); } finally { if (didErr) throw err; } } }; } +var $ = __webpack_require__(12); +var $find = __webpack_require__(75).find; +var addToUnscopables = __webpack_require__(118); -function _unsupportedIterableToArray(o, minLen) { if (!o) return; if (typeof o === "string") return _arrayLikeToArray(o, minLen); var n = Object.prototype.toString.call(o).slice(8, -1); if (n === "Object" && o.constructor) n = o.constructor.name; if (n === "Map" || n === "Set") return Array.from(o); if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen); } +var FIND = 'find'; +var SKIPS_HOLES = true; -function _arrayLikeToArray(arr, len) { if (len == null || len > arr.length) len = arr.length; for (var i = 0, arr2 = new Array(len); i < len; i++) { arr2[i] = arr[i]; } return arr2; } +// Shouldn't skip holes +if (FIND in []) Array(1)[FIND](function () { SKIPS_HOLES = false; }); -/** - * External dependencies - */ +// `Array.prototype.find` method +// https://tc39.es/ecma262/#sec-array.prototype.find +$({ target: 'Array', proto: true, forced: SKIPS_HOLES }, { + find: function find(callbackfn /* , that = undefined */) { + return $find(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined); + } +}); +// https://tc39.es/ecma262/#sec-array.prototype-@@unscopables +addToUnscopables(FIND); -/** - * WordPress dependencies - */ +/***/ }), +/* 193 */ +/***/ (function(module, exports, __webpack_require__) { +var global = __webpack_require__(3); -/** - * Internal dependencies - */ +module.exports = global.Promise; +/***/ }), +/* 194 */ +/***/ (function(module, exports, __webpack_require__) { -var disabledEventsOnDisabledButton = ['onMouseDown', 'onClick']; -function Button(props, ref) { - var href = props.href, - target = props.target, - isPrimary = props.isPrimary, - isSmall = props.isSmall, - isTertiary = props.isTertiary, - isPressed = props.isPressed, - isBusy = props.isBusy, - isDefault = props.isDefault, - isSecondary = props.isSecondary, - isLink = props.isLink, - isDestructive = props.isDestructive, - className = props.className, - disabled = props.disabled, - icon = props.icon, - iconSize = props.iconSize, - showTooltip = props.showTooltip, - tooltipPosition = props.tooltipPosition, - shortcut = props.shortcut, - label = props.label, - children = props.children, - isFocusable = props.__experimentalIsFocusable, - additionalProps = Object(_babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])(props, ["href", "target", "isPrimary", "isSmall", "isTertiary", "isPressed", "isBusy", "isDefault", "isSecondary", "isLink", "isDestructive", "className", "disabled", "icon", "iconSize", "showTooltip", "tooltipPosition", "shortcut", "label", "children", "__experimentalIsFocusable"]); +var global = __webpack_require__(3); +var getOwnPropertyDescriptor = __webpack_require__(33).f; +var macrotask = __webpack_require__(157).set; +var IS_IOS = __webpack_require__(158); +var IS_WEBOS_WEBKIT = __webpack_require__(195); +var IS_NODE = __webpack_require__(77); + +var MutationObserver = global.MutationObserver || global.WebKitMutationObserver; +var document = global.document; +var process = global.process; +var Promise = global.Promise; +// Node.js 11 shows ExperimentalWarning on getting `queueMicrotask` +var queueMicrotaskDescriptor = getOwnPropertyDescriptor(global, 'queueMicrotask'); +var queueMicrotask = queueMicrotaskDescriptor && queueMicrotaskDescriptor.value; + +var flush, head, last, notify, toggle, node, promise, then; + +// modern engines have queueMicrotask method +if (!queueMicrotask) { + flush = function () { + var parent, fn; + if (IS_NODE && (parent = process.domain)) parent.exit(); + while (head) { + fn = head.fn; + head = head.next; + try { + fn(); + } catch (error) { + if (head) notify(); + else last = undefined; + throw error; + } + } last = undefined; + if (parent) parent.enter(); + }; - if (isDefault) { - Object(_wordpress_deprecated__WEBPACK_IMPORTED_MODULE_5__[/* default */ "a"])('Button isDefault prop', { - alternative: 'isSecondary' - }); + // browsers with MutationObserver, except iOS - https://github.com/zloirock/core-js/issues/339 + // also except WebOS Webkit https://github.com/zloirock/core-js/issues/898 + if (!IS_IOS && !IS_NODE && !IS_WEBOS_WEBKIT && MutationObserver && document) { + toggle = true; + node = document.createTextNode(''); + new MutationObserver(flush).observe(node, { characterData: true }); + notify = function () { + node.data = toggle = !toggle; + }; + // environments with maybe non-completely correct, but existent Promise + } else if (Promise && Promise.resolve) { + // Promise.resolve without an argument throws an error in LG WebOS 2 + promise = Promise.resolve(undefined); + then = promise.then; + notify = function () { + then.call(promise, flush); + }; + // Node.js without promises + } else if (IS_NODE) { + notify = function () { + process.nextTick(flush); + }; + // for other environments - macrotask based on: + // - setImmediate + // - MessageChannel + // - window.postMessag + // - onreadystatechange + // - setTimeout + } else { + notify = function () { + // strange IE + webpack dev server bug - use .call(global) + macrotask.call(global, flush); + }; } +} - var classes = classnames__WEBPACK_IMPORTED_MODULE_3___default()('components-button', className, { - 'is-secondary': isDefault || isSecondary, - 'is-primary': isPrimary, - 'is-small': isSmall, - 'is-tertiary': isTertiary, - 'is-pressed': isPressed, - 'is-busy': isBusy, - 'is-link': isLink, - 'is-destructive': isDestructive, - 'has-text': !!icon && !!children, - 'has-icon': !!icon - }); - var trulyDisabled = disabled && !isFocusable; - var Tag = href !== undefined && !trulyDisabled ? 'a' : 'button'; - var tagProps = Tag === 'a' ? { - href: href, - target: target - } : { - type: 'button', - disabled: trulyDisabled, - 'aria-pressed': isPressed - }; - - if (disabled && isFocusable) { - // In this case, the button will be disabled, but still focusable and - // perceivable by screen reader users. - tagProps['aria-disabled'] = true; +module.exports = queueMicrotask || function (fn) { + var task = { fn: fn, next: undefined }; + if (last) last.next = task; + if (!head) { + head = task; + notify(); + } last = task; +}; - var _iterator = _createForOfIteratorHelper(disabledEventsOnDisabledButton), - _step; - try { - for (_iterator.s(); !(_step = _iterator.n()).done;) { - var disabledEvent = _step.value; +/***/ }), +/* 195 */ +/***/ (function(module, exports, __webpack_require__) { - additionalProps[disabledEvent] = function (event) { - event.stopPropagation(); - event.preventDefault(); - }; - } - } catch (err) { - _iterator.e(err); - } finally { - _iterator.f(); - } - } // Should show the tooltip if... +var userAgent = __webpack_require__(87); +module.exports = /web0s(?!.*chrome)/i.test(userAgent); - var shouldShowTooltip = !trulyDisabled && ( // an explicit tooltip is passed or... - showTooltip && label || // there's a shortcut or... - shortcut || // there's a label and... - !!label && ( // the children are empty and... - !children || Object(lodash__WEBPACK_IMPORTED_MODULE_4__["isArray"])(children) && !children.length) && // the tooltip is not explicitly disabled. - false !== showTooltip); - var element = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__["createElement"])(Tag, Object(_babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])({}, tagProps, additionalProps, { - className: classes, - "aria-label": additionalProps['aria-label'] || label, - ref: ref - }), icon && Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__["createElement"])(_icon__WEBPACK_IMPORTED_MODULE_7__[/* default */ "a"], { - icon: icon, - size: iconSize - }), children); - - if (!shouldShowTooltip) { - return element; - } - - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__["createElement"])(_tooltip__WEBPACK_IMPORTED_MODULE_6__[/* default */ "a"], { - text: label, - shortcut: shortcut, - position: tooltipPosition - }, element); -} -/* harmony default export */ __webpack_exports__["a"] = (Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__["forwardRef"])(Button)); -//# sourceMappingURL=index.js.map /***/ }), -/* 69 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; +/* 196 */ +/***/ (function(module, exports, __webpack_require__) { -// EXPORTS -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ build_module_focus; }); +var anObject = __webpack_require__(9); +var isObject = __webpack_require__(10); +var newPromiseCapability = __webpack_require__(159); + +module.exports = function (C, x) { + anObject(C); + if (isObject(x) && x.constructor === C) return x; + var promiseCapability = newPromiseCapability.f(C); + var resolve = promiseCapability.resolve; + resolve(x); + return promiseCapability.promise; +}; -// UNUSED EXPORTS: isHorizontalEdge, isVerticalEdge, getRectangleFromRange, computeCaretRect, placeCaretAtHorizontalEdge, placeCaretAtVerticalEdge, isTextField, isNumberInput, documentHasTextSelection, documentHasUncollapsedSelection, documentHasSelection, isEntirelySelected, getScrollContainer, getOffsetParent, replace, remove, insertAfter, unwrap, replaceTag, wrap, __unstableStripHTML, isEmpty, removeInvalidHTML, getPhrasingContentSchema, isPhrasingContent, isTextContent -// NAMESPACE OBJECT: ./node_modules/@wordpress/components/node_modules/@wordpress/dom/build-module/focusable.js -var focusable_namespaceObject = {}; -__webpack_require__.r(focusable_namespaceObject); -__webpack_require__.d(focusable_namespaceObject, "find", function() { return find; }); +/***/ }), +/* 197 */ +/***/ (function(module, exports, __webpack_require__) { -// NAMESPACE OBJECT: ./node_modules/@wordpress/components/node_modules/@wordpress/dom/build-module/tabbable.js -var tabbable_namespaceObject = {}; -__webpack_require__.r(tabbable_namespaceObject); -__webpack_require__.d(tabbable_namespaceObject, "isTabbableIndex", function() { return isTabbableIndex; }); -__webpack_require__.d(tabbable_namespaceObject, "find", function() { return tabbable_find; }); -__webpack_require__.d(tabbable_namespaceObject, "findPrevious", function() { return findPrevious; }); -__webpack_require__.d(tabbable_namespaceObject, "findNext", function() { return findNext; }); +var global = __webpack_require__(3); -// CONCATENATED MODULE: ./node_modules/@wordpress/components/node_modules/@wordpress/dom/build-module/focusable.js -/** - * References: - * - * Focusable: - * - https://www.w3.org/TR/html5/editing.html#focus-management - * - * Sequential focus navigation: - * - https://www.w3.org/TR/html5/editing.html#sequential-focus-navigation-and-the-tabindex-attribute - * - * Disabled elements: - * - https://www.w3.org/TR/html5/disabled-elements.html#disabled-elements - * - * getClientRects algorithm (requiring layout box): - * - https://www.w3.org/TR/cssom-view-1/#extension-to-the-element-interface - * - * AREA elements associated with an IMG: - * - https://w3c.github.io/html/editing.html#data-model - */ -var SELECTOR = ['[tabindex]', 'a[href]', 'button:not([disabled])', 'input:not([type="hidden"]):not([disabled])', 'select:not([disabled])', 'textarea:not([disabled])', 'iframe', 'object', 'embed', 'area[href]', '[contenteditable]:not([contenteditable=false])'].join(','); -/** - * Returns true if the specified element is visible (i.e. neither display: none - * nor visibility: hidden). - * - * @param {Element} element DOM element to test. - * - * @return {boolean} Whether element is visible. - */ +module.exports = function (a, b) { + var console = global.console; + if (console && console.error) { + arguments.length === 1 ? console.error(a) : console.error(a, b); + } +}; -function isVisible(element) { - return element.offsetWidth > 0 || element.offsetHeight > 0 || element.getClientRects().length > 0; -} -/** - * Returns true if the specified element should be skipped from focusable elements. - * For now it rather specific for `iframes` and if tabindex attribute is set to -1. - * - * @param {Element} element DOM element to test. - * - * @return {boolean} Whether element should be skipped from focusable elements. - */ +/***/ }), +/* 198 */ +/***/ (function(module, exports) { -function skipFocus(element) { - return element.nodeName.toLowerCase() === 'iframe' && element.getAttribute('tabindex') === '-1'; -} -/** - * Returns true if the specified area element is a valid focusable element, or - * false otherwise. Area is only focusable if within a map where a named map - * referenced by an image somewhere in the document. - * - * @param {Element} element DOM area element to test. - * - * @return {boolean} Whether area element is valid for focus. - */ +module.exports = function (exec) { + try { + return { error: false, value: exec() }; + } catch (error) { + return { error: true, value: error }; + } +}; -function isValidFocusableArea(element) { - var map = element.closest('map[name]'); +/***/ }), +/* 199 */ +/***/ (function(module, exports, __webpack_require__) { - if (!map) { - return false; - } +"use strict"; - var img = element.ownerDocument.querySelector('img[usemap="#' + map.name + '"]'); - return !!img && isVisible(img); -} -/** - * Returns all focusable elements within a given context. - * - * @param {Element} context Element in which to search. - * - * @return {Element[]} Focusable elements. - */ +var IteratorPrototype = __webpack_require__(173).IteratorPrototype; +var create = __webpack_require__(69); +var createPropertyDescriptor = __webpack_require__(39); +var setToStringTag = __webpack_require__(90); +var Iterators = __webpack_require__(110); +var returnThis = function () { return this; }; -function find(context) { - var elements = context.querySelectorAll(SELECTOR); - return Array.from(elements).filter(function (element) { - if (!isVisible(element) || skipFocus(element)) { - return false; - } +module.exports = function (IteratorConstructor, NAME, next) { + var TO_STRING_TAG = NAME + ' Iterator'; + IteratorConstructor.prototype = create(IteratorPrototype, { next: createPropertyDescriptor(1, next) }); + setToStringTag(IteratorConstructor, TO_STRING_TAG, false, true); + Iterators[TO_STRING_TAG] = returnThis; + return IteratorConstructor; +}; - var nodeName = element.nodeName; - if ('AREA' === nodeName) { - return isValidFocusableArea(element); - } +/***/ }), +/* 200 */ +/***/ (function(module, exports, __webpack_require__) { - return true; - }); -} -//# sourceMappingURL=focusable.js.map -// EXTERNAL MODULE: external "lodash" -var external_lodash_ = __webpack_require__(2); +"use strict"; -// CONCATENATED MODULE: ./node_modules/@wordpress/components/node_modules/@wordpress/dom/build-module/tabbable.js -/** - * External dependencies - */ -/** - * Internal dependencies - */ +var formats = __webpack_require__(169); +var has = Object.prototype.hasOwnProperty; +var isArray = Array.isArray; -/** - * Returns the tab index of the given element. In contrast with the tabIndex - * property, this normalizes the default (0) to avoid browser inconsistencies, - * operating under the assumption that this function is only ever called with a - * focusable node. - * - * @see https://bugzilla.mozilla.org/show_bug.cgi?id=1190261 - * - * @param {Element} element Element from which to retrieve. - * - * @return {?number} Tab index of element (default 0). - */ +var hexTable = (function () { + var array = []; + for (var i = 0; i < 256; ++i) { + array.push('%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase()); + } -function getTabIndex(element) { - var tabIndex = element.getAttribute('tabindex'); - return tabIndex === null ? 0 : parseInt(tabIndex, 10); -} -/** - * Returns true if the specified element is tabbable, or false otherwise. - * - * @param {Element} element Element to test. - * - * @return {boolean} Whether element is tabbable. - */ + return array; +}()); +var compactQueue = function compactQueue(queue) { + while (queue.length > 1) { + var item = queue.pop(); + var obj = item.obj[item.prop]; -function isTabbableIndex(element) { - return getTabIndex(element) !== -1; -} -/** - * Returns a stateful reducer function which constructs a filtered array of - * tabbable elements, where at most one radio input is selected for a given - * name, giving priority to checked input, falling back to the first - * encountered. - * - * @return {Function} Radio group collapse reducer. - */ + if (isArray(obj)) { + var compacted = []; -function createStatefulCollapseRadioGroup() { - var CHOSEN_RADIO_BY_NAME = {}; - return function collapseRadioGroup(result, element) { - var nodeName = element.nodeName, - type = element.type, - checked = element.checked, - name = element.name; // For all non-radio tabbables, construct to array by concatenating. + for (var j = 0; j < obj.length; ++j) { + if (typeof obj[j] !== 'undefined') { + compacted.push(obj[j]); + } + } - if (nodeName !== 'INPUT' || type !== 'radio' || !name) { - return result.concat(element); + item.obj[item.prop] = compacted; + } } +}; - var hasChosen = CHOSEN_RADIO_BY_NAME.hasOwnProperty(name); // Omit by skipping concatenation if the radio element is not chosen. - - var isChosen = checked || !hasChosen; - - if (!isChosen) { - return result; - } // At this point, if there had been a chosen element, the current - // element is checked and should take priority. Retroactively remove - // the element which had previously been considered the chosen one. +var arrayToObject = function arrayToObject(source, options) { + var obj = options && options.plainObjects ? Object.create(null) : {}; + for (var i = 0; i < source.length; ++i) { + if (typeof source[i] !== 'undefined') { + obj[i] = source[i]; + } + } + return obj; +}; - if (hasChosen) { - var hadChosenElement = CHOSEN_RADIO_BY_NAME[name]; - result = Object(external_lodash_["without"])(result, hadChosenElement); +var merge = function merge(target, source, options) { + /* eslint no-param-reassign: 0 */ + if (!source) { + return target; } - CHOSEN_RADIO_BY_NAME[name] = element; - return result.concat(element); - }; -} -/** - * An array map callback, returning an object with the element value and its - * array index location as properties. This is used to emulate a proper stable - * sort where equal tabIndex should be left in order of their occurrence in the - * document. - * - * @param {Element} element Element. - * @param {number} index Array index of element. - * - * @return {Object} Mapped object with element, index. - */ + if (typeof source !== 'object') { + if (isArray(target)) { + target.push(source); + } else if (target && typeof target === 'object') { + if ((options && (options.plainObjects || options.allowPrototypes)) || !has.call(Object.prototype, source)) { + target[source] = true; + } + } else { + return [target, source]; + } + return target; + } -function mapElementToObjectTabbable(element, index) { - return { - element: element, - index: index - }; -} -/** - * An array map callback, returning an element of the given mapped object's - * element value. - * - * @param {Object} object Mapped object with index. - * - * @return {Element} Mapped object element. - */ + if (!target || typeof target !== 'object') { + return [target].concat(source); + } + var mergeTarget = target; + if (isArray(target) && !isArray(source)) { + mergeTarget = arrayToObject(target, options); + } -function mapObjectTabbableToElement(object) { - return object.element; -} -/** - * A sort comparator function used in comparing two objects of mapped elements. - * - * @see mapElementToObjectTabbable - * - * @param {Object} a First object to compare. - * @param {Object} b Second object to compare. - * - * @return {number} Comparator result. - */ + if (isArray(target) && isArray(source)) { + source.forEach(function (item, i) { + if (has.call(target, i)) { + var targetItem = target[i]; + if (targetItem && typeof targetItem === 'object' && item && typeof item === 'object') { + target[i] = merge(targetItem, item, options); + } else { + target.push(item); + } + } else { + target[i] = item; + } + }); + return target; + } + return Object.keys(source).reduce(function (acc, key) { + var value = source[key]; -function compareObjectTabbables(a, b) { - var aTabIndex = getTabIndex(a.element); - var bTabIndex = getTabIndex(b.element); + if (has.call(acc, key)) { + acc[key] = merge(acc[key], value, options); + } else { + acc[key] = value; + } + return acc; + }, mergeTarget); +}; - if (aTabIndex === bTabIndex) { - return a.index - b.index; - } +var assign = function assignSingleSource(target, source) { + return Object.keys(source).reduce(function (acc, key) { + acc[key] = source[key]; + return acc; + }, target); +}; - return aTabIndex - bTabIndex; -} -/** - * Givin focusable elements, filters out tabbable element. - * - * @param {Array} focusables Focusable elements to filter. - * - * @return {Array} Tabbable elements. - */ +var decode = function (str, decoder, charset) { + var strWithoutPlus = str.replace(/\+/g, ' '); + if (charset === 'iso-8859-1') { + // unescape never throws, no try...catch needed: + return strWithoutPlus.replace(/%[0-9a-f]{2}/gi, unescape); + } + // utf-8 + try { + return decodeURIComponent(strWithoutPlus); + } catch (e) { + return strWithoutPlus; + } +}; +var encode = function encode(str, defaultEncoder, charset, kind, format) { + // This code was originally written by Brian White (mscdex) for the io.js core querystring library. + // It has been adapted here for stricter adherence to RFC 3986 + if (str.length === 0) { + return str; + } -function filterTabbable(focusables) { - return focusables.filter(isTabbableIndex).map(mapElementToObjectTabbable).sort(compareObjectTabbables).map(mapObjectTabbableToElement).reduce(createStatefulCollapseRadioGroup(), []); -} + var string = str; + if (typeof str === 'symbol') { + string = Symbol.prototype.toString.call(str); + } else if (typeof str !== 'string') { + string = String(str); + } -function tabbable_find(context) { - return filterTabbable(find(context)); -} -/** - * Given a focusable element, find the preceding tabbable element. - * - * @param {Element} element The focusable element before which to look. Defaults - * to the active element. - */ + if (charset === 'iso-8859-1') { + return escape(string).replace(/%u[0-9a-f]{4}/gi, function ($0) { + return '%26%23' + parseInt($0.slice(2), 16) + '%3B'; + }); + } -function findPrevious(element) { - var focusables = find(element.ownerDocument.body); - var index = focusables.indexOf(element); // Remove all focusables after and including `element`. + var out = ''; + for (var i = 0; i < string.length; ++i) { + var c = string.charCodeAt(i); - focusables.length = index; - return Object(external_lodash_["last"])(filterTabbable(focusables)); -} -/** - * Given a focusable element, find the next tabbable element. - * - * @param {Element} element The focusable element after which to look. Defaults - * to the active element. - */ + if ( + c === 0x2D // - + || c === 0x2E // . + || c === 0x5F // _ + || c === 0x7E // ~ + || (c >= 0x30 && c <= 0x39) // 0-9 + || (c >= 0x41 && c <= 0x5A) // a-z + || (c >= 0x61 && c <= 0x7A) // A-Z + || (format === formats.RFC1738 && (c === 0x28 || c === 0x29)) // ( ) + ) { + out += string.charAt(i); + continue; + } -function findNext(element) { - var focusables = find(element.ownerDocument.body); - var index = focusables.indexOf(element); // Remove all focusables before and inside `element`. + if (c < 0x80) { + out = out + hexTable[c]; + continue; + } - var remaining = focusables.slice(index + 1).filter(function (node) { - return !element.contains(node); - }); - return Object(external_lodash_["first"])(filterTabbable(remaining)); -} -//# sourceMappingURL=tabbable.js.map -// CONCATENATED MODULE: ./node_modules/@wordpress/components/node_modules/@wordpress/dom/build-module/index.js -/** - * Internal dependencies - */ + if (c < 0x800) { + out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } + if (c < 0xD800 || c >= 0xE000) { + out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); + continue; + } -/** - * Object grouping `focusable` and `tabbable` utils - * under the keys with the same name. - */ + i += 1; + c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); + out += hexTable[0xF0 | (c >> 18)] + + hexTable[0x80 | ((c >> 12) & 0x3F)] + + hexTable[0x80 | ((c >> 6) & 0x3F)] + + hexTable[0x80 | (c & 0x3F)]; + } -var build_module_focus = { - focusable: focusable_namespaceObject, - tabbable: tabbable_namespaceObject + return out; }; +var compact = function compact(value) { + var queue = [{ obj: { o: value }, prop: 'o' }]; + var refs = []; -//# sourceMappingURL=index.js.map - -/***/ }), -/* 70 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* unused harmony export getPhrasingContentSchema */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return isPhrasingContent; }); -/* unused harmony export isTextContent */ -/* harmony import */ var _babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(6); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(2); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(lodash__WEBPACK_IMPORTED_MODULE_1__); - - -function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; } + for (var i = 0; i < queue.length; ++i) { + var item = queue[i]; + var obj = item.obj[item.prop]; -function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(_babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } + var keys = Object.keys(obj); + for (var j = 0; j < keys.length; ++j) { + var key = keys[j]; + var val = obj[key]; + if (typeof val === 'object' && val !== null && refs.indexOf(val) === -1) { + queue.push({ obj: obj, prop: key }); + refs.push(val); + } + } + } -/** - * External dependencies - */ + compactQueue(queue); -/** - * All phrasing content elements. - * - * @see https://www.w3.org/TR/2011/WD-html5-20110525/content-models.html#phrasing-content-0 - */ + return value; +}; -/** - * All text-level semantic elements. - * - * @see https://html.spec.whatwg.org/multipage/text-level-semantics.html - */ +var isRegExp = function isRegExp(obj) { + return Object.prototype.toString.call(obj) === '[object RegExp]'; +}; -var textContentSchema = { - strong: {}, - em: {}, - s: {}, - del: {}, - ins: {}, - a: { - attributes: ['href', 'target', 'rel'] - }, - code: {}, - abbr: { - attributes: ['title'] - }, - sub: {}, - sup: {}, - br: {}, - small: {}, - // To do: fix blockquote. - // cite: {}, - q: { - attributes: ['cite'] - }, - dfn: { - attributes: ['title'] - }, - data: { - attributes: ['value'] - }, - time: { - attributes: ['datetime'] - }, - var: {}, - samp: {}, - kbd: {}, - i: {}, - b: {}, - u: {}, - mark: {}, - ruby: {}, - rt: {}, - rp: {}, - bdi: { - attributes: ['dir'] - }, - bdo: { - attributes: ['dir'] - }, - wbr: {}, - '#text': {} -}; // Recursion is needed. -// Possible: strong > em > strong. -// Impossible: strong > strong. - -Object(lodash__WEBPACK_IMPORTED_MODULE_1__["without"])(Object.keys(textContentSchema), '#text', 'br').forEach(function (tag) { - textContentSchema[tag].children = Object(lodash__WEBPACK_IMPORTED_MODULE_1__["omit"])(textContentSchema, tag); -}); -/** - * Embedded content elements. - * - * @see https://www.w3.org/TR/2011/WD-html5-20110525/content-models.html#embedded-content-0 - */ +var isBuffer = function isBuffer(obj) { + if (!obj || typeof obj !== 'object') { + return false; + } -var embeddedContentSchema = { - audio: { - attributes: ['src', 'preload', 'autoplay', 'mediagroup', 'loop', 'muted'] - }, - canvas: { - attributes: ['width', 'height'] - }, - embed: { - attributes: ['src', 'type', 'width', 'height'] - }, - img: { - attributes: ['alt', 'src', 'srcset', 'usemap', 'ismap', 'width', 'height'] - }, - object: { - attributes: ['data', 'type', 'name', 'usemap', 'form', 'width', 'height'] - }, - video: { - attributes: ['src', 'poster', 'preload', 'autoplay', 'mediagroup', 'loop', 'muted', 'controls', 'width', 'height'] - } + return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); }; -/** - * Phrasing content elements. - * - * @see https://www.w3.org/TR/2011/WD-html5-20110525/content-models.html#phrasing-content-0 - */ - -var phrasingContentSchema = _objectSpread(_objectSpread({}, textContentSchema), embeddedContentSchema); -/** - * Get schema of possible paths for phrasing content. - * - * @see https://developer.mozilla.org/en-US/docs/Web/Guide/HTML/Content_categories#Phrasing_content - * - * @param {string} context Set to "paste" to exclude invisible elements and - * sensitive data. - * - * @return {Object} Schema. - */ +var combine = function combine(a, b) { + return [].concat(a, b); +}; -function getPhrasingContentSchema(context) { - if (context !== 'paste') { - return phrasingContentSchema; - } +var maybeMap = function maybeMap(val, fn) { + if (isArray(val)) { + var mapped = []; + for (var i = 0; i < val.length; i += 1) { + mapped.push(fn(val[i])); + } + return mapped; + } + return fn(val); +}; - return Object(lodash__WEBPACK_IMPORTED_MODULE_1__["omit"])(_objectSpread(_objectSpread({}, phrasingContentSchema), {}, { - // We shouldn't paste potentially sensitive information which is not - // visible to the user when pasted, so strip the attributes. - ins: { - children: phrasingContentSchema.ins.children - }, - del: { - children: phrasingContentSchema.del.children - } - }), ['u', // Used to mark misspelling. Shouldn't be pasted. - 'abbr', // Invisible. - 'data', // Invisible. - 'time', // Invisible. - 'wbr', // Invisible. - 'bdi', // Invisible. - 'bdo' // Invisible. - ]); -} -/** - * Find out whether or not the given node is phrasing content. - * - * @see https://developer.mozilla.org/en-US/docs/Web/Guide/HTML/Content_categories#Phrasing_content - * - * @param {Element} node The node to test. - * - * @return {boolean} True if phrasing content, false if not. - */ +module.exports = { + arrayToObject: arrayToObject, + assign: assign, + combine: combine, + compact: compact, + decode: decode, + encode: encode, + isBuffer: isBuffer, + isRegExp: isRegExp, + maybeMap: maybeMap, + merge: merge +}; -function isPhrasingContent(node) { - var tag = node.nodeName.toLowerCase(); - return getPhrasingContentSchema().hasOwnProperty(tag) || tag === 'span'; -} -function isTextContent(node) { - var tag = node.nodeName.toLowerCase(); - return textContentSchema.hasOwnProperty(tag) || tag === 'span'; -} -//# sourceMappingURL=phrasing-content.js.map /***/ }), -/* 71 */ +/* 201 */, +/* 202 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return useSlot; }); -/* harmony import */ var _babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(6); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__); -/* harmony import */ var _slot_fill_context__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(61); - - -function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; } - -function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(_babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } -/** - * WordPress dependencies - */ +// EXPORTS +__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ createBrowserHistory; }); +__webpack_require__.d(__webpack_exports__, "c", function() { return /* binding */ createMemoryHistory; }); +__webpack_require__.d(__webpack_exports__, "b", function() { return /* binding */ createLocation; }); +__webpack_require__.d(__webpack_exports__, "e", function() { return /* binding */ locationsAreEqual; }); +__webpack_require__.d(__webpack_exports__, "d", function() { return /* binding */ createPath; }); -/** - * Internal dependencies - */ +// UNUSED EXPORTS: createHashHistory, parsePath +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/extends.js +var esm_extends = __webpack_require__(117); -function useSlot(name) { - var registry = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__["useContext"])(_slot_fill_context__WEBPACK_IMPORTED_MODULE_2__[/* default */ "a"]); - var slot = registry.slots[name] || {}; - var slotFills = registry.fills[name]; - var fills = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__["useMemo"])(function () { - return slotFills || []; - }, [slotFills]); - var updateSlot = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__["useCallback"])(function (fillProps) { - registry.updateSlot(name, fillProps); - }, [name, registry.updateSlot]); - var unregisterSlot = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__["useCallback"])(function (slotRef) { - registry.unregisterSlot(name, slotRef); - }, [name, registry.unregisterSlot]); - var registerFill = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__["useCallback"])(function (fillRef) { - registry.registerFill(name, fillRef); - }, [name, registry.registerFill]); - var unregisterFill = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__["useCallback"])(function (fillRef) { - registry.unregisterFill(name, fillRef); - }, [name, registry.unregisterFill]); - return _objectSpread(_objectSpread({}, slot), {}, { - updateSlot: updateSlot, - unregisterSlot: unregisterSlot, - fills: fills, - registerFill: registerFill, - unregisterFill: unregisterFill - }); +// CONCATENATED MODULE: ./node_modules/resolve-pathname/esm/resolve-pathname.js +function isAbsolute(pathname) { + return pathname.charAt(0) === '/'; } -//# sourceMappingURL=use-slot.js.map -/***/ }), -/* 72 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +// About 1.5x faster than the two-arg version of Array#splice() +function spliceOne(list, index) { + for (var i = index, k = i + 1, n = list.length; k < n; i += 1, k += 1) { + list[i] = list[k]; + } -"use strict"; -/* WEBPACK VAR INJECTION */(function(process) {/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return warning; }); -function isDev() { - return typeof process !== 'undefined' && process.env && "production" !== 'production'; + list.pop(); } -/** - * Shows a warning with `message` if environment is not `production`. - * - * @param {string} message Message to show in the warning. - * - * @example - * ```js - * import warning from '@wordpress/warning'; - * - * function MyComponent( props ) { - * if ( ! props.title ) { - * warning( '`props.title` was not passed' ); - * } - * ... - * } - * ``` - */ +// This implementation is based heavily on node's url.parse +function resolvePathname(to, from) { + if (from === undefined) from = ''; -function warning(message) { - if (!isDev()) { - return; - } // eslint-disable-next-line no-console + var toParts = (to && to.split('/')) || []; + var fromParts = (from && from.split('/')) || []; + + var isToAbs = to && isAbsolute(to); + var isFromAbs = from && isAbsolute(from); + var mustEndAbs = isToAbs || isFromAbs; + if (to && isAbsolute(to)) { + // to is absolute + fromParts = toParts; + } else if (toParts.length) { + // to is relative, drop the filename + fromParts.pop(); + fromParts = fromParts.concat(toParts); + } - console.warn(message); // Throwing an error and catching it immediately to improve debugging - // A consumer can use 'pause on caught exceptions' - // https://github.com/facebook/react/issues/4216 + if (!fromParts.length) return '/'; - try { - throw Error(message); - } catch (x) {// do nothing + var hasTrailingSlash; + if (fromParts.length) { + var last = fromParts[fromParts.length - 1]; + hasTrailingSlash = last === '.' || last === '..' || last === ''; + } else { + hasTrailingSlash = false; } -} -//# sourceMappingURL=index.js.map -/* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(64))) -/***/ }), -/* 73 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { + var up = 0; + for (var i = fromParts.length; i >= 0; i--) { + var part = fromParts[i]; -"use strict"; -function memoize(fn) { - var cache = {}; - return function (arg) { - if (cache[arg] === undefined) cache[arg] = fn(arg); - return cache[arg]; - }; -} + if (part === '.') { + spliceOne(fromParts, i); + } else if (part === '..') { + spliceOne(fromParts, i); + up++; + } else if (up) { + spliceOne(fromParts, i); + up--; + } + } -/* harmony default export */ __webpack_exports__["a"] = (memoize); + if (!mustEndAbs) for (; up--; up) fromParts.unshift('..'); + if ( + mustEndAbs && + fromParts[0] !== '' && + (!fromParts[0] || !isAbsolute(fromParts[0])) + ) + fromParts.unshift(''); -/***/ }), -/* 74 */ -/***/ (function(module, exports) { + var result = fromParts.join('/'); -(function() { module.exports = this["wc"]["components"]; }()); + if (hasTrailingSlash && result.substr(-1) !== '/') result += '/'; -/***/ }), -/* 75 */ -/***/ (function(module, exports) { - -function asyncGeneratorStep(gen, resolve, reject, _next, _throw, key, arg) { - try { - var info = gen[key](arg); - var value = info.value; - } catch (error) { - reject(error); - return; - } - - if (info.done) { - resolve(value); - } else { - Promise.resolve(value).then(_next, _throw); - } + return result; } -function _asyncToGenerator(fn) { - return function () { - var self = this, - args = arguments; - return new Promise(function (resolve, reject) { - var gen = fn.apply(self, args); - - function _next(value) { - asyncGeneratorStep(gen, resolve, reject, _next, _throw, "next", value); - } - - function _throw(err) { - asyncGeneratorStep(gen, resolve, reject, _next, _throw, "throw", err); - } +/* harmony default export */ var resolve_pathname = (resolvePathname); - _next(undefined); - }); - }; +// CONCATENATED MODULE: ./node_modules/value-equal/esm/value-equal.js +function value_equal_valueOf(obj) { + return obj.valueOf ? obj.valueOf() : Object.prototype.valueOf.call(obj); } -module.exports = _asyncToGenerator; +function valueEqual(a, b) { + // Test for strict equality first. + if (a === b) return true; -/***/ }), -/* 76 */ -/***/ (function(module, exports) { + // Otherwise, if either of them == null they are not equal. + if (a == null || b == null) return false; -(function() { module.exports = this["wp"]["htmlEntities"]; }()); + if (Array.isArray(a)) { + return ( + Array.isArray(b) && + a.length === b.length && + a.every(function(item, index) { + return valueEqual(item, b[index]); + }) + ); + } -/***/ }), -/* 77 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { + if (typeof a === 'object' || typeof b === 'object') { + var aValue = value_equal_valueOf(a); + var bValue = value_equal_valueOf(b); -"use strict"; -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(2); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(lodash__WEBPACK_IMPORTED_MODULE_0__); -/** - * External dependencies - */ + if (aValue !== a || bValue !== b) return valueEqual(aValue, bValue); -/** - * Given a function mapping a component to an enhanced component and modifier - * name, returns the enhanced component augmented with a generated displayName. - * - * @param {Function} mapComponentToEnhancedComponent Function mapping component - * to enhanced component. - * @param {string} modifierName Seed name from which to - * generated display name. - * - * @return {WPComponent} Component class with generated display name assigned. - */ + return Object.keys(Object.assign({}, a, b)).every(function(key) { + return valueEqual(a[key], b[key]); + }); + } -function createHigherOrderComponent(mapComponentToEnhancedComponent, modifierName) { - return function (OriginalComponent) { - var EnhancedComponent = mapComponentToEnhancedComponent(OriginalComponent); - var _OriginalComponent$di = OriginalComponent.displayName, - displayName = _OriginalComponent$di === void 0 ? OriginalComponent.name || 'Component' : _OriginalComponent$di; - EnhancedComponent.displayName = "".concat(Object(lodash__WEBPACK_IMPORTED_MODULE_0__["upperFirst"])(Object(lodash__WEBPACK_IMPORTED_MODULE_0__["camelCase"])(modifierName)), "(").concat(displayName, ")"); - return EnhancedComponent; - }; + return false; } -/* harmony default export */ __webpack_exports__["a"] = (createHigherOrderComponent); -//# sourceMappingURL=index.js.map - -/***/ }), -/* 78 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* harmony default export */ var value_equal = (valueEqual); -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Circle; }); -/* unused harmony export G */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return Path; }); -/* unused harmony export Polygon */ -/* unused harmony export Rect */ -/* unused harmony export Defs */ -/* unused harmony export RadialGradient */ -/* unused harmony export LinearGradient */ -/* unused harmony export Stop */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return SVG; }); -/* harmony import */ var _babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(6); -/* harmony import */ var _babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(11); -/* harmony import */ var classnames__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(4); -/* harmony import */ var classnames__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(classnames__WEBPACK_IMPORTED_MODULE_2__); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_3___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__); +// EXTERNAL MODULE: ./node_modules/tiny-invariant/dist/tiny-invariant.esm.js +var tiny_invariant_esm = __webpack_require__(176); +// CONCATENATED MODULE: ./node_modules/history/esm/history.js -function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; } -function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(_babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } -/** - * External dependencies - */ -/** - * WordPress dependencies - */ +function addLeadingSlash(path) { + return path.charAt(0) === '/' ? path : '/' + path; +} +function stripLeadingSlash(path) { + return path.charAt(0) === '/' ? path.substr(1) : path; +} +function hasBasename(path, prefix) { + return path.toLowerCase().indexOf(prefix.toLowerCase()) === 0 && '/?#'.indexOf(path.charAt(prefix.length)) !== -1; +} +function stripBasename(path, prefix) { + return hasBasename(path, prefix) ? path.substr(prefix.length) : path; +} +function stripTrailingSlash(path) { + return path.charAt(path.length - 1) === '/' ? path.slice(0, -1) : path; +} +function parsePath(path) { + var pathname = path || '/'; + var search = ''; + var hash = ''; + var hashIndex = pathname.indexOf('#'); -/** @typedef {{isPressed?: boolean} & import('react').ComponentPropsWithoutRef<'svg'>} SVGProps */ + if (hashIndex !== -1) { + hash = pathname.substr(hashIndex); + pathname = pathname.substr(0, hashIndex); + } -/** - * @param {import('react').ComponentPropsWithoutRef<'circle'>} props - * - * @return {JSX.Element} Circle component - */ + var searchIndex = pathname.indexOf('?'); -var Circle = function Circle(props) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])('circle', props); -}; -/** - * @param {import('react').ComponentPropsWithoutRef<'g'>} props - * - * @return {JSX.Element} G component - */ + if (searchIndex !== -1) { + search = pathname.substr(searchIndex); + pathname = pathname.substr(0, searchIndex); + } -var G = function G(props) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])('g', props); -}; -/** - * @param {import('react').ComponentPropsWithoutRef<'path'>} props - * - * @return {JSX.Element} Path component - */ + return { + pathname: pathname, + search: search === '?' ? '' : search, + hash: hash === '#' ? '' : hash + }; +} +function createPath(location) { + var pathname = location.pathname, + search = location.search, + hash = location.hash; + var path = pathname || '/'; + if (search && search !== '?') path += search.charAt(0) === '?' ? search : "?" + search; + if (hash && hash !== '#') path += hash.charAt(0) === '#' ? hash : "#" + hash; + return path; +} -var Path = function Path(props) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])('path', props); -}; -/** - * @param {import('react').ComponentPropsWithoutRef<'polygon'>} props - * - * @return {JSX.Element} Polygon component - */ +function createLocation(path, state, key, currentLocation) { + var location; -var Polygon = function Polygon(props) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])('polygon', props); -}; -/** - * @param {import('react').ComponentPropsWithoutRef<'rect'>} props - * - * @return {JSX.Element} Rect component - */ + if (typeof path === 'string') { + // Two-arg form: push(path, state) + location = parsePath(path); + location.state = state; + } else { + // One-arg form: push(location) + location = Object(esm_extends["a" /* default */])({}, path); + if (location.pathname === undefined) location.pathname = ''; -var Rect = function Rect(props) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])('rect', props); -}; -/** - * @param {import('react').ComponentPropsWithoutRef<'defs'>} props - * - * @return {JSX.Element} Defs component - */ + if (location.search) { + if (location.search.charAt(0) !== '?') location.search = '?' + location.search; + } else { + location.search = ''; + } -var Defs = function Defs(props) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])('defs', props); -}; -/** - * @param {import('react').ComponentPropsWithoutRef<'radialGradient'>} props - * - * @return {JSX.Element} RadialGradient component - */ + if (location.hash) { + if (location.hash.charAt(0) !== '#') location.hash = '#' + location.hash; + } else { + location.hash = ''; + } -var RadialGradient = function RadialGradient(props) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])('radialGradient', props); -}; -/** - * @param {import('react').ComponentPropsWithoutRef<'linearGradient'>} props - * - * @return {JSX.Element} LinearGradient component - */ + if (state !== undefined && location.state === undefined) location.state = state; + } -var LinearGradient = function LinearGradient(props) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])('linearGradient', props); -}; -/** - * @param {import('react').ComponentPropsWithoutRef<'stop'>} props - * - * @return {JSX.Element} Stop component - */ + try { + location.pathname = decodeURI(location.pathname); + } catch (e) { + if (e instanceof URIError) { + throw new URIError('Pathname "' + location.pathname + '" could not be decoded. ' + 'This is likely caused by an invalid percent-encoding.'); + } else { + throw e; + } + } -var Stop = function Stop(props) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])('stop', props); -}; -/** - * - * @param {SVGProps} props isPressed indicates whether the SVG should appear as pressed. - * Other props will be passed through to svg component. - * - * @return {JSX.Element} Stop component - */ + if (key) location.key = key; -var SVG = function SVG(_ref) { - var className = _ref.className, - isPressed = _ref.isPressed, - props = Object(_babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])(_ref, ["className", "isPressed"]); + if (currentLocation) { + // Resolve incomplete/relative pathname relative to current location. + if (!location.pathname) { + location.pathname = currentLocation.pathname; + } else if (location.pathname.charAt(0) !== '/') { + location.pathname = resolve_pathname(location.pathname, currentLocation.pathname); + } + } else { + // When there is no prior location and pathname is empty, set it to / + if (!location.pathname) { + location.pathname = '/'; + } + } - var appliedProps = _objectSpread(_objectSpread({}, props), {}, { - className: classnames__WEBPACK_IMPORTED_MODULE_2___default()(className, { - 'is-pressed': isPressed - }) || undefined, - role: 'img', - 'aria-hidden': true, - focusable: false - }); // Disable reason: We need to have a way to render HTML tag for web. - // eslint-disable-next-line react/forbid-elements + return location; +} +function locationsAreEqual(a, b) { + return a.pathname === b.pathname && a.search === b.search && a.hash === b.hash && a.key === b.key && value_equal(a.state, b.state); +} +function createTransitionManager() { + var prompt = null; - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])("svg", appliedProps); -}; -//# sourceMappingURL=index.js.map + function setPrompt(nextPrompt) { + false ? undefined : void 0; + prompt = nextPrompt; + return function () { + if (prompt === nextPrompt) prompt = null; + }; + } -/***/ }), -/* 79 */, -/* 80 */, -/* 81 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { + function confirmTransitionTo(location, action, getUserConfirmation, callback) { + // TODO: If another transition starts while we're still confirming + // the previous one, we may end up in a weird state. Figure out the + // best way to handle this. + if (prompt != null) { + var result = typeof prompt === 'function' ? prompt(location, action) : prompt; -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return domReady; }); -/** - * @typedef {() => void} Callback - * - * TODO: Remove this typedef and inline `() => void` type. - * - * This typedef is used so that a descriptive type is provided in our - * automatically generated documentation. - * - * An in-line type `() => void` would be preferable, but the generated - * documentation is `null` in that case. - * - * @see https://github.com/WordPress/gutenberg/issues/18045 - */ - -/** - * Specify a function to execute when the DOM is fully loaded. - * - * @param {Callback} callback A function to execute after the DOM is ready. - * - * @example - * ```js - * import domReady from '@wordpress/dom-ready'; - * - * domReady( function() { - * //do something after DOM loads. - * } ); - * ``` - * - * @return {void} - */ -function domReady(callback) { - if (document.readyState === 'complete' || // DOMContentLoaded + Images/Styles/etc loaded, so we call directly. - document.readyState === 'interactive' // DOMContentLoaded fires at this point, so we call directly. - ) { - return void callback(); - } // DOMContentLoaded has not fired yet, delay callback until then. - - - document.addEventListener('DOMContentLoaded', callback); -} -//# sourceMappingURL=index.js.map - -/***/ }), -/* 82 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -var stringify = __webpack_require__(136); -var parse = __webpack_require__(137); -var formats = __webpack_require__(99); - -module.exports = { - formats: formats, - parse: parse, - stringify: stringify -}; - - -/***/ }), -/* 83 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; - -// EXPORTS -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ get_get; }); - -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js -var getPrototypeOf = __webpack_require__(9); - -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/superPropBase.js - -function _superPropBase(object, property) { - while (!Object.prototype.hasOwnProperty.call(object, property)) { - object = Object(getPrototypeOf["a" /* default */])(object); - if (object === null) break; + if (typeof result === 'string') { + if (typeof getUserConfirmation === 'function') { + getUserConfirmation(result, callback); + } else { + false ? undefined : void 0; + callback(true); + } + } else { + // Return false from a transition hook to cancel the transition. + callback(result !== false); + } + } else { + callback(true); + } } - return object; -} -// CONCATENATED MODULE: ./node_modules/@babel/runtime/helpers/esm/get.js + var listeners = []; -function get_get(target, property, receiver) { - if (typeof Reflect !== "undefined" && Reflect.get) { - get_get = Reflect.get; - } else { - get_get = function _get(target, property, receiver) { - var base = _superPropBase(target, property); - if (!base) return; - var desc = Object.getOwnPropertyDescriptor(base, property); + function appendListener(fn) { + var isActive = true; - if (desc.get) { - return desc.get.call(receiver); - } + function listener() { + if (isActive) fn.apply(void 0, arguments); + } - return desc.value; + listeners.push(listener); + return function () { + isActive = false; + listeners = listeners.filter(function (item) { + return item !== listener; + }); }; } - return get_get(target, property, receiver || target); -} - -/***/ }), -/* 84 */, -/* 85 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { + function notifyListeners() { + for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { + args[_key] = arguments[_key]; + } -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return useMediaQuery; }); -/* harmony import */ var _babel_runtime_helpers_esm_slicedToArray__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(24); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__); + listeners.forEach(function (listener) { + return listener.apply(void 0, args); + }); + } + return { + setPrompt: setPrompt, + confirmTransitionTo: confirmTransitionTo, + appendListener: appendListener, + notifyListeners: notifyListeners + }; +} +var canUseDOM = !!(typeof window !== 'undefined' && window.document && window.document.createElement); +function getConfirmation(message, callback) { + callback(window.confirm(message)); // eslint-disable-line no-alert +} /** - * WordPress dependencies + * Returns true if the HTML5 history API is supported. Taken from Modernizr. + * + * https://github.com/Modernizr/Modernizr/blob/master/LICENSE + * https://github.com/Modernizr/Modernizr/blob/master/feature-detects/history.js + * changed to avoid false negatives for Windows Phones: https://github.com/reactjs/react-router/issues/586 */ +function supportsHistory() { + var ua = window.navigator.userAgent; + if ((ua.indexOf('Android 2.') !== -1 || ua.indexOf('Android 4.0') !== -1) && ua.indexOf('Mobile Safari') !== -1 && ua.indexOf('Chrome') === -1 && ua.indexOf('Windows Phone') === -1) return false; + return window.history && 'pushState' in window.history; +} /** - * Runs a media query and returns its value when it changes. - * - * @param {string} [query] Media Query. - * @return {boolean} return value of the media query. + * Returns true if browser fires popstate on hash change. + * IE10 and IE11 do not. */ -function useMediaQuery(query) { - var _useState = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__["useState"])(query && window.matchMedia(query).matches), - _useState2 = Object(_babel_runtime_helpers_esm_slicedToArray__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(_useState, 2), - match = _useState2[0], - setMatch = _useState2[1]; - - Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_1__["useEffect"])(function () { - if (!query) { - return; - } - - var updateMatch = function updateMatch() { - return setMatch(window.matchMedia(query).matches); - }; - - updateMatch(); - var list = window.matchMedia(query); - list.addListener(updateMatch); - return function () { - list.removeListener(updateMatch); - }; - }, [query]); - return query && match; +function supportsPopStateOnHashChange() { + return window.navigator.userAgent.indexOf('Trident') === -1; } -//# sourceMappingURL=index.js.map - -/***/ }), -/* 86 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* unused harmony export BASE */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return G2; }); -/* unused harmony export DARK_GRAY */ -/* unused harmony export DARK_OPACITY */ -/* unused harmony export DARK_OPACITY_LIGHT */ -/* unused harmony export LIGHT_GRAY */ -/* unused harmony export LIGHT_OPACITY_LIGHT */ -/* unused harmony export BLUE */ -/* unused harmony export ALERT */ -/* unused harmony export ADMIN */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return UI; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return COLORS; }); -/* harmony import */ var _babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(6); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(2); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(lodash__WEBPACK_IMPORTED_MODULE_1__); -/* harmony import */ var _colors__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(30); - - -function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; } - -function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(_babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } - /** - * External dependencies + * Returns false if using go(n) with hash history causes a full page reload. */ +function supportsGoWithoutReloadUsingHash() { + return window.navigator.userAgent.indexOf('Firefox') === -1; +} /** - * Internal dependencies + * Returns true if a given popstate event is an extraneous WebKit event. + * Accounts for the fact that Chrome on iOS fires real popstate events + * containing undefined state when pressing the back button. */ +function isExtraneousPopstateEvent(event) { + return event.state === undefined && navigator.userAgent.indexOf('CriOS') === -1; +} -var BASE = { - black: '#000', - white: '#fff' -}; +var PopStateEvent = 'popstate'; +var HashChangeEvent = 'hashchange'; + +function getHistoryState() { + try { + return window.history.state || {}; + } catch (e) { + // IE 11 sometimes throws when accessing window.history.state + // See https://github.com/ReactTraining/history/pull/289 + return {}; + } +} /** - * TODO: Continue to update values as "G2" design evolves. - * - * "G2" refers to the movement to advance the interface of the block editor. - * https://github.com/WordPress/gutenberg/issues/18667 + * Creates a history object that uses the HTML5 history API including + * pushState, replaceState, and the popstate event. */ -var G2 = { - blue: { - medium: { - focus: '#007cba', - focusDark: '#fff' - } - }, - gray: { - 900: '#1e1e1e', - 700: '#757575', - // Meets 4.6:1 text contrast against white. - 600: '#949494', - // Meets 3:1 UI or large text contrast against white. - 400: '#ccc', - 200: '#ddd', - // Used for most borders. - 100: '#f0f0f0' - }, - darkGray: { - primary: '#1e1e1e' - }, - mediumGray: { - text: '#757575' - }, - lightGray: { - ui: '#949494', - secondary: '#ccc', - tertiary: '#e7e8e9' - } -}; -var DARK_GRAY = { - 900: '#191e23', - 800: '#23282d', - 700: '#32373c', - 600: '#40464d', - 500: '#555d66', - // Use this most of the time for dark items. - 400: '#606a73', - 300: '#6c7781', - // Lightest gray that can be used for AA text contrast. - 200: '#7e8993', - 150: '#8d96a0', - // Lightest gray that can be used for AA non-text contrast. - 100: '#8f98a1' -}; -var DARK_OPACITY = { - 900: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#000510', 0.9), - 800: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#00000a', 0.85), - 700: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#06060b', 0.8), - 600: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#000913', 0.75), - 500: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#0a1829', 0.7), - 400: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#0a1829', 0.65), - 300: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#0e1c2e', 0.62), - 200: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#162435', 0.55), - 100: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#223443', 0.5), - backgroundFill: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(DARK_GRAY[700], 0.7) -}; -var DARK_OPACITY_LIGHT = { - 900: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#304455', 0.45), - 800: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#425863', 0.4), - 700: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#667886', 0.35), - 600: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#7b86a2', 0.3), - 500: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#9197a2', 0.25), - 400: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#95959c', 0.2), - 300: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#829493', 0.15), - 200: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#8b8b96', 0.1), - 100: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])('#747474', 0.05) -}; -var LIGHT_GRAY = { - 900: '#a2aab2', - 800: '#b5bcc2', - 700: '#ccd0d4', - 600: '#d7dade', - 500: '#e2e4e7', - // Good for "grayed" items and borders. - 400: '#e8eaeb', - // Good for "readonly" input fields and special text selection. - 300: '#edeff0', - 200: '#f3f4f5', - 100: '#f8f9f9' -}; -var LIGHT_OPACITY_LIGHT = { - 900: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(BASE.white, 0.5), - 800: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(BASE.white, 0.45), - 700: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(BASE.white, 0.4), - 600: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(BASE.white, 0.35), - 500: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(BASE.white, 0.3), - 400: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(BASE.white, 0.25), - 300: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(BASE.white, 0.2), - 200: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(BASE.white, 0.15), - 100: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(BASE.white, 0.1), - backgroundFill: Object(_colors__WEBPACK_IMPORTED_MODULE_2__[/* rgba */ "b"])(LIGHT_GRAY[300], 0.8) -}; // Additional colors. -// Some are from https://make.wordpress.org/design/handbook/foundations/colors/. - -var BLUE = { - wordpress: { - 700: '#00669b' - }, - dark: { - 900: '#0071a1' - }, - medium: { - 900: '#006589', - 800: '#00739c', - 700: '#007fac', - 600: '#008dbe', - 500: '#00a0d2', - 400: '#33b3db', - 300: '#66c6e4', - 200: '#bfe7f3', - 100: '#e5f5fa', - highlight: '#b3e7fe', - focus: '#007cba' - } -}; -var ALERT = { - yellow: '#f0b849', - red: '#d94f4f', - green: '#4ab866' -}; -var ADMIN = { - theme: "var( --wp-admin-theme-color, ".concat(BLUE.wordpress[700], ")"), - themeDark10: "var( --wp-admin-theme-color-darker-10, ".concat(BLUE.medium.focus, ")") -}; // Namespaced values for raw colors hex codes - -var UI = { - theme: ADMIN.theme, - background: BASE.white, - backgroundDisabled: LIGHT_GRAY[200], - border: G2.gray[700], - borderFocus: ADMIN.themeDark10, - borderDisabled: G2.gray[400], - borderLight: G2.gray[200], - label: DARK_GRAY[500], - textDisabled: DARK_GRAY[150], - textDark: BASE.white, - textLight: BASE.black -}; -var COLORS = _objectSpread(_objectSpread({}, BASE), {}, { - darkGray: Object(lodash__WEBPACK_IMPORTED_MODULE_1__["merge"])({}, DARK_GRAY, G2.darkGray), - darkOpacity: DARK_OPACITY, - darkOpacityLight: DARK_OPACITY_LIGHT, - mediumGray: G2.mediumGray, - lightGray: Object(lodash__WEBPACK_IMPORTED_MODULE_1__["merge"])({}, LIGHT_GRAY, G2.lightGray), - lightGrayLight: LIGHT_OPACITY_LIGHT, - blue: Object(lodash__WEBPACK_IMPORTED_MODULE_1__["merge"])({}, BLUE, G2.blue), - alert: ALERT, - admin: ADMIN, - ui: UI -}); -/* unused harmony default export */ var _unused_webpack_default_export = (COLORS); -//# sourceMappingURL=colors-values.js.map - -/***/ }), -/* 87 */ -/***/ (function(module, exports, __webpack_require__) { -"use strict"; +function createBrowserHistory(props) { + if (props === void 0) { + props = {}; + } + !canUseDOM ? false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) : void 0; + var globalHistory = window.history; + var canUseHistory = supportsHistory(); + var needsHashChangeListener = !supportsPopStateOnHashChange(); + var _props = props, + _props$forceRefresh = _props.forceRefresh, + forceRefresh = _props$forceRefresh === void 0 ? false : _props$forceRefresh, + _props$getUserConfirm = _props.getUserConfirmation, + getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm, + _props$keyLength = _props.keyLength, + keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength; + var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : ''; -var has = Object.prototype.hasOwnProperty; -var isArray = Array.isArray; + function getDOMLocation(historyState) { + var _ref = historyState || {}, + key = _ref.key, + state = _ref.state; -var hexTable = (function () { - var array = []; - for (var i = 0; i < 256; ++i) { - array.push('%' + ((i < 16 ? '0' : '') + i.toString(16)).toUpperCase()); - } + var _window$location = window.location, + pathname = _window$location.pathname, + search = _window$location.search, + hash = _window$location.hash; + var path = pathname + search + hash; + false ? undefined : void 0; + if (basename) path = stripBasename(path, basename); + return createLocation(path, state, key); + } - return array; -}()); + function createKey() { + return Math.random().toString(36).substr(2, keyLength); + } -var compactQueue = function compactQueue(queue) { - while (queue.length > 1) { - var item = queue.pop(); - var obj = item.obj[item.prop]; + var transitionManager = createTransitionManager(); - if (isArray(obj)) { - var compacted = []; + function setState(nextState) { + Object(esm_extends["a" /* default */])(history, nextState); - for (var j = 0; j < obj.length; ++j) { - if (typeof obj[j] !== 'undefined') { - compacted.push(obj[j]); - } - } + history.length = globalHistory.length; + transitionManager.notifyListeners(history.location, history.action); + } - item.obj[item.prop] = compacted; - } - } -}; + function handlePopState(event) { + // Ignore extraneous popstate events in WebKit. + if (isExtraneousPopstateEvent(event)) return; + handlePop(getDOMLocation(event.state)); + } -var arrayToObject = function arrayToObject(source, options) { - var obj = options && options.plainObjects ? Object.create(null) : {}; - for (var i = 0; i < source.length; ++i) { - if (typeof source[i] !== 'undefined') { - obj[i] = source[i]; - } - } + function handleHashChange() { + handlePop(getDOMLocation(getHistoryState())); + } - return obj; -}; + var forceNextPop = false; -var merge = function merge(target, source, options) { - /* eslint no-param-reassign: 0 */ - if (!source) { - return target; - } - - if (typeof source !== 'object') { - if (isArray(target)) { - target.push(source); - } else if (target && typeof target === 'object') { - if ((options && (options.plainObjects || options.allowPrototypes)) || !has.call(Object.prototype, source)) { - target[source] = true; - } + function handlePop(location) { + if (forceNextPop) { + forceNextPop = false; + setState(); + } else { + var action = 'POP'; + transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { + if (ok) { + setState({ + action: action, + location: location + }); } else { - return [target, source]; + revertPop(location); } - - return target; + }); } + } - if (!target || typeof target !== 'object') { - return [target].concat(source); - } + function revertPop(fromLocation) { + var toLocation = history.location; // TODO: We could probably make this more reliable by + // keeping a list of keys we've seen in sessionStorage. + // Instead, we just default to 0 for keys we don't know. - var mergeTarget = target; - if (isArray(target) && !isArray(source)) { - mergeTarget = arrayToObject(target, options); - } + var toIndex = allKeys.indexOf(toLocation.key); + if (toIndex === -1) toIndex = 0; + var fromIndex = allKeys.indexOf(fromLocation.key); + if (fromIndex === -1) fromIndex = 0; + var delta = toIndex - fromIndex; - if (isArray(target) && isArray(source)) { - source.forEach(function (item, i) { - if (has.call(target, i)) { - var targetItem = target[i]; - if (targetItem && typeof targetItem === 'object' && item && typeof item === 'object') { - target[i] = merge(targetItem, item, options); - } else { - target.push(item); - } - } else { - target[i] = item; - } - }); - return target; + if (delta) { + forceNextPop = true; + go(delta); } + } - return Object.keys(source).reduce(function (acc, key) { - var value = source[key]; - - if (has.call(acc, key)) { - acc[key] = merge(acc[key], value, options); - } else { - acc[key] = value; - } - return acc; - }, mergeTarget); -}; + var initialLocation = getDOMLocation(getHistoryState()); + var allKeys = [initialLocation.key]; // Public interface -var assign = function assignSingleSource(target, source) { - return Object.keys(source).reduce(function (acc, key) { - acc[key] = source[key]; - return acc; - }, target); -}; + function createHref(location) { + return basename + createPath(location); + } -var decode = function (str, decoder, charset) { - var strWithoutPlus = str.replace(/\+/g, ' '); - if (charset === 'iso-8859-1') { - // unescape never throws, no try...catch needed: - return strWithoutPlus.replace(/%[0-9a-f]{2}/gi, unescape); - } - // utf-8 - try { - return decodeURIComponent(strWithoutPlus); - } catch (e) { - return strWithoutPlus; - } -}; + function push(path, state) { + false ? undefined : void 0; + var action = 'PUSH'; + var location = createLocation(path, state, createKey(), history.location); + transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { + if (!ok) return; + var href = createHref(location); + var key = location.key, + state = location.state; -var encode = function encode(str, defaultEncoder, charset) { - // This code was originally written by Brian White (mscdex) for the io.js core querystring library. - // It has been adapted here for stricter adherence to RFC 3986 - if (str.length === 0) { - return str; - } + if (canUseHistory) { + globalHistory.pushState({ + key: key, + state: state + }, null, href); - var string = str; - if (typeof str === 'symbol') { - string = Symbol.prototype.toString.call(str); - } else if (typeof str !== 'string') { - string = String(str); - } + if (forceRefresh) { + window.location.href = href; + } else { + var prevIndex = allKeys.indexOf(history.location.key); + var nextKeys = allKeys.slice(0, prevIndex + 1); + nextKeys.push(location.key); + allKeys = nextKeys; + setState({ + action: action, + location: location + }); + } + } else { + false ? undefined : void 0; + window.location.href = href; + } + }); + } - if (charset === 'iso-8859-1') { - return escape(string).replace(/%u[0-9a-f]{4}/gi, function ($0) { - return '%26%23' + parseInt($0.slice(2), 16) + '%3B'; - }); - } + function replace(path, state) { + false ? undefined : void 0; + var action = 'REPLACE'; + var location = createLocation(path, state, createKey(), history.location); + transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { + if (!ok) return; + var href = createHref(location); + var key = location.key, + state = location.state; - var out = ''; - for (var i = 0; i < string.length; ++i) { - var c = string.charCodeAt(i); + if (canUseHistory) { + globalHistory.replaceState({ + key: key, + state: state + }, null, href); - if ( - c === 0x2D // - - || c === 0x2E // . - || c === 0x5F // _ - || c === 0x7E // ~ - || (c >= 0x30 && c <= 0x39) // 0-9 - || (c >= 0x41 && c <= 0x5A) // a-z - || (c >= 0x61 && c <= 0x7A) // A-Z - ) { - out += string.charAt(i); - continue; + if (forceRefresh) { + window.location.replace(href); + } else { + var prevIndex = allKeys.indexOf(history.location.key); + if (prevIndex !== -1) allKeys[prevIndex] = location.key; + setState({ + action: action, + location: location + }); } + } else { + false ? undefined : void 0; + window.location.replace(href); + } + }); + } - if (c < 0x80) { - out = out + hexTable[c]; - continue; - } + function go(n) { + globalHistory.go(n); + } - if (c < 0x800) { - out = out + (hexTable[0xC0 | (c >> 6)] + hexTable[0x80 | (c & 0x3F)]); - continue; - } + function goBack() { + go(-1); + } - if (c < 0xD800 || c >= 0xE000) { - out = out + (hexTable[0xE0 | (c >> 12)] + hexTable[0x80 | ((c >> 6) & 0x3F)] + hexTable[0x80 | (c & 0x3F)]); - continue; - } + function goForward() { + go(1); + } - i += 1; - c = 0x10000 + (((c & 0x3FF) << 10) | (string.charCodeAt(i) & 0x3FF)); - out += hexTable[0xF0 | (c >> 18)] - + hexTable[0x80 | ((c >> 12) & 0x3F)] - + hexTable[0x80 | ((c >> 6) & 0x3F)] - + hexTable[0x80 | (c & 0x3F)]; - } + var listenerCount = 0; - return out; -}; + function checkDOMListeners(delta) { + listenerCount += delta; -var compact = function compact(value) { - var queue = [{ obj: { o: value }, prop: 'o' }]; - var refs = []; + if (listenerCount === 1 && delta === 1) { + window.addEventListener(PopStateEvent, handlePopState); + if (needsHashChangeListener) window.addEventListener(HashChangeEvent, handleHashChange); + } else if (listenerCount === 0) { + window.removeEventListener(PopStateEvent, handlePopState); + if (needsHashChangeListener) window.removeEventListener(HashChangeEvent, handleHashChange); + } + } - for (var i = 0; i < queue.length; ++i) { - var item = queue[i]; - var obj = item.obj[item.prop]; + var isBlocked = false; - var keys = Object.keys(obj); - for (var j = 0; j < keys.length; ++j) { - var key = keys[j]; - var val = obj[key]; - if (typeof val === 'object' && val !== null && refs.indexOf(val) === -1) { - queue.push({ obj: obj, prop: key }); - refs.push(val); - } - } + function block(prompt) { + if (prompt === void 0) { + prompt = false; } - compactQueue(queue); - - return value; -}; + var unblock = transitionManager.setPrompt(prompt); -var isRegExp = function isRegExp(obj) { - return Object.prototype.toString.call(obj) === '[object RegExp]'; -}; - -var isBuffer = function isBuffer(obj) { - if (!obj || typeof obj !== 'object') { - return false; - } - - return !!(obj.constructor && obj.constructor.isBuffer && obj.constructor.isBuffer(obj)); -}; - -var combine = function combine(a, b) { - return [].concat(a, b); -}; - -var maybeMap = function maybeMap(val, fn) { - if (isArray(val)) { - var mapped = []; - for (var i = 0; i < val.length; i += 1) { - mapped.push(fn(val[i])); - } - return mapped; + if (!isBlocked) { + checkDOMListeners(1); + isBlocked = true; } - return fn(val); -}; - -module.exports = { - arrayToObject: arrayToObject, - assign: assign, - combine: combine, - compact: compact, - decode: decode, - encode: encode, - isBuffer: isBuffer, - isRegExp: isRegExp, - maybeMap: maybeMap, - merge: merge -}; - - -/***/ }), -/* 88 */, -/* 89 */, -/* 90 */ -/***/ (function(module, exports) { - -(function() { module.exports = this["ReactDOM"]; }()); - -/***/ }), -/* 91 */ -/***/ (function(module, exports, __webpack_require__) { -var e=__webpack_require__(8),n={display:"block",opacity:0,position:"absolute",top:0,left:0,height:"100%",width:"100%",overflow:"hidden",pointerEvents:"none",zIndex:-1},t=function(t){var r=t.onResize,u=e.useRef();return function(n,t){var r=function(){return n.current&&n.current.contentDocument&&n.current.contentDocument.defaultView};function u(){t();var e=r();e&&e.addEventListener("resize",t)}e.useEffect((function(){return r()?u():n.current&&n.current.addEventListener&&n.current.addEventListener("load",u),function(){var e=r();e&&"function"==typeof e.removeEventListener&&e.removeEventListener("resize",t)}}),[])}(u,(function(){return r(u)})),e.createElement("iframe",{style:n,src:"about:blank",ref:u,"aria-hidden":!0,tabIndex:-1,frameBorder:0})},r=function(e){return{width:null!=e?e.offsetWidth:null,height:null!=e?e.offsetHeight:null}};module.exports=function(n){void 0===n&&(n=r);var u=e.useState(n(null)),o=u[0],i=u[1],c=e.useCallback((function(e){return i(n(e.current))}),[n]);return[e.useMemo((function(){return e.createElement(t,{onResize:c})}),[c]),o]}; -//# sourceMappingURL=index.js.map + return function () { + if (isBlocked) { + isBlocked = false; + checkDOMListeners(-1); + } + return unblock(); + }; + } -/***/ }), -/* 92 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { + function listen(listener) { + var unlisten = transitionManager.appendListener(listener); + checkDOMListeners(1); + return function () { + checkDOMListeners(-1); + unlisten(); + }; + } -"use strict"; -var isProduction = "production" === 'production'; -var prefix = 'Invariant failed'; -function invariant(condition, message) { - if (condition) { - return; - } - if (isProduction) { - throw new Error(prefix); - } - throw new Error(prefix + ": " + (message || '')); + var history = { + length: globalHistory.length, + action: 'POP', + location: initialLocation, + createHref: createHref, + push: push, + replace: replace, + go: go, + goBack: goBack, + goForward: goForward, + block: block, + listen: listen + }; + return history; } -/* harmony default export */ __webpack_exports__["a"] = (invariant); - - -/***/ }), -/* 93 */ -/***/ (function(module, exports, __webpack_require__) { - -var arrayLikeToArray = __webpack_require__(62); +var HashChangeEvent$1 = 'hashchange'; +var HashPathCoders = { + hashbang: { + encodePath: function encodePath(path) { + return path.charAt(0) === '!' ? path : '!/' + stripLeadingSlash(path); + }, + decodePath: function decodePath(path) { + return path.charAt(0) === '!' ? path.substr(1) : path; + } + }, + noslash: { + encodePath: stripLeadingSlash, + decodePath: addLeadingSlash + }, + slash: { + encodePath: addLeadingSlash, + decodePath: addLeadingSlash + } +}; -function _arrayWithoutHoles(arr) { - if (Array.isArray(arr)) return arrayLikeToArray(arr); +function stripHash(url) { + var hashIndex = url.indexOf('#'); + return hashIndex === -1 ? url : url.slice(0, hashIndex); } -module.exports = _arrayWithoutHoles; - -/***/ }), -/* 94 */ -/***/ (function(module, exports) { - -function _iterableToArray(iter) { - if (typeof Symbol !== "undefined" && Symbol.iterator in Object(iter)) return Array.from(iter); +function getHashPath() { + // We can't use window.location.hash here because it's not + // consistent across browsers - Firefox will pre-decode it! + var href = window.location.href; + var hashIndex = href.indexOf('#'); + return hashIndex === -1 ? '' : href.substring(hashIndex + 1); } -module.exports = _iterableToArray; - -/***/ }), -/* 95 */ -/***/ (function(module, exports) { - -function _nonIterableSpread() { - throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); +function pushHashPath(path) { + window.location.hash = path; } -module.exports = _nonIterableSpread; - -/***/ }), -/* 96 */, -/* 97 */, -/* 98 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +function replaceHashPath(path) { + window.location.replace(stripHash(window.location.href) + '#' + path); +} -"use strict"; +function createHashHistory(props) { + if (props === void 0) { + props = {}; + } -// EXPORTS -__webpack_require__.d(__webpack_exports__, "b", function() { return /* binding */ slot_fill_Slot; }); -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ slot_fill_Fill; }); + !canUseDOM ? false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) : void 0; + var globalHistory = window.history; + var canGoWithoutReload = supportsGoWithoutReloadUsingHash(); + var _props = props, + _props$getUserConfirm = _props.getUserConfirmation, + getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm, + _props$hashType = _props.hashType, + hashType = _props$hashType === void 0 ? 'slash' : _props$hashType; + var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : ''; + var _HashPathCoders$hashT = HashPathCoders[hashType], + encodePath = _HashPathCoders$hashT.encodePath, + decodePath = _HashPathCoders$hashT.decodePath; -// UNUSED EXPORTS: createSlotFill, useSlot, Provider + function getDOMLocation() { + var path = decodePath(getHashPath()); + false ? undefined : void 0; + if (basename) path = stripBasename(path, basename); + return createLocation(path); + } -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/extends.js -var esm_extends = __webpack_require__(7); + var transitionManager = createTransitionManager(); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js -var objectWithoutProperties = __webpack_require__(11); + function setState(nextState) { + Object(esm_extends["a" /* default */])(history, nextState); -// EXTERNAL MODULE: external {"this":["wp","element"]} -var external_this_wp_element_ = __webpack_require__(0); + history.length = globalHistory.length; + transitionManager.notifyListeners(history.location, history.action); + } -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/classCallCheck.js -var classCallCheck = __webpack_require__(16); + var forceNextPop = false; + var ignorePath = null; -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/createClass.js -var createClass = __webpack_require__(17); + function locationsAreEqual$$1(a, b) { + return a.pathname === b.pathname && a.search === b.search && a.hash === b.hash; + } -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js -var assertThisInitialized = __webpack_require__(12); + function handleHashChange() { + var path = getHashPath(); + var encodedPath = encodePath(path); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/get.js + 1 modules -var get = __webpack_require__(83); + if (path !== encodedPath) { + // Ensure we always have a properly-encoded hash. + replaceHashPath(encodedPath); + } else { + var location = getDOMLocation(); + var prevLocation = history.location; + if (!forceNextPop && locationsAreEqual$$1(prevLocation, location)) return; // A hashchange doesn't always == location change. -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/inherits.js + 1 modules -var inherits = __webpack_require__(18); + if (ignorePath === createPath(location)) return; // Ignore this change; we already setState in push/replace. -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js -var possibleConstructorReturn = __webpack_require__(21); + ignorePath = null; + handlePop(location); + } + } -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js -var getPrototypeOf = __webpack_require__(9); + function handlePop(location) { + if (forceNextPop) { + forceNextPop = false; + setState(); + } else { + var action = 'POP'; + transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { + if (ok) { + setState({ + action: action, + location: location + }); + } else { + revertPop(location); + } + }); + } + } -// EXTERNAL MODULE: external "lodash" -var external_lodash_ = __webpack_require__(2); + function revertPop(fromLocation) { + var toLocation = history.location; // TODO: We could probably make this more reliable by + // keeping a list of paths we've seen in sessionStorage. + // Instead, we just default to 0 for paths we don't know. -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/context.js + 1 modules -var context = __webpack_require__(56); + var toIndex = allPaths.lastIndexOf(createPath(toLocation)); + if (toIndex === -1) toIndex = 0; + var fromIndex = allPaths.lastIndexOf(createPath(fromLocation)); + if (fromIndex === -1) fromIndex = 0; + var delta = toIndex - fromIndex; -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/slot.js + if (delta) { + forceNextPop = true; + go(delta); + } + } // Ensure the hash is encoded properly before doing anything else. + var path = getHashPath(); + var encodedPath = encodePath(path); + if (path !== encodedPath) replaceHashPath(encodedPath); + var initialLocation = getDOMLocation(); + var allPaths = [createPath(initialLocation)]; // Public interface + function createHref(location) { + var baseTag = document.querySelector('base'); + var href = ''; + if (baseTag && baseTag.getAttribute('href')) { + href = stripHash(window.location.href); + } + return href + '#' + encodePath(basename + createPath(location)); + } + function push(path, state) { + false ? undefined : void 0; + var action = 'PUSH'; + var location = createLocation(path, undefined, undefined, history.location); + transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { + if (!ok) return; + var path = createPath(location); + var encodedPath = encodePath(basename + path); + var hashChanged = getHashPath() !== encodedPath; + if (hashChanged) { + // We cannot tell if a hashchange was caused by a PUSH, so we'd + // rather setState here and ignore the hashchange. The caveat here + // is that other hash histories in the page will consider it a POP. + ignorePath = path; + pushHashPath(encodedPath); + var prevIndex = allPaths.lastIndexOf(createPath(history.location)); + var nextPaths = allPaths.slice(0, prevIndex + 1); + nextPaths.push(path); + allPaths = nextPaths; + setState({ + action: action, + location: location + }); + } else { + false ? undefined : void 0; + setState(); + } + }); + } + function replace(path, state) { + false ? undefined : void 0; + var action = 'REPLACE'; + var location = createLocation(path, undefined, undefined, history.location); + transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { + if (!ok) return; + var path = createPath(location); + var encodedPath = encodePath(basename + path); + var hashChanged = getHashPath() !== encodedPath; + if (hashChanged) { + // We cannot tell if a hashchange was caused by a REPLACE, so we'd + // rather setState here and ignore the hashchange. The caveat here + // is that other hash histories in the page will consider it a POP. + ignorePath = path; + replaceHashPath(encodedPath); + } -function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(getPrototypeOf["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(possibleConstructorReturn["a" /* default */])(this, result); }; } - -function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } } - -/** - * External dependencies - */ - -/** - * WordPress dependencies - */ - - -/** - * Internal dependencies - */ - + var prevIndex = allPaths.indexOf(createPath(history.location)); + if (prevIndex !== -1) allPaths[prevIndex] = path; + setState({ + action: action, + location: location + }); + }); + } + function go(n) { + false ? undefined : void 0; + globalHistory.go(n); + } -var slot_SlotComponent = /*#__PURE__*/function (_Component) { - Object(inherits["a" /* default */])(SlotComponent, _Component); + function goBack() { + go(-1); + } - var _super = _createSuper(SlotComponent); + function goForward() { + go(1); + } - function SlotComponent() { - var _this; + var listenerCount = 0; - Object(classCallCheck["a" /* default */])(this, SlotComponent); + function checkDOMListeners(delta) { + listenerCount += delta; - _this = _super.apply(this, arguments); - _this.isUnmounted = false; - _this.bindNode = _this.bindNode.bind(Object(assertThisInitialized["a" /* default */])(_this)); - return _this; + if (listenerCount === 1 && delta === 1) { + window.addEventListener(HashChangeEvent$1, handleHashChange); + } else if (listenerCount === 0) { + window.removeEventListener(HashChangeEvent$1, handleHashChange); + } } - Object(createClass["a" /* default */])(SlotComponent, [{ - key: "componentDidMount", - value: function componentDidMount() { - var registerSlot = this.props.registerSlot; - registerSlot(this.props.name, this); - } - }, { - key: "componentWillUnmount", - value: function componentWillUnmount() { - var unregisterSlot = this.props.unregisterSlot; - this.isUnmounted = true; - unregisterSlot(this.props.name, this); - } - }, { - key: "componentDidUpdate", - value: function componentDidUpdate(prevProps) { - var _this$props = this.props, - name = _this$props.name, - unregisterSlot = _this$props.unregisterSlot, - registerSlot = _this$props.registerSlot; + var isBlocked = false; - if (prevProps.name !== name) { - unregisterSlot(prevProps.name); - registerSlot(name, this); - } - } - }, { - key: "bindNode", - value: function bindNode(node) { - this.node = node; + function block(prompt) { + if (prompt === void 0) { + prompt = false; } - }, { - key: "forceUpdate", - value: function forceUpdate() { - if (this.isUnmounted) { - return; - } - Object(get["a" /* default */])(Object(getPrototypeOf["a" /* default */])(SlotComponent.prototype), "forceUpdate", this).call(this); - } - }, { - key: "render", - value: function render() { - var _this$props2 = this.props, - children = _this$props2.children, - name = _this$props2.name, - _this$props2$fillProp = _this$props2.fillProps, - fillProps = _this$props2$fillProp === void 0 ? {} : _this$props2$fillProp, - getFills = _this$props2.getFills; - var fills = Object(external_lodash_["map"])(getFills(name, this), function (fill) { - var fillKey = fill.occurrence; - var fillChildren = Object(external_lodash_["isFunction"])(fill.children) ? fill.children(fillProps) : fill.children; - return external_this_wp_element_["Children"].map(fillChildren, function (child, childIndex) { - if (!child || Object(external_lodash_["isString"])(child)) { - return child; - } + var unblock = transitionManager.setPrompt(prompt); - var childKey = "".concat(fillKey, "---").concat(child.key || childIndex); - return Object(external_this_wp_element_["cloneElement"])(child, { - key: childKey - }); - }); - }).filter( // In some cases fills are rendered only when some conditions apply. - // This ensures that we only use non-empty fills when rendering, i.e., - // it allows us to render wrappers only when the fills are actually present. - Object(external_lodash_["negate"])(external_this_wp_element_["isEmptyElement"])); - return Object(external_this_wp_element_["createElement"])(external_this_wp_element_["Fragment"], null, Object(external_lodash_["isFunction"])(children) ? children(fills) : fills); + if (!isBlocked) { + checkDOMListeners(1); + isBlocked = true; } - }]); - - return SlotComponent; -}(external_this_wp_element_["Component"]); - -var slot_Slot = function Slot(props) { - return Object(external_this_wp_element_["createElement"])(context["a" /* Consumer */], null, function (_ref) { - var registerSlot = _ref.registerSlot, - unregisterSlot = _ref.unregisterSlot, - getFills = _ref.getFills; - return Object(external_this_wp_element_["createElement"])(slot_SlotComponent, Object(esm_extends["a" /* default */])({}, props, { - registerSlot: registerSlot, - unregisterSlot: unregisterSlot, - getFills: getFills - })); - }); -}; - -/* harmony default export */ var slot_fill_slot = (slot_Slot); -//# sourceMappingURL=slot.js.map -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/fill.js - - - -/** - * External dependencies - */ - -/** - * WordPress dependencies - */ - -/** - * Internal dependencies - */ - - -var occurrences = 0; - -function fill_FillComponent(_ref) { - var name = _ref.name, - children = _ref.children, - registerFill = _ref.registerFill, - unregisterFill = _ref.unregisterFill; - var slot = Object(context["c" /* useSlot */])(name); - var ref = Object(external_this_wp_element_["useRef"])({ - name: name, - children: children - }); + return function () { + if (isBlocked) { + isBlocked = false; + checkDOMListeners(-1); + } - if (!ref.current.occurrence) { - ref.current.occurrence = ++occurrences; + return unblock(); + }; } - Object(external_this_wp_element_["useLayoutEffect"])(function () { - registerFill(name, ref.current); + function listen(listener) { + var unlisten = transitionManager.appendListener(listener); + checkDOMListeners(1); return function () { - return unregisterFill(name, ref.current); + checkDOMListeners(-1); + unlisten(); }; - }, []); - Object(external_this_wp_element_["useLayoutEffect"])(function () { - ref.current.children = children; - - if (slot) { - slot.forceUpdate(); - } - }, [children]); - Object(external_this_wp_element_["useLayoutEffect"])(function () { - if (name === ref.current.name) { - // ignore initial effect - return; - } - - unregisterFill(ref.current.name, ref.current); - ref.current.name = name; - registerFill(name, ref.current); - }, [name]); - - if (!slot || !slot.node) { - return null; - } // If a function is passed as a child, provide it with the fillProps. - - - if (Object(external_lodash_["isFunction"])(children)) { - children = children(slot.props.fillProps); } - return Object(external_this_wp_element_["createPortal"])(children, slot.node); + var history = { + length: globalHistory.length, + action: 'POP', + location: initialLocation, + createHref: createHref, + push: push, + replace: replace, + go: go, + goBack: goBack, + goForward: goForward, + block: block, + listen: listen + }; + return history; } -var fill_Fill = function Fill(props) { - return Object(external_this_wp_element_["createElement"])(context["a" /* Consumer */], null, function (_ref2) { - var registerFill = _ref2.registerFill, - unregisterFill = _ref2.unregisterFill; - return Object(external_this_wp_element_["createElement"])(fill_FillComponent, Object(esm_extends["a" /* default */])({}, props, { - registerFill: registerFill, - unregisterFill: unregisterFill - })); - }); -}; - -/* harmony default export */ var slot_fill_fill = (fill_Fill); -//# sourceMappingURL=fill.js.map -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/bubbles-virtually/slot-fill-context.js -var slot_fill_context = __webpack_require__(61); - -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/bubbles-virtually/slot.js - - - - -/** - * WordPress dependencies - */ - -/** - * Internal dependencies - */ - - -function bubbles_virtually_slot_Slot(_ref) { - var name = _ref.name, - _ref$fillProps = _ref.fillProps, - fillProps = _ref$fillProps === void 0 ? {} : _ref$fillProps, - _ref$as = _ref.as, - Component = _ref$as === void 0 ? 'div' : _ref$as, - props = Object(objectWithoutProperties["a" /* default */])(_ref, ["name", "fillProps", "as"]); - - var registry = Object(external_this_wp_element_["useContext"])(slot_fill_context["a" /* default */]); - var ref = Object(external_this_wp_element_["useRef"])(); - Object(external_this_wp_element_["useLayoutEffect"])(function () { - registry.registerSlot(name, ref, fillProps); - return function () { - registry.unregisterSlot(name, ref); - }; // We are not including fillProps in the deps because we don't want to - // unregister and register the slot whenever fillProps change, which would - // cause the fill to be re-mounted. We are only considering the initial value - // of fillProps. - }, [registry.registerSlot, registry.unregisterSlot, name]); // fillProps may be an update that interacts with the layout, so we - // useLayoutEffect - - Object(external_this_wp_element_["useLayoutEffect"])(function () { - registry.updateSlot(name, fillProps); - }); - return Object(external_this_wp_element_["createElement"])(Component, Object(esm_extends["a" /* default */])({ - ref: ref - }, props)); +function clamp(n, lowerBound, upperBound) { + return Math.min(Math.max(n, lowerBound), upperBound); } -//# sourceMappingURL=slot.js.map -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/slicedToArray.js + 3 modules -var slicedToArray = __webpack_require__(24); - -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/bubbles-virtually/use-slot.js -var use_slot = __webpack_require__(71); - -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/bubbles-virtually/fill.js - - /** - * WordPress dependencies - */ - -/** - * Internal dependencies + * Creates a history object that stores locations in memory. */ +function createMemoryHistory(props) { + if (props === void 0) { + props = {}; + } -function useForceUpdate() { - var _useState = Object(external_this_wp_element_["useState"])({}), - _useState2 = Object(slicedToArray["a" /* default */])(_useState, 2), - setState = _useState2[1]; - - return function () { - return setState({}); - }; -} + var _props = props, + getUserConfirmation = _props.getUserConfirmation, + _props$initialEntries = _props.initialEntries, + initialEntries = _props$initialEntries === void 0 ? ['/'] : _props$initialEntries, + _props$initialIndex = _props.initialIndex, + initialIndex = _props$initialIndex === void 0 ? 0 : _props$initialIndex, + _props$keyLength = _props.keyLength, + keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength; + var transitionManager = createTransitionManager(); -function bubbles_virtually_fill_Fill(_ref) { - var name = _ref.name, - children = _ref.children; - var slot = Object(use_slot["a" /* default */])(name); - var ref = Object(external_this_wp_element_["useRef"])({ - rerender: useForceUpdate() - }); - Object(external_this_wp_element_["useEffect"])(function () { - // We register fills so we can keep track of their existance. - // Some Slot implementations need to know if there're already fills - // registered so they can choose to render themselves or not. - slot.registerFill(ref); - return function () { - slot.unregisterFill(ref); - }; - }, [slot.registerFill, slot.unregisterFill]); + function setState(nextState) { + Object(esm_extends["a" /* default */])(history, nextState); - if (!slot.ref || !slot.ref.current) { - return null; + history.length = history.entries.length; + transitionManager.notifyListeners(history.location, history.action); } - if (typeof children === 'function') { - children = children(slot.fillProps); + function createKey() { + return Math.random().toString(36).substr(2, keyLength); } - return Object(external_this_wp_element_["createPortal"])(children, slot.ref.current); -} -//# sourceMappingURL=fill.js.map -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/index.js - - - - -/** - * Internal dependencies - */ - + var index = clamp(initialIndex, 0, initialEntries.length - 1); + var entries = initialEntries.map(function (entry) { + return typeof entry === 'string' ? createLocation(entry, undefined, createKey()) : createLocation(entry, undefined, entry.key || createKey()); + }); // Public interface + var createHref = createPath; + function push(path, state) { + false ? undefined : void 0; + var action = 'PUSH'; + var location = createLocation(path, state, createKey(), history.location); + transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { + if (!ok) return; + var prevIndex = history.index; + var nextIndex = prevIndex + 1; + var nextEntries = history.entries.slice(0); + if (nextEntries.length > nextIndex) { + nextEntries.splice(nextIndex, nextEntries.length - nextIndex, location); + } else { + nextEntries.push(location); + } + setState({ + action: action, + location: location, + index: nextIndex, + entries: nextEntries + }); + }); + } -function slot_fill_Slot(_ref) { - var bubblesVirtually = _ref.bubblesVirtually, - props = Object(objectWithoutProperties["a" /* default */])(_ref, ["bubblesVirtually"]); + function replace(path, state) { + false ? undefined : void 0; + var action = 'REPLACE'; + var location = createLocation(path, state, createKey(), history.location); + transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { + if (!ok) return; + history.entries[history.index] = location; + setState({ + action: action, + location: location + }); + }); + } - if (bubblesVirtually) { - return Object(external_this_wp_element_["createElement"])(bubbles_virtually_slot_Slot, props); + function go(n) { + var nextIndex = clamp(history.index + n, 0, history.entries.length - 1); + var action = 'POP'; + var location = history.entries[nextIndex]; + transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { + if (ok) { + setState({ + action: action, + location: location, + index: nextIndex + }); + } else { + // Mimic the behavior of DOM histories by + // causing a render after a cancelled POP. + setState(); + } + }); } - return Object(external_this_wp_element_["createElement"])(slot_fill_slot, props); -} -function slot_fill_Fill(props) { - // We're adding both Fills here so they can register themselves before - // their respective slot has been registered. Only the Fill that has a slot - // will render. The other one will return null. - return Object(external_this_wp_element_["createElement"])(external_this_wp_element_["Fragment"], null, Object(external_this_wp_element_["createElement"])(slot_fill_fill, props), Object(external_this_wp_element_["createElement"])(bubbles_virtually_fill_Fill, props)); -} -function createSlotFill(name) { - var FillComponent = function FillComponent(props) { - return Object(external_this_wp_element_["createElement"])(slot_fill_Fill, Object(esm_extends["a" /* default */])({ - name: name - }, props)); - }; + function goBack() { + go(-1); + } - FillComponent.displayName = name + 'Fill'; + function goForward() { + go(1); + } - var SlotComponent = function SlotComponent(props) { - return Object(external_this_wp_element_["createElement"])(slot_fill_Slot, Object(esm_extends["a" /* default */])({ - name: name - }, props)); - }; + function canGo(n) { + var nextIndex = history.index + n; + return nextIndex >= 0 && nextIndex < history.entries.length; + } - SlotComponent.displayName = name + 'Slot'; - return { - Fill: FillComponent, - Slot: SlotComponent + function block(prompt) { + if (prompt === void 0) { + prompt = false; + } + + return transitionManager.setPrompt(prompt); + } + + function listen(listener) { + return transitionManager.appendListener(listener); + } + + var history = { + length: entries.length, + action: 'POP', + location: entries[index], + index: index, + entries: entries, + createHref: createHref, + push: push, + replace: replace, + go: go, + goBack: goBack, + goForward: goForward, + canGo: canGo, + block: block, + listen: listen }; + return history; } -//# sourceMappingURL=index.js.map + + /***/ }), -/* 99 */ +/* 203 */ /***/ (function(module, exports, __webpack_require__) { "use strict"; - -var replace = String.prototype.replace; -var percentTwenties = /%20/g; - -var util = __webpack_require__(87); - -var Format = { - RFC1738: 'RFC1738', - RFC3986: 'RFC3986' -}; - -module.exports = util.assign( - { - 'default': Format.RFC3986, - formatters: { - RFC1738: function (value) { - return replace.call(value, percentTwenties, '+'); - }, - RFC3986: function (value) { - return String(value); - } - } +var fixRegExpWellKnownSymbolLogic = __webpack_require__(111); +var anObject = __webpack_require__(9); +var toLength = __webpack_require__(34); +var requireObjectCoercible = __webpack_require__(32); +var advanceStringIndex = __webpack_require__(121); +var regExpExec = __webpack_require__(112); + +// @@match logic +fixRegExpWellKnownSymbolLogic('match', 1, function (MATCH, nativeMatch, maybeCallNative) { + return [ + // `String.prototype.match` method + // https://tc39.es/ecma262/#sec-string.prototype.match + function match(regexp) { + var O = requireObjectCoercible(this); + var matcher = regexp == undefined ? undefined : regexp[MATCH]; + return matcher !== undefined ? matcher.call(regexp, O) : new RegExp(regexp)[MATCH](String(O)); }, - Format -); + // `RegExp.prototype[@@match]` method + // https://tc39.es/ecma262/#sec-regexp.prototype-@@match + function (regexp) { + var res = maybeCallNative(nativeMatch, regexp, this); + if (res.done) return res.value; + + var rx = anObject(regexp); + var S = String(this); + + if (!rx.global) return regExpExec(rx, S); + + var fullUnicode = rx.unicode; + rx.lastIndex = 0; + var A = []; + var n = 0; + var result; + while ((result = regExpExec(rx, S)) !== null) { + var matchStr = String(result[0]); + A[n] = matchStr; + if (matchStr === '') rx.lastIndex = advanceStringIndex(S, toLength(rx.lastIndex), fullUnicode); + n++; + } + return n === 0 ? null : A; + } + ]; +}); /***/ }), -/* 100 */ +/* 204 */ /***/ (function(module, exports) { -function _arrayWithHoles(arr) { - if (Array.isArray(arr)) return arr; +function _setPrototypeOf(o, p) { + module.exports = _setPrototypeOf = Object.setPrototypeOf || function _setPrototypeOf(o, p) { + o.__proto__ = p; + return o; + }; + + return _setPrototypeOf(o, p); } -module.exports = _arrayWithHoles; +module.exports = _setPrototypeOf; /***/ }), -/* 101 */ -/***/ (function(module, exports) { +/* 205 */ +/***/ (function(module, exports, __webpack_require__) { -function _iterableToArrayLimit(arr, i) { - if (typeof Symbol === "undefined" || !(Symbol.iterator in Object(arr))) return; - var _arr = []; - var _n = true; - var _d = false; - var _e = undefined; +var hiddenKeys = __webpack_require__(36); +var isObject = __webpack_require__(10); +var has = __webpack_require__(11); +var defineProperty = __webpack_require__(17).f; +var uid = __webpack_require__(55); +var FREEZING = __webpack_require__(253); - try { - for (var _i = arr[Symbol.iterator](), _s; !(_n = (_s = _i.next()).done); _n = true) { - _arr.push(_s.value); +var METADATA = uid('meta'); +var id = 0; - if (i && _arr.length === i) break; - } - } catch (err) { - _d = true; - _e = err; - } finally { - try { - if (!_n && _i["return"] != null) _i["return"](); - } finally { - if (_d) throw _e; - } - } +var isExtensible = Object.isExtensible || function () { + return true; +}; - return _arr; -} +var setMetadata = function (it) { + defineProperty(it, METADATA, { value: { + objectID: 'O' + ++id, // object ID + weakData: {} // weak collections IDs + } }); +}; -module.exports = _iterableToArrayLimit; +var fastKey = function (it, create) { + // return a primitive with prefix + if (!isObject(it)) return typeof it == 'symbol' ? it : (typeof it == 'string' ? 'S' : 'P') + it; + if (!has(it, METADATA)) { + // can't set metadata to uncaught frozen object + if (!isExtensible(it)) return 'F'; + // not necessary to add metadata + if (!create) return 'E'; + // add missing metadata + setMetadata(it); + // return object ID + } return it[METADATA].objectID; +}; -/***/ }), -/* 102 */ -/***/ (function(module, exports) { +var getWeakData = function (it, create) { + if (!has(it, METADATA)) { + // can't set metadata to uncaught frozen object + if (!isExtensible(it)) return true; + // not necessary to add metadata + if (!create) return false; + // add missing metadata + setMetadata(it); + // return the store of weak collections IDs + } return it[METADATA].weakData; +}; -function _nonIterableRest() { - throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method."); -} +// add metadata on freeze-family methods calling +var onFreeze = function (it) { + if (FREEZING && meta.REQUIRED && isExtensible(it) && !has(it, METADATA)) setMetadata(it); + return it; +}; + +var meta = module.exports = { + REQUIRED: false, + fastKey: fastKey, + getWeakData: getWeakData, + onFreeze: onFreeze +}; + +hiddenKeys[METADATA] = true; -module.exports = _nonIterableRest; /***/ }), -/* 103 */ +/* 206 */, +/* 207 */ /***/ (function(module, exports, __webpack_require__) { -"use strict"; +var isRegExp = __webpack_require__(144); +module.exports = function (it) { + if (isRegExp(it)) { + throw TypeError("The method doesn't accept regular expressions"); + } return it; +}; -var keys = Object.keys; -/** - * Returns true if the two objects are shallow equal, or false otherwise. - * - * @param {import('.').ComparableObject} a First object to compare. - * @param {import('.').ComparableObject} b Second object to compare. - * - * @return {boolean} Whether the two objects are shallow equal. - */ -function isShallowEqualObjects( a, b ) { - var aKeys, bKeys, i, key, aValue; +/***/ }), +/* 208 */ +/***/ (function(module, exports, __webpack_require__) { - if ( a === b ) { - return true; - } +var wellKnownSymbol = __webpack_require__(8); - aKeys = keys( a ); - bKeys = keys( b ); +var MATCH = wellKnownSymbol('match'); - if ( aKeys.length !== bKeys.length ) { - return false; - } +module.exports = function (METHOD_NAME) { + var regexp = /./; + try { + '/./'[METHOD_NAME](regexp); + } catch (error1) { + try { + regexp[MATCH] = false; + return '/./'[METHOD_NAME](regexp); + } catch (error2) { /* empty */ } + } return false; +}; - i = 0; - - while ( i < aKeys.length ) { - key = aKeys[ i ]; - aValue = a[ key ]; - - if ( - // In iterating only the keys of the first object after verifying - // equal lengths, account for the case that an explicit `undefined` - // value in the first is implicitly undefined in the second. - // - // Example: isShallowEqualObjects( { a: undefined }, { b: 5 } ) - ( aValue === undefined && ! b.hasOwnProperty( key ) ) || - aValue !== b[ key ] - ) { - return false; - } - i++; - } +/***/ }), +/* 209 */ +/***/ (function(module, exports, __webpack_require__) { + +var DESCRIPTORS = __webpack_require__(13); +var global = __webpack_require__(3); +var isForced = __webpack_require__(74); +var inheritIfRequired = __webpack_require__(156); +var defineProperty = __webpack_require__(17).f; +var getOwnPropertyNames = __webpack_require__(56).f; +var isRegExp = __webpack_require__(144); +var getFlags = __webpack_require__(114); +var stickyHelpers = __webpack_require__(137); +var redefine = __webpack_require__(27); +var fails = __webpack_require__(6); +var setInternalState = __webpack_require__(45).set; +var setSpecies = __webpack_require__(153); +var wellKnownSymbol = __webpack_require__(8); + +var MATCH = wellKnownSymbol('match'); +var NativeRegExp = global.RegExp; +var RegExpPrototype = NativeRegExp.prototype; +var re1 = /a/g; +var re2 = /a/g; + +// "new" should create a new object, old webkit bug +var CORRECT_NEW = new NativeRegExp(re1) !== re1; + +var UNSUPPORTED_Y = stickyHelpers.UNSUPPORTED_Y; + +var FORCED = DESCRIPTORS && isForced('RegExp', (!CORRECT_NEW || UNSUPPORTED_Y || fails(function () { + re2[MATCH] = false; + // RegExp constructor can alter flags and IsRegExp works correct with @@match + return NativeRegExp(re1) != re1 || NativeRegExp(re2) == re2 || NativeRegExp(re1, 'i') != '/a/i'; +}))); + +// `RegExp` constructor +// https://tc39.es/ecma262/#sec-regexp-constructor +if (FORCED) { + var RegExpWrapper = function RegExp(pattern, flags) { + var thisIsRegExp = this instanceof RegExpWrapper; + var patternIsRegExp = isRegExp(pattern); + var flagsAreUndefined = flags === undefined; + var sticky; + + if (!thisIsRegExp && patternIsRegExp && pattern.constructor === RegExpWrapper && flagsAreUndefined) { + return pattern; + } + + if (CORRECT_NEW) { + if (patternIsRegExp && !flagsAreUndefined) pattern = pattern.source; + } else if (pattern instanceof RegExpWrapper) { + if (flagsAreUndefined) flags = getFlags.call(pattern); + pattern = pattern.source; + } + + if (UNSUPPORTED_Y) { + sticky = !!flags && flags.indexOf('y') > -1; + if (sticky) flags = flags.replace(/y/g, ''); + } + + var result = inheritIfRequired( + CORRECT_NEW ? new NativeRegExp(pattern, flags) : NativeRegExp(pattern, flags), + thisIsRegExp ? this : RegExpPrototype, + RegExpWrapper + ); + + if (UNSUPPORTED_Y && sticky) setInternalState(result, { sticky: sticky }); - return true; + return result; + }; + var proxy = function (key) { + key in RegExpWrapper || defineProperty(RegExpWrapper, key, { + configurable: true, + get: function () { return NativeRegExp[key]; }, + set: function (it) { NativeRegExp[key] = it; } + }); + }; + var keys = getOwnPropertyNames(NativeRegExp); + var index = 0; + while (keys.length > index) proxy(keys[index++]); + RegExpPrototype.constructor = RegExpWrapper; + RegExpWrapper.prototype = RegExpPrototype; + redefine(global, 'RegExp', RegExpWrapper); } -module.exports = isShallowEqualObjects; +// https://tc39.es/ecma262/#sec-get-regexp-@@species +setSpecies('RegExp'); /***/ }), -/* 104 */ -/***/ (function(module, exports, __webpack_require__) { +/* 210 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return STORE_KEY; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return API_NAMESPACE; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return QUEUE_OPTION_NAME; }); +var STORE_KEY = 'wc/customer-effort-score'; +var API_NAMESPACE = '/wc-admin'; +var QUEUE_OPTION_NAME = 'woocommerce_ces_tracks_queue'; +/***/ }), +/* 211 */ +/***/ (function(module, exports) { -/** - * Returns true if the two arrays are shallow equal, or false otherwise. - * - * @param {any[]} a First array to compare. - * @param {any[]} b Second array to compare. - * - * @return {boolean} Whether the two arrays are shallow equal. - */ -function isShallowEqualArrays( a, b ) { - var i; +(function() { module.exports = window["wp"]["date"]; }()); - if ( a === b ) { - return true; - } +/***/ }), +/* 212 */ +/***/ (function(module, exports, __webpack_require__) { - if ( a.length !== b.length ) { - return false; - } +"use strict"; - for ( i = 0; i < a.length; i++ ) { - if ( a[ i ] !== b[ i ] ) { - return false; - } - } +var aFunction = __webpack_require__(70); +var isObject = __webpack_require__(10); - return true; -} +var slice = [].slice; +var factories = {}; + +var construct = function (C, argsLength, args) { + if (!(argsLength in factories)) { + for (var list = [], i = 0; i < argsLength; i++) list[i] = 'a[' + i + ']'; + // eslint-disable-next-line no-new-func -- we have no proper alternatives, IE8- only + factories[argsLength] = Function('C,a', 'return new C(' + list.join(',') + ')'); + } return factories[argsLength](C, args); +}; -module.exports = isShallowEqualArrays; +// `Function.prototype.bind` method implementation +// https://tc39.es/ecma262/#sec-function.prototype.bind +module.exports = Function.bind || function bind(that /* , ...args */) { + var fn = aFunction(this); + var partArgs = slice.call(arguments, 1); + var boundFunction = function bound(/* args... */) { + var args = partArgs.concat(slice.call(arguments)); + return this instanceof boundFunction ? construct(fn, args.length, args) : fn.apply(that, args); + }; + if (isObject(fn.prototype)) boundFunction.prototype = fn.prototype; + return boundFunction; +}; /***/ }), -/* 105 */, -/* 106 */ +/* 213 */ /***/ (function(module, exports, __webpack_require__) { -// TinyColor v1.4.2 -// https://github.com/bgrins/TinyColor -// Brian Grinstead, MIT License - -(function(Math) { - -var trimLeft = /^\s+/, - trimRight = /\s+$/, - tinyCounter = 0, - mathRound = Math.round, - mathMin = Math.min, - mathMax = Math.max, - mathRandom = Math.random; - -function tinycolor (color, opts) { - - color = (color) ? color : ''; - opts = opts || { }; - - // If input is already a tinycolor, return itself - if (color instanceof tinycolor) { - return color; - } - // If we are called as a function, call using new instead - if (!(this instanceof tinycolor)) { - return new tinycolor(color, opts); - } - - var rgb = inputToRGB(color); - this._originalInput = color, - this._r = rgb.r, - this._g = rgb.g, - this._b = rgb.b, - this._a = rgb.a, - this._roundA = mathRound(100*this._a) / 100, - this._format = opts.format || rgb.format; - this._gradientType = opts.gradientType; - - // Don't let the range of [0,255] come back in [0,1]. - // Potentially lose a little bit of precision here, but will fix issues where - // .5 gets interpreted as half of the total, instead of half of 1 - // If it was supposed to be 128, this was already taken care of by `inputToRgb` - if (this._r < 1) { this._r = mathRound(this._r); } - if (this._g < 1) { this._g = mathRound(this._g); } - if (this._b < 1) { this._b = mathRound(this._b); } - - this._ok = rgb.ok; - this._tc_id = tinyCounter++; -} +var fails = __webpack_require__(6); -tinycolor.prototype = { - isDark: function() { - return this.getBrightness() < 128; - }, - isLight: function() { - return !this.isDark(); - }, - isValid: function() { - return this._ok; - }, - getOriginalInput: function() { - return this._originalInput; - }, - getFormat: function() { - return this._format; - }, - getAlpha: function() { - return this._a; - }, - getBrightness: function() { - //http://www.w3.org/TR/AERT#color-contrast - var rgb = this.toRgb(); - return (rgb.r * 299 + rgb.g * 587 + rgb.b * 114) / 1000; - }, - getLuminance: function() { - //http://www.w3.org/TR/2008/REC-WCAG20-20081211/#relativeluminancedef - var rgb = this.toRgb(); - var RsRGB, GsRGB, BsRGB, R, G, B; - RsRGB = rgb.r/255; - GsRGB = rgb.g/255; - BsRGB = rgb.b/255; - - if (RsRGB <= 0.03928) {R = RsRGB / 12.92;} else {R = Math.pow(((RsRGB + 0.055) / 1.055), 2.4);} - if (GsRGB <= 0.03928) {G = GsRGB / 12.92;} else {G = Math.pow(((GsRGB + 0.055) / 1.055), 2.4);} - if (BsRGB <= 0.03928) {B = BsRGB / 12.92;} else {B = Math.pow(((BsRGB + 0.055) / 1.055), 2.4);} - return (0.2126 * R) + (0.7152 * G) + (0.0722 * B); - }, - setAlpha: function(value) { - this._a = boundAlpha(value); - this._roundA = mathRound(100*this._a) / 100; - return this; - }, - toHsv: function() { - var hsv = rgbToHsv(this._r, this._g, this._b); - return { h: hsv.h * 360, s: hsv.s, v: hsv.v, a: this._a }; - }, - toHsvString: function() { - var hsv = rgbToHsv(this._r, this._g, this._b); - var h = mathRound(hsv.h * 360), s = mathRound(hsv.s * 100), v = mathRound(hsv.v * 100); - return (this._a == 1) ? - "hsv(" + h + ", " + s + "%, " + v + "%)" : - "hsva(" + h + ", " + s + "%, " + v + "%, "+ this._roundA + ")"; - }, - toHsl: function() { - var hsl = rgbToHsl(this._r, this._g, this._b); - return { h: hsl.h * 360, s: hsl.s, l: hsl.l, a: this._a }; - }, - toHslString: function() { - var hsl = rgbToHsl(this._r, this._g, this._b); - var h = mathRound(hsl.h * 360), s = mathRound(hsl.s * 100), l = mathRound(hsl.l * 100); - return (this._a == 1) ? - "hsl(" + h + ", " + s + "%, " + l + "%)" : - "hsla(" + h + ", " + s + "%, " + l + "%, "+ this._roundA + ")"; - }, - toHex: function(allow3Char) { - return rgbToHex(this._r, this._g, this._b, allow3Char); - }, - toHexString: function(allow3Char) { - return '#' + this.toHex(allow3Char); - }, - toHex8: function(allow4Char) { - return rgbaToHex(this._r, this._g, this._b, this._a, allow4Char); - }, - toHex8String: function(allow4Char) { - return '#' + this.toHex8(allow4Char); - }, - toRgb: function() { - return { r: mathRound(this._r), g: mathRound(this._g), b: mathRound(this._b), a: this._a }; - }, - toRgbString: function() { - return (this._a == 1) ? - "rgb(" + mathRound(this._r) + ", " + mathRound(this._g) + ", " + mathRound(this._b) + ")" : - "rgba(" + mathRound(this._r) + ", " + mathRound(this._g) + ", " + mathRound(this._b) + ", " + this._roundA + ")"; - }, - toPercentageRgb: function() { - return { r: mathRound(bound01(this._r, 255) * 100) + "%", g: mathRound(bound01(this._g, 255) * 100) + "%", b: mathRound(bound01(this._b, 255) * 100) + "%", a: this._a }; - }, - toPercentageRgbString: function() { - return (this._a == 1) ? - "rgb(" + mathRound(bound01(this._r, 255) * 100) + "%, " + mathRound(bound01(this._g, 255) * 100) + "%, " + mathRound(bound01(this._b, 255) * 100) + "%)" : - "rgba(" + mathRound(bound01(this._r, 255) * 100) + "%, " + mathRound(bound01(this._g, 255) * 100) + "%, " + mathRound(bound01(this._b, 255) * 100) + "%, " + this._roundA + ")"; - }, - toName: function() { - if (this._a === 0) { - return "transparent"; - } +module.exports = !fails(function () { + function F() { /* empty */ } + F.prototype.constructor = null; + return Object.getPrototypeOf(new F()) !== F.prototype; +}); - if (this._a < 1) { - return false; - } - return hexNames[rgbToHex(this._r, this._g, this._b, true)] || false; - }, - toFilter: function(secondColor) { - var hex8String = '#' + rgbaToArgbHex(this._r, this._g, this._b, this._a); - var secondHex8String = hex8String; - var gradientType = this._gradientType ? "GradientType = 1, " : ""; - - if (secondColor) { - var s = tinycolor(secondColor); - secondHex8String = '#' + rgbaToArgbHex(s._r, s._g, s._b, s._a); - } +/***/ }), +/* 214 */ +/***/ (function(module, exports) { - return "progid:DXImageTransform.Microsoft.gradient("+gradientType+"startColorstr="+hex8String+",endColorstr="+secondHex8String+")"; - }, - toString: function(format) { - var formatSet = !!format; - format = format || this._format; - - var formattedString = false; - var hasAlpha = this._a < 1 && this._a >= 0; - var needsAlphaFormat = !formatSet && hasAlpha && (format === "hex" || format === "hex6" || format === "hex3" || format === "hex4" || format === "hex8" || format === "name"); - - if (needsAlphaFormat) { - // Special case for "transparent", all other non-alpha formats - // will return rgba when there is transparency. - if (format === "name" && this._a === 0) { - return this.toName(); - } - return this.toRgbString(); - } - if (format === "rgb") { - formattedString = this.toRgbString(); - } - if (format === "prgb") { - formattedString = this.toPercentageRgbString(); - } - if (format === "hex" || format === "hex6") { - formattedString = this.toHexString(); - } - if (format === "hex3") { - formattedString = this.toHexString(true); - } - if (format === "hex4") { - formattedString = this.toHex8String(true); - } - if (format === "hex8") { - formattedString = this.toHex8String(); - } - if (format === "name") { - formattedString = this.toName(); - } - if (format === "hsl") { - formattedString = this.toHslString(); - } - if (format === "hsv") { - formattedString = this.toHsvString(); - } - - return formattedString || this.toHexString(); - }, - clone: function() { - return tinycolor(this.toString()); - }, - - _applyModification: function(fn, args) { - var color = fn.apply(null, [this].concat([].slice.call(args))); - this._r = color._r; - this._g = color._g; - this._b = color._b; - this.setAlpha(color._a); - return this; - }, - lighten: function() { - return this._applyModification(lighten, arguments); - }, - brighten: function() { - return this._applyModification(brighten, arguments); - }, - darken: function() { - return this._applyModification(darken, arguments); - }, - desaturate: function() { - return this._applyModification(desaturate, arguments); - }, - saturate: function() { - return this._applyModification(saturate, arguments); - }, - greyscale: function() { - return this._applyModification(greyscale, arguments); - }, - spin: function() { - return this._applyModification(spin, arguments); - }, - - _applyCombination: function(fn, args) { - return fn.apply(null, [this].concat([].slice.call(args))); - }, - analogous: function() { - return this._applyCombination(analogous, arguments); - }, - complement: function() { - return this._applyCombination(complement, arguments); - }, - monochromatic: function() { - return this._applyCombination(monochromatic, arguments); - }, - splitcomplement: function() { - return this._applyCombination(splitcomplement, arguments); - }, - triad: function() { - return this._applyCombination(triad, arguments); - }, - tetrad: function() { - return this._applyCombination(tetrad, arguments); - } +// `SameValue` abstract operation +// https://tc39.es/ecma262/#sec-samevalue +module.exports = Object.is || function is(x, y) { + // eslint-disable-next-line no-self-compare -- NaN check + return x === y ? x !== 0 || 1 / x === 1 / y : x != x && y != y; }; -// If input is an object, force 1 into "1.0" to handle ratios properly -// String input requires "1.0" as input, so 1 will be treated as 1 -tinycolor.fromRatio = function(color, opts) { - if (typeof color == "object") { - var newColor = {}; - for (var i in color) { - if (color.hasOwnProperty(i)) { - if (i === "a") { - newColor[i] = color[i]; - } - else { - newColor[i] = convertToPercentage(color[i]); - } - } - } - color = newColor; - } - - return tinycolor(color, opts); -}; - -// Given a string or object, convert that input to RGB -// Possible string inputs: -// -// "red" -// "#f00" or "f00" -// "#ff0000" or "ff0000" -// "#ff000000" or "ff000000" -// "rgb 255 0 0" or "rgb (255, 0, 0)" -// "rgb 1.0 0 0" or "rgb (1, 0, 0)" -// "rgba (255, 0, 0, 1)" or "rgba 255, 0, 0, 1" -// "rgba (1.0, 0, 0, 1)" or "rgba 1.0, 0, 0, 1" -// "hsl(0, 100%, 50%)" or "hsl 0 100% 50%" -// "hsla(0, 100%, 50%, 1)" or "hsla 0 100% 50%, 1" -// "hsv(0, 100%, 100%)" or "hsv 0 100% 100%" -// -function inputToRGB(color) { - - var rgb = { r: 0, g: 0, b: 0 }; - var a = 1; - var s = null; - var v = null; - var l = null; - var ok = false; - var format = false; - - if (typeof color == "string") { - color = stringInputToObject(color); - } - - if (typeof color == "object") { - if (isValidCSSUnit(color.r) && isValidCSSUnit(color.g) && isValidCSSUnit(color.b)) { - rgb = rgbToRgb(color.r, color.g, color.b); - ok = true; - format = String(color.r).substr(-1) === "%" ? "prgb" : "rgb"; - } - else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.v)) { - s = convertToPercentage(color.s); - v = convertToPercentage(color.v); - rgb = hsvToRgb(color.h, s, v); - ok = true; - format = "hsv"; - } - else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.l)) { - s = convertToPercentage(color.s); - l = convertToPercentage(color.l); - rgb = hslToRgb(color.h, s, l); - ok = true; - format = "hsl"; - } - - if (color.hasOwnProperty("a")) { - a = color.a; - } - } - - a = boundAlpha(a); - - return { - ok: ok, - format: color.format || format, - r: mathMin(255, mathMax(rgb.r, 0)), - g: mathMin(255, mathMax(rgb.g, 0)), - b: mathMin(255, mathMax(rgb.b, 0)), - a: a - }; -} - - -// Conversion Functions -// -------------------- -// `rgbToHsl`, `rgbToHsv`, `hslToRgb`, `hsvToRgb` modified from: -// +/***/ }), +/* 215 */ +/***/ (function(module, exports, __webpack_require__) { -// `rgbToRgb` -// Handle bounds / percentage checking to conform to CSS color spec -// -// *Assumes:* r, g, b in [0, 255] or [0, 1] -// *Returns:* { r, g, b } in [0, 255] -function rgbToRgb(r, g, b){ - return { - r: bound01(r, 255) * 255, - g: bound01(g, 255) * 255, - b: bound01(b, 255) * 255 - }; -} +"use strict"; +/** + * Copyright (c) 2013-present, Facebook, Inc. + * + * This source code is licensed under the MIT license found in the + * LICENSE file in the root directory of this source tree. + */ -// `rgbToHsl` -// Converts an RGB color value to HSL. -// *Assumes:* r, g, and b are contained in [0, 255] or [0, 1] -// *Returns:* { h, s, l } in [0,1] -function rgbToHsl(r, g, b) { - r = bound01(r, 255); - g = bound01(g, 255); - b = bound01(b, 255); - var max = mathMax(r, g, b), min = mathMin(r, g, b); - var h, s, l = (max + min) / 2; +var ReactPropTypesSecret = __webpack_require__(216); - if(max == min) { - h = s = 0; // achromatic - } - else { - var d = max - min; - s = l > 0.5 ? d / (2 - max - min) : d / (max + min); - switch(max) { - case r: h = (g - b) / d + (g < b ? 6 : 0); break; - case g: h = (b - r) / d + 2; break; - case b: h = (r - g) / d + 4; break; - } +function emptyFunction() {} +function emptyFunctionWithReset() {} +emptyFunctionWithReset.resetWarningCache = emptyFunction; - h /= 6; +module.exports = function() { + function shim(props, propName, componentName, location, propFullName, secret) { + if (secret === ReactPropTypesSecret) { + // It is still safe when called from React. + return; } + var err = new Error( + 'Calling PropTypes validators directly is not supported by the `prop-types` package. ' + + 'Use PropTypes.checkPropTypes() to call them. ' + + 'Read more at http://fb.me/use-check-prop-types' + ); + err.name = 'Invariant Violation'; + throw err; + }; + shim.isRequired = shim; + function getShim() { + return shim; + }; + // Important! + // Keep this list in sync with production version in `./factoryWithTypeCheckers.js`. + var ReactPropTypes = { + array: shim, + bool: shim, + func: shim, + number: shim, + object: shim, + string: shim, + symbol: shim, - return { h: h, s: s, l: l }; -} - -// `hslToRgb` -// Converts an HSL color value to RGB. -// *Assumes:* h is contained in [0, 1] or [0, 360] and s and l are contained [0, 1] or [0, 100] -// *Returns:* { r, g, b } in the set [0, 255] -function hslToRgb(h, s, l) { - var r, g, b; - - h = bound01(h, 360); - s = bound01(s, 100); - l = bound01(l, 100); + any: shim, + arrayOf: getShim, + element: shim, + elementType: shim, + instanceOf: getShim, + node: shim, + objectOf: getShim, + oneOf: getShim, + oneOfType: getShim, + shape: getShim, + exact: getShim, - function hue2rgb(p, q, t) { - if(t < 0) t += 1; - if(t > 1) t -= 1; - if(t < 1/6) return p + (q - p) * 6 * t; - if(t < 1/2) return q; - if(t < 2/3) return p + (q - p) * (2/3 - t) * 6; - return p; - } + checkPropTypes: emptyFunctionWithReset, + resetWarningCache: emptyFunction + }; - if(s === 0) { - r = g = b = l; // achromatic - } - else { - var q = l < 0.5 ? l * (1 + s) : l + s - l * s; - var p = 2 * l - q; - r = hue2rgb(p, q, h + 1/3); - g = hue2rgb(p, q, h); - b = hue2rgb(p, q, h - 1/3); - } + ReactPropTypes.PropTypes = ReactPropTypes; - return { r: r * 255, g: g * 255, b: b * 255 }; -} + return ReactPropTypes; +}; -// `rgbToHsv` -// Converts an RGB color value to HSV -// *Assumes:* r, g, and b are contained in the set [0, 255] or [0, 1] -// *Returns:* { h, s, v } in [0,1] -function rgbToHsv(r, g, b) { - r = bound01(r, 255); - g = bound01(g, 255); - b = bound01(b, 255); +/***/ }), +/* 216 */ +/***/ (function(module, exports, __webpack_require__) { - var max = mathMax(r, g, b), min = mathMin(r, g, b); - var h, s, v = max; +"use strict"; +/** + * Copyright (c) 2013-present, Facebook, Inc. + * + * This source code is licensed under the MIT license found in the + * LICENSE file in the root directory of this source tree. + */ - var d = max - min; - s = max === 0 ? 0 : d / max; - if(max == min) { - h = 0; // achromatic - } - else { - switch(max) { - case r: h = (g - b) / d + (g < b ? 6 : 0); break; - case g: h = (b - r) / d + 2; break; - case b: h = (r - g) / d + 4; break; - } - h /= 6; - } - return { h: h, s: s, v: v }; -} -// `hsvToRgb` -// Converts an HSV color value to RGB. -// *Assumes:* h is contained in [0, 1] or [0, 360] and s and v are contained in [0, 1] or [0, 100] -// *Returns:* { r, g, b } in the set [0, 255] - function hsvToRgb(h, s, v) { - - h = bound01(h, 360) * 6; - s = bound01(s, 100); - v = bound01(v, 100); - - var i = Math.floor(h), - f = h - i, - p = v * (1 - s), - q = v * (1 - f * s), - t = v * (1 - (1 - f) * s), - mod = i % 6, - r = [v, q, p, p, t, v][mod], - g = [t, v, v, q, p, p][mod], - b = [p, p, t, v, v, q][mod]; - - return { r: r * 255, g: g * 255, b: b * 255 }; -} +var ReactPropTypesSecret = 'SECRET_DO_NOT_PASS_THIS_OR_YOU_WILL_BE_FIRED'; -// `rgbToHex` -// Converts an RGB color to hex -// Assumes r, g, and b are contained in the set [0, 255] -// Returns a 3 or 6 character hex -function rgbToHex(r, g, b, allow3Char) { +module.exports = ReactPropTypesSecret; - var hex = [ - pad2(mathRound(r).toString(16)), - pad2(mathRound(g).toString(16)), - pad2(mathRound(b).toString(16)) - ]; - // Return a 3 character hex if possible - if (allow3Char && hex[0].charAt(0) == hex[0].charAt(1) && hex[1].charAt(0) == hex[1].charAt(1) && hex[2].charAt(0) == hex[2].charAt(1)) { - return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0); - } +/***/ }), +/* 217 */, +/* 218 */, +/* 219 */, +/* 220 */, +/* 221 */ +/***/ (function(module, exports, __webpack_require__) { - return hex.join(""); -} +"use strict"; -// `rgbaToHex` -// Converts an RGBA color plus alpha transparency to hex -// Assumes r, g, b are contained in the set [0, 255] and -// a in [0, 1]. Returns a 4 or 8 character rgba hex -function rgbaToHex(r, g, b, a, allow4Char) { +var DESCRIPTORS = __webpack_require__(13); +var fails = __webpack_require__(6); +var objectKeys = __webpack_require__(54); +var getOwnPropertySymbolsModule = __webpack_require__(79); +var propertyIsEnumerableModule = __webpack_require__(76); +var toObject = __webpack_require__(37); +var IndexedObject = __webpack_require__(71); - var hex = [ - pad2(mathRound(r).toString(16)), - pad2(mathRound(g).toString(16)), - pad2(mathRound(b).toString(16)), - pad2(convertDecimalToHex(a)) - ]; +var nativeAssign = Object.assign; +var defineProperty = Object.defineProperty; - // Return a 4 character hex if possible - if (allow4Char && hex[0].charAt(0) == hex[0].charAt(1) && hex[1].charAt(0) == hex[1].charAt(1) && hex[2].charAt(0) == hex[2].charAt(1) && hex[3].charAt(0) == hex[3].charAt(1)) { - return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0) + hex[3].charAt(0); +// `Object.assign` method +// https://tc39.es/ecma262/#sec-object.assign +module.exports = !nativeAssign || fails(function () { + // should have correct order of operations (Edge bug) + if (DESCRIPTORS && nativeAssign({ b: 1 }, nativeAssign(defineProperty({}, 'a', { + enumerable: true, + get: function () { + defineProperty(this, 'b', { + value: 3, + enumerable: false + }); } + }), { b: 2 })).b !== 1) return true; + // should work with symbols and should have deterministic property order (V8 bug) + var A = {}; + var B = {}; + /* global Symbol -- required for testing */ + var symbol = Symbol(); + var alphabet = 'abcdefghijklmnopqrst'; + A[symbol] = 7; + alphabet.split('').forEach(function (chr) { B[chr] = chr; }); + return nativeAssign({}, A)[symbol] != 7 || objectKeys(nativeAssign({}, B)).join('') != alphabet; +}) ? function assign(target, source) { // eslint-disable-line no-unused-vars -- required for `.length` + var T = toObject(target); + var argumentsLength = arguments.length; + var index = 1; + var getOwnPropertySymbols = getOwnPropertySymbolsModule.f; + var propertyIsEnumerable = propertyIsEnumerableModule.f; + while (argumentsLength > index) { + var S = IndexedObject(arguments[index++]); + var keys = getOwnPropertySymbols ? objectKeys(S).concat(getOwnPropertySymbols(S)) : objectKeys(S); + var length = keys.length; + var j = 0; + var key; + while (length > j) { + key = keys[j++]; + if (!DESCRIPTORS || propertyIsEnumerable.call(S, key)) T[key] = S[key]; + } + } return T; +} : nativeAssign; - return hex.join(""); -} - -// `rgbaToArgbHex` -// Converts an RGBA color to an ARGB Hex8 string -// Rarely used, but required for "toFilter()" -function rgbaToArgbHex(r, g, b, a) { - - var hex = [ - pad2(convertDecimalToHex(a)), - pad2(mathRound(r).toString(16)), - pad2(mathRound(g).toString(16)), - pad2(mathRound(b).toString(16)) - ]; - - return hex.join(""); -} -// `equals` -// Can be called with any tinycolor input -tinycolor.equals = function (color1, color2) { - if (!color1 || !color2) { return false; } - return tinycolor(color1).toRgbString() == tinycolor(color2).toRgbString(); -}; +/***/ }), +/* 222 */, +/* 223 */, +/* 224 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { -tinycolor.random = function() { - return tinycolor.fromRatio({ - r: mathRandom(), - g: mathRandom(), - b: mathRandom() +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _defineProperty; }); +function _defineProperty(obj, key, value) { + if (key in obj) { + Object.defineProperty(obj, key, { + value: value, + enumerable: true, + configurable: true, + writable: true }); -}; - - -// Modification Functions -// ---------------------- -// Thanks to less.js for some of the basics here -// - -function desaturate(color, amount) { - amount = (amount === 0) ? 0 : (amount || 10); - var hsl = tinycolor(color).toHsl(); - hsl.s -= amount / 100; - hsl.s = clamp01(hsl.s); - return tinycolor(hsl); -} - -function saturate(color, amount) { - amount = (amount === 0) ? 0 : (amount || 10); - var hsl = tinycolor(color).toHsl(); - hsl.s += amount / 100; - hsl.s = clamp01(hsl.s); - return tinycolor(hsl); -} - -function greyscale(color) { - return tinycolor(color).desaturate(100); -} - -function lighten (color, amount) { - amount = (amount === 0) ? 0 : (amount || 10); - var hsl = tinycolor(color).toHsl(); - hsl.l += amount / 100; - hsl.l = clamp01(hsl.l); - return tinycolor(hsl); -} - -function brighten(color, amount) { - amount = (amount === 0) ? 0 : (amount || 10); - var rgb = tinycolor(color).toRgb(); - rgb.r = mathMax(0, mathMin(255, rgb.r - mathRound(255 * - (amount / 100)))); - rgb.g = mathMax(0, mathMin(255, rgb.g - mathRound(255 * - (amount / 100)))); - rgb.b = mathMax(0, mathMin(255, rgb.b - mathRound(255 * - (amount / 100)))); - return tinycolor(rgb); -} - -function darken (color, amount) { - amount = (amount === 0) ? 0 : (amount || 10); - var hsl = tinycolor(color).toHsl(); - hsl.l -= amount / 100; - hsl.l = clamp01(hsl.l); - return tinycolor(hsl); -} - -// Spin takes a positive or negative amount within [-360, 360] indicating the change of hue. -// Values outside of this range will be wrapped into this range. -function spin(color, amount) { - var hsl = tinycolor(color).toHsl(); - var hue = (hsl.h + amount) % 360; - hsl.h = hue < 0 ? 360 + hue : hue; - return tinycolor(hsl); -} - -// Combination Functions -// --------------------- -// Thanks to jQuery xColor for some of the ideas behind these -// - -function complement(color) { - var hsl = tinycolor(color).toHsl(); - hsl.h = (hsl.h + 180) % 360; - return tinycolor(hsl); -} - -function triad(color) { - var hsl = tinycolor(color).toHsl(); - var h = hsl.h; - return [ - tinycolor(color), - tinycolor({ h: (h + 120) % 360, s: hsl.s, l: hsl.l }), - tinycolor({ h: (h + 240) % 360, s: hsl.s, l: hsl.l }) - ]; -} - -function tetrad(color) { - var hsl = tinycolor(color).toHsl(); - var h = hsl.h; - return [ - tinycolor(color), - tinycolor({ h: (h + 90) % 360, s: hsl.s, l: hsl.l }), - tinycolor({ h: (h + 180) % 360, s: hsl.s, l: hsl.l }), - tinycolor({ h: (h + 270) % 360, s: hsl.s, l: hsl.l }) - ]; -} + } else { + obj[key] = value; + } -function splitcomplement(color) { - var hsl = tinycolor(color).toHsl(); - var h = hsl.h; - return [ - tinycolor(color), - tinycolor({ h: (h + 72) % 360, s: hsl.s, l: hsl.l}), - tinycolor({ h: (h + 216) % 360, s: hsl.s, l: hsl.l}) - ]; + return obj; } -function analogous(color, results, slices) { - results = results || 6; - slices = slices || 30; +/***/ }), +/* 225 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { - var hsl = tinycolor(color).toHsl(); - var part = 360 / slices; - var ret = [tinycolor(color)]; +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return _objectWithoutProperties; }); +/* harmony import */ var _babel_runtime_helpers_esm_objectWithoutPropertiesLoose__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(134); - for (hsl.h = ((hsl.h - (part * results >> 1)) + 720) % 360; --results; ) { - hsl.h = (hsl.h + part) % 360; - ret.push(tinycolor(hsl)); - } - return ret; -} +function _objectWithoutProperties(source, excluded) { + if (source == null) return {}; + var target = Object(_babel_runtime_helpers_esm_objectWithoutPropertiesLoose__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(source, excluded); + var key, i; -function monochromatic(color, results) { - results = results || 6; - var hsv = tinycolor(color).toHsv(); - var h = hsv.h, s = hsv.s, v = hsv.v; - var ret = []; - var modification = 1 / results; + if (Object.getOwnPropertySymbols) { + var sourceSymbolKeys = Object.getOwnPropertySymbols(source); - while (results--) { - ret.push(tinycolor({ h: h, s: s, v: v})); - v = (v + modification) % 1; + for (i = 0; i < sourceSymbolKeys.length; i++) { + key = sourceSymbolKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + if (!Object.prototype.propertyIsEnumerable.call(source, key)) continue; + target[key] = source[key]; } + } - return ret; + return target; } -// Utility Functions -// --------------------- - -tinycolor.mix = function(color1, color2, amount) { - amount = (amount === 0) ? 0 : (amount || 50); +/***/ }), +/* 226 */, +/* 227 */ +/***/ (function(module, exports, __webpack_require__) { - var rgb1 = tinycolor(color1).toRgb(); - var rgb2 = tinycolor(color2).toRgb(); +"use strict"; - var p = amount / 100; - var rgba = { - r: ((rgb2.r - rgb1.r) * p) + rgb1.r, - g: ((rgb2.g - rgb1.g) * p) + rgb1.g, - b: ((rgb2.b - rgb1.b) * p) + rgb1.b, - a: ((rgb2.a - rgb1.a) * p) + rgb1.a - }; +var utils = __webpack_require__(200); +var formats = __webpack_require__(169); +var has = Object.prototype.hasOwnProperty; - return tinycolor(rgba); +var arrayPrefixGenerators = { + brackets: function brackets(prefix) { + return prefix + '[]'; + }, + comma: 'comma', + indices: function indices(prefix, key) { + return prefix + '[' + key + ']'; + }, + repeat: function repeat(prefix) { + return prefix; + } }; +var isArray = Array.isArray; +var push = Array.prototype.push; +var pushToArray = function (arr, valueOrArray) { + push.apply(arr, isArray(valueOrArray) ? valueOrArray : [valueOrArray]); +}; -// Readability Functions -// --------------------- -// false -// tinycolor.isReadable("#000", "#111",{level:"AA",size:"large"}) => false -tinycolor.isReadable = function(color1, color2, wcag2) { - var readability = tinycolor.readability(color1, color2); - var wcag2Parms, out; - - out = false; - - wcag2Parms = validateWCAG2Parms(wcag2); - switch (wcag2Parms.level + wcag2Parms.size) { - case "AAsmall": - case "AAAlarge": - out = readability >= 4.5; - break; - case "AAlarge": - out = readability >= 3; - break; - case "AAAsmall": - out = readability >= 7; - break; - } - return out; - +var isNonNullishPrimitive = function isNonNullishPrimitive(v) { + return typeof v === 'string' + || typeof v === 'number' + || typeof v === 'boolean' + || typeof v === 'symbol' + || typeof v === 'bigint'; }; -// `mostReadable` -// Given a base color and a list of possible foreground or background -// colors for that base, returns the most readable color. -// Optionally returns Black or White if the most readable color is unreadable. -// *Example* -// tinycolor.mostReadable(tinycolor.mostReadable("#123", ["#124", "#125"],{includeFallbackColors:false}).toHexString(); // "#112255" -// tinycolor.mostReadable(tinycolor.mostReadable("#123", ["#124", "#125"],{includeFallbackColors:true}).toHexString(); // "#ffffff" -// tinycolor.mostReadable("#a8015a", ["#faf3f3"],{includeFallbackColors:true,level:"AAA",size:"large"}).toHexString(); // "#faf3f3" -// tinycolor.mostReadable("#a8015a", ["#faf3f3"],{includeFallbackColors:true,level:"AAA",size:"small"}).toHexString(); // "#ffffff" -tinycolor.mostReadable = function(baseColor, colorList, args) { - var bestColor = null; - var bestScore = 0; - var readability; - var includeFallbackColors, level, size ; - args = args || {}; - includeFallbackColors = args.includeFallbackColors ; - level = args.level; - size = args.size; - - for (var i= 0; i < colorList.length ; i++) { - readability = tinycolor.readability(baseColor, colorList[i]); - if (readability > bestScore) { - bestScore = readability; - bestColor = tinycolor(colorList[i]); - } +var stringify = function stringify( + object, + prefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + format, + formatter, + encodeValuesOnly, + charset +) { + var obj = object; + if (typeof filter === 'function') { + obj = filter(prefix, obj); + } else if (obj instanceof Date) { + obj = serializeDate(obj); + } else if (generateArrayPrefix === 'comma' && isArray(obj)) { + obj = utils.maybeMap(obj, function (value) { + if (value instanceof Date) { + return serializeDate(value); + } + return value; + }); } - if (tinycolor.isReadable(baseColor, bestColor, {"level":level,"size":size}) || !includeFallbackColors) { - return bestColor; - } - else { - args.includeFallbackColors=false; - return tinycolor.mostReadable(baseColor,["#fff", "#000"],args); - } -}; - - -// Big List of Colors -// ------------------ -// -var names = tinycolor.names = { - aliceblue: "f0f8ff", - antiquewhite: "faebd7", - aqua: "0ff", - aquamarine: "7fffd4", - azure: "f0ffff", - beige: "f5f5dc", - bisque: "ffe4c4", - black: "000", - blanchedalmond: "ffebcd", - blue: "00f", - blueviolet: "8a2be2", - brown: "a52a2a", - burlywood: "deb887", - burntsienna: "ea7e5d", - cadetblue: "5f9ea0", - chartreuse: "7fff00", - chocolate: "d2691e", - coral: "ff7f50", - cornflowerblue: "6495ed", - cornsilk: "fff8dc", - crimson: "dc143c", - cyan: "0ff", - darkblue: "00008b", - darkcyan: "008b8b", - darkgoldenrod: "b8860b", - darkgray: "a9a9a9", - darkgreen: "006400", - darkgrey: "a9a9a9", - darkkhaki: "bdb76b", - darkmagenta: "8b008b", - darkolivegreen: "556b2f", - darkorange: "ff8c00", - darkorchid: "9932cc", - darkred: "8b0000", - darksalmon: "e9967a", - darkseagreen: "8fbc8f", - darkslateblue: "483d8b", - darkslategray: "2f4f4f", - darkslategrey: "2f4f4f", - darkturquoise: "00ced1", - darkviolet: "9400d3", - deeppink: "ff1493", - deepskyblue: "00bfff", - dimgray: "696969", - dimgrey: "696969", - dodgerblue: "1e90ff", - firebrick: "b22222", - floralwhite: "fffaf0", - forestgreen: "228b22", - fuchsia: "f0f", - gainsboro: "dcdcdc", - ghostwhite: "f8f8ff", - gold: "ffd700", - goldenrod: "daa520", - gray: "808080", - green: "008000", - greenyellow: "adff2f", - grey: "808080", - honeydew: "f0fff0", - hotpink: "ff69b4", - indianred: "cd5c5c", - indigo: "4b0082", - ivory: "fffff0", - khaki: "f0e68c", - lavender: "e6e6fa", - lavenderblush: "fff0f5", - lawngreen: "7cfc00", - lemonchiffon: "fffacd", - lightblue: "add8e6", - lightcoral: "f08080", - lightcyan: "e0ffff", - lightgoldenrodyellow: "fafad2", - lightgray: "d3d3d3", - lightgreen: "90ee90", - lightgrey: "d3d3d3", - lightpink: "ffb6c1", - lightsalmon: "ffa07a", - lightseagreen: "20b2aa", - lightskyblue: "87cefa", - lightslategray: "789", - lightslategrey: "789", - lightsteelblue: "b0c4de", - lightyellow: "ffffe0", - lime: "0f0", - limegreen: "32cd32", - linen: "faf0e6", - magenta: "f0f", - maroon: "800000", - mediumaquamarine: "66cdaa", - mediumblue: "0000cd", - mediumorchid: "ba55d3", - mediumpurple: "9370db", - mediumseagreen: "3cb371", - mediumslateblue: "7b68ee", - mediumspringgreen: "00fa9a", - mediumturquoise: "48d1cc", - mediumvioletred: "c71585", - midnightblue: "191970", - mintcream: "f5fffa", - mistyrose: "ffe4e1", - moccasin: "ffe4b5", - navajowhite: "ffdead", - navy: "000080", - oldlace: "fdf5e6", - olive: "808000", - olivedrab: "6b8e23", - orange: "ffa500", - orangered: "ff4500", - orchid: "da70d6", - palegoldenrod: "eee8aa", - palegreen: "98fb98", - paleturquoise: "afeeee", - palevioletred: "db7093", - papayawhip: "ffefd5", - peachpuff: "ffdab9", - peru: "cd853f", - pink: "ffc0cb", - plum: "dda0dd", - powderblue: "b0e0e6", - purple: "800080", - rebeccapurple: "663399", - red: "f00", - rosybrown: "bc8f8f", - royalblue: "4169e1", - saddlebrown: "8b4513", - salmon: "fa8072", - sandybrown: "f4a460", - seagreen: "2e8b57", - seashell: "fff5ee", - sienna: "a0522d", - silver: "c0c0c0", - skyblue: "87ceeb", - slateblue: "6a5acd", - slategray: "708090", - slategrey: "708090", - snow: "fffafa", - springgreen: "00ff7f", - steelblue: "4682b4", - tan: "d2b48c", - teal: "008080", - thistle: "d8bfd8", - tomato: "ff6347", - turquoise: "40e0d0", - violet: "ee82ee", - wheat: "f5deb3", - white: "fff", - whitesmoke: "f5f5f5", - yellow: "ff0", - yellowgreen: "9acd32" -}; - -// Make it easy to access colors via `hexNames[hex]` -var hexNames = tinycolor.hexNames = flip(names); - - -// Utilities -// --------- - -// `{ 'name1': 'val1' }` becomes `{ 'val1': 'name1' }` -function flip(o) { - var flipped = { }; - for (var i in o) { - if (o.hasOwnProperty(i)) { - flipped[o[i]] = i; + if (obj === null) { + if (strictNullHandling) { + return encoder && !encodeValuesOnly ? encoder(prefix, defaults.encoder, charset, 'key', format) : prefix; } - } - return flipped; -} - -// Return a valid alpha value [0,1] with all invalid values being set to 1 -function boundAlpha(a) { - a = parseFloat(a); - if (isNaN(a) || a < 0 || a > 1) { - a = 1; + obj = ''; } - return a; -} - -// Take input from [0, n] and return it as [0, 1] -function bound01(n, max) { - if (isOnePointZero(n)) { n = "100%"; } + if (isNonNullishPrimitive(obj) || utils.isBuffer(obj)) { + if (encoder) { + var keyValue = encodeValuesOnly ? prefix : encoder(prefix, defaults.encoder, charset, 'key', format); + return [formatter(keyValue) + '=' + formatter(encoder(obj, defaults.encoder, charset, 'value', format))]; + } + return [formatter(prefix) + '=' + formatter(String(obj))]; + } - var processPercent = isPercentage(n); - n = mathMin(max, mathMax(0, parseFloat(n))); + var values = []; - // Automatically convert percentage into number - if (processPercent) { - n = parseInt(n * max, 10) / 100; + if (typeof obj === 'undefined') { + return values; } - // Handle floating point rounding errors - if ((Math.abs(n - max) < 0.000001)) { - return 1; + var objKeys; + if (generateArrayPrefix === 'comma' && isArray(obj)) { + // we need to join elements in + objKeys = [{ value: obj.length > 0 ? obj.join(',') || null : undefined }]; + } else if (isArray(filter)) { + objKeys = filter; + } else { + var keys = Object.keys(obj); + objKeys = sort ? keys.sort(sort) : keys; } - // Convert into [0, 1] range if it isn't already - return (n % max) / parseFloat(max); -} - -// Force a number between 0 and 1 -function clamp01(val) { - return mathMin(1, mathMax(0, val)); -} - -// Parse a base-16 hex value into a base-10 integer -function parseIntFromHex(val) { - return parseInt(val, 16); -} - -// Need to handle 1.0 as 100%, since once it is a number, there is no difference between it and 1 -// -function isOnePointZero(n) { - return typeof n == "string" && n.indexOf('.') != -1 && parseFloat(n) === 1; -} + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + var value = typeof key === 'object' && key.value !== undefined ? key.value : obj[key]; -// Check to see if string passed in is a percentage -function isPercentage(n) { - return typeof n === "string" && n.indexOf('%') != -1; -} + if (skipNulls && value === null) { + continue; + } -// Force a hex value to have 2 characters -function pad2(c) { - return c.length == 1 ? '0' + c : '' + c; -} + var keyPrefix = isArray(obj) + ? typeof generateArrayPrefix === 'function' ? generateArrayPrefix(prefix, key) : prefix + : prefix + (allowDots ? '.' + key : '[' + key + ']'); -// Replace a decimal with it's percentage value -function convertToPercentage(n) { - if (n <= 1) { - n = (n * 100) + "%"; + pushToArray(values, stringify( + value, + keyPrefix, + generateArrayPrefix, + strictNullHandling, + skipNulls, + encoder, + filter, + sort, + allowDots, + serializeDate, + format, + formatter, + encodeValuesOnly, + charset + )); } - return n; -} - -// Converts a decimal to a hex value -function convertDecimalToHex(d) { - return Math.round(parseFloat(d) * 255).toString(16); -} -// Converts a hex value to a decimal -function convertHexToDecimal(h) { - return (parseIntFromHex(h) / 255); -} + return values; +}; -var matchers = (function() { +var normalizeStringifyOptions = function normalizeStringifyOptions(opts) { + if (!opts) { + return defaults; + } - // - var CSS_INTEGER = "[-\\+]?\\d+%?"; + if (opts.encoder !== null && opts.encoder !== undefined && typeof opts.encoder !== 'function') { + throw new TypeError('Encoder has to be a function.'); + } - // - var CSS_NUMBER = "[-\\+]?\\d*\\.\\d+%?"; + var charset = opts.charset || defaults.charset; + if (typeof opts.charset !== 'undefined' && opts.charset !== 'utf-8' && opts.charset !== 'iso-8859-1') { + throw new TypeError('The charset option must be either utf-8, iso-8859-1, or undefined'); + } - // Allow positive/negative integer/number. Don't capture the either/or, just the entire outcome. - var CSS_UNIT = "(?:" + CSS_NUMBER + ")|(?:" + CSS_INTEGER + ")"; + var format = formats['default']; + if (typeof opts.format !== 'undefined') { + if (!has.call(formats.formatters, opts.format)) { + throw new TypeError('Unknown format option provided.'); + } + format = opts.format; + } + var formatter = formats.formatters[format]; - // Actual matching. - // Parentheses and commas are optional, but not required. - // Whitespace can take the place of commas or opening paren - var PERMISSIVE_MATCH3 = "[\\s|\\(]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")\\s*\\)?"; - var PERMISSIVE_MATCH4 = "[\\s|\\(]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")\\s*\\)?"; + var filter = defaults.filter; + if (typeof opts.filter === 'function' || isArray(opts.filter)) { + filter = opts.filter; + } return { - CSS_UNIT: new RegExp(CSS_UNIT), - rgb: new RegExp("rgb" + PERMISSIVE_MATCH3), - rgba: new RegExp("rgba" + PERMISSIVE_MATCH4), - hsl: new RegExp("hsl" + PERMISSIVE_MATCH3), - hsla: new RegExp("hsla" + PERMISSIVE_MATCH4), - hsv: new RegExp("hsv" + PERMISSIVE_MATCH3), - hsva: new RegExp("hsva" + PERMISSIVE_MATCH4), - hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, - hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/, - hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, - hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/ + addQueryPrefix: typeof opts.addQueryPrefix === 'boolean' ? opts.addQueryPrefix : defaults.addQueryPrefix, + allowDots: typeof opts.allowDots === 'undefined' ? defaults.allowDots : !!opts.allowDots, + charset: charset, + charsetSentinel: typeof opts.charsetSentinel === 'boolean' ? opts.charsetSentinel : defaults.charsetSentinel, + delimiter: typeof opts.delimiter === 'undefined' ? defaults.delimiter : opts.delimiter, + encode: typeof opts.encode === 'boolean' ? opts.encode : defaults.encode, + encoder: typeof opts.encoder === 'function' ? opts.encoder : defaults.encoder, + encodeValuesOnly: typeof opts.encodeValuesOnly === 'boolean' ? opts.encodeValuesOnly : defaults.encodeValuesOnly, + filter: filter, + format: format, + formatter: formatter, + serializeDate: typeof opts.serializeDate === 'function' ? opts.serializeDate : defaults.serializeDate, + skipNulls: typeof opts.skipNulls === 'boolean' ? opts.skipNulls : defaults.skipNulls, + sort: typeof opts.sort === 'function' ? opts.sort : null, + strictNullHandling: typeof opts.strictNullHandling === 'boolean' ? opts.strictNullHandling : defaults.strictNullHandling }; -})(); - -// `isValidCSSUnit` -// Take in a single string / number and check to see if it looks like a CSS unit -// (see `matchers` above for definition). -function isValidCSSUnit(color) { - return !!matchers.CSS_UNIT.exec(color); -} +}; -// `stringInputToObject` -// Permissive string parsing. Take in a number of formats, and output an object -// based on detected format. Returns `{ r, g, b }` or `{ h, s, l }` or `{ h, s, v}` -function stringInputToObject(color) { +module.exports = function (object, opts) { + var obj = object; + var options = normalizeStringifyOptions(opts); - color = color.replace(trimLeft,'').replace(trimRight, '').toLowerCase(); - var named = false; - if (names[color]) { - color = names[color]; - named = true; - } - else if (color == 'transparent') { - return { r: 0, g: 0, b: 0, a: 0, format: "name" }; - } + var objKeys; + var filter; - // Try to match string input using regular expressions. - // Keep most of the number bounding out of this function - don't worry about [0,1] or [0,100] or [0,360] - // Just return an object and let the conversion functions handle that. - // This way the result will be the same whether the tinycolor is initialized with string or object. - var match; - if ((match = matchers.rgb.exec(color))) { - return { r: match[1], g: match[2], b: match[3] }; - } - if ((match = matchers.rgba.exec(color))) { - return { r: match[1], g: match[2], b: match[3], a: match[4] }; - } - if ((match = matchers.hsl.exec(color))) { - return { h: match[1], s: match[2], l: match[3] }; - } - if ((match = matchers.hsla.exec(color))) { - return { h: match[1], s: match[2], l: match[3], a: match[4] }; - } - if ((match = matchers.hsv.exec(color))) { - return { h: match[1], s: match[2], v: match[3] }; - } - if ((match = matchers.hsva.exec(color))) { - return { h: match[1], s: match[2], v: match[3], a: match[4] }; - } - if ((match = matchers.hex8.exec(color))) { - return { - r: parseIntFromHex(match[1]), - g: parseIntFromHex(match[2]), - b: parseIntFromHex(match[3]), - a: convertHexToDecimal(match[4]), - format: named ? "name" : "hex8" - }; - } - if ((match = matchers.hex6.exec(color))) { - return { - r: parseIntFromHex(match[1]), - g: parseIntFromHex(match[2]), - b: parseIntFromHex(match[3]), - format: named ? "name" : "hex" - }; - } - if ((match = matchers.hex4.exec(color))) { - return { - r: parseIntFromHex(match[1] + '' + match[1]), - g: parseIntFromHex(match[2] + '' + match[2]), - b: parseIntFromHex(match[3] + '' + match[3]), - a: convertHexToDecimal(match[4] + '' + match[4]), - format: named ? "name" : "hex8" - }; - } - if ((match = matchers.hex3.exec(color))) { - return { - r: parseIntFromHex(match[1] + '' + match[1]), - g: parseIntFromHex(match[2] + '' + match[2]), - b: parseIntFromHex(match[3] + '' + match[3]), - format: named ? "name" : "hex" - }; + if (typeof options.filter === 'function') { + filter = options.filter; + obj = filter('', obj); + } else if (isArray(options.filter)) { + filter = options.filter; + objKeys = filter; } - return false; -} + var keys = []; -function validateWCAG2Parms(parms) { - // return valid WCAG2 parms for isReadable. - // If input parms are invalid, return {"level":"AA", "size":"small"} - var level, size; - parms = parms || {"level":"AA", "size":"small"}; - level = (parms.level || "AA").toUpperCase(); - size = (parms.size || "small").toLowerCase(); - if (level !== "AA" && level !== "AAA") { - level = "AA"; - } - if (size !== "small" && size !== "large") { - size = "small"; + if (typeof obj !== 'object' || obj === null) { + return ''; } - return {"level":level, "size":size}; -} - -// Node: Export function -if ( true && module.exports) { - module.exports = tinycolor; -} -// AMD/requirejs: Define the module -else if (typeof define === 'function' && define.amd) { - define(function () {return tinycolor;}); -} -// Browser: Expose to window -else { - window.tinycolor = tinycolor; -} -})(Math); + var arrayFormat; + if (opts && opts.arrayFormat in arrayPrefixGenerators) { + arrayFormat = opts.arrayFormat; + } else if (opts && 'indices' in opts) { + arrayFormat = opts.indices ? 'indices' : 'repeat'; + } else { + arrayFormat = 'indices'; + } + var generateArrayPrefix = arrayPrefixGenerators[arrayFormat]; -/***/ }), -/* 107 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { + if (!objKeys) { + objKeys = Object.keys(obj); + } -"use strict"; -/* harmony import */ var _babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(7); -/* harmony import */ var _babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(11); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__); + if (options.sort) { + objKeys.sort(options.sort); + } + for (var i = 0; i < objKeys.length; ++i) { + var key = objKeys[i]; + if (options.skipNulls && obj[key] === null) { + continue; + } + pushToArray(keys, stringify( + obj[key], + key, + generateArrayPrefix, + options.strictNullHandling, + options.skipNulls, + options.encode ? options.encoder : null, + options.filter, + options.sort, + options.allowDots, + options.serializeDate, + options.format, + options.formatter, + options.encodeValuesOnly, + options.charset + )); + } + var joined = keys.join(options.delimiter); + var prefix = options.addQueryPrefix === true ? '?' : ''; -function Dashicon(_ref) { - var icon = _ref.icon, - _ref$size = _ref.size, - size = _ref$size === void 0 ? 20 : _ref$size, - className = _ref.className, - extraProps = Object(_babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])(_ref, ["icon", "size", "className"]); + if (options.charsetSentinel) { + if (options.charset === 'iso-8859-1') { + // encodeURIComponent('✓'), the "numeric entity" representation of a checkmark + prefix += 'utf8=%26%2310003%3B&'; + } else { + // encodeURIComponent('✓') + prefix += 'utf8=%E2%9C%93&'; + } + } - var iconClass = ['dashicon', 'dashicons', 'dashicons-' + icon, className].filter(Boolean).join(' '); - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__["createElement"])("span", Object(_babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])({ - className: iconClass, - width: size, - height: size - }, extraProps)); -} + return joined.length > 0 ? prefix + joined : ''; +}; -/* harmony default export */ __webpack_exports__["a"] = (Dashicon); -//# sourceMappingURL=index.js.map /***/ }), -/* 108 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 228 */ +/***/ (function(module, exports, __webpack_require__) { "use strict"; -// EXPORTS -__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ createBrowserHistory; }); -__webpack_require__.d(__webpack_exports__, "c", function() { return /* binding */ createMemoryHistory; }); -__webpack_require__.d(__webpack_exports__, "b", function() { return /* binding */ createLocation; }); -__webpack_require__.d(__webpack_exports__, "e", function() { return /* binding */ locationsAreEqual; }); -__webpack_require__.d(__webpack_exports__, "d", function() { return /* binding */ createPath; }); - -// UNUSED EXPORTS: createHashHistory, parsePath -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/extends.js -var esm_extends = __webpack_require__(7); +var utils = __webpack_require__(200); -// CONCATENATED MODULE: ./node_modules/resolve-pathname/esm/resolve-pathname.js -function isAbsolute(pathname) { - return pathname.charAt(0) === '/'; -} +var has = Object.prototype.hasOwnProperty; +var isArray = Array.isArray; -// About 1.5x faster than the two-arg version of Array#splice() -function spliceOne(list, index) { - for (var i = index, k = i + 1, n = list.length; k < n; i += 1, k += 1) { - list[i] = list[k]; - } +var defaults = { + allowDots: false, + allowPrototypes: false, + arrayLimit: 20, + charset: 'utf-8', + charsetSentinel: false, + comma: false, + decoder: utils.decode, + delimiter: '&', + depth: 5, + ignoreQueryPrefix: false, + interpretNumericEntities: false, + parameterLimit: 1000, + parseArrays: true, + plainObjects: false, + strictNullHandling: false +}; - list.pop(); -} +var interpretNumericEntities = function (str) { + return str.replace(/&#(\d+);/g, function ($0, numberStr) { + return String.fromCharCode(parseInt(numberStr, 10)); + }); +}; -// This implementation is based heavily on node's url.parse -function resolvePathname(to, from) { - if (from === undefined) from = ''; +var parseArrayValue = function (val, options) { + if (val && typeof val === 'string' && options.comma && val.indexOf(',') > -1) { + return val.split(','); + } - var toParts = (to && to.split('/')) || []; - var fromParts = (from && from.split('/')) || []; + return val; +}; - var isToAbs = to && isAbsolute(to); - var isFromAbs = from && isAbsolute(from); - var mustEndAbs = isToAbs || isFromAbs; +// This is what browsers will submit when the ✓ character occurs in an +// application/x-www-form-urlencoded body and the encoding of the page containing +// the form is iso-8859-1, or when the submitted form has an accept-charset +// attribute of iso-8859-1. Presumably also with other charsets that do not contain +// the ✓ character, such as us-ascii. +var isoSentinel = 'utf8=%26%2310003%3B'; // encodeURIComponent('✓') - if (to && isAbsolute(to)) { - // to is absolute - fromParts = toParts; - } else if (toParts.length) { - // to is relative, drop the filename - fromParts.pop(); - fromParts = fromParts.concat(toParts); - } +// These are the percent-encoded utf-8 octets representing a checkmark, indicating that the request actually is utf-8 encoded. +var charsetSentinel = 'utf8=%E2%9C%93'; // encodeURIComponent('✓') - if (!fromParts.length) return '/'; +var parseValues = function parseQueryStringValues(str, options) { + var obj = {}; + var cleanStr = options.ignoreQueryPrefix ? str.replace(/^\?/, '') : str; + var limit = options.parameterLimit === Infinity ? undefined : options.parameterLimit; + var parts = cleanStr.split(options.delimiter, limit); + var skipIndex = -1; // Keep track of where the utf8 sentinel was found + var i; - var hasTrailingSlash; - if (fromParts.length) { - var last = fromParts[fromParts.length - 1]; - hasTrailingSlash = last === '.' || last === '..' || last === ''; - } else { - hasTrailingSlash = false; - } + var charset = options.charset; + if (options.charsetSentinel) { + for (i = 0; i < parts.length; ++i) { + if (parts[i].indexOf('utf8=') === 0) { + if (parts[i] === charsetSentinel) { + charset = 'utf-8'; + } else if (parts[i] === isoSentinel) { + charset = 'iso-8859-1'; + } + skipIndex = i; + i = parts.length; // The eslint settings do not allow break; + } + } + } - var up = 0; - for (var i = fromParts.length; i >= 0; i--) { - var part = fromParts[i]; + for (i = 0; i < parts.length; ++i) { + if (i === skipIndex) { + continue; + } + var part = parts[i]; - if (part === '.') { - spliceOne(fromParts, i); - } else if (part === '..') { - spliceOne(fromParts, i); - up++; - } else if (up) { - spliceOne(fromParts, i); - up--; - } - } + var bracketEqualsPos = part.indexOf(']='); + var pos = bracketEqualsPos === -1 ? part.indexOf('=') : bracketEqualsPos + 1; - if (!mustEndAbs) for (; up--; up) fromParts.unshift('..'); + var key, val; + if (pos === -1) { + key = options.decoder(part, defaults.decoder, charset, 'key'); + val = options.strictNullHandling ? null : ''; + } else { + key = options.decoder(part.slice(0, pos), defaults.decoder, charset, 'key'); + val = utils.maybeMap( + parseArrayValue(part.slice(pos + 1), options), + function (encodedVal) { + return options.decoder(encodedVal, defaults.decoder, charset, 'value'); + } + ); + } - if ( - mustEndAbs && - fromParts[0] !== '' && - (!fromParts[0] || !isAbsolute(fromParts[0])) - ) - fromParts.unshift(''); + if (val && options.interpretNumericEntities && charset === 'iso-8859-1') { + val = interpretNumericEntities(val); + } - var result = fromParts.join('/'); + if (part.indexOf('[]=') > -1) { + val = isArray(val) ? [val] : val; + } - if (hasTrailingSlash && result.substr(-1) !== '/') result += '/'; + if (has.call(obj, key)) { + obj[key] = utils.combine(obj[key], val); + } else { + obj[key] = val; + } + } - return result; -} + return obj; +}; -/* harmony default export */ var resolve_pathname = (resolvePathname); +var parseObject = function (chain, val, options, valuesParsed) { + var leaf = valuesParsed ? val : parseArrayValue(val, options); -// CONCATENATED MODULE: ./node_modules/value-equal/esm/value-equal.js -function value_equal_valueOf(obj) { - return obj.valueOf ? obj.valueOf() : Object.prototype.valueOf.call(obj); -} + for (var i = chain.length - 1; i >= 0; --i) { + var obj; + var root = chain[i]; -function valueEqual(a, b) { - // Test for strict equality first. - if (a === b) return true; + if (root === '[]' && options.parseArrays) { + obj = [].concat(leaf); + } else { + obj = options.plainObjects ? Object.create(null) : {}; + var cleanRoot = root.charAt(0) === '[' && root.charAt(root.length - 1) === ']' ? root.slice(1, -1) : root; + var index = parseInt(cleanRoot, 10); + if (!options.parseArrays && cleanRoot === '') { + obj = { 0: leaf }; + } else if ( + !isNaN(index) + && root !== cleanRoot + && String(index) === cleanRoot + && index >= 0 + && (options.parseArrays && index <= options.arrayLimit) + ) { + obj = []; + obj[index] = leaf; + } else { + obj[cleanRoot] = leaf; + } + } - // Otherwise, if either of them == null they are not equal. - if (a == null || b == null) return false; + leaf = obj; + } - if (Array.isArray(a)) { - return ( - Array.isArray(b) && - a.length === b.length && - a.every(function(item, index) { - return valueEqual(item, b[index]); - }) - ); - } + return leaf; +}; - if (typeof a === 'object' || typeof b === 'object') { - var aValue = value_equal_valueOf(a); - var bValue = value_equal_valueOf(b); +var parseKeys = function parseQueryStringKeys(givenKey, val, options, valuesParsed) { + if (!givenKey) { + return; + } - if (aValue !== a || bValue !== b) return valueEqual(aValue, bValue); + // Transform dot notation to bracket notation + var key = options.allowDots ? givenKey.replace(/\.([^.[]+)/g, '[$1]') : givenKey; - return Object.keys(Object.assign({}, a, b)).every(function(key) { - return valueEqual(a[key], b[key]); - }); - } + // The regex chunks - return false; -} + var brackets = /(\[[^[\]]*])/; + var child = /(\[[^[\]]*])/g; -/* harmony default export */ var value_equal = (valueEqual); + // Get the parent -// EXTERNAL MODULE: ./node_modules/tiny-invariant/dist/tiny-invariant.esm.js -var tiny_invariant_esm = __webpack_require__(92); + var segment = options.depth > 0 && brackets.exec(key); + var parent = segment ? key.slice(0, segment.index) : key; -// CONCATENATED MODULE: ./node_modules/history/esm/history.js + // Stash the parent if it exists + var keys = []; + if (parent) { + // If we aren't using plain objects, optionally prefix keys that would overwrite object prototype properties + if (!options.plainObjects && has.call(Object.prototype, parent)) { + if (!options.allowPrototypes) { + return; + } + } + keys.push(parent); + } + // Loop through children appending to the array until we hit depth + var i = 0; + while (options.depth > 0 && (segment = child.exec(key)) !== null && i < options.depth) { + i += 1; + if (!options.plainObjects && has.call(Object.prototype, segment[1].slice(1, -1))) { + if (!options.allowPrototypes) { + return; + } + } + keys.push(segment[1]); + } + // If there's a remainder, just add whatever is left -function addLeadingSlash(path) { - return path.charAt(0) === '/' ? path : '/' + path; -} -function stripLeadingSlash(path) { - return path.charAt(0) === '/' ? path.substr(1) : path; -} -function hasBasename(path, prefix) { - return path.toLowerCase().indexOf(prefix.toLowerCase()) === 0 && '/?#'.indexOf(path.charAt(prefix.length)) !== -1; -} -function stripBasename(path, prefix) { - return hasBasename(path, prefix) ? path.substr(prefix.length) : path; -} -function stripTrailingSlash(path) { - return path.charAt(path.length - 1) === '/' ? path.slice(0, -1) : path; -} -function parsePath(path) { - var pathname = path || '/'; - var search = ''; - var hash = ''; - var hashIndex = pathname.indexOf('#'); - - if (hashIndex !== -1) { - hash = pathname.substr(hashIndex); - pathname = pathname.substr(0, hashIndex); - } - - var searchIndex = pathname.indexOf('?'); - - if (searchIndex !== -1) { - search = pathname.substr(searchIndex); - pathname = pathname.substr(0, searchIndex); - } - - return { - pathname: pathname, - search: search === '?' ? '' : search, - hash: hash === '#' ? '' : hash - }; -} -function createPath(location) { - var pathname = location.pathname, - search = location.search, - hash = location.hash; - var path = pathname || '/'; - if (search && search !== '?') path += search.charAt(0) === '?' ? search : "?" + search; - if (hash && hash !== '#') path += hash.charAt(0) === '#' ? hash : "#" + hash; - return path; -} + if (segment) { + keys.push('[' + key.slice(segment.index) + ']'); + } -function createLocation(path, state, key, currentLocation) { - var location; + return parseObject(keys, val, options, valuesParsed); +}; - if (typeof path === 'string') { - // Two-arg form: push(path, state) - location = parsePath(path); - location.state = state; - } else { - // One-arg form: push(location) - location = Object(esm_extends["a" /* default */])({}, path); - if (location.pathname === undefined) location.pathname = ''; +var normalizeParseOptions = function normalizeParseOptions(opts) { + if (!opts) { + return defaults; + } - if (location.search) { - if (location.search.charAt(0) !== '?') location.search = '?' + location.search; - } else { - location.search = ''; + if (opts.decoder !== null && opts.decoder !== undefined && typeof opts.decoder !== 'function') { + throw new TypeError('Decoder has to be a function.'); } - if (location.hash) { - if (location.hash.charAt(0) !== '#') location.hash = '#' + location.hash; - } else { - location.hash = ''; + if (typeof opts.charset !== 'undefined' && opts.charset !== 'utf-8' && opts.charset !== 'iso-8859-1') { + throw new TypeError('The charset option must be either utf-8, iso-8859-1, or undefined'); } + var charset = typeof opts.charset === 'undefined' ? defaults.charset : opts.charset; - if (state !== undefined && location.state === undefined) location.state = state; - } + return { + allowDots: typeof opts.allowDots === 'undefined' ? defaults.allowDots : !!opts.allowDots, + allowPrototypes: typeof opts.allowPrototypes === 'boolean' ? opts.allowPrototypes : defaults.allowPrototypes, + arrayLimit: typeof opts.arrayLimit === 'number' ? opts.arrayLimit : defaults.arrayLimit, + charset: charset, + charsetSentinel: typeof opts.charsetSentinel === 'boolean' ? opts.charsetSentinel : defaults.charsetSentinel, + comma: typeof opts.comma === 'boolean' ? opts.comma : defaults.comma, + decoder: typeof opts.decoder === 'function' ? opts.decoder : defaults.decoder, + delimiter: typeof opts.delimiter === 'string' || utils.isRegExp(opts.delimiter) ? opts.delimiter : defaults.delimiter, + // eslint-disable-next-line no-implicit-coercion, no-extra-parens + depth: (typeof opts.depth === 'number' || opts.depth === false) ? +opts.depth : defaults.depth, + ignoreQueryPrefix: opts.ignoreQueryPrefix === true, + interpretNumericEntities: typeof opts.interpretNumericEntities === 'boolean' ? opts.interpretNumericEntities : defaults.interpretNumericEntities, + parameterLimit: typeof opts.parameterLimit === 'number' ? opts.parameterLimit : defaults.parameterLimit, + parseArrays: opts.parseArrays !== false, + plainObjects: typeof opts.plainObjects === 'boolean' ? opts.plainObjects : defaults.plainObjects, + strictNullHandling: typeof opts.strictNullHandling === 'boolean' ? opts.strictNullHandling : defaults.strictNullHandling + }; +}; - try { - location.pathname = decodeURI(location.pathname); - } catch (e) { - if (e instanceof URIError) { - throw new URIError('Pathname "' + location.pathname + '" could not be decoded. ' + 'This is likely caused by an invalid percent-encoding.'); - } else { - throw e; +module.exports = function (str, opts) { + var options = normalizeParseOptions(opts); + + if (str === '' || str === null || typeof str === 'undefined') { + return options.plainObjects ? Object.create(null) : {}; } - } - if (key) location.key = key; + var tempObj = typeof str === 'string' ? parseValues(str, options) : str; + var obj = options.plainObjects ? Object.create(null) : {}; - if (currentLocation) { - // Resolve incomplete/relative pathname relative to current location. - if (!location.pathname) { - location.pathname = currentLocation.pathname; - } else if (location.pathname.charAt(0) !== '/') { - location.pathname = resolve_pathname(location.pathname, currentLocation.pathname); - } - } else { - // When there is no prior location and pathname is empty, set it to / - if (!location.pathname) { - location.pathname = '/'; + // Iterate over the keys and setup the new object + + var keys = Object.keys(tempObj); + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; + var newObj = parseKeys(key, tempObj[key], options, typeof str === 'string'); + obj = utils.merge(obj, newObj, options); } - } - return location; -} -function locationsAreEqual(a, b) { - return a.pathname === b.pathname && a.search === b.search && a.hash === b.hash && a.key === b.key && value_equal(a.state, b.state); -} + return utils.compact(obj); +}; -function createTransitionManager() { - var prompt = null; - function setPrompt(nextPrompt) { - false ? undefined : void 0; - prompt = nextPrompt; - return function () { - if (prompt === nextPrompt) prompt = null; - }; - } +/***/ }), +/* 229 */ +/***/ (function(module, exports, __webpack_require__) { - function confirmTransitionTo(location, action, getUserConfirmation, callback) { - // TODO: If another transition starts while we're still confirming - // the previous one, we may end up in a weird state. Figure out the - // best way to handle this. - if (prompt != null) { - var result = typeof prompt === 'function' ? prompt(location, action) : prompt; +"use strict"; - if (typeof result === 'string') { - if (typeof getUserConfirmation === 'function') { - getUserConfirmation(result, callback); - } else { - false ? undefined : void 0; - callback(true); - } - } else { - // Return false from a transition hook to cancel the transition. - callback(result !== false); +var $ = __webpack_require__(12); +var global = __webpack_require__(3); +var isForced = __webpack_require__(74); +var redefine = __webpack_require__(27); +var InternalMetadataModule = __webpack_require__(205); +var iterate = __webpack_require__(154); +var anInstance = __webpack_require__(136); +var isObject = __webpack_require__(10); +var fails = __webpack_require__(6); +var checkCorrectnessOfIteration = __webpack_require__(166); +var setToStringTag = __webpack_require__(90); +var inheritIfRequired = __webpack_require__(156); + +module.exports = function (CONSTRUCTOR_NAME, wrapper, common) { + var IS_MAP = CONSTRUCTOR_NAME.indexOf('Map') !== -1; + var IS_WEAK = CONSTRUCTOR_NAME.indexOf('Weak') !== -1; + var ADDER = IS_MAP ? 'set' : 'add'; + var NativeConstructor = global[CONSTRUCTOR_NAME]; + var NativePrototype = NativeConstructor && NativeConstructor.prototype; + var Constructor = NativeConstructor; + var exported = {}; + + var fixMethod = function (KEY) { + var nativeMethod = NativePrototype[KEY]; + redefine(NativePrototype, KEY, + KEY == 'add' ? function add(value) { + nativeMethod.call(this, value === 0 ? 0 : value); + return this; + } : KEY == 'delete' ? function (key) { + return IS_WEAK && !isObject(key) ? false : nativeMethod.call(this, key === 0 ? 0 : key); + } : KEY == 'get' ? function get(key) { + return IS_WEAK && !isObject(key) ? undefined : nativeMethod.call(this, key === 0 ? 0 : key); + } : KEY == 'has' ? function has(key) { + return IS_WEAK && !isObject(key) ? false : nativeMethod.call(this, key === 0 ? 0 : key); + } : function set(key, value) { + nativeMethod.call(this, key === 0 ? 0 : key, value); + return this; } - } else { - callback(true); - } - } - - var listeners = []; + ); + }; - function appendListener(fn) { - var isActive = true; + var REPLACE = isForced( + CONSTRUCTOR_NAME, + typeof NativeConstructor != 'function' || !(IS_WEAK || NativePrototype.forEach && !fails(function () { + new NativeConstructor().entries().next(); + })) + ); - function listener() { - if (isActive) fn.apply(void 0, arguments); - } + if (REPLACE) { + // create collection constructor + Constructor = common.getConstructor(wrapper, CONSTRUCTOR_NAME, IS_MAP, ADDER); + InternalMetadataModule.REQUIRED = true; + } else if (isForced(CONSTRUCTOR_NAME, true)) { + var instance = new Constructor(); + // early implementations not supports chaining + var HASNT_CHAINING = instance[ADDER](IS_WEAK ? {} : -0, 1) != instance; + // V8 ~ Chromium 40- weak-collections throws on primitives, but should return false + var THROWS_ON_PRIMITIVES = fails(function () { instance.has(1); }); + // most early implementations doesn't supports iterables, most modern - not close it correctly + // eslint-disable-next-line no-new -- required for testing + var ACCEPT_ITERABLES = checkCorrectnessOfIteration(function (iterable) { new NativeConstructor(iterable); }); + // for early implementations -0 and +0 not the same + var BUGGY_ZERO = !IS_WEAK && fails(function () { + // V8 ~ Chromium 42- fails only with 5+ elements + var $instance = new NativeConstructor(); + var index = 5; + while (index--) $instance[ADDER](index, index); + return !$instance.has(-0); + }); - listeners.push(listener); - return function () { - isActive = false; - listeners = listeners.filter(function (item) { - return item !== listener; + if (!ACCEPT_ITERABLES) { + Constructor = wrapper(function (dummy, iterable) { + anInstance(dummy, Constructor, CONSTRUCTOR_NAME); + var that = inheritIfRequired(new NativeConstructor(), dummy, Constructor); + if (iterable != undefined) iterate(iterable, that[ADDER], { that: that, AS_ENTRIES: IS_MAP }); + return that; }); - }; - } + Constructor.prototype = NativePrototype; + NativePrototype.constructor = Constructor; + } - function notifyListeners() { - for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { - args[_key] = arguments[_key]; + if (THROWS_ON_PRIMITIVES || BUGGY_ZERO) { + fixMethod('delete'); + fixMethod('has'); + IS_MAP && fixMethod('get'); } - listeners.forEach(function (listener) { - return listener.apply(void 0, args); - }); + if (BUGGY_ZERO || HASNT_CHAINING) fixMethod(ADDER); + + // weak collections should not contains .clear method + if (IS_WEAK && NativePrototype.clear) delete NativePrototype.clear; } - return { - setPrompt: setPrompt, - confirmTransitionTo: confirmTransitionTo, - appendListener: appendListener, - notifyListeners: notifyListeners - }; -} + exported[CONSTRUCTOR_NAME] = Constructor; + $({ global: true, forced: Constructor != NativeConstructor }, exported); -var canUseDOM = !!(typeof window !== 'undefined' && window.document && window.document.createElement); -function getConfirmation(message, callback) { - callback(window.confirm(message)); // eslint-disable-line no-alert -} -/** - * Returns true if the HTML5 history API is supported. Taken from Modernizr. - * - * https://github.com/Modernizr/Modernizr/blob/master/LICENSE - * https://github.com/Modernizr/Modernizr/blob/master/feature-detects/history.js - * changed to avoid false negatives for Windows Phones: https://github.com/reactjs/react-router/issues/586 - */ + setToStringTag(Constructor, CONSTRUCTOR_NAME); -function supportsHistory() { - var ua = window.navigator.userAgent; - if ((ua.indexOf('Android 2.') !== -1 || ua.indexOf('Android 4.0') !== -1) && ua.indexOf('Mobile Safari') !== -1 && ua.indexOf('Chrome') === -1 && ua.indexOf('Windows Phone') === -1) return false; - return window.history && 'pushState' in window.history; -} -/** - * Returns true if browser fires popstate on hash change. - * IE10 and IE11 do not. - */ + if (!IS_WEAK) common.setStrong(Constructor, CONSTRUCTOR_NAME, IS_MAP); -function supportsPopStateOnHashChange() { - return window.navigator.userAgent.indexOf('Trident') === -1; -} -/** - * Returns false if using go(n) with hash history causes a full page reload. - */ + return Constructor; +}; -function supportsGoWithoutReloadUsingHash() { - return window.navigator.userAgent.indexOf('Firefox') === -1; -} -/** - * Returns true if a given popstate event is an extraneous WebKit event. - * Accounts for the fact that Chrome on iOS fires real popstate events - * containing undefined state when pressing the back button. - */ -function isExtraneousPopstateEvent(event) { - return event.state === undefined && navigator.userAgent.indexOf('CriOS') === -1; -} +/***/ }), +/* 230 */, +/* 231 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { -var PopStateEvent = 'popstate'; -var HashChangeEvent = 'hashchange'; +"use strict"; +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return getCountryCode; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return getCurrencyRegion; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "e", function() { return getProductIdsForCart; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return getCategorizedOnboardingProducts; }); +/* unused harmony export getProductList */ +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "d", function() { return getPriceValue; }); +/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "f", function() { return isWCAdmin; }); +/* harmony import */ var _babel_runtime_helpers_toConsumableArray__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(44); +/* harmony import */ var _babel_runtime_helpers_toConsumableArray__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_babel_runtime_helpers_toConsumableArray__WEBPACK_IMPORTED_MODULE_0__); +/* harmony import */ var core_js_modules_es_string_split_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(186); +/* harmony import */ var core_js_modules_es_string_split_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_string_split_js__WEBPACK_IMPORTED_MODULE_1__); +/* harmony import */ var core_js_modules_es_regexp_exec_js__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(88); +/* harmony import */ var core_js_modules_es_regexp_exec_js__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_regexp_exec_js__WEBPACK_IMPORTED_MODULE_2__); +/* harmony import */ var core_js_modules_es_array_includes_js__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(107); +/* harmony import */ var core_js_modules_es_array_includes_js__WEBPACK_IMPORTED_MODULE_3___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_array_includes_js__WEBPACK_IMPORTED_MODULE_3__); +/* harmony import */ var core_js_modules_es_string_includes_js__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(140); +/* harmony import */ var core_js_modules_es_string_includes_js__WEBPACK_IMPORTED_MODULE_4___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_string_includes_js__WEBPACK_IMPORTED_MODULE_4__); +/* harmony import */ var core_js_modules_es_array_map_js__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(52); +/* harmony import */ var core_js_modules_es_array_map_js__WEBPACK_IMPORTED_MODULE_5___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_array_map_js__WEBPACK_IMPORTED_MODULE_5__); +/* harmony import */ var core_js_modules_es_set_js__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(248); +/* harmony import */ var core_js_modules_es_set_js__WEBPACK_IMPORTED_MODULE_6___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_set_js__WEBPACK_IMPORTED_MODULE_6__); +/* harmony import */ var core_js_modules_es_object_to_string_js__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(100); +/* harmony import */ var core_js_modules_es_object_to_string_js__WEBPACK_IMPORTED_MODULE_7___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_object_to_string_js__WEBPACK_IMPORTED_MODULE_7__); +/* harmony import */ var core_js_modules_es_string_iterator_js__WEBPACK_IMPORTED_MODULE_8__ = __webpack_require__(151); +/* harmony import */ var core_js_modules_es_string_iterator_js__WEBPACK_IMPORTED_MODULE_8___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_string_iterator_js__WEBPACK_IMPORTED_MODULE_8__); +/* harmony import */ var core_js_modules_es_array_iterator_js__WEBPACK_IMPORTED_MODULE_9__ = __webpack_require__(123); +/* harmony import */ var core_js_modules_es_array_iterator_js__WEBPACK_IMPORTED_MODULE_9___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_array_iterator_js__WEBPACK_IMPORTED_MODULE_9__); +/* harmony import */ var core_js_modules_web_dom_collections_iterator_js__WEBPACK_IMPORTED_MODULE_10__ = __webpack_require__(146); +/* harmony import */ var core_js_modules_web_dom_collections_iterator_js__WEBPACK_IMPORTED_MODULE_10___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_web_dom_collections_iterator_js__WEBPACK_IMPORTED_MODULE_10__); +/* harmony import */ var core_js_modules_es_array_concat_js__WEBPACK_IMPORTED_MODULE_11__ = __webpack_require__(66); +/* harmony import */ var core_js_modules_es_array_concat_js__WEBPACK_IMPORTED_MODULE_11___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_array_concat_js__WEBPACK_IMPORTED_MODULE_11__); +/* harmony import */ var core_js_modules_web_dom_collections_for_each_js__WEBPACK_IMPORTED_MODULE_12__ = __webpack_require__(49); +/* harmony import */ var core_js_modules_web_dom_collections_for_each_js__WEBPACK_IMPORTED_MODULE_12___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_web_dom_collections_for_each_js__WEBPACK_IMPORTED_MODULE_12__); +/* harmony import */ var core_js_modules_es_array_find_js__WEBPACK_IMPORTED_MODULE_13__ = __webpack_require__(192); +/* harmony import */ var core_js_modules_es_array_find_js__WEBPACK_IMPORTED_MODULE_13___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_array_find_js__WEBPACK_IMPORTED_MODULE_13__); +/* harmony import */ var core_js_modules_es_number_constructor_js__WEBPACK_IMPORTED_MODULE_14__ = __webpack_require__(177); +/* harmony import */ var core_js_modules_es_number_constructor_js__WEBPACK_IMPORTED_MODULE_14___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_number_constructor_js__WEBPACK_IMPORTED_MODULE_14__); +/* harmony import */ var core_js_modules_es_string_replace_js__WEBPACK_IMPORTED_MODULE_15__ = __webpack_require__(127); +/* harmony import */ var core_js_modules_es_string_replace_js__WEBPACK_IMPORTED_MODULE_15___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_string_replace_js__WEBPACK_IMPORTED_MODULE_15__); +/* harmony import */ var _wordpress_html_entities__WEBPACK_IMPORTED_MODULE_16__ = __webpack_require__(133); +/* harmony import */ var _wordpress_html_entities__WEBPACK_IMPORTED_MODULE_16___default = /*#__PURE__*/__webpack_require__.n(_wordpress_html_entities__WEBPACK_IMPORTED_MODULE_16__); +/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_17__ = __webpack_require__(5); +/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_17___default = /*#__PURE__*/__webpack_require__.n(lodash__WEBPACK_IMPORTED_MODULE_17__); +/* harmony import */ var _woocommerce_wc_admin_settings__WEBPACK_IMPORTED_MODULE_18__ = __webpack_require__(85); -function getHistoryState() { - try { - return window.history.state || {}; - } catch (e) { - // IE 11 sometimes throws when accessing window.history.state - // See https://github.com/ReactTraining/history/pull/289 - return {}; - } -} -/** - * Creates a history object that uses the HTML5 history API including - * pushState, replaceState, and the popstate event. - */ -function createBrowserHistory(props) { - if (props === void 0) { - props = {}; - } - - !canUseDOM ? false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) : void 0; - var globalHistory = window.history; - var canUseHistory = supportsHistory(); - var needsHashChangeListener = !supportsPopStateOnHashChange(); - var _props = props, - _props$forceRefresh = _props.forceRefresh, - forceRefresh = _props$forceRefresh === void 0 ? false : _props$forceRefresh, - _props$getUserConfirm = _props.getUserConfirmation, - getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm, - _props$keyLength = _props.keyLength, - keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength; - var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : ''; - function getDOMLocation(historyState) { - var _ref = historyState || {}, - key = _ref.key, - state = _ref.state; - var _window$location = window.location, - pathname = _window$location.pathname, - search = _window$location.search, - hash = _window$location.hash; - var path = pathname + search + hash; - false ? undefined : void 0; - if (basename) path = stripBasename(path, basename); - return createLocation(path, state, key); - } - function createKey() { - return Math.random().toString(36).substr(2, keyLength); - } - var transitionManager = createTransitionManager(); - function setState(nextState) { - Object(esm_extends["a" /* default */])(history, nextState); - history.length = globalHistory.length; - transitionManager.notifyListeners(history.location, history.action); - } - function handlePopState(event) { - // Ignore extraneous popstate events in WebKit. - if (isExtraneousPopstateEvent(event)) return; - handlePop(getDOMLocation(event.state)); - } - function handleHashChange() { - handlePop(getDOMLocation(getHistoryState())); - } - var forceNextPop = false; - function handlePop(location) { - if (forceNextPop) { - forceNextPop = false; - setState(); - } else { - var action = 'POP'; - transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { - if (ok) { - setState({ - action: action, - location: location - }); - } else { - revertPop(location); - } - }); - } - } - function revertPop(fromLocation) { - var toLocation = history.location; // TODO: We could probably make this more reliable by - // keeping a list of keys we've seen in sessionStorage. - // Instead, we just default to 0 for keys we don't know. - var toIndex = allKeys.indexOf(toLocation.key); - if (toIndex === -1) toIndex = 0; - var fromIndex = allKeys.indexOf(fromLocation.key); - if (fromIndex === -1) fromIndex = 0; - var delta = toIndex - fromIndex; - if (delta) { - forceNextPop = true; - go(delta); - } - } - var initialLocation = getDOMLocation(getHistoryState()); - var allKeys = [initialLocation.key]; // Public interface +/** + * External dependencies + */ - function createHref(location) { - return basename + createPath(location); - } - function push(path, state) { - false ? undefined : void 0; - var action = 'PUSH'; - var location = createLocation(path, state, createKey(), history.location); - transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { - if (!ok) return; - var href = createHref(location); - var key = location.key, - state = location.state; - if (canUseHistory) { - globalHistory.pushState({ - key: key, - state: state - }, null, href); +/** + * Gets the country code from a country:state value string. + * + * @param {string} countryState Country state string, e.g. US:GA. + * @return {string} Country string. + */ - if (forceRefresh) { - window.location.href = href; - } else { - var prevIndex = allKeys.indexOf(history.location.key); - var nextKeys = allKeys.slice(0, prevIndex + 1); - nextKeys.push(location.key); - allKeys = nextKeys; - setState({ - action: action, - location: location - }); - } - } else { - false ? undefined : void 0; - window.location.href = href; - } - }); +function getCountryCode(countryState) { + if (!countryState) { + return null; } - function replace(path, state) { - false ? undefined : void 0; - var action = 'REPLACE'; - var location = createLocation(path, state, createKey(), history.location); - transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { - if (!ok) return; - var href = createHref(location); - var key = location.key, - state = location.state; - - if (canUseHistory) { - globalHistory.replaceState({ - key: key, - state: state - }, null, href); + return countryState.split(':')[0]; +} +function getCurrencyRegion(countryState) { + var region = getCountryCode(countryState); + var euCountries = Object(lodash__WEBPACK_IMPORTED_MODULE_17__["without"])(Object(_woocommerce_wc_admin_settings__WEBPACK_IMPORTED_MODULE_18__[/* getSetting */ "g"])('onboarding', { + euCountries: [] + }).euCountries, 'GB'); - if (forceRefresh) { - window.location.replace(href); - } else { - var prevIndex = allKeys.indexOf(history.location.key); - if (prevIndex !== -1) allKeys[prevIndex] = location.key; - setState({ - action: action, - location: location - }); - } - } else { - false ? undefined : void 0; - window.location.replace(href); - } - }); + if (euCountries.includes(region)) { + region = 'EU'; } - function go(n) { - globalHistory.go(n); - } + return region; +} +/** + * Gets the product IDs for items based on the product types and theme selected in the onboarding profiler. + * + * @param {Object} profileItems Onboarding profile. + * @param {boolean} includeInstalledItems Include installed items in returned product IDs. + * @param {Array} installedPlugins Installed plugins. + * @return {Array} Product Ids. + */ - function goBack() { - go(-1); - } +function getProductIdsForCart(profileItems) { + var includeInstalledItems = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + var installedPlugins = arguments.length > 2 ? arguments[2] : undefined; + var productList = getProductList(profileItems, includeInstalledItems, installedPlugins); + var productIds = productList.map(function (product) { + return product.id || product.product; + }); + return productIds; +} +/** + * Gets the labeled/categorized product names and types for items based on the product types and theme selected in the onboarding profiler. + * + * @param {Object} profileItems Onboarding profile. + * @param {Array} installedPlugins Installed plugins. + * @return {Array} Objects with labeled/categorized product names and types. + */ - function goForward() { - go(1); - } +function getCategorizedOnboardingProducts(profileItems, installedPlugins) { + var productList = {}; + productList.products = getProductList(profileItems, true, installedPlugins); + productList.remainingProducts = getProductList(profileItems, false, installedPlugins); - var listenerCount = 0; + var uniqueItemsList = _babel_runtime_helpers_toConsumableArray__WEBPACK_IMPORTED_MODULE_0___default()(new Set([].concat(_babel_runtime_helpers_toConsumableArray__WEBPACK_IMPORTED_MODULE_0___default()(productList.products), _babel_runtime_helpers_toConsumableArray__WEBPACK_IMPORTED_MODULE_0___default()(productList.remainingProducts)))); - function checkDOMListeners(delta) { - listenerCount += delta; + productList.uniqueItemsList = uniqueItemsList.map(function (product) { + var cleanedProduct; - if (listenerCount === 1 && delta === 1) { - window.addEventListener(PopStateEvent, handlePopState); - if (needsHashChangeListener) window.addEventListener(HashChangeEvent, handleHashChange); - } else if (listenerCount === 0) { - window.removeEventListener(PopStateEvent, handlePopState); - if (needsHashChangeListener) window.removeEventListener(HashChangeEvent, handleHashChange); + if (product.label) { + cleanedProduct = { + type: 'extension', + name: product.label + }; + } else { + cleanedProduct = { + type: 'theme', + name: product.title + }; } - } - var isBlocked = false; + return cleanedProduct; + }); + return productList; +} +/** + * Gets a product list for items based on the product types and theme selected in the onboarding profiler. + * + * @param {Object} profileItems Onboarding profile. + * @param {boolean} includeInstalledItems Include installed items in returned product list. + * @param {Array} installedPlugins Installed plugins. + * @return {Array} Products. + */ - function block(prompt) { - if (prompt === void 0) { - prompt = false; - } +function getProductList(profileItems) { + var includeInstalledItems = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; + var installedPlugins = arguments.length > 2 ? arguments[2] : undefined; + var onboarding = Object(_woocommerce_wc_admin_settings__WEBPACK_IMPORTED_MODULE_18__[/* getSetting */ "g"])('onboarding', {}); + var productList = []; // The population of onboarding.productTypes only happens if the task list should be shown + // so bail early if it isn't present. - var unblock = transitionManager.setPrompt(prompt); + if (!onboarding.productTypes) { + return productList; + } - if (!isBlocked) { - checkDOMListeners(1); - isBlocked = true; + var productTypes = profileItems.product_types || []; + productTypes.forEach(function (productType) { + if (onboarding.productTypes[productType] && onboarding.productTypes[productType].product && (includeInstalledItems || !installedPlugins.includes(onboarding.productTypes[productType].slug))) { + productList.push(onboarding.productTypes[productType]); } + }); + var theme = onboarding.themes.find(function (themeData) { + return themeData.slug === profileItems.theme; + }); - return function () { - if (isBlocked) { - isBlocked = false; - checkDOMListeners(-1); - } - - return unblock(); - }; - } - - function listen(listener) { - var unlisten = transitionManager.appendListener(listener); - checkDOMListeners(1); - return function () { - checkDOMListeners(-1); - unlisten(); - }; + if (theme && theme.id && getPriceValue(theme.price) > 0 && (includeInstalledItems || !theme.is_installed)) { + productList.push(theme); } - var history = { - length: globalHistory.length, - action: 'POP', - location: initialLocation, - createHref: createHref, - push: push, - replace: replace, - go: go, - goBack: goBack, - goForward: goForward, - block: block, - listen: listen - }; - return history; + return productList; } +/** + * Get the value of a price from a string, removing any non-numeric characters. + * + * @param {string} string Price string. + * @return {number} Number value. + */ -var HashChangeEvent$1 = 'hashchange'; -var HashPathCoders = { - hashbang: { - encodePath: function encodePath(path) { - return path.charAt(0) === '!' ? path : '!/' + stripLeadingSlash(path); - }, - decodePath: function decodePath(path) { - return path.charAt(0) === '!' ? path.substr(1) : path; - } - }, - noslash: { - encodePath: stripLeadingSlash, - decodePath: addLeadingSlash - }, - slash: { - encodePath: addLeadingSlash, - decodePath: addLeadingSlash - } -}; - -function stripHash(url) { - var hashIndex = url.indexOf('#'); - return hashIndex === -1 ? url : url.slice(0, hashIndex); +function getPriceValue(string) { + return Number(Object(_wordpress_html_entities__WEBPACK_IMPORTED_MODULE_16__["decodeEntities"])(string).replace(/[^0-9.-]+/g, '')); } +/** + * Determines if a URL is a WC admin url. + * + * @param {*} url - the url to test + * @return {boolean} true if the url is a wc-admin URL + */ -function getHashPath() { - // We can't use window.location.hash here because it's not - // consistent across browsers - Firefox will pre-decode it! - var href = window.location.href; - var hashIndex = href.indexOf('#'); - return hashIndex === -1 ? '' : href.substring(hashIndex + 1); +function isWCAdmin(url) { + return /admin.php\?page=wc-admin/.test(url); } -function pushHashPath(path) { - window.location.hash = path; -} +/***/ }), +/* 232 */, +/* 233 */ +/***/ (function(module, exports) { -function replaceHashPath(path) { - window.location.replace(stripHash(window.location.href) + '#' + path); -} +function _objectWithoutPropertiesLoose(source, excluded) { + if (source == null) return {}; + var target = {}; + var sourceKeys = Object.keys(source); + var key, i; -function createHashHistory(props) { - if (props === void 0) { - props = {}; + for (i = 0; i < sourceKeys.length; i++) { + key = sourceKeys[i]; + if (excluded.indexOf(key) >= 0) continue; + target[key] = source[key]; } - !canUseDOM ? false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) : void 0; - var globalHistory = window.history; - var canGoWithoutReload = supportsGoWithoutReloadUsingHash(); - var _props = props, - _props$getUserConfirm = _props.getUserConfirmation, - getUserConfirmation = _props$getUserConfirm === void 0 ? getConfirmation : _props$getUserConfirm, - _props$hashType = _props.hashType, - hashType = _props$hashType === void 0 ? 'slash' : _props$hashType; - var basename = props.basename ? stripTrailingSlash(addLeadingSlash(props.basename)) : ''; - var _HashPathCoders$hashT = HashPathCoders[hashType], - encodePath = _HashPathCoders$hashT.encodePath, - decodePath = _HashPathCoders$hashT.decodePath; + return target; +} - function getDOMLocation() { - var path = decodePath(getHashPath()); - false ? undefined : void 0; - if (basename) path = stripBasename(path, basename); - return createLocation(path); - } +module.exports = _objectWithoutPropertiesLoose; - var transitionManager = createTransitionManager(); +/***/ }), +/* 234 */ +/***/ (function(module, exports, __webpack_require__) { - function setState(nextState) { - Object(esm_extends["a" /* default */])(history, nextState); +"use strict"; - history.length = globalHistory.length; - transitionManager.notifyListeners(history.location, history.action); +var bind = __webpack_require__(94); +var toObject = __webpack_require__(37); +var callWithSafeIterationClosing = __webpack_require__(252); +var isArrayIteratorMethod = __webpack_require__(171); +var toLength = __webpack_require__(34); +var createProperty = __webpack_require__(102); +var getIteratorMethod = __webpack_require__(155); + +// `Array.from` method implementation +// https://tc39.es/ecma262/#sec-array.from +module.exports = function from(arrayLike /* , mapfn = undefined, thisArg = undefined */) { + var O = toObject(arrayLike); + var C = typeof this == 'function' ? this : Array; + var argumentsLength = arguments.length; + var mapfn = argumentsLength > 1 ? arguments[1] : undefined; + var mapping = mapfn !== undefined; + var iteratorMethod = getIteratorMethod(O); + var index = 0; + var length, result, step, iterator, next, value; + if (mapping) mapfn = bind(mapfn, argumentsLength > 2 ? arguments[2] : undefined, 2); + // if the target is not iterable or it's an array with the default iterator - use a simple case + if (iteratorMethod != undefined && !(C == Array && isArrayIteratorMethod(iteratorMethod))) { + iterator = iteratorMethod.call(O); + next = iterator.next; + result = new C(); + for (;!(step = next.call(iterator)).done; index++) { + value = mapping ? callWithSafeIterationClosing(iterator, mapfn, [step.value, index], true) : step.value; + createProperty(result, index, value); + } + } else { + length = toLength(O.length); + result = new C(length); + for (;length > index; index++) { + value = mapping ? mapfn(O[index], index) : O[index]; + createProperty(result, index, value); + } } + result.length = index; + return result; +}; - var forceNextPop = false; - var ignorePath = null; - function locationsAreEqual$$1(a, b) { - return a.pathname === b.pathname && a.search === b.search && a.hash === b.hash; - } +/***/ }), +/* 235 */ +/***/ (function(module, exports, __webpack_require__) { - function handleHashChange() { - var path = getHashPath(); - var encodedPath = encodePath(path); +"use strict"; - if (path !== encodedPath) { - // Ensure we always have a properly-encoded hash. - replaceHashPath(encodedPath); - } else { - var location = getDOMLocation(); - var prevLocation = history.location; - if (!forceNextPop && locationsAreEqual$$1(prevLocation, location)) return; // A hashchange doesn't always == location change. +var defineProperty = __webpack_require__(17).f; +var create = __webpack_require__(69); +var redefineAll = __webpack_require__(152); +var bind = __webpack_require__(94); +var anInstance = __webpack_require__(136); +var iterate = __webpack_require__(154); +var defineIterator = __webpack_require__(167); +var setSpecies = __webpack_require__(153); +var DESCRIPTORS = __webpack_require__(13); +var fastKey = __webpack_require__(205).fastKey; +var InternalStateModule = __webpack_require__(45); + +var setInternalState = InternalStateModule.set; +var internalStateGetterFor = InternalStateModule.getterFor; - if (ignorePath === createPath(location)) return; // Ignore this change; we already setState in push/replace. +module.exports = { + getConstructor: function (wrapper, CONSTRUCTOR_NAME, IS_MAP, ADDER) { + var C = wrapper(function (that, iterable) { + anInstance(that, C, CONSTRUCTOR_NAME); + setInternalState(that, { + type: CONSTRUCTOR_NAME, + index: create(null), + first: undefined, + last: undefined, + size: 0 + }); + if (!DESCRIPTORS) that.size = 0; + if (iterable != undefined) iterate(iterable, that[ADDER], { that: that, AS_ENTRIES: IS_MAP }); + }); - ignorePath = null; - handlePop(location); - } - } + var getInternalState = internalStateGetterFor(CONSTRUCTOR_NAME); - function handlePop(location) { - if (forceNextPop) { - forceNextPop = false; - setState(); - } else { - var action = 'POP'; - transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { - if (ok) { - setState({ - action: action, - location: location - }); - } else { - revertPop(location); + var define = function (that, key, value) { + var state = getInternalState(that); + var entry = getEntry(that, key); + var previous, index; + // change existing entry + if (entry) { + entry.value = value; + // create new entry + } else { + state.last = entry = { + index: index = fastKey(key, true), + key: key, + value: value, + previous: previous = state.last, + next: undefined, + removed: false + }; + if (!state.first) state.first = entry; + if (previous) previous.next = entry; + if (DESCRIPTORS) state.size++; + else that.size++; + // add to index + if (index !== 'F') state.index[index] = entry; + } return that; + }; + + var getEntry = function (that, key) { + var state = getInternalState(that); + // fast case + var index = fastKey(key); + var entry; + if (index !== 'F') return state.index[index]; + // frozen object case + for (entry = state.first; entry; entry = entry.next) { + if (entry.key == key) return entry; + } + }; + + redefineAll(C.prototype, { + // 23.1.3.1 Map.prototype.clear() + // 23.2.3.2 Set.prototype.clear() + clear: function clear() { + var that = this; + var state = getInternalState(that); + var data = state.index; + var entry = state.first; + while (entry) { + entry.removed = true; + if (entry.previous) entry.previous = entry.previous.next = undefined; + delete data[entry.index]; + entry = entry.next; + } + state.first = state.last = undefined; + if (DESCRIPTORS) state.size = 0; + else that.size = 0; + }, + // 23.1.3.3 Map.prototype.delete(key) + // 23.2.3.4 Set.prototype.delete(value) + 'delete': function (key) { + var that = this; + var state = getInternalState(that); + var entry = getEntry(that, key); + if (entry) { + var next = entry.next; + var prev = entry.previous; + delete state.index[entry.index]; + entry.removed = true; + if (prev) prev.next = next; + if (next) next.previous = prev; + if (state.first == entry) state.first = next; + if (state.last == entry) state.last = prev; + if (DESCRIPTORS) state.size--; + else that.size--; + } return !!entry; + }, + // 23.2.3.6 Set.prototype.forEach(callbackfn, thisArg = undefined) + // 23.1.3.5 Map.prototype.forEach(callbackfn, thisArg = undefined) + forEach: function forEach(callbackfn /* , that = undefined */) { + var state = getInternalState(this); + var boundFunction = bind(callbackfn, arguments.length > 1 ? arguments[1] : undefined, 3); + var entry; + while (entry = entry ? entry.next : state.first) { + boundFunction(entry.value, entry.key, this); + // revert to the last existing entry + while (entry && entry.removed) entry = entry.previous; } + }, + // 23.1.3.7 Map.prototype.has(key) + // 23.2.3.7 Set.prototype.has(value) + has: function has(key) { + return !!getEntry(this, key); + } + }); + + redefineAll(C.prototype, IS_MAP ? { + // 23.1.3.6 Map.prototype.get(key) + get: function get(key) { + var entry = getEntry(this, key); + return entry && entry.value; + }, + // 23.1.3.9 Map.prototype.set(key, value) + set: function set(key, value) { + return define(this, key === 0 ? 0 : key, value); + } + } : { + // 23.2.3.1 Set.prototype.add(value) + add: function add(value) { + return define(this, value = value === 0 ? 0 : value, value); + } + }); + if (DESCRIPTORS) defineProperty(C.prototype, 'size', { + get: function () { + return getInternalState(this).size; + } + }); + return C; + }, + setStrong: function (C, CONSTRUCTOR_NAME, IS_MAP) { + var ITERATOR_NAME = CONSTRUCTOR_NAME + ' Iterator'; + var getInternalCollectionState = internalStateGetterFor(CONSTRUCTOR_NAME); + var getInternalIteratorState = internalStateGetterFor(ITERATOR_NAME); + // add .keys, .values, .entries, [@@iterator] + // 23.1.3.4, 23.1.3.8, 23.1.3.11, 23.1.3.12, 23.2.3.5, 23.2.3.8, 23.2.3.10, 23.2.3.11 + defineIterator(C, CONSTRUCTOR_NAME, function (iterated, kind) { + setInternalState(this, { + type: ITERATOR_NAME, + target: iterated, + state: getInternalCollectionState(iterated), + kind: kind, + last: undefined }); - } + }, function () { + var state = getInternalIteratorState(this); + var kind = state.kind; + var entry = state.last; + // revert to the last existing entry + while (entry && entry.removed) entry = entry.previous; + // get next entry + if (!state.target || !(state.last = entry = entry ? entry.next : state.state.first)) { + // or finish the iteration + state.target = undefined; + return { value: undefined, done: true }; + } + // return step by kind + if (kind == 'keys') return { value: entry.key, done: false }; + if (kind == 'values') return { value: entry.value, done: false }; + return { value: [entry.key, entry.value], done: false }; + }, IS_MAP ? 'entries' : 'values', !IS_MAP, true); + + // add [@@species], 23.1.2.2, 23.2.2.2 + setSpecies(CONSTRUCTOR_NAME); } +}; - function revertPop(fromLocation) { - var toLocation = history.location; // TODO: We could probably make this more reliable by - // keeping a list of paths we've seen in sessionStorage. - // Instead, we just default to 0 for paths we don't know. - var toIndex = allPaths.lastIndexOf(createPath(toLocation)); - if (toIndex === -1) toIndex = 0; - var fromIndex = allPaths.lastIndexOf(createPath(fromLocation)); - if (fromIndex === -1) fromIndex = 0; - var delta = toIndex - fromIndex; +/***/ }), +/* 236 */, +/* 237 */, +/* 238 */, +/* 239 */, +/* 240 */, +/* 241 */, +/* 242 */, +/* 243 */, +/* 244 */, +/* 245 */, +/* 246 */, +/* 247 */ +/***/ (function(module, exports) { - if (delta) { - forceNextPop = true; - go(delta); - } - } // Ensure the hash is encoded properly before doing anything else. +(function() { module.exports = window["wc"]["currency"]; }()); +/***/ }), +/* 248 */ +/***/ (function(module, exports, __webpack_require__) { - var path = getHashPath(); - var encodedPath = encodePath(path); - if (path !== encodedPath) replaceHashPath(encodedPath); - var initialLocation = getDOMLocation(); - var allPaths = [createPath(initialLocation)]; // Public interface +"use strict"; - function createHref(location) { - var baseTag = document.querySelector('base'); - var href = ''; +var collection = __webpack_require__(229); +var collectionStrong = __webpack_require__(235); - if (baseTag && baseTag.getAttribute('href')) { - href = stripHash(window.location.href); - } +// `Set` constructor +// https://tc39.es/ecma262/#sec-set-objects +module.exports = collection('Set', function (init) { + return function Set() { return init(this, arguments.length ? arguments[0] : undefined); }; +}, collectionStrong); - return href + '#' + encodePath(basename + createPath(location)); - } - function push(path, state) { - false ? undefined : void 0; - var action = 'PUSH'; - var location = createLocation(path, undefined, undefined, history.location); - transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { - if (!ok) return; - var path = createPath(location); - var encodedPath = encodePath(basename + path); - var hashChanged = getHashPath() !== encodedPath; +/***/ }), +/* 249 */ +/***/ (function(module, exports, __webpack_require__) { - if (hashChanged) { - // We cannot tell if a hashchange was caused by a PUSH, so we'd - // rather setState here and ignore the hashchange. The caveat here - // is that other hash histories in the page will consider it a POP. - ignorePath = path; - pushHashPath(encodedPath); - var prevIndex = allPaths.lastIndexOf(createPath(history.location)); - var nextPaths = allPaths.slice(0, prevIndex + 1); - nextPaths.push(path); - allPaths = nextPaths; - setState({ - action: action, - location: location - }); - } else { - false ? undefined : void 0; - setState(); +var DESCRIPTORS = __webpack_require__(13); +var objectKeys = __webpack_require__(54); +var toIndexedObject = __webpack_require__(21); +var propertyIsEnumerable = __webpack_require__(76).f; + +// `Object.{ entries, values }` methods implementation +var createMethod = function (TO_ENTRIES) { + return function (it) { + var O = toIndexedObject(it); + var keys = objectKeys(O); + var length = keys.length; + var i = 0; + var result = []; + var key; + while (length > i) { + key = keys[i++]; + if (!DESCRIPTORS || propertyIsEnumerable.call(O, key)) { + result.push(TO_ENTRIES ? [key, O[key]] : O[key]); } - }); - } + } + return result; + }; +}; - function replace(path, state) { - false ? undefined : void 0; - var action = 'REPLACE'; - var location = createLocation(path, undefined, undefined, history.location); - transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { - if (!ok) return; - var path = createPath(location); - var encodedPath = encodePath(basename + path); - var hashChanged = getHashPath() !== encodedPath; +module.exports = { + // `Object.entries` method + // https://tc39.es/ecma262/#sec-object.entries + entries: createMethod(true), + // `Object.values` method + // https://tc39.es/ecma262/#sec-object.values + values: createMethod(false) +}; - if (hashChanged) { - // We cannot tell if a hashchange was caused by a REPLACE, so we'd - // rather setState here and ignore the hashchange. The caveat here - // is that other hash histories in the page will consider it a POP. - ignorePath = path; - replaceHashPath(encodedPath); - } - var prevIndex = allPaths.indexOf(createPath(history.location)); - if (prevIndex !== -1) allPaths[prevIndex] = path; - setState({ - action: action, - location: location - }); - }); - } +/***/ }), +/* 250 */ +/***/ (function(module, exports, __webpack_require__) { - function go(n) { - false ? undefined : void 0; - globalHistory.go(n); - } +var $ = __webpack_require__(12); +var assign = __webpack_require__(221); - function goBack() { - go(-1); - } +// `Object.assign` method +// https://tc39.es/ecma262/#sec-object.assign +$({ target: 'Object', stat: true, forced: Object.assign !== assign }, { + assign: assign +}); - function goForward() { - go(1); - } - var listenerCount = 0; +/***/ }), +/* 251 */, +/* 252 */ +/***/ (function(module, exports, __webpack_require__) { - function checkDOMListeners(delta) { - listenerCount += delta; +var anObject = __webpack_require__(9); +var iteratorClose = __webpack_require__(172); - if (listenerCount === 1 && delta === 1) { - window.addEventListener(HashChangeEvent$1, handleHashChange); - } else if (listenerCount === 0) { - window.removeEventListener(HashChangeEvent$1, handleHashChange); - } +// call something on iterator step with safe closing on error +module.exports = function (iterator, fn, value, ENTRIES) { + try { + return ENTRIES ? fn(anObject(value)[0], value[1]) : fn(value); + // 7.4.6 IteratorClose(iterator, completion) + } catch (error) { + iteratorClose(iterator); + throw error; } +}; - var isBlocked = false; - function block(prompt) { - if (prompt === void 0) { - prompt = false; - } +/***/ }), +/* 253 */ +/***/ (function(module, exports, __webpack_require__) { - var unblock = transitionManager.setPrompt(prompt); +var fails = __webpack_require__(6); - if (!isBlocked) { - checkDOMListeners(1); - isBlocked = true; - } +module.exports = !fails(function () { + return Object.isExtensible(Object.preventExtensions({})); +}); - return function () { - if (isBlocked) { - isBlocked = false; - checkDOMListeners(-1); - } - return unblock(); - }; - } +/***/ }), +/* 254 */ +/***/ (function(module, exports, __webpack_require__) { - function listen(listener) { - var unlisten = transitionManager.appendListener(listener); - checkDOMListeners(1); - return function () { - checkDOMListeners(-1); - unlisten(); - }; - } +var fails = __webpack_require__(6); +var wellKnownSymbol = __webpack_require__(8); +var IS_PURE = __webpack_require__(57); - var history = { - length: globalHistory.length, - action: 'POP', - location: initialLocation, - createHref: createHref, - push: push, - replace: replace, - go: go, - goBack: goBack, - goForward: goForward, - block: block, - listen: listen - }; - return history; -} +var ITERATOR = wellKnownSymbol('iterator'); -function clamp(n, lowerBound, upperBound) { - return Math.min(Math.max(n, lowerBound), upperBound); -} -/** - * Creates a history object that stores locations in memory. - */ +module.exports = !fails(function () { + var url = new URL('b?a=1&b=2&c=3', 'http://a'); + var searchParams = url.searchParams; + var result = ''; + url.pathname = 'c%20d'; + searchParams.forEach(function (value, key) { + searchParams['delete']('b'); + result += key + value; + }); + return (IS_PURE && !url.toJSON) + || !searchParams.sort + || url.href !== 'http://a/c%20d?a=1&c=3' + || searchParams.get('c') !== '3' + || String(new URLSearchParams('?a=1')) !== 'a=1' + || !searchParams[ITERATOR] + // throws in Edge + || new URL('https://a@b').username !== 'a' + || new URLSearchParams(new URLSearchParams('a=b')).get('a') !== 'b' + // not punycoded in Edge + || new URL('http://тест').host !== 'xn--e1aybc' + // not escaped in Chrome 62- + || new URL('http://a#б').hash !== '#%D0%B1' + // fails in Chrome 66- + || result !== 'a1c3' + // throws in Safari + || new URL('http://x', undefined).host !== 'x'; +}); -function createMemoryHistory(props) { - if (props === void 0) { - props = {}; - } +/***/ }), +/* 255 */, +/* 256 */, +/* 257 */, +/* 258 */, +/* 259 */, +/* 260 */, +/* 261 */, +/* 262 */ +/***/ (function(module, exports) { - var _props = props, - getUserConfirmation = _props.getUserConfirmation, - _props$initialEntries = _props.initialEntries, - initialEntries = _props$initialEntries === void 0 ? ['/'] : _props$initialEntries, - _props$initialIndex = _props.initialIndex, - initialIndex = _props$initialIndex === void 0 ? 0 : _props$initialIndex, - _props$keyLength = _props.keyLength, - keyLength = _props$keyLength === void 0 ? 6 : _props$keyLength; - var transitionManager = createTransitionManager(); +(function() { module.exports = window["wp"]["dom"]; }()); - function setState(nextState) { - Object(esm_extends["a" /* default */])(history, nextState); +/***/ }), +/* 263 */, +/* 264 */, +/* 265 */, +/* 266 */, +/* 267 */, +/* 268 */ +/***/ (function(module, exports, __webpack_require__) { - history.length = history.entries.length; - transitionManager.notifyListeners(history.location, history.action); - } +"use strict"; - function createKey() { - return Math.random().toString(36).substr(2, keyLength); - } - var index = clamp(initialIndex, 0, initialEntries.length - 1); - var entries = initialEntries.map(function (entry) { - return typeof entry === 'string' ? createLocation(entry, undefined, createKey()) : createLocation(entry, undefined, entry.key || createKey()); - }); // Public interface +if (true) { + module.exports = __webpack_require__(298); +} else {} - var createHref = createPath; - function push(path, state) { - false ? undefined : void 0; - var action = 'PUSH'; - var location = createLocation(path, state, createKey(), history.location); - transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { - if (!ok) return; - var prevIndex = history.index; - var nextIndex = prevIndex + 1; - var nextEntries = history.entries.slice(0); +/***/ }), +/* 269 */, +/* 270 */, +/* 271 */, +/* 272 */, +/* 273 */, +/* 274 */, +/* 275 */, +/* 276 */, +/* 277 */ +/***/ (function(module, __webpack_exports__, __webpack_require__) { - if (nextEntries.length > nextIndex) { - nextEntries.splice(nextIndex, nextEntries.length - nextIndex, location); - } else { - nextEntries.push(location); - } +"use strict"; +/* harmony import */ var core_js_modules_es_promise_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(165); +/* harmony import */ var core_js_modules_es_promise_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_promise_js__WEBPACK_IMPORTED_MODULE_0__); +/* harmony import */ var core_js_modules_es_object_to_string_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(100); +/* harmony import */ var core_js_modules_es_object_to_string_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_object_to_string_js__WEBPACK_IMPORTED_MODULE_1__); +/* harmony import */ var core_js_modules_es_string_iterator_js__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(151); +/* harmony import */ var core_js_modules_es_string_iterator_js__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_string_iterator_js__WEBPACK_IMPORTED_MODULE_2__); +/* harmony import */ var core_js_modules_es_array_iterator_js__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(123); +/* harmony import */ var core_js_modules_es_array_iterator_js__WEBPACK_IMPORTED_MODULE_3___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_array_iterator_js__WEBPACK_IMPORTED_MODULE_3__); +/* harmony import */ var core_js_modules_web_dom_collections_iterator_js__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(146); +/* harmony import */ var core_js_modules_web_dom_collections_iterator_js__WEBPACK_IMPORTED_MODULE_4___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_web_dom_collections_iterator_js__WEBPACK_IMPORTED_MODULE_4__); +/* harmony import */ var core_js_modules_es_array_filter_js__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(41); +/* harmony import */ var core_js_modules_es_array_filter_js__WEBPACK_IMPORTED_MODULE_5___default = /*#__PURE__*/__webpack_require__.n(core_js_modules_es_array_filter_js__WEBPACK_IMPORTED_MODULE_5__); +/* harmony import */ var _wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(2); +/* harmony import */ var _wordpress_i18n__WEBPACK_IMPORTED_MODULE_6___default = /*#__PURE__*/__webpack_require__.n(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__); +/* harmony import */ var _wordpress_hooks__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(141); +/* harmony import */ var _wordpress_hooks__WEBPACK_IMPORTED_MODULE_7___default = /*#__PURE__*/__webpack_require__.n(_wordpress_hooks__WEBPACK_IMPORTED_MODULE_7__); +/* harmony import */ var _woocommerce_wc_admin_settings__WEBPACK_IMPORTED_MODULE_8__ = __webpack_require__(85); +/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_9__ = __webpack_require__(0); +/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_9___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__); - setState({ - action: action, - location: location, - index: nextIndex, - entries: nextEntries - }); - }); - } - function replace(path, state) { - false ? undefined : void 0; - var action = 'REPLACE'; - var location = createLocation(path, state, createKey(), history.location); - transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { - if (!ok) return; - history.entries[history.index] = location; - setState({ - action: action, - location: location - }); - }); - } - function go(n) { - var nextIndex = clamp(history.index + n, 0, history.entries.length - 1); - var action = 'POP'; - var location = history.entries[nextIndex]; - transitionManager.confirmTransitionTo(location, action, getUserConfirmation, function (ok) { - if (ok) { - setState({ - action: action, - location: location, - index: nextIndex - }); - } else { - // Mimic the behavior of DOM histories by - // causing a render after a cancelled POP. - setState(); - } - }); - } - function goBack() { - go(-1); - } - - function goForward() { - go(1); - } - function canGo(n) { - var nextIndex = history.index + n; - return nextIndex >= 0 && nextIndex < history.entries.length; - } - function block(prompt) { - if (prompt === void 0) { - prompt = false; - } - return transitionManager.setPrompt(prompt); - } +/** + * External dependencies + */ - function listen(listener) { - return transitionManager.appendListener(listener); - } - var history = { - length: entries.length, - action: 'POP', - location: entries[index], - index: index, - entries: entries, - createHref: createHref, - push: push, - replace: replace, - go: go, - goBack: goBack, - goForward: goForward, - canGo: canGo, - block: block, - listen: listen - }; - return history; -} +var manageStock = Object(_woocommerce_wc_admin_settings__WEBPACK_IMPORTED_MODULE_8__[/* getSetting */ "g"])('manageStock', 'no'); +var REPORTS_FILTER = 'woocommerce_admin_reports_list'; +/** + * Internal dependencies + */ +var RevenueReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-revenue */[__webpack_require__.e(0), __webpack_require__.e(16)]).then(__webpack_require__.bind(null, 583)); +}); +var ProductsReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-products */[__webpack_require__.e(0), __webpack_require__.e(2), __webpack_require__.e(15)]).then(__webpack_require__.bind(null, 579)); +}); +var VariationsReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-variations */[__webpack_require__.e(0), __webpack_require__.e(2), __webpack_require__.e(19)]).then(__webpack_require__.bind(null, 584)); +}); +var OrdersReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-orders */[__webpack_require__.e(0), __webpack_require__.e(5), __webpack_require__.e(14)]).then(__webpack_require__.bind(null, 585)); +}); +var CategoriesReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-categories */[__webpack_require__.e(0), __webpack_require__.e(2), __webpack_require__.e(10)]).then(__webpack_require__.bind(null, 581)); +}); +var CouponsReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-coupons */[__webpack_require__.e(0), __webpack_require__.e(11)]).then(__webpack_require__.bind(null, 586)); +}); +var TaxesReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-taxes */[__webpack_require__.e(0), __webpack_require__.e(18)]).then(__webpack_require__.bind(null, 587)); +}); +var DownloadsReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-downloads */[__webpack_require__.e(0), __webpack_require__.e(13)]).then(__webpack_require__.bind(null, 588)); +}); +var StockReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-stock */[__webpack_require__.e(0), __webpack_require__.e(17)]).then(__webpack_require__.bind(null, 580)); +}); +var CustomersReport = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_9__["lazy"])(function () { + return Promise.all(/* import() | analytics-report-customers */[__webpack_require__.e(0), __webpack_require__.e(12)]).then(__webpack_require__.bind(null, 582)); +}); +/* harmony default export */ __webpack_exports__["a"] = (function () { + var reports = [{ + report: 'revenue', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Revenue', 'woocommerce-admin'), + component: RevenueReport, + navArgs: { + id: 'woocommerce-analytics-revenue' + } + }, { + report: 'products', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Products', 'woocommerce-admin'), + component: ProductsReport, + navArgs: { + id: 'woocommerce-analytics-products' + } + }, { + report: 'variations', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Variations', 'woocommerce-admin'), + component: VariationsReport, + navArgs: { + id: 'woocommerce-analytics-variations' + } + }, { + report: 'orders', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Orders', 'woocommerce-admin'), + component: OrdersReport, + navArgs: { + id: 'woocommerce-analytics-orders' + } + }, { + report: 'categories', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Categories', 'woocommerce-admin'), + component: CategoriesReport, + navArgs: { + id: 'woocommerce-analytics-categories' + } + }, { + report: 'coupons', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Coupons', 'woocommerce-admin'), + component: CouponsReport, + navArgs: { + id: 'woocommerce-analytics-coupons' + } + }, { + report: 'taxes', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Taxes', 'woocommerce-admin'), + component: TaxesReport, + navArgs: { + id: 'woocommerce-analytics-taxes' + } + }, manageStock === 'yes' ? { + report: 'stock', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Stock', 'woocommerce-admin'), + component: StockReport, + navArgs: { + id: 'woocommerce-analytics-stock' + } + } : null, { + report: 'customers', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Customers', 'woocommerce-admin'), + component: CustomersReport + }, { + report: 'downloads', + title: Object(_wordpress_i18n__WEBPACK_IMPORTED_MODULE_6__["__"])('Downloads', 'woocommerce-admin'), + component: DownloadsReport, + navArgs: { + id: 'woocommerce-analytics-downloads' + } + }].filter(Boolean); + return Object(_wordpress_hooks__WEBPACK_IMPORTED_MODULE_7__["applyFilters"])(REPORTS_FILTER, reports); +}); /***/ }), -/* 109 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +/* 278 */ +/***/ (function(module, exports, __webpack_require__) { "use strict"; -/* harmony import */ var _babel_runtime_helpers_esm_classCallCheck__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(16); -/* harmony import */ var _babel_runtime_helpers_esm_createClass__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(17); -/* harmony import */ var _babel_runtime_helpers_esm_assertThisInitialized__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(12); -/* harmony import */ var _babel_runtime_helpers_esm_inherits__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(18); -/* harmony import */ var _babel_runtime_helpers_esm_possibleConstructorReturn__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(21); -/* harmony import */ var _babel_runtime_helpers_esm_getPrototypeOf__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(9); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_6___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_6__); -/* harmony import */ var _wordpress_compose__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(77); -/* harmony import */ var _wordpress_keycodes__WEBPACK_IMPORTED_MODULE_8__ = __webpack_require__(57); -/* harmony import */ var _wordpress_dom__WEBPACK_IMPORTED_MODULE_9__ = __webpack_require__(69); - - - - +var reactIs = __webpack_require__(268); +/** + * Copyright 2015, Yahoo! Inc. + * Copyrights licensed under the New BSD License. See the accompanying LICENSE file for terms. + */ +var REACT_STATICS = { + childContextTypes: true, + contextType: true, + contextTypes: true, + defaultProps: true, + displayName: true, + getDefaultProps: true, + getDerivedStateFromError: true, + getDerivedStateFromProps: true, + mixins: true, + propTypes: true, + type: true +}; +var KNOWN_STATICS = { + name: true, + length: true, + prototype: true, + caller: true, + callee: true, + arguments: true, + arity: true +}; +var FORWARD_REF_STATICS = { + '$$typeof': true, + render: true, + defaultProps: true, + displayName: true, + propTypes: true +}; +var MEMO_STATICS = { + '$$typeof': true, + compare: true, + defaultProps: true, + displayName: true, + propTypes: true, + type: true +}; +var TYPE_STATICS = {}; +TYPE_STATICS[reactIs.ForwardRef] = FORWARD_REF_STATICS; +TYPE_STATICS[reactIs.Memo] = MEMO_STATICS; -function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(_babel_runtime_helpers_esm_getPrototypeOf__WEBPACK_IMPORTED_MODULE_5__[/* default */ "a"])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(_babel_runtime_helpers_esm_getPrototypeOf__WEBPACK_IMPORTED_MODULE_5__[/* default */ "a"])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(_babel_runtime_helpers_esm_possibleConstructorReturn__WEBPACK_IMPORTED_MODULE_4__[/* default */ "a"])(this, result); }; } +function getStatics(component) { + // React v16.11 and below + if (reactIs.isMemo(component)) { + return MEMO_STATICS; + } // React v16.12 and above -function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } } -/** - * WordPress dependencies - */ + return TYPE_STATICS[component['$$typeof']] || REACT_STATICS; +} +var defineProperty = Object.defineProperty; +var getOwnPropertyNames = Object.getOwnPropertyNames; +var getOwnPropertySymbols = Object.getOwnPropertySymbols; +var getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor; +var getPrototypeOf = Object.getPrototypeOf; +var objectPrototype = Object.prototype; +function hoistNonReactStatics(targetComponent, sourceComponent, blacklist) { + if (typeof sourceComponent !== 'string') { + // don't hoist over string (html) components + if (objectPrototype) { + var inheritedComponent = getPrototypeOf(sourceComponent); + if (inheritedComponent && inheritedComponent !== objectPrototype) { + hoistNonReactStatics(targetComponent, inheritedComponent, blacklist); + } + } + var keys = getOwnPropertyNames(sourceComponent); -var withConstrainedTabbing = Object(_wordpress_compose__WEBPACK_IMPORTED_MODULE_7__[/* default */ "a"])(function (WrappedComponent) { - return /*#__PURE__*/function (_Component) { - Object(_babel_runtime_helpers_esm_inherits__WEBPACK_IMPORTED_MODULE_3__[/* default */ "a"])(_class, _Component); + if (getOwnPropertySymbols) { + keys = keys.concat(getOwnPropertySymbols(sourceComponent)); + } - var _super = _createSuper(_class); + var targetStatics = getStatics(targetComponent); + var sourceStatics = getStatics(sourceComponent); - function _class() { - var _this; + for (var i = 0; i < keys.length; ++i) { + var key = keys[i]; - Object(_babel_runtime_helpers_esm_classCallCheck__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(this, _class); + if (!KNOWN_STATICS[key] && !(blacklist && blacklist[key]) && !(sourceStatics && sourceStatics[key]) && !(targetStatics && targetStatics[key])) { + var descriptor = getOwnPropertyDescriptor(sourceComponent, key); - _this = _super.apply(this, arguments); - _this.focusContainRef = Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_6__["createRef"])(); - _this.handleTabBehaviour = _this.handleTabBehaviour.bind(Object(_babel_runtime_helpers_esm_assertThisInitialized__WEBPACK_IMPORTED_MODULE_2__[/* default */ "a"])(_this)); - return _this; + try { + // Avoid failures from read-only properties + defineProperty(targetComponent, key, descriptor); + } catch (e) {} + } } + } - Object(_babel_runtime_helpers_esm_createClass__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])(_class, [{ - key: "handleTabBehaviour", - value: function handleTabBehaviour(event) { - if (event.keyCode !== _wordpress_keycodes__WEBPACK_IMPORTED_MODULE_8__[/* TAB */ "e"]) { - return; - } + return targetComponent; +} - var tabbables = _wordpress_dom__WEBPACK_IMPORTED_MODULE_9__[/* focus */ "a"].tabbable.find(this.focusContainRef.current); +module.exports = hoistNonReactStatics; - if (!tabbables.length) { - return; - } - var firstTabbable = tabbables[0]; - var lastTabbable = tabbables[tabbables.length - 1]; - - if (event.shiftKey && event.target === firstTabbable) { - event.preventDefault(); - lastTabbable.focus(); - } else if (!event.shiftKey && event.target === lastTabbable) { - event.preventDefault(); - firstTabbable.focus(); - /* - * When pressing Tab and none of the tabbables has focus, the keydown - * event happens on the wrapper div: move focus on the first tabbable. - */ - } else if (!tabbables.includes(event.target)) { - event.preventDefault(); - firstTabbable.focus(); - } - } - }, { - key: "render", - value: function render() { - // Disable reason: this component is non-interactive, but must capture - // events from the wrapped component to determine when the Tab key is used. - - /* eslint-disable jsx-a11y/no-static-element-interactions */ - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_6__["createElement"])("div", { - onKeyDown: this.handleTabBehaviour, - ref: this.focusContainRef, - tabIndex: "-1" - }, Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_6__["createElement"])(WrappedComponent, this.props)); - /* eslint-enable jsx-a11y/no-static-element-interactions */ - } - }]); +/***/ }), +/* 279 */ +/***/ (function(module, exports) { - return _class; - }(_wordpress_element__WEBPACK_IMPORTED_MODULE_6__["Component"]); -}, 'withConstrainedTabbing'); -/* harmony default export */ __webpack_exports__["a"] = (withConstrainedTabbing); -//# sourceMappingURL=index.js.map +(function() { module.exports = window["wp"]["plugins"]; }()); /***/ }), -/* 110 */ +/* 280 */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; -/* harmony import */ var _babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(7); -/* harmony import */ var _babel_runtime_helpers_esm_classCallCheck__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(16); -/* harmony import */ var _babel_runtime_helpers_esm_createClass__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(17); -/* harmony import */ var _babel_runtime_helpers_esm_assertThisInitialized__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(12); -/* harmony import */ var _babel_runtime_helpers_esm_inherits__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(18); -/* harmony import */ var _babel_runtime_helpers_esm_possibleConstructorReturn__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(21); -/* harmony import */ var _babel_runtime_helpers_esm_getPrototypeOf__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(9); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_7___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_7__); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_8__ = __webpack_require__(2); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_8___default = /*#__PURE__*/__webpack_require__.n(lodash__WEBPACK_IMPORTED_MODULE_8__); -/* harmony import */ var _wordpress_compose__WEBPACK_IMPORTED_MODULE_9__ = __webpack_require__(77); +// EXPORTS +__webpack_require__.d(__webpack_exports__, "c", function() { return /* binding */ layout_PrimaryLayout; }); +__webpack_require__.d(__webpack_exports__, "b", function() { return /* binding */ PageLayout; }); +__webpack_require__.d(__webpack_exports__, "a", function() { return /* binding */ EmbedLayout; }); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.reflect.construct.js +var es_reflect_construct = __webpack_require__(64); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.object.keys.js +var es_object_keys = __webpack_require__(38); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.symbol.js +var es_symbol = __webpack_require__(53); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.object.get-own-property-descriptor.js +var es_object_get_own_property_descriptor = __webpack_require__(60); +// EXTERNAL MODULE: ./node_modules/core-js/modules/web.dom-collections.for-each.js +var web_dom_collections_for_each = __webpack_require__(49); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.object.get-own-property-descriptors.js +var es_object_get_own_property_descriptors = __webpack_require__(61); +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/extends.js +var helpers_extends = __webpack_require__(80); +var extends_default = /*#__PURE__*/__webpack_require__.n(helpers_extends); -function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(_babel_runtime_helpers_esm_getPrototypeOf__WEBPACK_IMPORTED_MODULE_6__[/* default */ "a"])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(_babel_runtime_helpers_esm_getPrototypeOf__WEBPACK_IMPORTED_MODULE_6__[/* default */ "a"])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(_babel_runtime_helpers_esm_possibleConstructorReturn__WEBPACK_IMPORTED_MODULE_5__[/* default */ "a"])(this, result); }; } +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/objectWithoutProperties.js +var objectWithoutProperties = __webpack_require__(116); +var objectWithoutProperties_default = /*#__PURE__*/__webpack_require__.n(objectWithoutProperties); -function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } } +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/defineProperty.js +var defineProperty = __webpack_require__(7); +var defineProperty_default = /*#__PURE__*/__webpack_require__.n(defineProperty); -/** - * External dependencies - */ +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/classCallCheck.js +var classCallCheck = __webpack_require__(22); +var classCallCheck_default = /*#__PURE__*/__webpack_require__.n(classCallCheck); -/** - * WordPress dependencies - */ +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/createClass.js +var createClass = __webpack_require__(23); +var createClass_default = /*#__PURE__*/__webpack_require__.n(createClass); +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/inherits.js +var inherits = __webpack_require__(24); +var inherits_default = /*#__PURE__*/__webpack_require__.n(inherits); +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/possibleConstructorReturn.js +var possibleConstructorReturn = __webpack_require__(25); +var possibleConstructorReturn_default = /*#__PURE__*/__webpack_require__.n(possibleConstructorReturn); -/** - * Input types which are classified as button types, for use in considering - * whether element is a (focus-normalized) button. - * - * @type {string[]} - */ +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/getPrototypeOf.js +var getPrototypeOf = __webpack_require__(14); +var getPrototypeOf_default = /*#__PURE__*/__webpack_require__.n(getPrototypeOf); -var INPUT_BUTTON_TYPES = ['button', 'submit']; -/** - * Returns true if the given element is a button element subject to focus - * normalization, or false otherwise. - * - * @see https://developer.mozilla.org/en-US/docs/Web/HTML/Element/button#Clicking_and_focus - * - * @param {Element} element Element to test. - * - * @return {boolean} Whether element is a button. - */ - -function isFocusNormalizedButton(element) { - switch (element.nodeName) { - case 'A': - case 'BUTTON': - return true; - - case 'INPUT': - return Object(lodash__WEBPACK_IMPORTED_MODULE_8__["includes"])(INPUT_BUTTON_TYPES, element.type); - } - - return false; -} - -/* harmony default export */ __webpack_exports__["a"] = (Object(_wordpress_compose__WEBPACK_IMPORTED_MODULE_9__[/* default */ "a"])(function (WrappedComponent) { - return /*#__PURE__*/function (_Component) { - Object(_babel_runtime_helpers_esm_inherits__WEBPACK_IMPORTED_MODULE_4__[/* default */ "a"])(_class, _Component); - - var _super = _createSuper(_class); - - function _class() { - var _this; - - Object(_babel_runtime_helpers_esm_classCallCheck__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])(this, _class); - - _this = _super.apply(this, arguments); - _this.bindNode = _this.bindNode.bind(Object(_babel_runtime_helpers_esm_assertThisInitialized__WEBPACK_IMPORTED_MODULE_3__[/* default */ "a"])(_this)); - _this.cancelBlurCheck = _this.cancelBlurCheck.bind(Object(_babel_runtime_helpers_esm_assertThisInitialized__WEBPACK_IMPORTED_MODULE_3__[/* default */ "a"])(_this)); - _this.queueBlurCheck = _this.queueBlurCheck.bind(Object(_babel_runtime_helpers_esm_assertThisInitialized__WEBPACK_IMPORTED_MODULE_3__[/* default */ "a"])(_this)); - _this.normalizeButtonFocus = _this.normalizeButtonFocus.bind(Object(_babel_runtime_helpers_esm_assertThisInitialized__WEBPACK_IMPORTED_MODULE_3__[/* default */ "a"])(_this)); - return _this; - } - - Object(_babel_runtime_helpers_esm_createClass__WEBPACK_IMPORTED_MODULE_2__[/* default */ "a"])(_class, [{ - key: "componentWillUnmount", - value: function componentWillUnmount() { - this.cancelBlurCheck(); - } - }, { - key: "bindNode", - value: function bindNode(node) { - if (node) { - this.node = node; - } else { - delete this.node; - this.cancelBlurCheck(); - } - } - }, { - key: "queueBlurCheck", - value: function queueBlurCheck(event) { - var _this2 = this; - - // React does not allow using an event reference asynchronously - // due to recycling behavior, except when explicitly persisted. - event.persist(); // Skip blur check if clicking button. See `normalizeButtonFocus`. - - if (this.preventBlurCheck) { - return; - } +// EXTERNAL MODULE: external ["wp","element"] +var external_wp_element_ = __webpack_require__(0); - this.blurCheckTimeout = setTimeout(function () { - // If document is not focused then focus should remain - // inside the wrapped component and therefore we cancel - // this blur event thereby leaving focus in place. - // https://developer.mozilla.org/en-US/docs/Web/API/Document/hasFocus. - if (!document.hasFocus()) { - event.preventDefault(); - return; - } +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.promise.js +var es_promise = __webpack_require__(165); - if ('function' === typeof _this2.node.handleFocusOutside) { - _this2.node.handleFocusOutside(event); - } - }, 0); - } - }, { - key: "cancelBlurCheck", - value: function cancelBlurCheck() { - clearTimeout(this.blurCheckTimeout); - } - /** - * Handles a mousedown or mouseup event to respectively assign and - * unassign a flag for preventing blur check on button elements. Some - * browsers, namely Firefox and Safari, do not emit a focus event on - * button elements when clicked, while others do. The logic here - * intends to normalize this as treating click on buttons as focus. - * - * @see https://developer.mozilla.org/en-US/docs/Web/HTML/Element/button#Clicking_and_focus - * - * @param {MouseEvent} event Event for mousedown or mouseup. - */ +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.object.to-string.js +var es_object_to_string = __webpack_require__(100); - }, { - key: "normalizeButtonFocus", - value: function normalizeButtonFocus(event) { - var type = event.type, - target = event.target; - var isInteractionEnd = Object(lodash__WEBPACK_IMPORTED_MODULE_8__["includes"])(['mouseup', 'touchend'], type); - - if (isInteractionEnd) { - this.preventBlurCheck = false; - } else if (isFocusNormalizedButton(target)) { - this.preventBlurCheck = true; - } - } - }, { - key: "render", - value: function render() { - // Disable reason: See `normalizeButtonFocus` for browser-specific - // focus event normalization. - - /* eslint-disable jsx-a11y/no-static-element-interactions */ - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_7__["createElement"])("div", { - onFocus: this.cancelBlurCheck, - onMouseDown: this.normalizeButtonFocus, - onMouseUp: this.normalizeButtonFocus, - onTouchStart: this.normalizeButtonFocus, - onTouchEnd: this.normalizeButtonFocus, - onBlur: this.queueBlurCheck - }, Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_7__["createElement"])(WrappedComponent, Object(_babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])({ - ref: this.bindNode - }, this.props))); - /* eslint-enable jsx-a11y/no-static-element-interactions */ - } - }]); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.string.iterator.js +var es_string_iterator = __webpack_require__(151); - return _class; - }(_wordpress_element__WEBPACK_IMPORTED_MODULE_7__["Component"]); -}, 'withFocusOutside')); -//# sourceMappingURL=index.js.map +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.array.iterator.js +var es_array_iterator = __webpack_require__(123); -/***/ }), -/* 111 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +// EXTERNAL MODULE: ./node_modules/core-js/modules/web.dom-collections.iterator.js +var web_dom_collections_iterator = __webpack_require__(146); -"use strict"; -/* harmony import */ var _babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(7); -/* harmony import */ var _babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(11); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.string.search.js +var es_string_search = __webpack_require__(170); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.regexp.exec.js +var es_regexp_exec = __webpack_require__(88); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.string.replace.js +var es_string_replace = __webpack_require__(127); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.array.includes.js +var es_array_includes = __webpack_require__(107); -/** - * WordPress dependencies - */ +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.string.includes.js +var es_string_includes = __webpack_require__(140); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.array.map.js +var es_array_map = __webpack_require__(52); -function stopPropagation(event) { - event.stopPropagation(); -} +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.array.filter.js +var es_array_filter = __webpack_require__(41); -/* harmony default export */ __webpack_exports__["a"] = (Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__["forwardRef"])(function (_ref, ref) { - var children = _ref.children, - props = Object(_babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])(_ref, ["children"]); +// EXTERNAL MODULE: external ["wp","compose"] +var external_wp_compose_ = __webpack_require__(65); - // Disable reason: this stops certain events from propagating outside of the component. - // - onMouseDown is disabled as this can cause interactions with other DOM elements +// EXTERNAL MODULE: external ["wp","data"] +var external_wp_data_ = __webpack_require__(26); - /* eslint-disable jsx-a11y/no-static-element-interactions */ - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_2__["createElement"])("div", Object(_babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])({}, props, { - ref: ref, - onMouseDown: stopPropagation - }), children); - /* eslint-enable jsx-a11y/no-static-element-interactions */ -})); -//# sourceMappingURL=index.js.map +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/inheritsLoose.js + 1 modules +var inheritsLoose = __webpack_require__(129); -/***/ }), -/* 112 */, -/* 113 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +// EXTERNAL MODULE: external "React" +var external_React_ = __webpack_require__(20); +var external_React_default = /*#__PURE__*/__webpack_require__.n(external_React_); -"use strict"; +// EXTERNAL MODULE: ./node_modules/prop-types/index.js +var prop_types = __webpack_require__(1); +var prop_types_default = /*#__PURE__*/__webpack_require__.n(prop_types); -// UNUSED EXPORTS: Provider +// EXTERNAL MODULE: ./node_modules/history/esm/history.js + 2 modules +var esm_history = __webpack_require__(202); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/toConsumableArray.js + 3 modules -var toConsumableArray = __webpack_require__(26); +// EXTERNAL MODULE: ./node_modules/mini-create-react-context/dist/esm/index.js +var esm = __webpack_require__(316); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/classCallCheck.js -var classCallCheck = __webpack_require__(16); +// EXTERNAL MODULE: ./node_modules/tiny-invariant/dist/tiny-invariant.esm.js +var tiny_invariant_esm = __webpack_require__(176); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/createClass.js -var createClass = __webpack_require__(17); +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/extends.js +var esm_extends = __webpack_require__(117); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/inherits.js + 1 modules -var inherits = __webpack_require__(18); +// EXTERNAL MODULE: ./node_modules/path-to-regexp/index.js +var path_to_regexp = __webpack_require__(317); +var path_to_regexp_default = /*#__PURE__*/__webpack_require__.n(path_to_regexp); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js -var possibleConstructorReturn = __webpack_require__(21); +// EXTERNAL MODULE: ./node_modules/react-is/index.js +var react_is = __webpack_require__(268); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js -var getPrototypeOf = __webpack_require__(9); +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/objectWithoutPropertiesLoose.js +var objectWithoutPropertiesLoose = __webpack_require__(134); -// EXTERNAL MODULE: external {"this":["wp","element"]} -var external_this_wp_element_ = __webpack_require__(0); +// EXTERNAL MODULE: ./node_modules/hoist-non-react-statics/dist/hoist-non-react-statics.cjs.js +var hoist_non_react_statics_cjs = __webpack_require__(278); +var hoist_non_react_statics_cjs_default = /*#__PURE__*/__webpack_require__.n(hoist_non_react_statics_cjs); -// EXTERNAL MODULE: external "lodash" -var external_lodash_ = __webpack_require__(2); +// CONCATENATED MODULE: ./node_modules/react-router/esm/react-router.js -// EXTERNAL MODULE: ./node_modules/@wordpress/compose/build-module/utils/create-higher-order-component/index.js -var create_higher_order_component = __webpack_require__(77); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/assertThisInitialized.js -var assertThisInitialized = __webpack_require__(12); -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/higher-order/with-focus-return/context.js @@ -9248,4559 +9243,3604 @@ var assertThisInitialized = __webpack_require__(12); -function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(getPrototypeOf["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(possibleConstructorReturn["a" /* default */])(this, result); }; } -function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } } +// TODO: Replace with React.createContext once we can assume React 16+ -/** - * External dependencies - */ +var react_router_createNamedContext = function createNamedContext(name) { + var context = Object(esm["a" /* default */])(); + context.displayName = name; + return context; +}; -/** - * WordPress dependencies - */ +var historyContext = +/*#__PURE__*/ +react_router_createNamedContext("Router-History"); +// TODO: Replace with React.createContext once we can assume React 16+ +var createNamedContext$1 = function createNamedContext(name) { + var context = Object(esm["a" /* default */])(); + context.displayName = name; + return context; +}; -var _createContext = Object(external_this_wp_element_["createContext"])({ - focusHistory: [] -}), - Provider = _createContext.Provider, - Consumer = _createContext.Consumer; +var react_router_context = +/*#__PURE__*/ +createNamedContext$1("Router"); -Provider.displayName = 'FocusReturnProvider'; -Consumer.displayName = 'FocusReturnConsumer'; /** - * The maximum history length to capture for the focus stack. When exceeded, - * items should be shifted from the stack for each consecutive push. - * - * @type {number} + * The public API for putting history on context. */ -var MAX_STACK_LENGTH = 100; - -var context_FocusReturnProvider = /*#__PURE__*/function (_Component) { - Object(inherits["a" /* default */])(FocusReturnProvider, _Component); +var react_router_Router = +/*#__PURE__*/ +function (_React$Component) { + Object(inheritsLoose["a" /* default */])(Router, _React$Component); - var _super = _createSuper(FocusReturnProvider); + Router.computeRootMatch = function computeRootMatch(pathname) { + return { + path: "/", + url: "/", + params: {}, + isExact: pathname === "/" + }; + }; - function FocusReturnProvider() { + function Router(props) { var _this; - Object(classCallCheck["a" /* default */])(this, FocusReturnProvider); - - _this = _super.apply(this, arguments); - _this.onFocus = _this.onFocus.bind(Object(assertThisInitialized["a" /* default */])(_this)); + _this = _React$Component.call(this, props) || this; _this.state = { - focusHistory: [] - }; - return _this; - } + location: props.history.location + }; // This is a bit of a hack. We have to start listening for location + // changes here in the constructor in case there are any s + // on the initial render. If there are, they will replace/push when + // they mount and since cDM fires in children before parents, we may + // get a new location before the is mounted. - Object(createClass["a" /* default */])(FocusReturnProvider, [{ - key: "onFocus", - value: function onFocus(event) { - var focusHistory = this.state.focusHistory; // Push the focused element to the history stack, keeping only unique - // members but preferring the _last_ occurrence of any duplicates. - // Lodash's `uniq` behavior favors the first occurrence, so the array - // is temporarily reversed prior to it being called upon. Uniqueness - // helps avoid situations where, such as in a constrained tabbing area, - // the user changes focus enough within a transient element that the - // stack may otherwise only consist of members pending destruction, at - // which point focus might have been lost. + _this._isMounted = false; + _this._pendingLocation = null; - var nextFocusHistory = Object(external_lodash_["uniq"])([].concat(Object(toConsumableArray["a" /* default */])(focusHistory), [event.target]).slice(-1 * MAX_STACK_LENGTH).reverse()).reverse(); - this.setState({ - focusHistory: nextFocusHistory + if (!props.staticContext) { + _this.unlisten = props.history.listen(function (location) { + if (_this._isMounted) { + _this.setState({ + location: location + }); + } else { + _this._pendingLocation = location; + } }); } - }, { - key: "render", - value: function render() { - var _this$props = this.props, - children = _this$props.children, - className = _this$props.className; - return Object(external_this_wp_element_["createElement"])(Provider, { - value: this.state - }, Object(external_this_wp_element_["createElement"])("div", { - onFocus: this.onFocus, - className: className - }, children)); - } - }]); - - return FocusReturnProvider; -}(external_this_wp_element_["Component"]); - -/* harmony default export */ var with_focus_return_context = (context_FocusReturnProvider); - -//# sourceMappingURL=context.js.map -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/higher-order/with-focus-return/index.js - - - - - + return _this; + } + var _proto = Router.prototype; -function with_focus_return_createSuper(Derived) { var hasNativeReflectConstruct = with_focus_return_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(getPrototypeOf["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(possibleConstructorReturn["a" /* default */])(this, result); }; } + _proto.componentDidMount = function componentDidMount() { + this._isMounted = true; -function with_focus_return_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } } + if (this._pendingLocation) { + this.setState({ + location: this._pendingLocation + }); + } + }; -/** - * External dependencies - */ + _proto.componentWillUnmount = function componentWillUnmount() { + if (this.unlisten) this.unlisten(); + }; -/** - * WordPress dependencies - */ + _proto.render = function render() { + return external_React_default.a.createElement(react_router_context.Provider, { + value: { + history: this.props.history, + location: this.state.location, + match: Router.computeRootMatch(this.state.location.pathname), + staticContext: this.props.staticContext + } + }, external_React_default.a.createElement(historyContext.Provider, { + children: this.props.children || null, + value: this.props.history + })); + }; + return Router; +}(external_React_default.a.Component); +if (false) {} /** - * Internal dependencies + * The public API for a that stores location in memory. */ +var react_router_MemoryRouter = +/*#__PURE__*/ +function (_React$Component) { + Object(inheritsLoose["a" /* default */])(MemoryRouter, _React$Component); -/** - * Returns true if the given object is component-like. An object is component- - * like if it is an instance of wp.element.Component, or is a function. - * - * @param {*} object Object to test. - * - * @return {boolean} Whether object is component-like. - */ - -function isComponentLike(object) { - return object instanceof external_this_wp_element_["Component"] || typeof object === 'function'; -} -/** - * Higher Order Component used to be used to wrap disposable elements like - * sidebars, modals, dropdowns. When mounting the wrapped component, we track a - * reference to the current active element so we know where to restore focus - * when the component is unmounted. - * - * @param {(WPComponent|Object)} options The component to be enhanced with - * focus return behavior, or an object - * describing the component and the - * focus return characteristics. - * - * @return {WPComponent} Component with the focus restauration behaviour. - */ + function MemoryRouter() { + var _this; + for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { + args[_key] = arguments[_key]; + } -function withFocusReturn(options) { - // Normalize as overloaded form `withFocusReturn( options )( Component )` - // or as `withFocusReturn( Component )`. - if (isComponentLike(options)) { - var WrappedComponent = options; - return withFocusReturn({})(WrappedComponent); + _this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this; + _this.history = Object(esm_history["c" /* createMemoryHistory */])(_this.props); + return _this; } - var _options$onFocusRetur = options.onFocusReturn, - onFocusReturn = _options$onFocusRetur === void 0 ? external_lodash_["stubTrue"] : _options$onFocusRetur; - return function (WrappedComponent) { - var FocusReturn = /*#__PURE__*/function (_Component) { - Object(inherits["a" /* default */])(FocusReturn, _Component); + var _proto = MemoryRouter.prototype; - var _super = with_focus_return_createSuper(FocusReturn); + _proto.render = function render() { + return external_React_default.a.createElement(react_router_Router, { + history: this.history, + children: this.props.children + }); + }; - function FocusReturn() { - var _this; + return MemoryRouter; +}(external_React_default.a.Component); - Object(classCallCheck["a" /* default */])(this, FocusReturn); +if (false) {} - _this = _super.apply(this, arguments); - _this.ownFocusedElements = new Set(); - _this.activeElementOnMount = document.activeElement; +var react_router_Lifecycle = +/*#__PURE__*/ +function (_React$Component) { + Object(inheritsLoose["a" /* default */])(Lifecycle, _React$Component); - _this.setIsFocusedFalse = function () { - return _this.isFocused = false; - }; + function Lifecycle() { + return _React$Component.apply(this, arguments) || this; + } - _this.setIsFocusedTrue = function (event) { - _this.ownFocusedElements.add(event.target); + var _proto = Lifecycle.prototype; - _this.isFocused = true; - }; + _proto.componentDidMount = function componentDidMount() { + if (this.props.onMount) this.props.onMount.call(this, this); + }; - return _this; - } + _proto.componentDidUpdate = function componentDidUpdate(prevProps) { + if (this.props.onUpdate) this.props.onUpdate.call(this, this, prevProps); + }; - Object(createClass["a" /* default */])(FocusReturn, [{ - key: "componentWillUnmount", - value: function componentWillUnmount() { - var activeElementOnMount = this.activeElementOnMount, - isFocused = this.isFocused, - ownFocusedElements = this.ownFocusedElements; + _proto.componentWillUnmount = function componentWillUnmount() { + if (this.props.onUnmount) this.props.onUnmount.call(this, this); + }; - if (!isFocused) { - return; - } // Defer to the component's own explicit focus return behavior, - // if specified. The function should return `false` to prevent - // the default behavior otherwise occurring here. This allows - // for support that the `onFocusReturn` decides to allow the - // default behavior to occur under some conditions. + _proto.render = function render() { + return null; + }; + return Lifecycle; +}(external_React_default.a.Component); - if (onFocusReturn() === false) { - return; - } +/** + * The public API for prompting the user before navigating away from a screen. + */ - var stack = [].concat(Object(toConsumableArray["a" /* default */])(external_lodash_["without"].apply(void 0, [this.props.focus.focusHistory].concat(Object(toConsumableArray["a" /* default */])(ownFocusedElements)))), [activeElementOnMount]); - var candidate; - - while (candidate = stack.pop()) { - if (document.body.contains(candidate)) { - candidate.focus(); - return; - } - } - } - }, { - key: "render", - value: function render() { - return Object(external_this_wp_element_["createElement"])("div", { - onFocus: this.setIsFocusedTrue, - onBlur: this.setIsFocusedFalse - }, Object(external_this_wp_element_["createElement"])(WrappedComponent, this.props.childProps)); +function Prompt(_ref) { + var message = _ref.message, + _ref$when = _ref.when, + when = _ref$when === void 0 ? true : _ref$when; + return external_React_default.a.createElement(react_router_context.Consumer, null, function (context) { + !context ? false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) : void 0; + if (!when || context.staticContext) return null; + var method = context.history.block; + return external_React_default.a.createElement(react_router_Lifecycle, { + onMount: function onMount(self) { + self.release = method(message); + }, + onUpdate: function onUpdate(self, prevProps) { + if (prevProps.message !== message) { + self.release(); + self.release = method(message); } - }]); - - return FocusReturn; - }(external_this_wp_element_["Component"]); - - return function (props) { - return Object(external_this_wp_element_["createElement"])(Consumer, null, function (context) { - return Object(external_this_wp_element_["createElement"])(FocusReturn, { - childProps: props, - focus: context - }); - }); - }; - }; + }, + onUnmount: function onUnmount(self) { + self.release(); + }, + message: message + }); + }); } -/* harmony default export */ var with_focus_return = __webpack_exports__["a"] = (Object(create_higher_order_component["a" /* default */])(withFocusReturn, 'withFocusReturn')); - -//# sourceMappingURL=index.js.map - -/***/ }), -/* 114 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony import */ var _babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(6); -/* harmony import */ var _babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(7); -/* harmony import */ var _babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(11); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_3___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__); -/* harmony import */ var _wordpress_primitives__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(78); -/* harmony import */ var _dashicon__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(107); - - - - -function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; } +if (false) { var messageType; } -function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(_babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } +var cache = {}; +var cacheLimit = 10000; +var cacheCount = 0; -/** - * WordPress dependencies - */ +function compilePath(path) { + if (cache[path]) return cache[path]; + var generator = path_to_regexp_default.a.compile(path); + if (cacheCount < cacheLimit) { + cache[path] = generator; + cacheCount++; + } + return generator; +} /** - * Internal dependencies + * Public API for generating a URL pathname from a path and parameters. */ +function generatePath(path, params) { + if (path === void 0) { + path = "/"; + } -function Icon(_ref) { - var _ref$icon = _ref.icon, - icon = _ref$icon === void 0 ? null : _ref$icon, - size = _ref.size, - additionalProps = Object(_babel_runtime_helpers_esm_objectWithoutProperties__WEBPACK_IMPORTED_MODULE_2__[/* default */ "a"])(_ref, ["icon", "size"]); - - // Dashicons should be 20x20 by default. - var dashiconSize = size || 20; - - if ('string' === typeof icon) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])(_dashicon__WEBPACK_IMPORTED_MODULE_5__[/* default */ "a"], Object(_babel_runtime_helpers_esm_extends__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])({ - icon: icon, - size: dashiconSize - }, additionalProps)); + if (params === void 0) { + params = {}; } - if (icon && _dashicon__WEBPACK_IMPORTED_MODULE_5__[/* default */ "a"] === icon.type) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["cloneElement"])(icon, _objectSpread({ - size: dashiconSize - }, additionalProps)); - } // Icons should be 24x24 by default. + return path === "/" ? path : compilePath(path)(params, { + pretty: true + }); +} +/** + * The public API for navigating programmatically with a component. + */ - var iconSize = size || 24; +function Redirect(_ref) { + var computedMatch = _ref.computedMatch, + to = _ref.to, + _ref$push = _ref.push, + push = _ref$push === void 0 ? false : _ref$push; + return external_React_default.a.createElement(react_router_context.Consumer, null, function (context) { + !context ? false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) : void 0; + var history = context.history, + staticContext = context.staticContext; + var method = push ? history.push : history.replace; + var location = Object(esm_history["b" /* createLocation */])(computedMatch ? typeof to === "string" ? generatePath(to, computedMatch.params) : Object(esm_extends["a" /* default */])({}, to, { + pathname: generatePath(to.pathname, computedMatch.params) + }) : to); // When rendering in a static context, + // set the new location immediately. - if ('function' === typeof icon) { - if (icon.prototype instanceof _wordpress_element__WEBPACK_IMPORTED_MODULE_3__["Component"]) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])(icon, _objectSpread({ - size: iconSize - }, additionalProps)); + if (staticContext) { + method(location); + return null; } - return icon(_objectSpread({ - size: iconSize - }, additionalProps)); - } - - if (icon && (icon.type === 'svg' || icon.type === _wordpress_primitives__WEBPACK_IMPORTED_MODULE_4__[/* SVG */ "c"])) { - var appliedProps = _objectSpread(_objectSpread({ - width: iconSize, - height: iconSize - }, icon.props), additionalProps); - - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["createElement"])(_wordpress_primitives__WEBPACK_IMPORTED_MODULE_4__[/* SVG */ "c"], appliedProps); - } - - if (Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["isValidElement"])(icon)) { - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_3__["cloneElement"])(icon, _objectSpread({ - size: iconSize - }, additionalProps)); - } + return external_React_default.a.createElement(react_router_Lifecycle, { + onMount: function onMount() { + method(location); + }, + onUpdate: function onUpdate(self, prevProps) { + var prevLocation = Object(esm_history["b" /* createLocation */])(prevProps.to); - return icon; + if (!Object(esm_history["e" /* locationsAreEqual */])(prevLocation, Object(esm_extends["a" /* default */])({}, location, { + key: prevLocation.key + }))) { + method(location); + } + }, + to: to + }); + }); } -/* harmony default export */ __webpack_exports__["a"] = (Icon); -//# sourceMappingURL=index.js.map - -/***/ }), -/* 115 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { +if (false) {} -"use strict"; -/* harmony import */ var _babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(6); -/* harmony import */ var _babel_runtime_helpers_esm_slicedToArray__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(24); -/* harmony import */ var classnames__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(4); -/* harmony import */ var classnames__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(classnames__WEBPACK_IMPORTED_MODULE_2__); +var cache$1 = {}; +var cacheLimit$1 = 10000; +var cacheCount$1 = 0; +function compilePath$1(path, options) { + var cacheKey = "" + options.end + options.strict + options.sensitive; + var pathCache = cache$1[cacheKey] || (cache$1[cacheKey] = {}); + if (pathCache[path]) return pathCache[path]; + var keys = []; + var regexp = path_to_regexp_default()(path, keys, options); + var result = { + regexp: regexp, + keys: keys + }; + if (cacheCount$1 < cacheLimit$1) { + pathCache[path] = result; + cacheCount$1++; + } + return result; +} /** - * External dependencies + * Public API for matching a URL pathname to a path. */ -function Animate(_ref) { - var type = _ref.type, - _ref$options = _ref.options, - options = _ref$options === void 0 ? {} : _ref$options, - children = _ref.children; - - if (type === 'appear') { - var _classnames; - - var _options$origin = options.origin, - origin = _options$origin === void 0 ? 'top' : _options$origin; - - var _origin$split = origin.split(' '), - _origin$split2 = Object(_babel_runtime_helpers_esm_slicedToArray__WEBPACK_IMPORTED_MODULE_1__[/* default */ "a"])(_origin$split, 2), - yAxis = _origin$split2[0], - _origin$split2$ = _origin$split2[1], - xAxis = _origin$split2$ === void 0 ? 'center' : _origin$split2$; - - return children({ - className: classnames__WEBPACK_IMPORTED_MODULE_2___default()('components-animate__appear', (_classnames = {}, Object(_babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(_classnames, 'is-from-' + xAxis, xAxis !== 'center'), Object(_babel_runtime_helpers_esm_defineProperty__WEBPACK_IMPORTED_MODULE_0__[/* default */ "a"])(_classnames, 'is-from-' + yAxis, yAxis !== 'middle'), _classnames)) - }); - } - - if (type === 'slide-in') { - var _options$origin2 = options.origin, - _origin = _options$origin2 === void 0 ? 'left' : _options$origin2; - - return children({ - className: classnames__WEBPACK_IMPORTED_MODULE_2___default()('components-animate__slide-in', 'is-from-' + _origin) - }); +function matchPath(pathname, options) { + if (options === void 0) { + options = {}; } - if (type === 'loading') { - return children({ - className: classnames__WEBPACK_IMPORTED_MODULE_2___default()('components-animate__loading') - }); + if (typeof options === "string" || Array.isArray(options)) { + options = { + path: options + }; } - return children({}); -} - -/* harmony default export */ __webpack_exports__["a"] = (Animate); -//# sourceMappingURL=index.js.map + var _options = options, + path = _options.path, + _options$exact = _options.exact, + exact = _options$exact === void 0 ? false : _options$exact, + _options$strict = _options.strict, + strict = _options$strict === void 0 ? false : _options$strict, + _options$sensitive = _options.sensitive, + sensitive = _options$sensitive === void 0 ? false : _options$sensitive; + var paths = [].concat(path); + return paths.reduce(function (matched, path) { + if (!path && path !== "") return null; + if (matched) return matched; -/***/ }), -/* 116 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { + var _compilePath = compilePath$1(path, { + end: exact, + strict: strict, + sensitive: sensitive + }), + regexp = _compilePath.regexp, + keys = _compilePath.keys; -"use strict"; -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(0); -/* harmony import */ var _wordpress_element__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_wordpress_element__WEBPACK_IMPORTED_MODULE_0__); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(2); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(lodash__WEBPACK_IMPORTED_MODULE_1__); + var match = regexp.exec(pathname); + if (!match) return null; + var url = match[0], + values = match.slice(1); + var isExact = pathname === url; + if (exact && !isExact) return null; + return { + path: path, + // the path used to match + url: path === "/" && url === "" ? "/" : url, + // the matched portion of the URL + isExact: isExact, + // whether or not we matched exactly + params: keys.reduce(function (memo, key, index) { + memo[key.name] = values[index]; + return memo; + }, {}) + }; + }, null); +} +function isEmptyChildren(children) { + return external_React_default.a.Children.count(children) === 0; +} +function evalChildrenDev(children, props, path) { + var value = children(props); + false ? undefined : void 0; + return value || null; +} /** - * External dependencies + * The public API for matching a single path and rendering. */ -function Shortcut(_ref) { - var shortcut = _ref.shortcut, - className = _ref.className; +var react_router_Route = +/*#__PURE__*/ +function (_React$Component) { + Object(inheritsLoose["a" /* default */])(Route, _React$Component); - if (!shortcut) { - return null; + function Route() { + return _React$Component.apply(this, arguments) || this; } - var displayText; - var ariaLabel; + var _proto = Route.prototype; - if (Object(lodash__WEBPACK_IMPORTED_MODULE_1__["isString"])(shortcut)) { - displayText = shortcut; - } + _proto.render = function render() { + var _this = this; - if (Object(lodash__WEBPACK_IMPORTED_MODULE_1__["isObject"])(shortcut)) { - displayText = shortcut.display; - ariaLabel = shortcut.ariaLabel; - } + return external_React_default.a.createElement(react_router_context.Consumer, null, function (context$1) { + !context$1 ? false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) : void 0; + var location = _this.props.location || context$1.location; + var match = _this.props.computedMatch ? _this.props.computedMatch // already computed the match for us + : _this.props.path ? matchPath(location.pathname, _this.props) : context$1.match; - return Object(_wordpress_element__WEBPACK_IMPORTED_MODULE_0__["createElement"])("span", { - className: className, - "aria-label": ariaLabel - }, displayText); -} + var props = Object(esm_extends["a" /* default */])({}, context$1, { + location: location, + match: match + }); -/* harmony default export */ __webpack_exports__["a"] = (Shortcut); -//# sourceMappingURL=index.js.map + var _this$props = _this.props, + children = _this$props.children, + component = _this$props.component, + render = _this$props.render; // Preact uses an empty array as children by + // default, so use null if that's the case. -/***/ }), -/* 117 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { + if (Array.isArray(children) && children.length === 0) { + children = null; + } -"use strict"; + return external_React_default.a.createElement(react_router_context.Provider, { + value: props + }, props.match ? children ? typeof children === "function" ? false ? undefined : children(props) : children : component ? external_React_default.a.createElement(component, props) : render ? render(props) : null : typeof children === "function" ? false ? undefined : children(props) : null); + }); + }; -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/extends.js -var esm_extends = __webpack_require__(7); + return Route; +}(external_React_default.a.Component); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/slicedToArray.js + 3 modules -var slicedToArray = __webpack_require__(24); +if (false) {} -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/objectWithoutProperties.js -var objectWithoutProperties = __webpack_require__(11); +function addLeadingSlash(path) { + return path.charAt(0) === "/" ? path : "/" + path; +} -// EXTERNAL MODULE: external {"this":["wp","element"]} -var external_this_wp_element_ = __webpack_require__(0); +function addBasename(basename, location) { + if (!basename) return location; + return Object(esm_extends["a" /* default */])({}, location, { + pathname: addLeadingSlash(basename) + location.pathname + }); +} -// EXTERNAL MODULE: ./node_modules/classnames/index.js -var classnames = __webpack_require__(4); -var classnames_default = /*#__PURE__*/__webpack_require__.n(classnames); +function stripBasename(basename, location) { + if (!basename) return location; + var base = addLeadingSlash(basename); + if (location.pathname.indexOf(base) !== 0) return location; + return Object(esm_extends["a" /* default */])({}, location, { + pathname: location.pathname.substr(base.length) + }); +} + +function createURL(location) { + return typeof location === "string" ? location : Object(esm_history["d" /* createPath */])(location); +} + +function staticHandler(methodName) { + return function () { + false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) ; + }; +} + +function noop() {} +/** + * The public top-level API for a "static" , so-called because it + * can't actually change the current location. Instead, it just records + * location changes in a context object. Useful mainly in testing and + * server-rendering scenarios. + */ -// EXTERNAL MODULE: ./node_modules/@wordpress/components/node_modules/@wordpress/dom/build-module/dom.js -var dom = __webpack_require__(129); -// EXTERNAL MODULE: ./node_modules/@wordpress/components/node_modules/@wordpress/dom/build-module/index.js + 2 modules -var build_module = __webpack_require__(69); +var react_router_StaticRouter = +/*#__PURE__*/ +function (_React$Component) { + Object(inheritsLoose["a" /* default */])(StaticRouter, _React$Component); -// EXTERNAL MODULE: ./node_modules/@wordpress/components/node_modules/@wordpress/keycodes/build-module/index.js + 1 modules -var keycodes_build_module = __webpack_require__(57); + function StaticRouter() { + var _this; -// EXTERNAL MODULE: ./node_modules/@wordpress/deprecated/build-module/index.js -var deprecated_build_module = __webpack_require__(47); + for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) { + args[_key] = arguments[_key]; + } -// EXTERNAL MODULE: ./node_modules/@wordpress/compose/build-module/hooks/use-viewport-match/index.js -var use_viewport_match = __webpack_require__(180); + _this = _React$Component.call.apply(_React$Component, [this].concat(args)) || this; -// EXTERNAL MODULE: ./node_modules/@wordpress/compose/build-module/hooks/use-resize-observer/index.js -var use_resize_observer = __webpack_require__(207); + _this.handlePush = function (location) { + return _this.navigateTo(location, "PUSH"); + }; -// EXTERNAL MODULE: ./node_modules/@wordpress/components/node_modules/@wordpress/icons/build-module/library/close.js -var library_close = __webpack_require__(257); + _this.handleReplace = function (location) { + return _this.navigateTo(location, "REPLACE"); + }; -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/defineProperty.js -var defineProperty = __webpack_require__(6); + _this.handleListen = function () { + return noop; + }; -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/popover/utils.js + _this.handleBlock = function () { + return noop; + }; + return _this; + } + var _proto = StaticRouter.prototype; -function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; } + _proto.navigateTo = function navigateTo(location, action) { + var _this$props = this.props, + _this$props$basename = _this$props.basename, + basename = _this$props$basename === void 0 ? "" : _this$props$basename, + _this$props$context = _this$props.context, + context = _this$props$context === void 0 ? {} : _this$props$context; + context.action = action; + context.location = addBasename(basename, Object(esm_history["b" /* createLocation */])(location)); + context.url = createURL(context.location); + }; -function _objectSpread(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { Object(defineProperty["a" /* default */])(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } + _proto.render = function render() { + var _this$props2 = this.props, + _this$props2$basename = _this$props2.basename, + basename = _this$props2$basename === void 0 ? "" : _this$props2$basename, + _this$props2$context = _this$props2.context, + context = _this$props2$context === void 0 ? {} : _this$props2$context, + _this$props2$location = _this$props2.location, + location = _this$props2$location === void 0 ? "/" : _this$props2$location, + rest = Object(objectWithoutPropertiesLoose["a" /* default */])(_this$props2, ["basename", "context", "location"]); -/** - * WordPress dependencies - */ + var history = { + createHref: function createHref(path) { + return addLeadingSlash(basename + createURL(path)); + }, + action: "POP", + location: stripBasename(basename, Object(esm_history["b" /* createLocation */])(location)), + push: this.handlePush, + replace: this.handleReplace, + go: staticHandler("go"), + goBack: staticHandler("goBack"), + goForward: staticHandler("goForward"), + listen: this.handleListen, + block: this.handleBlock + }; + return external_React_default.a.createElement(react_router_Router, Object(esm_extends["a" /* default */])({}, rest, { + history: history, + staticContext: context + })); + }; -/** - * Module constants - */ + return StaticRouter; +}(external_React_default.a.Component); -var HEIGHT_OFFSET = 10; // used by the arrow and a bit of empty space +if (false) {} /** - * Utility used to compute the popover position over the xAxis - * - * @param {Object} anchorRect Anchor Rect. - * @param {Object} contentSize Content Size. - * @param {string} xAxis Desired xAxis. - * @param {string} corner Desired corner. - * @param {boolean} sticky Whether or not to stick the popover to the - * scroll container edge when part of the anchor - * leaves view. - * @param {string} chosenYAxis yAxis to be used. - * @param {Element} boundaryElement Boundary element. - * - * @return {Object} Popover xAxis position and constraints. + * The public API for rendering the first that matches. */ -function computePopoverXAxisPosition(anchorRect, contentSize, xAxis, corner, sticky, chosenYAxis, boundaryElement) { - var width = contentSize.width; - var isRTL = document.documentElement.dir === 'rtl'; // Correct xAxis for RTL support +var react_router_Switch = +/*#__PURE__*/ +function (_React$Component) { + Object(inheritsLoose["a" /* default */])(Switch, _React$Component); - if (xAxis === 'left' && isRTL) { - xAxis = 'right'; - } else if (xAxis === 'right' && isRTL) { - xAxis = 'left'; + function Switch() { + return _React$Component.apply(this, arguments) || this; } - if (corner === 'left' && isRTL) { - corner = 'right'; - } else if (corner === 'right' && isRTL) { - corner = 'left'; - } // x axis alignment choices + var _proto = Switch.prototype; + + _proto.render = function render() { + var _this = this; + return external_React_default.a.createElement(react_router_context.Consumer, null, function (context) { + !context ? false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) : void 0; + var location = _this.props.location || context.location; + var element, match; // We use React.Children.forEach instead of React.Children.toArray().find() + // here because toArray adds keys to all child elements and we do not want + // to trigger an unmount/remount for two s that render the same + // component at different URLs. - var anchorMidPoint = Math.round(anchorRect.left + anchorRect.width / 2); - var centerAlignment = { - popoverLeft: anchorMidPoint, - contentWidth: (anchorMidPoint - width / 2 > 0 ? width / 2 : anchorMidPoint) + (anchorMidPoint + width / 2 > window.innerWidth ? window.innerWidth - anchorMidPoint : width / 2) + external_React_default.a.Children.forEach(_this.props.children, function (child) { + if (match == null && external_React_default.a.isValidElement(child)) { + element = child; + var path = child.props.path || child.props.from; + match = path ? matchPath(location.pathname, Object(esm_extends["a" /* default */])({}, child.props, { + path: path + })) : context.match; + } + }); + return match ? external_React_default.a.cloneElement(element, { + location: location, + computedMatch: match + }) : null; + }); }; - var leftAlignmentX = anchorRect.left; - if (corner === 'right') { - leftAlignmentX = anchorRect.right; - } else if (chosenYAxis !== 'middle') { - leftAlignmentX = anchorMidPoint; - } + return Switch; +}(external_React_default.a.Component); + +if (false) {} + +/** + * A public higher-order component to access the imperative API + */ - var rightAlignmentX = anchorRect.right; +function withRouter(Component) { + var displayName = "withRouter(" + (Component.displayName || Component.name) + ")"; - if (corner === 'left') { - rightAlignmentX = anchorRect.left; - } else if (chosenYAxis !== 'middle') { - rightAlignmentX = anchorMidPoint; - } + var C = function C(props) { + var wrappedComponentRef = props.wrappedComponentRef, + remainingProps = Object(objectWithoutPropertiesLoose["a" /* default */])(props, ["wrappedComponentRef"]); - var leftAlignment = { - popoverLeft: leftAlignmentX, - contentWidth: leftAlignmentX - width > 0 ? width : leftAlignmentX + return external_React_default.a.createElement(react_router_context.Consumer, null, function (context) { + !context ? false ? undefined : Object(tiny_invariant_esm["a" /* default */])(false) : void 0; + return external_React_default.a.createElement(Component, Object(esm_extends["a" /* default */])({}, remainingProps, context, { + ref: wrappedComponentRef + })); + }); }; - var rightAlignment = { - popoverLeft: rightAlignmentX, - contentWidth: rightAlignmentX + width > window.innerWidth ? window.innerWidth - rightAlignmentX : width - }; // Choosing the x axis - - var chosenXAxis = xAxis; - var contentWidth = null; - - if (!sticky) { - if (xAxis === 'center' && centerAlignment.contentWidth === width) { - chosenXAxis = 'center'; - } else if (xAxis === 'left' && leftAlignment.contentWidth === width) { - chosenXAxis = 'left'; - } else if (xAxis === 'right' && rightAlignment.contentWidth === width) { - chosenXAxis = 'right'; - } else { - chosenXAxis = leftAlignment.contentWidth > rightAlignment.contentWidth ? 'left' : 'right'; - var chosenWidth = chosenXAxis === 'left' ? leftAlignment.contentWidth : rightAlignment.contentWidth; - contentWidth = chosenWidth !== width ? chosenWidth : null; - } - } - var popoverLeft; + C.displayName = displayName; + C.WrappedComponent = Component; - if (chosenXAxis === 'center') { - popoverLeft = centerAlignment.popoverLeft; - } else if (chosenXAxis === 'left') { - popoverLeft = leftAlignment.popoverLeft; - } else { - popoverLeft = rightAlignment.popoverLeft; - } + if (false) {} - if (boundaryElement) { - var boundaryRect = boundaryElement.getBoundingClientRect(); - popoverLeft = Math.min(popoverLeft, boundaryRect.right - width); - } + return hoist_non_react_statics_cjs_default()(C, Component); +} - return { - xAxis: chosenXAxis, - popoverLeft: popoverLeft, - contentWidth: contentWidth - }; +var useContext = external_React_default.a.useContext; +function useHistory() { + if (false) {} + + return useContext(historyContext); } -/** - * Utility used to compute the popover position over the yAxis - * - * @param {Object} anchorRect Anchor Rect. - * @param {Object} contentSize Content Size. - * @param {string} yAxis Desired yAxis. - * @param {string} corner Desired corner. - * @param {boolean} sticky Whether or not to stick the popover to the - * scroll container edge when part of the - * anchor leaves view. - * @param {Element} anchorRef The anchor element. - * @param {Element} relativeOffsetTop If applicable, top offset of the relative - * positioned parent container. - * - * @return {Object} Popover xAxis position and constraints. - */ +function useLocation() { + if (false) {} -function computePopoverYAxisPosition(anchorRect, contentSize, yAxis, corner, sticky, anchorRef, relativeOffsetTop) { - var height = contentSize.height; + return useContext(react_router_context).location; +} +function useParams() { + if (false) {} - if (sticky) { - var scrollContainerEl = Object(dom["b" /* getScrollContainer */])(anchorRef) || document.body; - var scrollRect = scrollContainerEl.getBoundingClientRect(); - var stickyPosition = scrollRect.top + height - relativeOffsetTop; + var match = useContext(react_router_context).match; + return match ? match.params : {}; +} +function useRouteMatch(path) { + if (false) {} - if (anchorRect.top <= stickyPosition) { - return { - yAxis: yAxis, - popoverTop: Math.min(anchorRect.bottom, stickyPosition) - }; - } - } // y axis alignment choices + var location = useLocation(); + var match = useContext(react_router_context).match; + return path ? matchPath(location.pathname, path) : match; +} +if (false) { var secondaryBuildName, initialBuildName, buildNames, react_router_key, global; } - var anchorMidPoint = anchorRect.top + anchorRect.height / 2; - if (corner === 'bottom') { - anchorMidPoint = anchorRect.bottom; - } else if (corner === 'top') { - anchorMidPoint = anchorRect.top; - } +//# sourceMappingURL=react-router.js.map - var middleAlignment = { - popoverTop: anchorMidPoint, - contentHeight: (anchorMidPoint - height / 2 > 0 ? height / 2 : anchorMidPoint) + (anchorMidPoint + height / 2 > window.innerHeight ? window.innerHeight - anchorMidPoint : height / 2) - }; - var topAlignment = { - popoverTop: anchorRect.top, - contentHeight: anchorRect.top - HEIGHT_OFFSET - height > 0 ? height : anchorRect.top - HEIGHT_OFFSET - }; - var bottomAlignment = { - popoverTop: anchorRect.bottom, - contentHeight: anchorRect.bottom + HEIGHT_OFFSET + height > window.innerHeight ? window.innerHeight - HEIGHT_OFFSET - anchorRect.bottom : height - }; // Choosing the y axis - - var chosenYAxis = yAxis; - var contentHeight = null; - - if (!sticky) { - if (yAxis === 'middle' && middleAlignment.contentHeight === height) { - chosenYAxis = 'middle'; - } else if (yAxis === 'top' && topAlignment.contentHeight === height) { - chosenYAxis = 'top'; - } else if (yAxis === 'bottom' && bottomAlignment.contentHeight === height) { - chosenYAxis = 'bottom'; - } else { - chosenYAxis = topAlignment.contentHeight > bottomAlignment.contentHeight ? 'top' : 'bottom'; - var chosenHeight = chosenYAxis === 'top' ? topAlignment.contentHeight : bottomAlignment.contentHeight; - contentHeight = chosenHeight !== height ? chosenHeight : null; - } - } +// EXTERNAL MODULE: external "lodash" +var external_lodash_ = __webpack_require__(5); - var popoverTop; +// EXTERNAL MODULE: ./node_modules/qs/lib/index.js +var lib = __webpack_require__(163); - if (chosenYAxis === 'middle') { - popoverTop = middleAlignment.popoverTop; - } else if (chosenYAxis === 'top') { - popoverTop = topAlignment.popoverTop; - } else { - popoverTop = bottomAlignment.popoverTop; - } +// EXTERNAL MODULE: external ["wc","components"] +var external_wc_components_ = __webpack_require__(145); - return { - yAxis: chosenYAxis, - popoverTop: popoverTop, - contentHeight: contentHeight - }; -} -/** - * Utility used to compute the popover position and the content max width/height - * for a popover given its anchor rect and its content size. - * - * @param {Object} anchorRect Anchor Rect. - * @param {Object} contentSize Content Size. - * @param {string} position Position. - * @param {boolean} sticky Whether or not to stick the popover to the - * scroll container edge when part of the - * anchor leaves view. - * @param {Element} anchorRef The anchor element. - * @param {number} relativeOffsetTop If applicable, top offset of the relative - * positioned parent container. - * @param {Element} boundaryElement Boundary element. - * - * @return {Object} Popover position and constraints. - */ +// EXTERNAL MODULE: external ["wc","navigation"] +var external_wc_navigation_ = __webpack_require__(50); -function computePopoverPosition(anchorRect, contentSize) { - var position = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 'top'; - var sticky = arguments.length > 3 ? arguments[3] : undefined; - var anchorRef = arguments.length > 4 ? arguments[4] : undefined; - var relativeOffsetTop = arguments.length > 5 ? arguments[5] : undefined; - var boundaryElement = arguments.length > 6 ? arguments[6] : undefined; - - var _position$split = position.split(' '), - _position$split2 = Object(slicedToArray["a" /* default */])(_position$split, 3), - yAxis = _position$split2[0], - _position$split2$ = _position$split2[1], - xAxis = _position$split2$ === void 0 ? 'center' : _position$split2$, - corner = _position$split2[2]; - - var yAxisPosition = computePopoverYAxisPosition(anchorRect, contentSize, yAxis, corner, sticky, anchorRef, relativeOffsetTop); - var xAxisPosition = computePopoverXAxisPosition(anchorRect, contentSize, xAxis, corner, sticky, yAxisPosition.yAxis, boundaryElement); - return _objectSpread(_objectSpread({}, xAxisPosition), yAxisPosition); -} -//# sourceMappingURL=utils.js.map -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/higher-order/with-focus-return/index.js + 1 modules -var with_focus_return = __webpack_require__(113); +// EXTERNAL MODULE: ./client/wc-admin-settings/index.js +var wc_admin_settings = __webpack_require__(85); -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/higher-order/with-constrained-tabbing/index.js -var with_constrained_tabbing = __webpack_require__(109); +// EXTERNAL MODULE: external ["wc","data"] +var external_wc_data_ = __webpack_require__(59); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/classCallCheck.js -var classCallCheck = __webpack_require__(16); +// EXTERNAL MODULE: external ["wc","tracks"] +var external_wc_tracks_ = __webpack_require__(92); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/createClass.js -var createClass = __webpack_require__(17); +// EXTERNAL MODULE: external ["wc","notices"] +var external_wc_notices_ = __webpack_require__(420); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/inherits.js + 1 modules -var inherits = __webpack_require__(18); +// EXTERNAL MODULE: ./client/layout/style.scss +var layout_style = __webpack_require__(421); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/possibleConstructorReturn.js -var possibleConstructorReturn = __webpack_require__(21); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.array.concat.js +var es_array_concat = __webpack_require__(66); -// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/esm/getPrototypeOf.js -var getPrototypeOf = __webpack_require__(9); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.string.match.js +var es_string_match = __webpack_require__(203); -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/higher-order/with-focus-outside/index.js -var with_focus_outside = __webpack_require__(110); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.string.split.js +var es_string_split = __webpack_require__(186); -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/popover/detect-outside.js +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.object.assign.js +var es_object_assign = __webpack_require__(250); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.array.from.js +var es_array_from = __webpack_require__(283); +// EXTERNAL MODULE: external ["wp","hooks"] +var external_wp_hooks_ = __webpack_require__(141); +// EXTERNAL MODULE: external ["wp","i18n"] +var external_wp_i18n_ = __webpack_require__(2); +// EXTERNAL MODULE: ./client/analytics/report/get-reports.js +var get_reports = __webpack_require__(277); +// EXTERNAL MODULE: ./client/dashboard/utils.js +var utils = __webpack_require__(231); -function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(getPrototypeOf["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(possibleConstructorReturn["a" /* default */])(this, result); }; } +// CONCATENATED MODULE: ./client/layout/controller.js -function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } } -/** - * WordPress dependencies - */ -/** - * Internal dependencies - */ -var detect_outside_PopoverDetectOutside = /*#__PURE__*/function (_Component) { - Object(inherits["a" /* default */])(PopoverDetectOutside, _Component); - var _super = _createSuper(PopoverDetectOutside); - function PopoverDetectOutside() { - Object(classCallCheck["a" /* default */])(this, PopoverDetectOutside); +function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = getPrototypeOf_default()(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = getPrototypeOf_default()(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return possibleConstructorReturn_default()(this, result); }; } - return _super.apply(this, arguments); - } +function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(Reflect.construct(Boolean, [], function () {})); return true; } catch (e) { return false; } } - Object(createClass["a" /* default */])(PopoverDetectOutside, [{ - key: "handleFocusOutside", - value: function handleFocusOutside(event) { - this.props.onFocusOutside(event); - } - }, { - key: "render", - value: function render() { - return this.props.children; - } - }]); - return PopoverDetectOutside; -}(external_this_wp_element_["Component"]); -/* harmony default export */ var detect_outside = (Object(with_focus_outside["a" /* default */])(detect_outside_PopoverDetectOutside)); -//# sourceMappingURL=detect-outside.js.map -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/button/index.js -var build_module_button = __webpack_require__(68); -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/scroll-lock/index.js -function scroll_lock_createSuper(Derived) { var hasNativeReflectConstruct = scroll_lock_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = Object(getPrototypeOf["a" /* default */])(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = Object(getPrototypeOf["a" /* default */])(this).constructor; result = Reflect.construct(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return Object(possibleConstructorReturn["a" /* default */])(this, result); }; } -function scroll_lock_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !Reflect.construct) return false; if (Reflect.construct.sham) return false; if (typeof Proxy === "function") return true; try { Date.prototype.toString.call(Reflect.construct(Date, [], function () {})); return true; } catch (e) { return false; } } -/** - * WordPress dependencies - */ -/** - * Creates a ScrollLock component bound to the specified document. - * - * This function creates a ScrollLock component for the specified document - * and is exposed so we can create an isolated component for unit testing. - * - * @param {Object} args Keyword args. - * @param {HTMLDocument} args.htmlDocument The document to lock the scroll for. - * @param {string} args.className The name of the class used to lock scrolling. - * @return {WPComponent} The bound ScrollLock component. - */ -function createScrollLockComponent() { - var _ref = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {}, - _ref$htmlDocument = _ref.htmlDocument, - htmlDocument = _ref$htmlDocument === void 0 ? document : _ref$htmlDocument, - _ref$className = _ref.className, - className = _ref$className === void 0 ? 'lockscroll' : _ref$className; - - var lockCounter = 0; - /* - * Setting `overflow: hidden` on html and body elements resets body scroll in iOS. - * Save scroll top so we can restore it after locking scroll. - * - * NOTE: It would be cleaner and possibly safer to find a localized solution such - * as preventing default on certain touchmove events. - */ - var previousScrollTop = 0; - /** - * Locks and unlocks scroll depending on the boolean argument. - * - * @param {boolean} locked Whether or not scroll should be locked. - */ - function setLocked(locked) { - var scrollingElement = htmlDocument.scrollingElement || htmlDocument.body; - if (locked) { - previousScrollTop = scrollingElement.scrollTop; - } - var methodName = locked ? 'add' : 'remove'; - scrollingElement.classList[methodName](className); // Adding the class to the document element seems to be necessary in iOS. +/** + * External dependencies + */ - htmlDocument.documentElement.classList[methodName](className); - if (!locked) { - scrollingElement.scrollTop = previousScrollTop; - } - } - /** - * Requests scroll lock. - * - * This function tracks requests for scroll lock. It locks scroll on the first - * request and counts each request so `releaseLock` can unlock scroll when - * all requests have been released. - */ - function requestLock() { - if (lockCounter === 0) { - setLocked(true); - } - ++lockCounter; - } - /** - * Releases a request for scroll lock. - * - * This function tracks released requests for scroll lock. When all requests - * have been released, it unlocks scroll. - */ - function releaseLock() { - if (lockCounter === 1) { - setLocked(false); - } - --lockCounter; - } +/** + * Internal dependencies + */ - return /*#__PURE__*/function (_Component) { - Object(inherits["a" /* default */])(ScrollLock, _Component); - var _super = scroll_lock_createSuper(ScrollLock); - function ScrollLock() { - Object(classCallCheck["a" /* default */])(this, ScrollLock); +var AnalyticsReport = Object(external_wp_element_["lazy"])(function () { + return __webpack_require__.e(/* import() | analytics-report */ 9).then(__webpack_require__.bind(null, 691)); +}); +var AnalyticsSettings = Object(external_wp_element_["lazy"])(function () { + return __webpack_require__.e(/* import() | analytics-settings */ 20).then(__webpack_require__.bind(null, 711)); +}); +var Dashboard = Object(external_wp_element_["lazy"])(function () { + return __webpack_require__.e(/* import() | dashboard */ 28).then(__webpack_require__.bind(null, 692)); +}); +var Homescreen = Object(external_wp_element_["lazy"])(function () { + return Promise.all(/* import() | homescreen */[__webpack_require__.e(1), __webpack_require__.e(3), __webpack_require__.e(52), __webpack_require__.e(4), __webpack_require__.e(32)]).then(__webpack_require__.bind(null, 708)); +}); +var MarketingOverview = Object(external_wp_element_["lazy"])(function () { + return Promise.all(/* import() | marketing-overview */[__webpack_require__.e(3), __webpack_require__.e(36)]).then(__webpack_require__.bind(null, 712)); +}); +var ProfileWizard = Object(external_wp_element_["lazy"])(function () { + return Promise.all(/* import() | profile-wizard */[__webpack_require__.e(53), __webpack_require__.e(46)]).then(__webpack_require__.bind(null, 709)); +}); +var SettingsGroup = Object(external_wp_element_["lazy"])(function () { + return Promise.all(/* import() | profile-wizard */[__webpack_require__.e(53), __webpack_require__.e(46)]).then(__webpack_require__.bind(null, 704)); +}); +var PAGES_FILTER = 'woocommerce_admin_pages_list'; +var controller_getPages = function getPages() { + var pages = []; + var initialBreadcrumbs = [['', wcSettings.woocommerceTranslation]]; + pages.push({ + container: Homescreen, + path: '/', + breadcrumbs: [].concat(initialBreadcrumbs, [Object(external_wp_i18n_["__"])('Home', 'woocommerce-admin')]), + wpOpenMenu: 'toplevel_page_woocommerce', + navArgs: { + id: 'woocommerce-home' + }, + capability: 'manage_woocommerce' + }); - return _super.apply(this, arguments); - } + if (window.wcAdminFeatures.analytics) { + pages.push({ + container: Dashboard, + path: '/analytics/overview', + breadcrumbs: [].concat(initialBreadcrumbs, [['/analytics/overview', Object(external_wp_i18n_["__"])('Analytics', 'woocommerce-admin')], Object(external_wp_i18n_["__"])('Overview', 'woocommerce-admin')]), + wpOpenMenu: 'toplevel_page_wc-admin-path--analytics-overview', + navArgs: { + id: 'woocommerce-analytics-overview' + }, + capability: 'view_woocommerce_reports' + }); + pages.push({ + container: AnalyticsSettings, + path: '/analytics/settings', + breadcrumbs: [].concat(initialBreadcrumbs, [['/analytics/revenue', Object(external_wp_i18n_["__"])('Analytics', 'woocommerce-admin')], Object(external_wp_i18n_["__"])('Settings', 'woocommerce-admin')]), + wpOpenMenu: 'toplevel_page_wc-admin-path--analytics-overview', + navArgs: { + id: 'woocommerce-analytics-settings' + }, + capability: 'view_woocommerce_reports' + }); + pages.push({ + container: AnalyticsReport, + path: '/customers', + breadcrumbs: [].concat(initialBreadcrumbs, [Object(external_wp_i18n_["__"])('Customers', 'woocommerce-admin')]), + wpOpenMenu: 'toplevel_page_woocommerce', + navArgs: { + id: 'woocommerce-analytics-customers' + }, + capability: 'view_woocommerce_reports' + }); + pages.push({ + container: AnalyticsReport, + path: '/analytics/:report', + breadcrumbs: function breadcrumbs(_ref) { + var match = _ref.match; + var report = Object(external_lodash_["find"])(Object(get_reports["a" /* default */])(), { + report: match.params.report + }); - Object(createClass["a" /* default */])(ScrollLock, [{ - key: "componentDidMount", + if (!report) { + return []; + } - /** - * Requests scroll lock on mount. - */ - value: function componentDidMount() { - requestLock(); - } - /** - * Releases scroll lock before unmount. - */ + return [].concat(initialBreadcrumbs, [['/analytics/revenue', Object(external_wp_i18n_["__"])('Analytics', 'woocommerce-admin')], report.title]); + }, + wpOpenMenu: 'toplevel_page_wc-admin-path--analytics-overview', + capability: 'view_woocommerce_reports' + }); + } - }, { - key: "componentWillUnmount", - value: function componentWillUnmount() { - releaseLock(); - } - /** - * Render nothing as this component is merely a way to declare scroll lock. - * - * @return {null} Render nothing by returning `null`. - */ + if (window.wcAdminFeatures.marketing) { + pages.push({ + container: MarketingOverview, + path: '/marketing', + breadcrumbs: [].concat(initialBreadcrumbs, [['/marketing', Object(external_wp_i18n_["__"])('Marketing', 'woocommerce-admin')], Object(external_wp_i18n_["__"])('Overview', 'woocommerce-admin')]), + wpOpenMenu: 'toplevel_page_woocommerce-marketing', + navArgs: { + id: 'woocommerce-marketing-overview' + }, + capability: 'view_woocommerce_reports' + }); + } - }, { - key: "render", - value: function render() { - return null; - } - }]); + if (window.wcAdminFeatures.onboarding) { + pages.push({ + container: ProfileWizard, + path: '/setup-wizard', + breadcrumbs: [].concat(initialBreadcrumbs, [['/setup-wizard', Object(external_wp_i18n_["__"])('Setup Wizard', 'woocommerce-admin')]]), + capability: 'manage_woocommerce' + }); + } - return ScrollLock; - }(external_this_wp_element_["Component"]); -} -/* harmony default export */ var scroll_lock = (createScrollLockComponent()); -//# sourceMappingURL=index.js.map -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/isolated-event-container/index.js -var isolated_event_container = __webpack_require__(111); + if (window.wcAdminFeatures.settings) { + pages.push({ + container: SettingsGroup, + path: '/settings/:page', + breadcrumbs: function breadcrumbs(_ref2) { + var match = _ref2.match; + // @todo This might need to be refactored to retreive groups via data store. + var settingsPages = Object(wc_admin_settings["g" /* getSetting */])('settingsPages'); + var page = settingsPages[match.params.page]; + + if (!page) { + return []; + } -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/bubbles-virtually/use-slot.js -var use_slot = __webpack_require__(71); + return [].concat(initialBreadcrumbs, [[settingsPages.general ? '/settings/general' : "/settings/".concat(Object.keys(settingsPages)[0]), Object(external_wp_i18n_["__"])('Settings', 'woocommerce-admin')], page]); + }, + wpOpenMenu: 'toplevel_page_woocommerce', + capability: 'manage_woocommerce' + }); + } -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/slot-fill/index.js + 4 modules -var slot_fill = __webpack_require__(98); + return Object(external_wp_hooks_["applyFilters"])(PAGES_FILTER, pages); +}; +var controller_Controller = /*#__PURE__*/function (_Component) { + inherits_default()(Controller, _Component); -// EXTERNAL MODULE: ./node_modules/@wordpress/components/build-module/animate/index.js -var build_module_animate = __webpack_require__(115); + var _super = _createSuper(Controller); -// CONCATENATED MODULE: ./node_modules/@wordpress/components/build-module/popover/index.js + function Controller() { + classCallCheck_default()(this, Controller); + return _super.apply(this, arguments); + } + createClass_default()(Controller, [{ + key: "componentDidMount", + value: function componentDidMount() { + window.document.documentElement.scrollTop = 0; + window.document.body.classList.remove('woocommerce-admin-is-loading'); + } + }, { + key: "componentDidUpdate", + value: function componentDidUpdate(prevProps) { + var prevBaseQuery = Object(external_lodash_["omit"])(prevProps.query, 'chartType', 'filter', 'paged'); + var baseQuery = Object(external_lodash_["omit"])(this.props.query, 'chartType', 'filter', 'paged'); + if (prevProps.query.paged > 1 && !Object(external_lodash_["isEqual"])(prevBaseQuery, baseQuery)) { + Object(external_wc_navigation_["getHistory"])().replace(Object(external_wc_navigation_["getNewPath"])({ + paged: 1 + })); + } + if (prevProps.match.url !== this.props.match.url) { + window.document.documentElement.scrollTop = 0; + } + } + }, { + key: "render", + value: function render() { + var _this$props = this.props, + page = _this$props.page, + match = _this$props.match, + query = _this$props.query; + var url = match.url, + params = match.params; + window.wpNavMenuUrlUpdate(query); + window.wpNavMenuClassChange(page, url); + return Object(external_wp_element_["createElement"])(external_wp_element_["Suspense"], { + fallback: Object(external_wp_element_["createElement"])(external_wc_components_["Spinner"], null) + }, Object(external_wp_element_["createElement"])(page.container, { + params: params, + path: url, + pathMatch: page.path, + query: query + })); + } + }]); + return Controller; +}(external_wp_element_["Component"]); /** - * External dependencies + * Update an anchor's link in sidebar to include persisted queries. Leave excluded screens + * as is. + * + * @param {HTMLElement} item - Sidebar anchor link. + * @param {Object} nextQuery - A query object to be added to updated hrefs. + * @param {Array} excludedScreens - wc-admin screens to avoid updating. */ -/** - * WordPress dependencies - */ +function updateLinkHref(item, nextQuery, excludedScreens) { + if (Object(utils["f" /* isWCAdmin */])(item.href)) { + var search = Object(external_lodash_["last"])(item.href.split('?')); + var query = Object(lib["parse"])(search); + var path = query.path || 'homescreen'; + var screen = Object(external_wc_navigation_["getScreenFromPath"])(path); + var isExcludedScreen = excludedScreens.includes(screen); + var href = 'admin.php?' + Object(lib["stringify"])(Object.assign(query, isExcludedScreen ? {} : nextQuery)); // Replace the href so you can see the url on hover. + item.href = href; + item.onclick = function (e) { + e.preventDefault(); + Object(external_wc_navigation_["getHistory"])().push(href); + }; + } +} // Update's wc-admin links in wp-admin menu +window.wpNavMenuUrlUpdate = function (query) { + var nextQuery = Object(external_wc_navigation_["getPersistedQuery"])(query); + var excludedScreens = Object(external_wc_navigation_["getQueryExcludedScreens"])(); + Array.from(document.querySelectorAll('#adminmenu a')).forEach(function (item) { + return updateLinkHref(item, nextQuery, excludedScreens); + }); +}; // When the route changes, we need to update wp-admin's menu with the correct section & current link +window.wpNavMenuClassChange = function (page, url) { + Array.from(document.getElementsByClassName('current')).forEach(function (item) { + item.classList.remove('current'); + }); + var submenu = Array.from(document.querySelectorAll('.wp-has-current-submenu')); + submenu.forEach(function (element) { + element.classList.remove('wp-has-current-submenu'); + element.classList.remove('wp-menu-open'); + element.classList.remove('selected'); + element.classList.add('wp-not-current-submenu'); + element.classList.add('menu-top'); + }); + var pageUrl = url === '/' ? 'admin.php?page=wc-admin' : 'admin.php?page=wc-admin&path=' + encodeURIComponent(url); + var currentItemsSelector = url === '/' ? "li > a[href$=\"".concat(pageUrl, "\"], li > a[href*=\"").concat(pageUrl, "?\"]") : "li > a[href*=\"".concat(pageUrl, "\"]"); + var currentItems = document.querySelectorAll(currentItemsSelector); + Array.from(currentItems).forEach(function (item) { + item.parentElement.classList.add('current'); + }); + if (page.wpOpenMenu) { + var currentMenu = document.querySelector('#' + page.wpOpenMenu); -/** - * Internal dependencies - */ + if (currentMenu) { + currentMenu.classList.remove('wp-not-current-submenu'); + currentMenu.classList.add('wp-has-current-submenu'); + currentMenu.classList.add('wp-menu-open'); + currentMenu.classList.add('current'); + } + } + var wpWrap = document.querySelector('#wpwrap'); + wpWrap.classList.remove('wp-responsive-open'); +}; +// EXTERNAL MODULE: ./node_modules/core-js/modules/web.url.js +var web_url = __webpack_require__(287); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.array.slice.js +var es_array_slice = __webpack_require__(187); +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.array.join.js +var es_array_join = __webpack_require__(139); +// EXTERNAL MODULE: external ["wp","components"] +var external_wp_components_ = __webpack_require__(4); +// EXTERNAL MODULE: ./node_modules/classnames/index.js +var classnames = __webpack_require__(15); +var classnames_default = /*#__PURE__*/__webpack_require__.n(classnames); +// EXTERNAL MODULE: external ["wp","htmlEntities"] +var external_wp_htmlEntities_ = __webpack_require__(133); +// EXTERNAL MODULE: ./packages/experimental/build-module/index.js +var build_module = __webpack_require__(105); +// EXTERNAL MODULE: ./node_modules/@wordpress/icons/build-module/icon/index.js +var build_module_icon = __webpack_require__(425); +// EXTERNAL MODULE: ./node_modules/@wordpress/icons/build-module/library/chevron-left.js +var chevron_left = __webpack_require__(596); -var FocusManaged = Object(with_constrained_tabbing["a" /* default */])(Object(with_focus_return["a" /* default */])(function (_ref) { - var children = _ref.children; - return children; -})); -/** - * Name of slot in which popover should fill. - * - * @type {string} - */ +// EXTERNAL MODULE: external ["wp","keycodes"] +var external_wp_keycodes_ = __webpack_require__(126); -var SLOT_NAME = 'Popover'; +// EXTERNAL MODULE: ./client/header/style.scss +var header_style = __webpack_require__(422); -function computeAnchorRect(anchorRefFallback, anchorRect, getAnchorRect) { - var anchorRef = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : false; - var shouldAnchorIncludePadding = arguments.length > 4 ? arguments[4] : undefined; +// EXTERNAL MODULE: ./node_modules/@babel/runtime/helpers/slicedToArray.js +var slicedToArray = __webpack_require__(43); +var slicedToArray_default = /*#__PURE__*/__webpack_require__.n(slicedToArray); - if (anchorRect) { - return anchorRect; - } +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.function.name.js +var es_function_name = __webpack_require__(130); - if (getAnchorRect) { - if (!anchorRefFallback.current) { - return; - } +// EXTERNAL MODULE: external ["wp","primitives"] +var external_wp_primitives_ = __webpack_require__(28); - return getAnchorRect(anchorRefFallback.current); - } +// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/inbox.js - if (anchorRef !== false) { - if (!anchorRef || !window.Range || !window.Element || !window.DOMRect) { - return; - } - if (anchorRef instanceof window.Range) { - return Object(dom["a" /* getRectangleFromRange */])(anchorRef); - } +/** + * WordPress dependencies + */ - if (anchorRef instanceof window.Element) { - var _rect2 = anchorRef.getBoundingClientRect(); +var inbox_inbox = Object(external_wp_element_["createElement"])(external_wp_primitives_["SVG"], { + xmlns: "http://www.w3.org/2000/svg", + viewBox: "0 0 24 24" +}, Object(external_wp_element_["createElement"])(external_wp_primitives_["Path"], { + fillRule: "evenodd", + d: "M6 5.5h12a.5.5 0 01.5.5v7H14a2 2 0 11-4 0H5.5V6a.5.5 0 01.5-.5zm-.5 9V18a.5.5 0 00.5.5h12a.5.5 0 00.5-.5v-3.5h-3.337a3.5 3.5 0 01-6.326 0H5.5zM4 13V6a2 2 0 012-2h12a2 2 0 012 2v12a2 2 0 01-2 2H6a2 2 0 01-2-2v-5z", + clipRule: "evenodd" +})); +/* harmony default export */ var library_inbox = (inbox_inbox); +//# sourceMappingURL=inbox.js.map +// CONCATENATED MODULE: ./node_modules/@wordpress/icons/build-module/library/help.js - if (shouldAnchorIncludePadding) { - return _rect2; - } - return withoutPadding(_rect2, anchorRef); - } +/** + * WordPress dependencies + */ - var top = anchorRef.top, - bottom = anchorRef.bottom; - var topRect = top.getBoundingClientRect(); - var bottomRect = bottom.getBoundingClientRect(); - - var _rect = new window.DOMRect(topRect.left, topRect.top, topRect.width, bottomRect.bottom - topRect.top); - - if (shouldAnchorIncludePadding) { - return _rect; - } - - return withoutPadding(_rect, anchorRef); - } - - if (!anchorRefFallback.current) { - return; - } +var help_help = Object(external_wp_element_["createElement"])(external_wp_primitives_["SVG"], { + xmlns: "http://www.w3.org/2000/svg", + viewBox: "0 0 24 24" +}, Object(external_wp_element_["createElement"])(external_wp_primitives_["Path"], { + d: "M12 4.75a7.25 7.25 0 100 14.5 7.25 7.25 0 000-14.5zM3.25 12a8.75 8.75 0 1117.5 0 8.75 8.75 0 01-17.5 0zM12 8.75a1.5 1.5 0 01.167 2.99c-.465.052-.917.44-.917 1.01V14h1.5v-.845A3 3 0 109 10.25h1.5a1.5 1.5 0 011.5-1.5zM11.25 15v1.5h1.5V15h-1.5z" +})); +/* harmony default export */ var library_help = (help_help); +//# sourceMappingURL=help.js.map +// EXTERNAL MODULE: ./node_modules/@wordpress/icons/build-module/library/external.js +var external = __webpack_require__(595); - var parentNode = anchorRefFallback.current.parentNode; - var rect = parentNode.getBoundingClientRect(); +// EXTERNAL MODULE: ./client/header/activity-panel/style.scss +var activity_panel_style = __webpack_require__(423); - if (shouldAnchorIncludePadding) { - return rect; - } +// EXTERNAL MODULE: ./client/inbox-panel/utils.js +var inbox_panel_utils = __webpack_require__(331); - return withoutPadding(rect, parentNode); -} +// CONCATENATED MODULE: ./client/header/activity-panel/unread-indicators.js +/** + * External dependencies + */ -function getComputedStyle(node) { - return node.ownerDocument.defaultView.getComputedStyle(node); -} -function withoutPadding(rect, element) { - var _getComputedStyle = getComputedStyle(element), - paddingTop = _getComputedStyle.paddingTop, - paddingBottom = _getComputedStyle.paddingBottom, - paddingLeft = _getComputedStyle.paddingLeft, - paddingRight = _getComputedStyle.paddingRight; - - var top = paddingTop ? parseInt(paddingTop, 10) : 0; - var bottom = paddingBottom ? parseInt(paddingBottom, 10) : 0; - var left = paddingLeft ? parseInt(paddingLeft, 10) : 0; - var right = paddingRight ? parseInt(paddingRight, 10) : 0; - return { - x: rect.left + left, - y: rect.top + top, - width: rect.width - left - right, - height: rect.height - top - bottom, - left: rect.left + left, - right: rect.right - right, - top: rect.top + top, - bottom: rect.bottom - bottom - }; -} /** - * Hook used to focus the first tabbable element on mount. - * - * @param {boolean|string} focusOnMount Focus on mount mode. - * @param {Object} contentRef Reference to the popover content element. + * Internal dependencies */ -function useFocusContentOnMount(focusOnMount, contentRef) { - // Focus handling - Object(external_this_wp_element_["useEffect"])(function () { - /* - * Without the setTimeout, the dom node is not being focused. Related: - * https://stackoverflow.com/questions/35522220/react-ref-with-focus-doesnt-work-without-settimeout-my-example - * - * TODO: Treat the cause, not the symptom. - */ - var focusTimeout = setTimeout(function () { - if (!focusOnMount || !contentRef.current) { - return; - } - - if (focusOnMount === 'firstElement') { - // Find first tabbable node within content and shift focus, falling - // back to the popover panel itself. - var firstTabbable = build_module["a" /* focus */].tabbable.find(contentRef.current)[0]; +var UNREAD_NOTES_QUERY = { + page: 1, + per_page: external_wc_data_["QUERY_DEFAULTS"].pageSize, + status: 'unactioned', + type: external_wc_data_["QUERY_DEFAULTS"].noteTypes, + orderby: 'date', + order: 'desc' +}; +function getUnreadNotes(select) { + var _select = select(external_wc_data_["NOTES_STORE_NAME"]), + getNotes = _select.getNotes, + getNotesError = _select.getNotesError, + isResolving = _select.isResolving; - if (firstTabbable) { - firstTabbable.focus(); - } else { - contentRef.current.focus(); - } + var _select2 = select(external_wc_data_["USER_STORE_NAME"]), + getCurrentUser = _select2.getCurrentUser; - return; - } + var userData = getCurrentUser(); + var lastRead = parseInt(userData && userData.woocommerce_meta && userData.woocommerce_meta.activity_panel_inbox_last_read, 10); - if (focusOnMount === 'container') { - // Focus the popover panel itself so items in the popover are easily - // accessed via keyboard navigation. - contentRef.current.focus(); - } - }, 0); - return function () { - return clearTimeout(focusTimeout); - }; - }, []); -} -/** - * Sets or removes an element attribute. - * - * @param {Element} element The element to modify. - * @param {string} name The attribute name to set or remove. - * @param {?string} value The value to set. A falsy value will remove the - * attribute. - */ + if (!lastRead) { + return null; + } + getNotes(UNREAD_NOTES_QUERY); + var isError = Boolean(getNotesError('getNotes', [UNREAD_NOTES_QUERY])); + var isRequesting = isResolving('getNotes', [UNREAD_NOTES_QUERY]); -function setAttribute(element, name, value) { - if (!value) { - if (element.hasAttribute(name)) { - element.removeAttribute(name); - } - } else if (element.getAttribute(name) !== value) { - element.setAttribute(name, value); + if (isError || isRequesting) { + return null; } + + var latestNotes = getNotes(UNREAD_NOTES_QUERY); + var unreadNotesCount = Object(inbox_panel_utils["a" /* getUnreadNotesCount */])(latestNotes, lastRead); + return unreadNotesCount > 0; } -/** - * Sets or removes an element style property. - * - * @param {Element} element The element to modify. - * @param {string} property The property to set or remove. - * @param {?string} value The value to set. A falsy value will remove the - * property. - */ +function getLowStockCount() { + return Object(wc_admin_settings["g" /* getSetting */])('lowStockCount', 0); +} +// CONCATENATED MODULE: ./client/header/activity-panel/tab/index.js -function setStyle(element, property) { - var value = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : ''; - if (element.style[property] !== value) { - element.style[property] = value; - } -} /** - * Sets or removes an element class. - * - * @param {Element} element The element to modify. - * @param {string} name The class to set or remove. - * @param {boolean} toggle True to set the class, false to remove. + * External dependencies */ -function setClass(element, name, toggle) { - if (toggle) { - if (!element.classList.contains(name)) { - element.classList.add(name); - } - } else if (element.classList.contains(name)) { - element.classList.remove(name); - } -} -var popover_Popover = function Popover(_ref2) { - var headerTitle = _ref2.headerTitle, - onClose = _ref2.onClose, - onKeyDown = _ref2.onKeyDown, - children = _ref2.children, - className = _ref2.className, - _ref2$noArrow = _ref2.noArrow, - noArrow = _ref2$noArrow === void 0 ? true : _ref2$noArrow, - isAlternate = _ref2.isAlternate, - _ref2$position = _ref2.position, - position = _ref2$position === void 0 ? 'bottom right' : _ref2$position, - range = _ref2.range, - _ref2$focusOnMount = _ref2.focusOnMount, - focusOnMount = _ref2$focusOnMount === void 0 ? 'firstElement' : _ref2$focusOnMount, - anchorRef = _ref2.anchorRef, - shouldAnchorIncludePadding = _ref2.shouldAnchorIncludePadding, - anchorRect = _ref2.anchorRect, - getAnchorRect = _ref2.getAnchorRect, - expandOnMobile = _ref2.expandOnMobile, - _ref2$animate = _ref2.animate, - animate = _ref2$animate === void 0 ? true : _ref2$animate, - onClickOutside = _ref2.onClickOutside, - onFocusOutside = _ref2.onFocusOutside, - __unstableSticky = _ref2.__unstableSticky, - _ref2$__unstableSlotN = _ref2.__unstableSlotName, - __unstableSlotName = _ref2$__unstableSlotN === void 0 ? SLOT_NAME : _ref2$__unstableSlotN, - __unstableObserveElement = _ref2.__unstableObserveElement, - __unstableBoundaryParent = _ref2.__unstableBoundaryParent, - contentProps = Object(objectWithoutProperties["a" /* default */])(_ref2, ["headerTitle", "onClose", "onKeyDown", "children", "className", "noArrow", "isAlternate", "position", "range", "focusOnMount", "anchorRef", "shouldAnchorIncludePadding", "anchorRect", "getAnchorRect", "expandOnMobile", "animate", "onClickOutside", "onFocusOutside", "__unstableSticky", "__unstableSlotName", "__unstableObserveElement", "__unstableBoundaryParent"]); - - var anchorRefFallback = Object(external_this_wp_element_["useRef"])(null); - var contentRef = Object(external_this_wp_element_["useRef"])(null); - var containerRef = Object(external_this_wp_element_["useRef"])(); - var isMobileViewport = Object(use_viewport_match["a" /* default */])('medium', '<'); - - var _useState = Object(external_this_wp_element_["useState"])(), - _useState2 = Object(slicedToArray["a" /* default */])(_useState, 2), - animateOrigin = _useState2[0], - setAnimateOrigin = _useState2[1]; - - var slot = Object(use_slot["a" /* default */])(__unstableSlotName); - var isExpanded = expandOnMobile && isMobileViewport; - - var _useResizeObserver = Object(use_resize_observer["a" /* default */])(), - _useResizeObserver2 = Object(slicedToArray["a" /* default */])(_useResizeObserver, 2), - containerResizeListener = _useResizeObserver2[0], - contentSize = _useResizeObserver2[1]; - - noArrow = isExpanded || noArrow; - Object(external_this_wp_element_["useLayoutEffect"])(function () { - if (isExpanded) { - setClass(containerRef.current, 'is-without-arrow', noArrow); - setClass(containerRef.current, 'is-alternate', isAlternate); - setAttribute(containerRef.current, 'data-x-axis'); - setAttribute(containerRef.current, 'data-y-axis'); - setStyle(containerRef.current, 'top'); - setStyle(containerRef.current, 'left'); - setStyle(contentRef.current, 'maxHeight'); - setStyle(contentRef.current, 'maxWidth'); - return; +var tab_Tab = function Tab(_ref) { + var icon = _ref.icon, + title = _ref.title, + name = _ref.name, + unread = _ref.unread, + selected = _ref.selected, + isPanelOpen = _ref.isPanelOpen, + onTabClick = _ref.onTabClick; + var className = classnames_default()('woocommerce-layout__activity-panel-tab', { + 'is-active': isPanelOpen && selected, + 'has-unread': unread + }); + var tabKey = "activity-panel-tab-".concat(name); + return Object(external_wp_element_["createElement"])(external_wp_components_["Button"], { + role: "tab", + className: className, + "aria-selected": selected, + "aria-controls": "activity-panel-".concat(name), + key: tabKey, + id: tabKey, + onClick: function onClick() { + onTabClick(name); } + }, icon, title, ' ', unread && Object(external_wp_element_["createElement"])("span", { + className: "screen-reader-text" + }, Object(external_wp_i18n_["__"])('unread activity', 'woocommerce-admin'))); +}; +// CONCATENATED MODULE: ./client/header/activity-panel/tabs/index.js - var refresh = function refresh() { - if (!containerRef.current || !contentRef.current) { - return; - } - - var anchor = computeAnchorRect(anchorRefFallback, anchorRect, getAnchorRect, anchorRef, shouldAnchorIncludePadding); - - if (!anchor) { - return; - } - - var _containerRef$current = containerRef.current, - offsetParent = _containerRef$current.offsetParent, - ownerDocument = _containerRef$current.ownerDocument; - var relativeOffsetTop = 0; // If there is a positioned ancestor element that is not the body, - // subtract the position from the anchor rect. If the position of - // the popover is fixed, the offset parent is null or the body - // element, in which case the position is relative to the viewport. - // See https://developer.mozilla.org/en-US/docs/Web/API/HTMLElement/offsetParent - - if (offsetParent && offsetParent !== ownerDocument.body) { - var offsetParentRect = offsetParent.getBoundingClientRect(); - relativeOffsetTop = offsetParentRect.top; - anchor = new window.DOMRect(anchor.left - offsetParentRect.left, anchor.top - offsetParentRect.top, anchor.width, anchor.height); - } - var boundaryElement; - if (__unstableBoundaryParent) { - var _containerRef$current2; - boundaryElement = (_containerRef$current2 = containerRef.current.closest('.popover-slot')) === null || _containerRef$current2 === void 0 ? void 0 : _containerRef$current2.parentNode; - } - var usedContentSize = !contentSize.height ? contentRef.current.getBoundingClientRect() : contentSize; - var _computePopoverPositi = computePopoverPosition(anchor, usedContentSize, position, __unstableSticky, containerRef.current, relativeOffsetTop, boundaryElement), - popoverTop = _computePopoverPositi.popoverTop, - popoverLeft = _computePopoverPositi.popoverLeft, - xAxis = _computePopoverPositi.xAxis, - yAxis = _computePopoverPositi.yAxis, - contentHeight = _computePopoverPositi.contentHeight, - contentWidth = _computePopoverPositi.contentWidth; +/** + * External dependencies + */ - if (typeof popoverTop === 'number' && typeof popoverLeft === 'number') { - setStyle(containerRef.current, 'top', popoverTop + 'px'); - setStyle(containerRef.current, 'left', popoverLeft + 'px'); - } - setClass(containerRef.current, 'is-without-arrow', noArrow || xAxis === 'center' && yAxis === 'middle'); - setClass(containerRef.current, 'is-alternate', isAlternate); - setAttribute(containerRef.current, 'data-x-axis', xAxis); - setAttribute(containerRef.current, 'data-y-axis', yAxis); - setStyle(contentRef.current, 'maxHeight', typeof contentHeight === 'number' ? contentHeight + 'px' : ''); - setStyle(contentRef.current, 'maxWidth', typeof contentWidth === 'number' ? contentWidth + 'px' : ''); // Compute the animation position - var yAxisMapping = { - top: 'bottom', - bottom: 'top' - }; - var xAxisMapping = { - left: 'right', - right: 'left' - }; - var animateYAxis = yAxisMapping[yAxis] || 'middle'; - var animateXAxis = xAxisMapping[xAxis] || 'center'; - setAnimateOrigin(animateXAxis + ' ' + animateYAxis); - }; +/** + * Internal dependencies + */ - refresh(); - /* - * There are sometimes we need to reposition or resize the popover that - * are not handled by the resize/scroll window events (i.e. CSS changes - * in the layout that changes the position of the anchor). - * - * For these situations, we refresh the popover every 0.5s - */ - - var intervalHandle = window.setInterval(refresh, 500); - var rafId; - - var refreshOnAnimationFrame = function refreshOnAnimationFrame() { - window.cancelAnimationFrame(rafId); - rafId = window.requestAnimationFrame(refresh); - }; // Sometimes a click trigger a layout change that affects the popover - // position. This is an opportunity to immediately refresh rather than - // at the interval. - - - window.addEventListener('click', refreshOnAnimationFrame); - window.addEventListener('resize', refresh); - window.addEventListener('scroll', refresh, true); - var observer; - - if (__unstableObserveElement) { - observer = new window.MutationObserver(refresh); - observer.observe(__unstableObserveElement, { - attributes: true - }); - } - return function () { - window.clearInterval(intervalHandle); - window.removeEventListener('resize', refresh); - window.removeEventListener('scroll', refresh, true); - window.removeEventListener('click', refreshOnAnimationFrame); - window.cancelAnimationFrame(rafId); - - if (observer) { - observer.disconnect(); - } - }; - }, [isExpanded, anchorRect, getAnchorRect, anchorRef, shouldAnchorIncludePadding, position, contentSize, __unstableSticky, __unstableObserveElement, __unstableBoundaryParent]); - useFocusContentOnMount(focusOnMount, contentRef); // Event handlers +var tabs_Tabs = function Tabs(_ref) { + var tabs = _ref.tabs, + _onTabClick = _ref.onTabClick, + selectedTabName = _ref.selectedTab, + _ref$tabOpen = _ref.tabOpen, + tabOpen = _ref$tabOpen === void 0 ? false : _ref$tabOpen; - var maybeClose = function maybeClose(event) { - // Close on escape - if (event.keyCode === keycodes_build_module["b" /* ESCAPE */] && onClose) { - event.stopPropagation(); - onClose(); - } // Preserve original content prop behavior + var _useState = Object(external_wp_element_["useState"])({ + tabOpen: tabOpen, + currentTab: selectedTabName + }), + _useState2 = slicedToArray_default()(_useState, 2), + _useState2$ = _useState2[0], + tabIsOpenState = _useState2$.tabOpen, + currentTab = _useState2$.currentTab, + setTabState = _useState2[1]; // Keep state synced with props - if (onKeyDown) { - onKeyDown(event); + Object(external_wp_element_["useEffect"])(function () { + setTabState({ + tabOpen: tabOpen, + currentTab: selectedTabName + }); + }, [tabOpen, selectedTabName]); + return Object(external_wp_element_["createElement"])(external_wp_components_["NavigableMenu"], { + role: "tablist", + orientation: "horizontal", + className: "woocommerce-layout__activity-panel-tabs" + }, tabs && tabs.map(function (tab, i) { + if (tab.component) { + var Comp = tab.component, + options = tab.options; + return Object(external_wp_element_["createElement"])(Comp, extends_default()({ + key: i + }, options)); } - }; - /** - * Shims an onFocusOutside callback to be compatible with a deprecated - * onClickOutside prop function, if provided. - * - * @param {FocusEvent} event Focus event from onFocusOutside. - */ - - - function handleOnFocusOutside(event) { - // Defer to given `onFocusOutside` if specified. Call `onClose` only if - // both `onFocusOutside` and `onClickOutside` are unspecified. Doing so - // assures backwards-compatibility for prior `onClickOutside` default. - if (onFocusOutside) { - onFocusOutside(event); - return; - } else if (!onClickOutside) { - if (onClose) { - onClose(); - } - - return; - } // Simulate MouseEvent using FocusEvent#relatedTarget as emulated click - // target. MouseEvent constructor is unsupported in Internet Explorer. + return Object(external_wp_element_["createElement"])(tab_Tab, extends_default()({ + key: i, + index: i, + isPanelOpen: tabIsOpenState, + selected: currentTab === tab.name + }, tab, { + onTabClick: function onTabClick() { + var isTabOpen = currentTab === tab.name || currentTab === '' ? !tabIsOpenState : true; // If a panel is being opened, or if an existing panel is already open and a different one is being opened, record a track. - var clickEvent; + if (!isTabOpen || currentTab !== tab.name) { + Object(external_wc_tracks_["recordEvent"])('activity_panel_open', { + tab: tab.name + }); + } - try { - clickEvent = new window.MouseEvent('click'); - } catch (error) { - clickEvent = document.createEvent('MouseEvent'); - clickEvent.initMouseEvent('click', true, true, window, 0, 0, 0, 0, 0, false, false, false, false, 0, null); - } + setTabState({ + tabOpen: isTabOpen, + currentTab: tab.name + }); - Object.defineProperty(clickEvent, 'target', { - get: function get() { - return event.relatedTarget; - } - }); - Object(deprecated_build_module["a" /* default */])('Popover onClickOutside prop', { - alternative: 'onFocusOutside' - }); - onClickOutside(clickEvent); - } // Disable reason: We care to capture the _bubbled_ events from inputs - // within popover as inferring close intent. - - - var content = Object(external_this_wp_element_["createElement"])(detect_outside, { - onFocusOutside: handleOnFocusOutside - }, Object(external_this_wp_element_["createElement"])(build_module_animate["a" /* default */], { - type: animate && animateOrigin ? 'appear' : null, - options: { - origin: animateOrigin - } - }, function (_ref3) { - var animateClassName = _ref3.className; - return Object(external_this_wp_element_["createElement"])(isolated_event_container["a" /* default */], Object(esm_extends["a" /* default */])({ - className: classnames_default()('components-popover', className, animateClassName, { - 'is-expanded': isExpanded, - 'is-without-arrow': noArrow, - 'is-alternate': isAlternate - }) - }, contentProps, { - onKeyDown: maybeClose, - ref: containerRef - }), isExpanded && Object(external_this_wp_element_["createElement"])(scroll_lock, null), isExpanded && Object(external_this_wp_element_["createElement"])("div", { - className: "components-popover__header" - }, Object(external_this_wp_element_["createElement"])("span", { - className: "components-popover__header-title" - }, headerTitle), Object(external_this_wp_element_["createElement"])(build_module_button["a" /* default */], { - className: "components-popover__close", - icon: library_close["a" /* default */], - onClick: onClose - })), Object(external_this_wp_element_["createElement"])("div", { - ref: contentRef, - className: "components-popover__content", - tabIndex: "-1" - }, Object(external_this_wp_element_["createElement"])("div", { - style: { - position: 'relative' + _onTabClick(tab, isTabOpen); } - }, containerResizeListener, children))); - })); // Apply focus to element as long as focusOnMount is truthy; false is - // the only "disabled" value. - - if (focusOnMount) { - content = Object(external_this_wp_element_["createElement"])(FocusManaged, null, content); - } - - if (slot.ref) { - content = Object(external_this_wp_element_["createElement"])(slot_fill["a" /* Fill */], { - name: __unstableSlotName - }, content); - } - - if (anchorRef || anchorRect) { - return content; - } - - return Object(external_this_wp_element_["createElement"])("span", { - ref: anchorRefFallback - }, content); + })); + })); }; +// CONCATENATED MODULE: ./client/header/activity-panel/setup-progress.js -var PopoverContainer = popover_Popover; - -PopoverContainer.Slot = function (_ref4) { - var _ref4$name = _ref4.name, - name = _ref4$name === void 0 ? SLOT_NAME : _ref4$name; - return Object(external_this_wp_element_["createElement"])(slot_fill["b" /* Slot */], { - bubblesVirtually: true, - name: name, - className: "popover-slot" - }); +var setup_progress_SetupProgress = function SetupProgress() { + return Object(external_wp_element_["createElement"])("svg", { + className: "woocommerce-layout__activity-panel-tab-icon setup-progress", + width: "18", + height: "18", + viewBox: "0 0 24 24", + fill: "none", + xmlns: "http://www.w3.org/2000/svg" + }, Object(external_wp_element_["createElement"])("path", { + d: "M12 20C16.4183 20 20 16.4183 20 12C20 7.58172 16.4183 4 12 4C7.58172 4 4 7.58172 4 12C4 16.4183 7.58172 20 12 20Z", + stroke: "#DCDCDE", + strokeWidth: "2" + }), Object(external_wp_element_["createElement"])("path", { + d: "M4 12V12C4 16.4183 7.58172 20 12 20V20C16.4183 20 20 16.4183 20 12V12C20 7.58172 16.4183 4 12 4V4", + strokeWidth: "2", + strokeLinecap: "round" + })); }; +// CONCATENATED MODULE: ./client/header/activity-panel/display-options/icons/display.js -/* harmony default export */ var popover = __webpack_exports__["a"] = (PopoverContainer); -//# sourceMappingURL=index.js.map - -/***/ }), -/* 118 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "c", function() { return STORE_KEY; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return API_NAMESPACE; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return QUEUE_OPTION_NAME; }); -var STORE_KEY = 'wc/customer-effort-score'; -var API_NAMESPACE = '/wc-admin'; -var QUEUE_OPTION_NAME = 'woocommerce_ces_tracks_queue'; - -/***/ }), -/* 119 */ -/***/ (function(module, exports, __webpack_require__) { /** - * Copyright (c) 2014-present, Facebook, Inc. - * - * This source code is licensed under the MIT license found in the - * LICENSE file in the root directory of this source tree. + * External dependencies */ -var runtime = (function (exports) { - "use strict"; - - var Op = Object.prototype; - var hasOwn = Op.hasOwnProperty; - var undefined; // More compressible than void 0. - var $Symbol = typeof Symbol === "function" ? Symbol : {}; - var iteratorSymbol = $Symbol.iterator || "@@iterator"; - var asyncIteratorSymbol = $Symbol.asyncIterator || "@@asyncIterator"; - var toStringTagSymbol = $Symbol.toStringTag || "@@toStringTag"; - - function define(obj, key, value) { - Object.defineProperty(obj, key, { - value: value, - enumerable: true, - configurable: true, - writable: true - }); - return obj[key]; - } - try { - // IE 8 has a broken Object.defineProperty that only works on DOM objects. - define({}, ""); - } catch (err) { - define = function(obj, key, value) { - return obj[key] = value; - }; - } - - function wrap(innerFn, outerFn, self, tryLocsList) { - // If outerFn provided and outerFn.prototype is a Generator, then outerFn.prototype instanceof Generator. - var protoGenerator = outerFn && outerFn.prototype instanceof Generator ? outerFn : Generator; - var generator = Object.create(protoGenerator.prototype); - var context = new Context(tryLocsList || []); - - // The ._invoke method unifies the implementations of the .next, - // .throw, and .return methods. - generator._invoke = makeInvokeMethod(innerFn, self, context); - - return generator; - } - exports.wrap = wrap; - - // Try/catch helper to minimize deoptimizations. Returns a completion - // record like context.tryEntries[i].completion. This interface could - // have been (and was previously) designed to take a closure to be - // invoked without arguments, but in all the cases we care about we - // already have an existing method we want to call, so there's no need - // to create a new function object. We can even get away with assuming - // the method takes exactly one argument, since that happens to be true - // in every case, so we don't have to touch the arguments object. The - // only additional allocation required is the completion record, which - // has a stable shape and so hopefully should be cheap to allocate. - function tryCatch(fn, obj, arg) { - try { - return { type: "normal", arg: fn.call(obj, arg) }; - } catch (err) { - return { type: "throw", arg: err }; - } - } - - var GenStateSuspendedStart = "suspendedStart"; - var GenStateSuspendedYield = "suspendedYield"; - var GenStateExecuting = "executing"; - var GenStateCompleted = "completed"; +var display_DisplayIcon = function DisplayIcon() { + return Object(external_wp_element_["createElement"])(external_wp_element_["Fragment"], null, Object(external_wp_element_["createElement"])("svg", { + className: "woocommerce-layout__activity-panel-tab-icon", + width: "24", + height: "24", + viewBox: "3 3 24 24", + fill: "none", + xmlns: "http://www.w3.org/2000/svg" + }, Object(external_wp_element_["createElement"])("path", { + d: "M13.8053 15.3982C13.8053 15.7965 13.4867 16.1947 13.0089 16.1947H6.79646C6.55752 16.1947 6.39823 16.115 6.23894 15.9558C6.07965 15.7965 6 15.6372 6 15.3982V6.79646C6 6.63717 6.15929 6.39823 6.23894 6.23894C6.39823 6.07965 6.55752 6 6.79646 6H13.0089C13.4071 6 13.8053 6.31858 13.8053 6.79646V15.3982Z", + strokeWidth: "1.5", + strokeLinecap: "round", + strokeLinejoin: "round" + }), Object(external_wp_element_["createElement"])("path", { + d: "M23.9203 10.6195C23.9203 11.0177 23.6017 11.4159 23.1238 11.4159H16.9115C16.6725 11.4159 16.5132 11.3363 16.3539 11.177C16.1946 11.0177 16.115 10.8584 16.115 10.6195V6.79646C16.115 6.39823 16.4336 6 16.9115 6H23.1238C23.5221 6 23.9203 6.31858 23.9203 6.79646V10.6195Z", + strokeWidth: "1.5", + strokeLinecap: "round", + strokeLinejoin: "round" + }), Object(external_wp_element_["createElement"])("path", { + d: "M13.8053 23.2035C13.8053 23.4424 13.7257 23.6017 13.5664 23.761C13.4071 23.9203 13.2478 23.9999 13.0089 23.9999H6.79646C6.39823 23.9999 6 23.6813 6 23.2035V19.3804C6 19.1415 6.07965 18.9822 6.23894 18.8229C6.39823 18.6636 6.55752 18.584 6.79646 18.584H13.0089C13.4071 18.584 13.8053 18.9026 13.8053 19.3804V23.2035Z", + strokeWidth: "1.5", + strokeLinecap: "round", + strokeLinejoin: "round" + }), Object(external_wp_element_["createElement"])("path", { + d: "M16.9912 23.9999C16.7522 23.9999 16.5929 23.9202 16.4336 23.7609C16.2743 23.6016 16.1947 23.4423 16.1947 23.2034V14.6016C16.1947 14.3627 16.2743 14.2034 16.4336 14.0441C16.5929 13.8848 16.7522 13.8052 16.9912 13.8052H23.2036C23.4425 13.8052 23.6018 13.8848 23.7611 14.0441C23.9204 14.2034 24 14.3627 24 14.6016V23.2034C24 23.6016 23.6814 23.9999 23.2036 23.9999H16.9912Z", + strokeWidth: "1.5", + strokeLinecap: "round", + strokeLinejoin: "round" + })), Object(external_wp_i18n_["__"])('Display', 'woocommerce-admin')); +}; +// CONCATENATED MODULE: ./client/header/activity-panel/display-options/icons/single-column.js - // Returning this object from the innerFn has the same effect as - // breaking out of the dispatch switch statement. - var ContinueSentinel = {}; +var single_column_SingleColumnIcon = function SingleColumnIcon() { + return Object(external_wp_element_["createElement"])("svg", { + className: "woocommerce-layout__activity-panel-tab-icon", + width: "12", + height: "14", + viewBox: "0 0 12 14", + fill: "none", + xmlns: "http://www.w3.org/2000/svg" + }, Object(external_wp_element_["createElement"])("rect", { + x: "0.5", + y: "0.5", + width: "11", + height: "13", + strokeWidth: "1" + })); +}; +// CONCATENATED MODULE: ./client/header/activity-panel/display-options/icons/two-columns.js - // Dummy constructor functions that we use as the .constructor and - // .constructor.prototype properties for functions that return Generator - // objects. For full spec compliance, you may wish to configure your - // minifier not to mangle the names of these two functions. - function Generator() {} - function GeneratorFunction() {} - function GeneratorFunctionPrototype() {} +var two_columns_TwoColumnsIcon = function TwoColumnsIcon() { + return Object(external_wp_element_["createElement"])("svg", { + className: "woocommerce-layout__activity-panel-tab-icon", + width: "18", + height: "14", + viewBox: "0 0 18 14", + fill: "none", + xmlns: "http://www.w3.org/2000/svg" + }, Object(external_wp_element_["createElement"])("rect", { + x: "0.5", + y: "0.5", + width: "7", + height: "13", + strokeWidth: "1" + }), Object(external_wp_element_["createElement"])("rect", { + x: "9.5", + y: "0.5", + width: "7", + height: "13", + strokeWidth: "1" + })); +}; +// CONCATENATED MODULE: ./client/header/activity-panel/display-options/index.js - // This is a polyfill for %IteratorPrototype% for environments that - // don't natively support it. - var IteratorPrototype = {}; - IteratorPrototype[iteratorSymbol] = function () { - return this; - }; - var getProto = Object.getPrototypeOf; - var NativeIteratorPrototype = getProto && getProto(getProto(values([]))); - if (NativeIteratorPrototype && - NativeIteratorPrototype !== Op && - hasOwn.call(NativeIteratorPrototype, iteratorSymbol)) { - // This environment has a native %IteratorPrototype%; use it instead - // of the polyfill. - IteratorPrototype = NativeIteratorPrototype; - } - - var Gp = GeneratorFunctionPrototype.prototype = - Generator.prototype = Object.create(IteratorPrototype); - GeneratorFunction.prototype = Gp.constructor = GeneratorFunctionPrototype; - GeneratorFunctionPrototype.constructor = GeneratorFunction; - GeneratorFunction.displayName = define( - GeneratorFunctionPrototype, - toStringTagSymbol, - "GeneratorFunction" - ); +/** + * External dependencies + */ - // Helper for defining the .next, .throw, and .return methods of the - // Iterator interface in terms of a single ._invoke method. - function defineIteratorMethods(prototype) { - ["next", "throw", "return"].forEach(function(method) { - define(prototype, method, function(arg) { - return this._invoke(method, arg); - }); - }); - } - exports.isGeneratorFunction = function(genFun) { - var ctor = typeof genFun === "function" && genFun.constructor; - return ctor - ? ctor === GeneratorFunction || - // For the native GeneratorFunction constructor, the best we can - // do is to check its .name property. - (ctor.displayName || ctor.name) === "GeneratorFunction" - : false; - }; - exports.mark = function(genFun) { - if (Object.setPrototypeOf) { - Object.setPrototypeOf(genFun, GeneratorFunctionPrototype); - } else { - genFun.__proto__ = GeneratorFunctionPrototype; - define(genFun, toStringTagSymbol, "GeneratorFunction"); - } - genFun.prototype = Object.create(Gp); - return genFun; - }; - // Within the body of any async function, `await x` is transformed to - // `yield regeneratorRuntime.awrap(x)`, so that the runtime can test - // `hasOwn.call(value, "__await")` to determine if the yielded value is - // meant to be awaited. - exports.awrap = function(arg) { - return { __await: arg }; - }; - function AsyncIterator(generator, PromiseImpl) { - function invoke(method, arg, resolve, reject) { - var record = tryCatch(generator[method], generator, arg); - if (record.type === "throw") { - reject(record.arg); - } else { - var result = record.arg; - var value = result.value; - if (value && - typeof value === "object" && - hasOwn.call(value, "__await")) { - return PromiseImpl.resolve(value.__await).then(function(value) { - invoke("next", value, resolve, reject); - }, function(err) { - invoke("throw", err, resolve, reject); - }); - } +/** + * Internal dependencies + */ - return PromiseImpl.resolve(value).then(function(unwrapped) { - // When a yielded Promise is resolved, its final value becomes - // the .value of the Promise<{value,done}> result for the - // current iteration. - result.value = unwrapped; - resolve(result); - }, function(error) { - // If a rejected Promise was yielded, throw the rejection back - // into the async generator function so it can be handled there. - return invoke("throw", error, resolve, reject); - }); - } - } - var previousPromise; - function enqueue(method, arg) { - function callInvokeWithMethodAndArg() { - return new PromiseImpl(function(resolve, reject) { - invoke(method, arg, resolve, reject); - }); - } - return previousPromise = - // If enqueue has been called before, then we want to wait until - // all previous Promises have been resolved before calling invoke, - // so that results are always delivered in the correct order. If - // enqueue has not been called before, then it is important to - // call invoke immediately, without waiting on a callback to fire, - // so that the async generator function has the opportunity to do - // any necessary setup in a predictable way. This predictability - // is why the Promise constructor synchronously invokes its - // executor callback, and why async functions synchronously - // execute code before the first await. Since we implement simple - // async functions in terms of async generators, it is especially - // important to get this right, even though it requires care. - previousPromise ? previousPromise.then( - callInvokeWithMethodAndArg, - // Avoid propagating failures to Promises returned by later - // invocations of the iterator. - callInvokeWithMethodAndArg - ) : callInvokeWithMethodAndArg(); - } - - // Define the unified helper method that is used to implement .next, - // .throw, and .return (see defineIteratorMethods). - this._invoke = enqueue; - } - - defineIteratorMethods(AsyncIterator.prototype); - AsyncIterator.prototype[asyncIteratorSymbol] = function () { - return this; - }; - exports.AsyncIterator = AsyncIterator; +var LAYOUTS = [{ + value: 'single_column', + label: Object(external_wp_element_["createElement"])(external_wp_element_["Fragment"], null, Object(external_wp_element_["createElement"])(single_column_SingleColumnIcon, null), Object(external_wp_i18n_["__"])('Single column', 'woocommerce-admin')) +}, { + value: 'two_columns', + label: Object(external_wp_element_["createElement"])(external_wp_element_["Fragment"], null, Object(external_wp_element_["createElement"])(two_columns_TwoColumnsIcon, null), Object(external_wp_i18n_["__"])('Two columns', 'woocommerce-admin')) +}]; +var display_options_DisplayOptions = function DisplayOptions() { + var defaultHomescreenLayout = Object(external_wp_data_["useSelect"])(function (select) { + var _select = select(external_wc_data_["OPTIONS_STORE_NAME"]), + getOption = _select.getOption; - // Note that simple async functions are implemented on top of - // AsyncIterator objects; they just return a Promise for the value of - // the final result produced by the iterator. - exports.async = function(innerFn, outerFn, self, tryLocsList, PromiseImpl) { - if (PromiseImpl === void 0) PromiseImpl = Promise; + return getOption('woocommerce_default_homepage_layout') || 'single_column'; + }); - var iter = new AsyncIterator( - wrap(innerFn, outerFn, self, tryLocsList), - PromiseImpl - ); + var _useUserPreferences = Object(external_wc_data_["useUserPreferences"])(), + updateUserPreferences = _useUserPreferences.updateUserPreferences, + layout = _useUserPreferences.homepage_layout; - return exports.isGeneratorFunction(outerFn) - ? iter // If outerFn is a generator, return the full iterator. - : iter.next().then(function(result) { - return result.done ? result.value : iter.next(); + return Object(external_wp_element_["createElement"])(external_wp_components_["DropdownMenu"], { + icon: Object(external_wp_element_["createElement"])(display_DisplayIcon, null) + /* translators: button label text should, if possible, be under 16 characters. */ + , + label: Object(external_wp_i18n_["__"])('Display options', 'woocommerce-admin'), + toggleProps: { + className: 'woocommerce-layout__activity-panel-tab display-options', + onClick: function onClick() { + return Object(external_wc_tracks_["recordEvent"])('homescreen_display_click'); + } + }, + popoverProps: { + className: 'woocommerce-layout__activity-panel-popover' + } + }, function (_ref) { + var onClose = _ref.onClose; + return Object(external_wp_element_["createElement"])(external_wp_components_["MenuGroup"], { + className: "woocommerce-layout__homescreen-display-options", + label: Object(external_wp_i18n_["__"])('Layout', 'woocommerce-admin') + }, Object(external_wp_element_["createElement"])(external_wp_components_["MenuItemsChoice"], { + choices: LAYOUTS, + onSelect: function onSelect(newLayout) { + updateUserPreferences({ + homepage_layout: newLayout }); - }; - - function makeInvokeMethod(innerFn, self, context) { - var state = GenStateSuspendedStart; + onClose(); + Object(external_wc_tracks_["recordEvent"])('homescreen_display_option', { + display_option: newLayout + }); + }, + value: layout || defaultHomescreenLayout + })); + }); +}; +// EXTERNAL MODULE: ./node_modules/@wordpress/icons/build-module/library/close.js +var library_close = __webpack_require__(594); - return function invoke(method, arg) { - if (state === GenStateExecuting) { - throw new Error("Generator is already running"); - } +// EXTERNAL MODULE: ./client/header/activity-panel/highlight-tooltip/style.scss +var highlight_tooltip_style = __webpack_require__(424); - if (state === GenStateCompleted) { - if (method === "throw") { - throw arg; - } +// CONCATENATED MODULE: ./client/header/activity-panel/highlight-tooltip/index.js - // Be forgiving, per 25.3.3.3.3 of the spec: - // https://people.mozilla.org/~jorendorff/es6-draft.html#sec-generatorresume - return doneResult(); - } - context.method = method; - context.arg = arg; - while (true) { - var delegate = context.delegate; - if (delegate) { - var delegateResult = maybeInvokeDelegate(delegate, context); - if (delegateResult) { - if (delegateResult === ContinueSentinel) continue; - return delegateResult; - } - } +/** + * External dependencies + */ - if (context.method === "next") { - // Setting context._sent for legacy support of Babel's - // function.sent implementation. - context.sent = context._sent = context.arg; - } else if (context.method === "throw") { - if (state === GenStateSuspendedStart) { - state = GenStateCompleted; - throw context.arg; - } - context.dispatchException(context.arg); - } else if (context.method === "return") { - context.abrupt("return", context.arg); - } - state = GenStateExecuting; - var record = tryCatch(innerFn, self, context); - if (record.type === "normal") { - // If an exception is thrown from innerFn, we leave state === - // GenStateExecuting and loop back for another invocation. - state = context.done - ? GenStateCompleted - : GenStateSuspendedYield; +/** + * Internal dependencies + */ - if (record.arg === ContinueSentinel) { - continue; - } - return { - value: record.arg, - done: context.done - }; +var SHOW_CLASS = 'highlight-tooltip__show'; - } else if (record.type === "throw") { - state = GenStateCompleted; - // Dispatch the exception by looping back around to the - // context.dispatchException(context.arg) call above. - context.method = "throw"; - context.arg = record.arg; - } - } - }; - } +function HighlightTooltip(_ref) { + var title = _ref.title, + closeButtonText = _ref.closeButtonText, + content = _ref.content, + _ref$show = _ref.show, + show = _ref$show === void 0 ? true : _ref$show, + id = _ref.id, + onClose = _ref.onClose, + delay = _ref.delay, + _ref$onShow = _ref.onShow, + onShow = _ref$onShow === void 0 ? external_lodash_["noop"] : _ref$onShow, + _ref$useAnchor = _ref.useAnchor, + useAnchor = _ref$useAnchor === void 0 ? false : _ref$useAnchor; - // Call delegate.iterator[context.method](context.arg) and handle the - // result, either by returning a { value, done } result from the - // delegate iterator, or by modifying context.method and context.arg, - // setting context.delegate to null, and returning the ContinueSentinel. - function maybeInvokeDelegate(delegate, context) { - var method = delegate.iterator[context.method]; - if (method === undefined) { - // A .throw or .return when the delegate iterator has no .throw - // method always terminates the yield* loop. - context.delegate = null; - - if (context.method === "throw") { - // Note: ["return"] must be used for ES3 parsing compatibility. - if (delegate.iterator["return"]) { - // If the delegate iterator has a return method, give it a - // chance to clean up. - context.method = "return"; - context.arg = undefined; - maybeInvokeDelegate(delegate, context); - - if (context.method === "throw") { - // If maybeInvokeDelegate(context) changed context.method from - // "return" to "throw", let that override the TypeError below. - return ContinueSentinel; - } - } + var _useState = Object(external_wp_element_["useState"])(delay > 0 ? null : show), + _useState2 = slicedToArray_default()(_useState, 2), + showHighlight = _useState2[0], + setShowHighlight = _useState2[1]; - context.method = "throw"; - context.arg = new TypeError( - "The iterator does not provide a 'throw' method"); + var _useState3 = Object(external_wp_element_["useState"])(null), + _useState4 = slicedToArray_default()(_useState3, 2), + node = _useState4[0], + setNode = _useState4[1]; + + var _useState5 = Object(external_wp_element_["useState"])(null), + _useState6 = slicedToArray_default()(_useState5, 2), + anchorRect = _useState6[0], + setAnchorRect = _useState6[1]; + + Object(external_wp_element_["useEffect"])(function () { + var element = document.getElementById(id); + var container, parent; + + if (element && !node) { + // Add tooltip container + if (!useAnchor) { + parent = element.parentElement; + } else { + parent = document.createElement('div'); + document.body.appendChild(parent); } - return ContinueSentinel; - } - - var record = tryCatch(method, delegate.iterator, context.arg); - - if (record.type === "throw") { - context.method = "throw"; - context.arg = record.arg; - context.delegate = null; - return ContinueSentinel; - } - - var info = record.arg; - - if (! info) { - context.method = "throw"; - context.arg = new TypeError("iterator result is not an object"); - context.delegate = null; - return ContinueSentinel; + container = document.createElement('div'); + container.classList.add('highlight-tooltip__container'); + parent.appendChild(container); + setNode(container); } - if (info.done) { - // Assign the result of the finished delegate to the temporary - // variable specified by delegate.resultName (see delegateYield). - context[delegate.resultName] = info.value; - - // Resume execution at the desired location (see delegateYield). - context.next = delegate.nextLoc; + var timeoutId = triggerShowTooltip(container); + return function () { + if (container) { + var parentElement = container.parentElement; + parentElement.removeChild(container); - // If context.method was "throw" but the delegate handled the - // exception, let the outer generator proceed normally. If - // context.method was "next", forget context.arg since it has been - // "consumed" by the delegate iterator. If context.method was - // "return", allow the original .return call to continue in the - // outer generator. - if (context.method !== "return") { - context.method = "next"; - context.arg = undefined; + if (useAnchor) { + parentElement.remove(); + } } - } else { - // Re-yield the result returned by the delegate method. - return info; + if (timeoutId) { + clearTimeout(timeoutId); + } + }; + }, []); + Object(external_wp_element_["useEffect"])(function () { + if (!showHighlight && node) { + node.classList.remove(SHOW_CLASS); + } + }, [showHighlight]); + Object(external_wp_element_["useEffect"])(function () { + if (show !== showHighlight && showHighlight !== null && node) { + setShowHighlight(show); + + if (!show) { + node.classList.remove(SHOW_CLASS); + } else if (node) { + triggerShowTooltip(node); + } } + }, [show]); + Object(external_wp_element_["useLayoutEffect"])(function () { + window.addEventListener('resize', updateSize); + return function () { + return window.removeEventListener('resize', updateSize); + }; + }, []); - // The delegate iterator is finished, so forget it and continue with - // the outer generator. - context.delegate = null; - return ContinueSentinel; + function updateSize() { + if (useAnchor) { + var element = document.getElementById(id); + setAnchorRect(element.getBoundingClientRect()); + } } - // Define Generator.prototype.{next,throw,return} in terms of the - // unified ._invoke helper method. - defineIteratorMethods(Gp); + var triggerShowTooltip = function triggerShowTooltip(container) { + var timeoutId = null; - define(Gp, toStringTagSymbol, "Generator"); - - // A Generator should always return itself as the iterator object when the - // @@iterator function is called on it. Some browsers' implementations of the - // iterator prototype chain incorrectly implement this, causing the Generator - // object to not be returned from this call. This ensures that doesn't happen. - // See https://github.com/facebook/regenerator/issues/274 for more details. - Gp[iteratorSymbol] = function() { - return this; - }; + if (delay > 0) { + timeoutId = setTimeout(function () { + timeoutId = null; + showTooltip(container); + }, delay); + } else if (!showHighlight) { + showTooltip(container); + } - Gp.toString = function() { - return "[object Generator]"; + return timeoutId; }; - function pushTryEntry(locs) { - var entry = { tryLoc: locs[0] }; + var showTooltip = function showTooltip(container) { + var element = document.getElementById(id); - if (1 in locs) { - entry.catchLoc = locs[1]; + if (element && useAnchor) { + setAnchorRect(element.getBoundingClientRect()); } - if (2 in locs) { - entry.finallyLoc = locs[2]; - entry.afterLoc = locs[3]; + if (container) { + container.classList.add(SHOW_CLASS); } - this.tryEntries.push(entry); - } - - function resetTryEntry(entry) { - var record = entry.completion || {}; - record.type = "normal"; - delete record.arg; - entry.completion = record; - } - - function Context(tryLocsList) { - // The root entry object (effectively a try statement without a catch - // or a finally block) gives us a place to store values thrown from - // locations where there is no enclosing try statement. - this.tryEntries = [{ tryLoc: "root" }]; - tryLocsList.forEach(pushTryEntry, this); - this.reset(true); - } + setShowHighlight(true); + onShow(); + }; - exports.keys = function(object) { - var keys = []; - for (var key in object) { - keys.push(key); - } - keys.reverse(); - - // Rather than returning an object with a next method, we keep - // things simple and return the next function itself. - return function next() { - while (keys.length) { - var key = keys.pop(); - if (key in object) { - next.value = key; - next.done = false; - return next; - } - } + var triggerClose = function triggerClose() { + setShowHighlight(false); - // To avoid creating an additional object, we just hang the .value - // and .done properties off the next function object itself. This - // also ensures that the minifier will not anonymize the function. - next.done = true; - return next; - }; + if (onClose) { + onClose(); + } }; - function values(iterable) { - if (iterable) { - var iteratorMethod = iterable[iteratorSymbol]; - if (iteratorMethod) { - return iteratorMethod.call(iterable); - } + if (!node) { + return null; + } - if (typeof iterable.next === "function") { - return iterable; - } + return Object(external_wp_element_["createPortal"])(Object(external_wp_element_["createElement"])("div", { + className: "highlight-tooltip__portal" + }, showHighlight ? Object(external_wp_element_["createElement"])(external_wp_element_["Fragment"], null, Object(external_wp_element_["createElement"])(external_wp_components_["IsolatedEventContainer"], { + className: "highlight-tooltip__overlay" + }), Object(external_wp_element_["createElement"])(external_wp_components_["Popover"], { + className: "highlight-tooltip__popover", + noArrow: false, + anchorRect: anchorRect, + focusOnMount: "container" + }, Object(external_wp_element_["createElement"])(external_wp_components_["Card"], { + size: "medium" + }, Object(external_wp_element_["createElement"])(external_wp_components_["CardHeader"], null, title, Object(external_wp_element_["createElement"])(external_wp_components_["Button"], { + isSmall: true, + onClick: triggerClose, + icon: library_close["a" /* default */] + })), Object(external_wp_element_["createElement"])(external_wp_components_["CardBody"], null, content || null), Object(external_wp_element_["createElement"])(external_wp_components_["CardFooter"], { + isBorderless: true + }, Object(external_wp_element_["createElement"])(external_wp_components_["Button"], { + size: "small", + isPrimary: true, + onClick: triggerClose + }, closeButtonText || Object(external_wp_i18n_["__"])('Close', 'woocommerce-admin')))))) : null), node); +} + +HighlightTooltip.propTypes = { + /** + * The id of the element it should highlight, should be unique per HighlightTooltip. + */ + id: prop_types_default.a.string.isRequired, - if (!isNaN(iterable.length)) { - var i = -1, next = function next() { - while (++i < iterable.length) { - if (hasOwn.call(iterable, i)) { - next.value = iterable[i]; - next.done = false; - return next; - } - } + /** + * Title of the popup + */ + title: prop_types_default.a.string.isRequired, - next.value = undefined; - next.done = true; + /** + * Text of the close button. + */ + closeButtonText: prop_types_default.a.string.isRequired, - return next; - }; + /** + * Content of the popup, can be either text or react element. + */ + content: prop_types_default.a.oneOfType([prop_types_default.a.string, prop_types_default.a.node]), - return next.next = next; - } - } + /** + * If to show the popup, defaults to true. + */ + show: prop_types_default.a.bool, - // Return an iterator with no values. - return { next: doneResult }; - } - exports.values = values; + /** + * Callback for when the user closes the popup. + */ + onClose: prop_types_default.a.func, - function doneResult() { - return { value: undefined, done: true }; - } + /** + * This will delay the popup from appearing by the number of ms. + */ + delay: prop_types_default.a.number, - Context.prototype = { - constructor: Context, + /** + * A callback for when the tooltip is shown. + */ + onShow: prop_types_default.a.func, - reset: function(skipTempReset) { - this.prev = 0; - this.next = 0; - // Resetting context._sent for legacy support of Babel's - // function.sent implementation. - this.sent = this._sent = undefined; - this.done = false; - this.delegate = null; + /** + * useAnchor, will append the tooltip to the body tag, and make use of the anchorRect to display the tooltip. + * Defaults to false. + */ + useAnchor: prop_types_default.a.bool +}; - this.method = "next"; - this.arg = undefined; +// EXTERNAL MODULE: ./node_modules/core-js/modules/es.array.find.js +var es_array_find = __webpack_require__(192); - this.tryEntries.forEach(resetTryEntry); +// EXTERNAL MODULE: external ["wp","dom"] +var external_wp_dom_ = __webpack_require__(262); - if (!skipTempReset) { - for (var name in this) { - // Not sure about the optimal order of these conditions: - if (name.charAt(0) === "t" && - hasOwn.call(this, name) && - !isNaN(+name.slice(1))) { - this[name] = undefined; - } - } - } - }, +// CONCATENATED MODULE: ./client/hooks/useFocusOnMount.js - stop: function() { - this.done = true; - var rootEntry = this.tryEntries[0]; - var rootRecord = rootEntry.completion; - if (rootRecord.type === "throw") { - throw rootRecord.arg; - } +/** + * This hook was directly copied from https://github.com/WordPress/gutenberg/blob/master/packages/compose/src/hooks/use-focus-on-mount/index.js + * to avoid its absence in older versions of WordPress. + * + * This can be removed once the minimum supported version of WordPress includes this hook. + */ - return this.rval; - }, +/** + * External dependencies + */ - dispatchException: function(exception) { - if (this.done) { - throw exception; - } - var context = this; - function handle(loc, caught) { - record.type = "throw"; - record.arg = exception; - context.next = loc; - - if (caught) { - // If the dispatched exception was caught by a catch block, - // then let that catch block handle the exception normally. - context.method = "next"; - context.arg = undefined; - } +/** + * Hook used to focus the first tabbable element on mount. + * + * @param {boolean|string} focusOnMount Focus on mount mode. + * @return {Function} Ref callback. + * + * @example + * ```js + * import { useFocusOnMount } from '@wordpress/compose'; + * + * const WithFocusOnMount = () => { + * const ref = useFocusOnMount() + * return ( + *
+ *
+ * ); + * } + * ``` + */ - return !! caught; - } +function useFocusOnMount() { + var focusOnMount = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 'firstElement'; + var focusOnMountRef = Object(external_wp_element_["useRef"])(focusOnMount); + Object(external_wp_element_["useEffect"])(function () { + focusOnMountRef.current = focusOnMount; + }, [focusOnMount]); + return Object(external_wp_element_["useCallback"])(function (node) { + if (!node || focusOnMountRef.current === false) { + return; + } - for (var i = this.tryEntries.length - 1; i >= 0; --i) { - var entry = this.tryEntries[i]; - var record = entry.completion; + if (node.contains(node.ownerDocument.activeElement)) { + return; + } - if (entry.tryLoc === "root") { - // Exception thrown outside of any try block that could handle - // it, so set the completion value of the entire function to - // throw the exception. - return handle("end"); - } + var target = node; - if (entry.tryLoc <= this.prev) { - var hasCatch = hasOwn.call(entry, "catchLoc"); - var hasFinally = hasOwn.call(entry, "finallyLoc"); + if (focusOnMountRef.current === 'firstElement') { + var firstTabbable = external_wp_dom_["focus"].tabbable.find(node)[0]; - if (hasCatch && hasFinally) { - if (this.prev < entry.catchLoc) { - return handle(entry.catchLoc, true); - } else if (this.prev < entry.finallyLoc) { - return handle(entry.finallyLoc); - } + if (firstTabbable) { + target = firstTabbable; + } + } - } else if (hasCatch) { - if (this.prev < entry.catchLoc) { - return handle(entry.catchLoc, true); - } - - } else if (hasFinally) { - if (this.prev < entry.finallyLoc) { - return handle(entry.finallyLoc); - } - - } else { - throw new Error("try statement without catch or finally"); - } - } - } - }, + target.focus(); + }, []); +} +// CONCATENATED MODULE: ./client/hooks/useFocusOutside.js +/** + * External dependencies + */ - abrupt: function(type, arg) { - for (var i = this.tryEntries.length - 1; i >= 0; --i) { - var entry = this.tryEntries[i]; - if (entry.tryLoc <= this.prev && - hasOwn.call(entry, "finallyLoc") && - this.prev < entry.finallyLoc) { - var finallyEntry = entry; - break; - } - } - if (finallyEntry && - (type === "break" || - type === "continue") && - finallyEntry.tryLoc <= arg && - arg <= finallyEntry.finallyLoc) { - // Ignore the finally entry if control is not jumping to a - // location outside the try/catch block. - finallyEntry = null; - } +/** + * Input types which are classified as button types, for use in considering + * whether element is a (focus-normalized) button. + * + * @type {string[]} + */ - var record = finallyEntry ? finallyEntry.completion : {}; - record.type = type; - record.arg = arg; +var INPUT_BUTTON_TYPES = ['button', 'submit']; +/** + * @typedef {HTMLButtonElement | HTMLLinkElement | HTMLInputElement} FocusNormalizedButton + */ +// Disable reason: Rule doesn't support predicate return types - if (finallyEntry) { - this.method = "next"; - this.next = finallyEntry.finallyLoc; - return ContinueSentinel; - } +/* eslint-disable jsdoc/valid-types */ - return this.complete(record); - }, +/** + * Returns true if the given element is a button element subject to focus + * normalization, or false otherwise. + * + * @see https://developer.mozilla.org/en-US/docs/Web/HTML/Element/button#Clicking_and_focus + * + * @param {EventTarget} eventTarget The target from a mouse or touch event. + * + * @return {eventTarget is FocusNormalizedButton} Whether element is a button. + */ - complete: function(record, afterLoc) { - if (record.type === "throw") { - throw record.arg; - } +function isFocusNormalizedButton(eventTarget) { + if (!(eventTarget instanceof window.HTMLElement)) { + return false; + } - if (record.type === "break" || - record.type === "continue") { - this.next = record.arg; - } else if (record.type === "return") { - this.rval = this.arg = record.arg; - this.method = "return"; - this.next = "end"; - } else if (record.type === "normal" && afterLoc) { - this.next = afterLoc; - } + switch (eventTarget.nodeName) { + case 'A': + case 'BUTTON': + return true; - return ContinueSentinel; - }, + case 'INPUT': + return Object(external_lodash_["includes"])(INPUT_BUTTON_TYPES, + /** @type {HTMLInputElement} */ + eventTarget.type); + } - finish: function(finallyLoc) { - for (var i = this.tryEntries.length - 1; i >= 0; --i) { - var entry = this.tryEntries[i]; - if (entry.finallyLoc === finallyLoc) { - this.complete(entry.completion, entry.afterLoc); - resetTryEntry(entry); - return ContinueSentinel; - } - } - }, + return false; +} +/* eslint-enable jsdoc/valid-types */ - "catch": function(tryLoc) { - for (var i = this.tryEntries.length - 1; i >= 0; --i) { - var entry = this.tryEntries[i]; - if (entry.tryLoc === tryLoc) { - var record = entry.completion; - if (record.type === "throw") { - var thrown = record.arg; - resetTryEntry(entry); - } - return thrown; - } - } +/** + * @typedef {import('react').SyntheticEvent} SyntheticEvent + */ - // The context.catch method must only be called with a location - // argument that corresponds to a known catch block. - throw new Error("illegal catch attempt"); - }, +/** + * @callback EventCallback + * @param {SyntheticEvent} event input related event. + */ - delegateYield: function(iterable, resultName, nextLoc) { - this.delegate = { - iterator: values(iterable), - resultName: resultName, - nextLoc: nextLoc - }; +/** + * @typedef FocusOutsideReactElement + * @property {EventCallback} handleFocusOutside callback for a focus outside event. + */ - if (this.method === "next") { - // Deliberately forget the last sent value so that we don't - // accidentally pass it on to the delegate. - this.arg = undefined; - } +/** + * @typedef {import('react').MutableRefObject} FocusOutsideRef + */ - return ContinueSentinel; - } - }; +/** + * @typedef {Object} FocusOutsideReturnValue + * @property {EventCallback} onFocus An event handler for focus events. + * @property {EventCallback} onBlur An event handler for blur events. + * @property {EventCallback} onMouseDown An event handler for mouse down events. + * @property {EventCallback} onMouseUp An event handler for mouse up events. + * @property {EventCallback} onTouchStart An event handler for touch start events. + * @property {EventCallback} onTouchEnd An event handler for touch end events. + */ - // Regardless of whether this script is executing as a CommonJS module - // or not, return the runtime object so that we can declare the variable - // regeneratorRuntime in the outer scope, which allows this module to be - // injected easily by `bin/regenerator --include-runtime script.js`. - return exports; +/** + * A react hook that can be used to check whether focus has moved outside the + * element the event handlers are bound to. + * + * @param {EventCallback} onFocusOutside A callback triggered when focus moves outside + * the element the event handlers are bound to. + * + * @return {FocusOutsideReturnValue} An object containing event handlers. Bind the event handlers + * to a wrapping element element to capture when focus moves + * outside that element. + */ -}( - // If this script is executing as a CommonJS module, use module.exports - // as the regeneratorRuntime namespace. Otherwise create a new empty - // object. Either way, the resulting object will be used to initialize - // the regeneratorRuntime variable at the top of this file. - true ? module.exports : undefined -)); -try { - regeneratorRuntime = runtime; -} catch (accidentalStrictMode) { - // This module should not be running in strict mode, so the above - // assignment should always work unless something is misconfigured. Just - // in case runtime.js accidentally runs in strict mode, we can escape - // strict mode using a global Function call. This could conceivably fail - // if a Content Security Policy forbids using Function, but in that case - // the proper solution is to fix the accidental strict mode problem. If - // you've misconfigured your bundler to force strict mode and applied a - // CSP to forbid Function, and you're not willing to fix either of those - // problems, please detail your unique predicament in a GitHub issue. - Function("r", "regeneratorRuntime = r")(runtime); -} +function useFocusOutside(onFocusOutside) { + var currentOnFocusOutside = Object(external_wp_element_["useRef"])(onFocusOutside); + Object(external_wp_element_["useEffect"])(function () { + currentOnFocusOutside.current = onFocusOutside; + }, [onFocusOutside]); + var preventBlurCheck = Object(external_wp_element_["useRef"])(false); + /** + * @type {import('react').MutableRefObject} + */ + var blurCheckTimeoutId = Object(external_wp_element_["useRef"])(); + /** + * Cancel a blur check timeout. + */ -/***/ }), -/* 120 */ -/***/ (function(module, exports, __webpack_require__) { + var cancelBlurCheck = Object(external_wp_element_["useCallback"])(function () { + clearTimeout(blurCheckTimeoutId.current); + }, []); // Cancel blur checks on unmount. -"use strict"; -/** - * Copyright (c) 2013-present, Facebook, Inc. - * - * This source code is licensed under the MIT license found in the - * LICENSE file in the root directory of this source tree. - */ + Object(external_wp_element_["useEffect"])(function () { + return function () { + return cancelBlurCheck(); + }; + }, []); // Cancel a blur check if the callback or ref is no longer provided. + Object(external_wp_element_["useEffect"])(function () { + if (!onFocusOutside) { + cancelBlurCheck(); + } + }, [onFocusOutside, cancelBlurCheck]); + /** + * Handles a mousedown or mouseup event to respectively assign and + * unassign a flag for preventing blur check on button elements. Some + * browsers, namely Firefox and Safari, do not emit a focus event on + * button elements when clicked, while others do. The logic here + * intends to normalize this as treating click on buttons as focus. + * + * @see https://developer.mozilla.org/en-US/docs/Web/HTML/Element/button#Clicking_and_focus + * + * @param {SyntheticEvent} event Event for mousedown or mouseup. + */ + var normalizeButtonFocus = Object(external_wp_element_["useCallback"])(function (event) { + var type = event.type, + target = event.target; + var isInteractionEnd = Object(external_lodash_["includes"])(['mouseup', 'touchend'], type); -var ReactPropTypesSecret = __webpack_require__(121); + if (isInteractionEnd) { + preventBlurCheck.current = false; + } else if (isFocusNormalizedButton(target)) { + preventBlurCheck.current = true; + } + }, []); + /** + * A callback triggered when a blur event occurs on the element the handler + * is bound to. + * + * Calls the `onFocusOutside` callback in an immediate timeout if focus has + * move outside the bound element and is still within the document. + * + * @param {SyntheticEvent} event Blur event. + */ -function emptyFunction() {} -function emptyFunctionWithReset() {} -emptyFunctionWithReset.resetWarningCache = emptyFunction; + var queueBlurCheck = Object(external_wp_element_["useCallback"])(function (event) { + // React does not allow using an event reference asynchronously + // due to recycling behavior, except when explicitly persisted. + event.persist(); // Skip blur check if clicking button. See `normalizeButtonFocus`. -module.exports = function() { - function shim(props, propName, componentName, location, propFullName, secret) { - if (secret === ReactPropTypesSecret) { - // It is still safe when called from React. + if (preventBlurCheck.current) { return; } - var err = new Error( - 'Calling PropTypes validators directly is not supported by the `prop-types` package. ' + - 'Use PropTypes.checkPropTypes() to call them. ' + - 'Read more at http://fb.me/use-check-prop-types' - ); - err.name = 'Invariant Violation'; - throw err; - }; - shim.isRequired = shim; - function getShim() { - return shim; - }; - // Important! - // Keep this list in sync with production version in `./factoryWithTypeCheckers.js`. - var ReactPropTypes = { - array: shim, - bool: shim, - func: shim, - number: shim, - object: shim, - string: shim, - symbol: shim, - any: shim, - arrayOf: getShim, - element: shim, - elementType: shim, - instanceOf: getShim, - node: shim, - objectOf: getShim, - oneOf: getShim, - oneOfType: getShim, - shape: getShim, - exact: getShim, + blurCheckTimeoutId.current = setTimeout(function () { + // If document is not focused then focus should remain + // inside the wrapped component and therefore we cancel + // this blur event thereby leaving focus in place. + // https://developer.mozilla.org/en-US/docs/Web/API/Document/hasFocus. + if (!document.hasFocus()) { + event.preventDefault(); + return; + } - checkPropTypes: emptyFunctionWithReset, - resetWarningCache: emptyFunction + if (typeof currentOnFocusOutside.current === 'function') { + currentOnFocusOutside.current(event); + } + }, 0); + }, []); + return { + onFocus: cancelBlurCheck, + onMouseDown: normalizeButtonFocus, + onMouseUp: normalizeButtonFocus, + onTouchStart: normalizeButtonFocus, + onTouchEnd: normalizeButtonFocus, + onBlur: queueBlurCheck }; - - ReactPropTypes.PropTypes = ReactPropTypes; - - return ReactPropTypes; -}; +} +// CONCATENATED MODULE: ./client/header/activity-panel/panel.js -/***/ }), -/* 121 */ -/***/ (function(module, exports, __webpack_require__) { -"use strict"; /** - * Copyright (c) 2013-present, Facebook, Inc. - * - * This source code is licensed under the MIT license found in the - * LICENSE file in the root directory of this source tree. + * External dependencies */ -var ReactPropTypesSecret = 'SECRET_DO_NOT_PASS_THIS_OR_YOU_WILL_BE_FIRED'; +/** + * Internal dependencies + */ -module.exports = ReactPropTypesSecret; -/***/ }), -/* 122 */, -/* 123 */, -/* 124 */, -/* 125 */, -/* 126 */, -/* 127 */ -/***/ (function(module, exports) { +var panel_Panel = function Panel(_ref) { + var content = _ref.content, + isPanelOpen = _ref.isPanelOpen, + isPanelSwitching = _ref.isPanelSwitching, + currentTab = _ref.currentTab, + tab = _ref.tab, + closePanel = _ref.closePanel, + clearPanel = _ref.clearPanel; + var panelClass = 'woocommerce-layout__activity-panel-wrapper'; -var g; + var handleFocusOutside = function handleFocusOutside(event) { + var isClickOnModalOrSnackbar = event.relatedTarget && (event.relatedTarget.closest('.woocommerce-inbox-dismiss-confirmation_modal') || event.relatedTarget.closest('.components-snackbar__action')); -// This works in non-strict mode -g = (function() { - return this; -})(); + if (isPanelOpen && !isClickOnModalOrSnackbar) { + closePanel(); + } + }; -try { - // This works if eval is allowed (see CSP) - g = g || new Function("return this")(); -} catch (e) { - // This works if the window reference is available - if (typeof window === "object") g = window; -} + var possibleFocusPanel = function possibleFocusPanel() { + if (!containerRef.current || !isPanelOpen || !tab) { + return; + } -// g can still be undefined, but nothing to do about it... -// We return undefined, instead of nothing here, so it's -// easier to handle this case. if(!global) { ...} + focusOnMountRef(containerRef.current); + }; -module.exports = g; + var finishTransition = function finishTransition(e) { + if (e && e.propertyName === 'transform') { + clearPanel(); + possibleFocusPanel(); + } + }; + var focusOnMountRef = useFocusOnMount(); + var useFocusOutsideProps = useFocusOutside(handleFocusOutside); + var containerRef = Object(external_wp_element_["useRef"])(null); + var mergedContainerRef = Object(external_wp_element_["useCallback"])(function (node) { + containerRef.current = node; + focusOnMountRef(node); + }, []); -/***/ }), -/* 128 */, -/* 129 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { + if (!tab) { + return Object(external_wp_element_["createElement"])("div", { + className: panelClass + }); + } -"use strict"; -/* unused harmony export isHorizontalEdge */ -/* unused harmony export isVerticalEdge */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return getRectangleFromRange; }); -/* unused harmony export computeCaretRect */ -/* unused harmony export placeCaretAtHorizontalEdge */ -/* unused harmony export placeCaretAtVerticalEdge */ -/* unused harmony export isTextField */ -/* unused harmony export isNumberInput */ -/* unused harmony export documentHasTextSelection */ -/* unused harmony export documentHasUncollapsedSelection */ -/* unused harmony export documentHasSelection */ -/* unused harmony export isEntirelySelected */ -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return getScrollContainer; }); -/* unused harmony export getOffsetParent */ -/* unused harmony export replace */ -/* unused harmony export remove */ -/* unused harmony export insertAfter */ -/* unused harmony export unwrap */ -/* unused harmony export replaceTag */ -/* unused harmony export wrap */ -/* unused harmony export __unstableStripHTML */ -/* unused harmony export isEmpty */ -/* unused harmony export removeInvalidHTML */ -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(2); -/* harmony import */ var lodash__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(lodash__WEBPACK_IMPORTED_MODULE_0__); -/* harmony import */ var _phrasing_content__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(70); -/** - * External dependencies - */ + if (!content) { + return null; + } -/** - * Internal dependencies - */ + var classNames = classnames_default()(panelClass, { + 'is-open': isPanelOpen, + 'is-switching': isPanelSwitching + }); + return Object(external_wp_element_["createElement"])("div", extends_default()({ + className: classNames, + tabIndex: 0, + role: "tabpanel", + "aria-label": tab.title, + onTransitionEnd: finishTransition + }, useFocusOutsideProps, { + ref: mergedContainerRef + }), Object(external_wp_element_["createElement"])("div", { + className: "woocommerce-layout__activity-panel-content", + key: 'activity-panel-' + currentTab, + id: 'activity-panel-' + currentTab + }, Object(external_wp_element_["createElement"])(external_wp_element_["Suspense"], { + fallback: Object(external_wp_element_["createElement"])(external_wc_components_["Spinner"], null) + }, content))); +}; +/* harmony default export */ var panel = (panel_Panel); +// CONCATENATED MODULE: ./client/header/activity-panel/index.js -function getComputedStyle(node) { - return node.ownerDocument.defaultView.getComputedStyle(node); -} -/** - * Returns true if the given selection object is in the forward direction, or - * false otherwise. - * - * @see https://developer.mozilla.org/en-US/docs/Web/API/Node/compareDocumentPosition - * - * @param {Selection} selection Selection object to check. - * - * @return {boolean} Whether the selection is forward. - */ -function isSelectionForward(selection) { - var anchorNode = selection.anchorNode, - focusNode = selection.focusNode, - anchorOffset = selection.anchorOffset, - focusOffset = selection.focusOffset; - var position = anchorNode.compareDocumentPosition(focusNode); // Disable reason: `Node#compareDocumentPosition` returns a bitmask value, - // so bitwise operators are intended. - /* eslint-disable no-bitwise */ - // Compare whether anchor node precedes focus node. If focus node (where - // end of selection occurs) is after the anchor node, it is forward. - if (position & anchorNode.DOCUMENT_POSITION_PRECEDING) { - return false; - } - if (position & anchorNode.DOCUMENT_POSITION_FOLLOWING) { - return true; - } - /* eslint-enable no-bitwise */ - // `compareDocumentPosition` returns 0 when passed the same node, in which - // case compare offsets. - if (position === 0) { - return anchorOffset <= focusOffset; - } // This should never be reached, but return true as default case. - return true; -} /** - * Check whether the selection is at the edge of the container. Checks for - * horizontal position by default. Set `onlyVertical` to true to check only - * vertically. - * - * @param {Element} container Focusable element. - * @param {boolean} isReverse Set to true to check left, false to check right. - * @param {boolean} onlyVertical Set to true to check only vertical position. - * - * @return {boolean} True if at the edge, false if not. + * External dependencies */ -function isEdge(container, isReverse, onlyVertical) { - if (Object(lodash__WEBPACK_IMPORTED_MODULE_0__["includes"])(['INPUT', 'TEXTAREA'], container.tagName)) { - if (container.selectionStart !== container.selectionEnd) { - return false; - } - if (isReverse) { - return container.selectionStart === 0; - } - return container.value.length === container.selectionStart; - } - if (!container.isContentEditable) { - return true; - } - var ownerDocument = container.ownerDocument; - var defaultView = ownerDocument.defaultView; - var selection = defaultView.getSelection(); - if (!selection.rangeCount) { - return false; - } - var originalRange = selection.getRangeAt(0); - var range = originalRange.cloneRange(); - var isForward = isSelectionForward(selection); - var isCollapsed = selection.isCollapsed; // Collapse in direction of selection. - if (!isCollapsed) { - range.collapse(!isForward); - } - var rangeRect = getRectangleFromRange(range); +/** + * Internal dependencies + */ - if (!rangeRect) { - return false; - } - var computedStyle = getComputedStyle(container); - var lineHeight = parseInt(computedStyle.lineHeight, 10) || 0; // Only consider the multiline selection at the edge if the direction is - // towards the edge. - if (!isCollapsed && rangeRect.height > lineHeight && isForward === isReverse) { - return false; - } - var padding = parseInt(computedStyle["padding".concat(isReverse ? 'Top' : 'Bottom')], 10) || 0; // Calculate a buffer that is half the line height. In some browsers, the - // selection rectangle may not fill the entire height of the line, so we add - // 3/4 the line height to the selection rectangle to ensure that it is well - // over its line boundary. - var buffer = 3 * parseInt(lineHeight, 10) / 4; - var containerRect = container.getBoundingClientRect(); - var originalRangeRect = getRectangleFromRange(originalRange); - var verticalEdge = isReverse ? containerRect.top + padding > originalRangeRect.top - buffer : containerRect.bottom - padding < originalRangeRect.bottom + buffer; - if (!verticalEdge) { - return false; - } - if (onlyVertical) { - return true; - } // In the case of RTL scripts, the horizontal edge is at the opposite side. - var direction = computedStyle.direction; - var isReverseDir = direction === 'rtl' ? !isReverse : isReverse; // To calculate the horizontal position, we insert a test range and see if - // this test range has the same horizontal position. This method proves to - // be better than a DOM-based calculation, because it ignores empty text - // nodes and a trailing line break element. In other words, we need to check - // visual positioning, not DOM positioning. +var HelpPanel = Object(external_wp_element_["lazy"])(function () { + return Promise.all(/* import() | activity-panels-help */[__webpack_require__.e(54), __webpack_require__.e(6), __webpack_require__.e(7)]).then(__webpack_require__.bind(null, 705)); +}); +var InboxPanel = Object(external_wp_element_["lazy"])(function () { + return Promise.all(/* import() | activity-panels-inbox */[__webpack_require__.e(1), __webpack_require__.e(3), __webpack_require__.e(4), __webpack_require__.e(8)]).then(__webpack_require__.bind(null, 689)); +}); +var activity_panel_ActivityPanel = function ActivityPanel(_ref) { + var isEmbedded = _ref.isEmbedded, + query = _ref.query, + userPreferencesData = _ref.userPreferencesData; - var x = isReverseDir ? containerRect.left + 1 : containerRect.right - 1; - var y = isReverse ? containerRect.top + buffer : containerRect.bottom - buffer; - var testRange = hiddenCaretRangeFromPoint(ownerDocument, x, y, container); + var _useState = Object(external_wp_element_["useState"])(''), + _useState2 = slicedToArray_default()(_useState, 2), + currentTab = _useState2[0], + setCurrentTab = _useState2[1]; - if (!testRange) { - return false; - } + var _useState3 = Object(external_wp_element_["useState"])(false), + _useState4 = slicedToArray_default()(_useState3, 2), + isPanelClosing = _useState4[0], + setIsPanelClosing = _useState4[1]; + + var _useState5 = Object(external_wp_element_["useState"])(false), + _useState6 = slicedToArray_default()(_useState5, 2), + isPanelOpen = _useState6[0], + setIsPanelOpen = _useState6[1]; + + var _useState7 = Object(external_wp_element_["useState"])(false), + _useState8 = slicedToArray_default()(_useState7, 2), + isPanelSwitching = _useState8[0], + setIsPanelSwitching = _useState8[1]; + + var _useSelect = Object(external_wp_data_["useSelect"])(function (select) { + var _select = select(external_wc_data_["OPTIONS_STORE_NAME"]), + getOption = _select.getOption, + isResolving = _select.isResolving; - var side = isReverseDir ? 'left' : 'right'; - var testRect = getRectangleFromRange(testRange); // Allow the position to be 1px off. + return { + hasUnreadNotes: getUnreadNotes(select), + requestingTaskListOptions: isResolving('getOption', ['woocommerce_task_list_complete']) || isResolving('getOption', ['woocommerce_task_list_hidden']), + setupTaskListComplete: getOption('woocommerce_task_list_complete') === 'yes', + setupTaskListHidden: getOption('woocommerce_task_list_hidden') === 'yes', + trackedCompletedTasks: getOption('woocommerce_task_list_tracked_completed_tasks') || [] + }; + }), + hasUnreadNotes = _useSelect.hasUnreadNotes, + requestingTaskListOptions = _useSelect.requestingTaskListOptions, + setupTaskListComplete = _useSelect.setupTaskListComplete, + setupTaskListHidden = _useSelect.setupTaskListHidden, + trackedCompletedTasks = _useSelect.trackedCompletedTasks; - return Math.abs(testRect[side] - rangeRect[side]) <= 1; -} -/** - * Check whether the selection is horizontally at the edge of the container. - * - * @param {Element} container Focusable element. - * @param {boolean} isReverse Set to true to check left, false for right. - * - * @return {boolean} True if at the horizontal edge, false if not. - */ + var _useDispatch = Object(external_wp_data_["useDispatch"])(external_wc_data_["OPTIONS_STORE_NAME"]), + updateOptions = _useDispatch.updateOptions; + var _useUser = Object(external_wc_data_["useUser"])(), + currentUserCan = _useUser.currentUserCan; -function isHorizontalEdge(container, isReverse) { - return isEdge(container, isReverse); -} -/** - * Check whether the selection is vertically at the edge of the container. - * - * @param {Element} container Focusable element. - * @param {boolean} isReverse Set to true to check top, false for bottom. - * - * @return {boolean} True if at the vertical edge, false if not. - */ + var togglePanel = function togglePanel(_ref2, isTabOpen) { + var tabName = _ref2.name; + var panelSwitching = tabName !== currentTab && currentTab !== '' && isTabOpen && isPanelOpen; -function isVerticalEdge(container, isReverse) { - return isEdge(container, isReverse, true); -} -/** - * Get the rectangle of a given Range. - * - * @param {Range} range The range. - * - * @return {DOMRect} The rectangle. - */ + if (isPanelClosing) { + return; + } -function getRectangleFromRange(range) { - // For uncollapsed ranges, get the rectangle that bounds the contents of the - // range; this a rectangle enclosing the union of the bounding rectangles - // for all the elements in the range. - if (!range.collapsed) { - return range.getBoundingClientRect(); - } + setCurrentTab(tabName); + setIsPanelOpen(isTabOpen); + setIsPanelSwitching(panelSwitching); + }; - var _range = range, - startContainer = _range.startContainer; - var ownerDocument = startContainer.ownerDocument; // Correct invalid "BR" ranges. The cannot contain any children. + var _closePanel = function closePanel() { + setIsPanelClosing(true); + setIsPanelOpen(false); + }; - if (startContainer.nodeName === 'BR') { - var parentNode = startContainer.parentNode; - var index = Array.from(parentNode.childNodes).indexOf(startContainer); - range = ownerDocument.createRange(); - range.setStart(parentNode, index); - range.setEnd(parentNode, index); - } + var _clearPanel = function clearPanel() { + if (!isPanelOpen) { + setIsPanelClosing(false); + setIsPanelSwitching(false); + setCurrentTab(''); + } + }; - var rect = range.getClientRects()[0]; // If the collapsed range starts (and therefore ends) at an element node, - // `getClientRects` can be empty in some browsers. This can be resolved - // by adding a temporary text node with zero-width space to the range. - // - // See: https://stackoverflow.com/a/6847328/995445 + var isHomescreen = function isHomescreen() { + return query.page === 'wc-admin' && !query.path; + }; - if (!rect) { - var padNode = ownerDocument.createTextNode("\u200B"); // Do not modify the live range. + var isPerformingSetupTask = function isPerformingSetupTask() { + return query.task && !query.path && (requestingTaskListOptions === true || setupTaskListHidden === false && setupTaskListComplete === false); + }; // @todo Pull in dynamic unread status/count - range = range.cloneRange(); - range.insertNode(padNode); - rect = range.getClientRects()[0]; - padNode.parentNode.removeChild(padNode); - } - return rect; -} -/** - * Get the rectangle for the selection in a container. - * - * @param {Window} win The window of the selection. - * - * @return {?DOMRect} The rectangle. - */ + var getTabs = function getTabs() { + var inbox = { + name: 'inbox', + title: Object(external_wp_i18n_["__"])('Inbox', 'woocommerce-admin'), + icon: Object(external_wp_element_["createElement"])(build_module_icon["a" /* default */], { + icon: library_inbox + }), + unread: hasUnreadNotes, + visible: (isEmbedded || !isHomescreen()) && !isPerformingSetupTask() + }; + var setup = { + name: 'setup', + title: Object(external_wp_i18n_["__"])('Finish setup', 'woocommerce-admin'), + icon: Object(external_wp_element_["createElement"])(setup_progress_SetupProgress, null), + onClick: function onClick() { + var currentLocation = window.location.href; + var homescreenLocation = Object(wc_admin_settings["f" /* getAdminLink */])('admin.php?page=wc-admin'); // Don't navigate if we're already on the homescreen, this will cause an infinite loop -function computeCaretRect(win) { - var selection = win.getSelection(); - var range = selection.rangeCount ? selection.getRangeAt(0) : null; + if (currentLocation !== homescreenLocation) { + // Ensure that if the user is trying to get to the task list they can see it even if + // it was dismissed. + if (setupTaskListHidden === 'no') { + redirectToHomeScreen(); + } else { + updateOptions({ + woocommerce_task_list_hidden: 'no' + }).then(redirectToHomeScreen); + } + } - if (!range) { - return; - } + return null; + }, + visible: currentUserCan('manage_woocommerce') && !setupTaskListComplete && !setupTaskListHidden && !isPerformingSetupTask() && (!isHomescreen() || isEmbedded) + }; + var help = { + name: 'help', + title: Object(external_wp_i18n_["__"])('Help', 'woocommerce-admin'), + icon: Object(external_wp_element_["createElement"])(build_module_icon["a" /* default */], { + icon: library_help + }), + visible: isHomescreen() && !isEmbedded || isPerformingSetupTask() + }; + var displayOptions = { + component: display_options_DisplayOptions, + visible: !isEmbedded && isHomescreen() && !isPerformingSetupTask() + }; + var previewSite = { + name: 'previewSite', + title: Object(external_wp_i18n_["__"])('Preview site', 'woocommerce-admin'), + icon: Object(external_wp_element_["createElement"])(build_module_icon["a" /* default */], { + icon: external["a" /* default */] + }), + visible: query.page === 'wc-admin' && query.task === 'appearance', + onClick: function onClick() { + window.open(window.wcSettings.siteUrl); + return null; + } + }; + return [inbox, setup, previewSite, displayOptions, help].filter(function (tab) { + return tab.visible; + }); + }; - return getRectangleFromRange(range); -} -/** - * Places the caret at start or end of a given element. - * - * @param {Element} container Focusable element. - * @param {boolean} isReverse True for end, false for start. - */ + var getPanelContent = function getPanelContent(tab) { + var task = query.task; -function placeCaretAtHorizontalEdge(container, isReverse) { - if (!container) { - return; - } + switch (tab) { + case 'inbox': + return Object(external_wp_element_["createElement"])(InboxPanel, null); + + case 'help': + return Object(external_wp_element_["createElement"])(HelpPanel, { + taskName: task + }); - if (Object(lodash__WEBPACK_IMPORTED_MODULE_0__["includes"])(['INPUT', 'TEXTAREA'], container.tagName)) { - container.focus(); + default: + return null; + } + }; - if (isReverse) { - container.selectionStart = container.value.length; - container.selectionEnd = container.value.length; + var redirectToHomeScreen = function redirectToHomeScreen() { + if (Object(utils["f" /* isWCAdmin */])(window.location.href)) { + Object(external_wc_navigation_["getHistory"])().push(Object(external_wc_navigation_["getNewPath"])({}, '/', {})); } else { - container.selectionStart = 0; - container.selectionEnd = 0; + window.location.href = Object(wc_admin_settings["f" /* getAdminLink */])('admin.php?page=wc-admin'); } + }; - return; - } + var closedHelpPanelHighlight = function closedHelpPanelHighlight() { + Object(external_wc_tracks_["recordEvent"])('help_tooltip_click'); - container.focus(); + if (userPreferencesData && userPreferencesData.updateUserPreferences) { + userPreferencesData.updateUserPreferences({ + help_panel_highlight_shown: 'yes' + }); + } + }; - if (!container.isContentEditable) { - return; - } // Select on extent child of the container, not the container itself. This - // avoids the selection always being `endOffset` of 1 when placed at end, - // where `startContainer`, `endContainer` would always be container itself. + var shouldShowHelpTooltip = function shouldShowHelpTooltip() { + var task = query.task; + var startedTasks = userPreferencesData && userPreferencesData.task_list_tracked_started_tasks; + var highlightShown = userPreferencesData && userPreferencesData.help_panel_highlight_shown; + if (task && highlightShown !== 'yes' && (startedTasks || {})[task] > 1 && !trackedCompletedTasks.includes(task)) { + return true; + } - var rangeTarget = container[isReverse ? 'lastChild' : 'firstChild']; // If no range target, it implies that the container is empty. Focusing is - // sufficient for caret to be placed correctly. + return false; + }; - if (!rangeTarget) { - return; - } + var tabs = getTabs(); + var headerId = Object(external_lodash_["uniqueId"])('activity-panel-header_'); + var showHelpHighlightTooltip = shouldShowHelpTooltip(); + return Object(external_wp_element_["createElement"])("div", null, Object(external_wp_element_["createElement"])(external_wc_components_["H"], { + id: headerId, + className: "screen-reader-text" + }, Object(external_wp_i18n_["__"])('Store Activity', 'woocommerce-admin')), Object(external_wp_element_["createElement"])(external_wc_components_["Section"], { + component: "aside", + id: "woocommerce-activity-panel", + className: "woocommerce-layout__activity-panel", + "aria-labelledby": headerId + }, Object(external_wp_element_["createElement"])(tabs_Tabs, { + tabs: tabs, + tabOpen: isPanelOpen, + selectedTab: currentTab, + onTabClick: function onTabClick(tab, tabOpen) { + if (tab.onClick) { + tab.onClick(); + return; + } - var ownerDocument = container.ownerDocument; - var defaultView = ownerDocument.defaultView; - var selection = defaultView.getSelection(); - var range = ownerDocument.createRange(); - range.selectNodeContents(rangeTarget); - range.collapse(!isReverse); - selection.removeAllRanges(); - selection.addRange(range); -} + togglePanel(tab, tabOpen); + } + }), Object(external_wp_element_["createElement"])(panel_Panel, { + currentTab: true, + isPanelOpen: isPanelOpen, + isPanelSwitching: isPanelSwitching, + tab: Object(external_lodash_["find"])(getTabs(), { + name: currentTab + }), + content: getPanelContent(currentTab), + closePanel: function closePanel() { + return _closePanel(); + }, + clearPanel: function clearPanel() { + return _clearPanel(); + } + })), showHelpHighlightTooltip ? Object(external_wp_element_["createElement"])(HighlightTooltip, { + delay: 1000, + useAnchor: true, + title: Object(external_wp_i18n_["__"])("We're here for help", 'woocommerce-admin'), + content: Object(external_wp_i18n_["__"])('If you have any questions, feel free to explore the WooCommerce docs listed here.', 'woocommerce-admin'), + closeButtonText: Object(external_wp_i18n_["__"])('Got it', 'woocommerce-admin'), + id: "activity-panel-tab-help", + onClose: function onClose() { + return closedHelpPanelHighlight(); + }, + onShow: function onShow() { + return Object(external_wc_tracks_["recordEvent"])('help_tooltip_view'); + } + }) : null); +}; +activity_panel_ActivityPanel.defaultProps = { + getHistory: external_wc_navigation_["getHistory"] +}; +/* harmony default export */ var activity_panel = (activity_panel_ActivityPanel); +// CONCATENATED MODULE: ./client/lib/platform/index.js +var ANDROID_PLATFORM = 'android'; +var IOS_PLATFORM = 'ios'; +var UNKNOWN_PLATFORM = 'unknown'; /** - * Polyfill. - * Get a collapsed range for a given point. - * - * @see https://developer.mozilla.org/en-US/docs/Web/API/Document/caretRangeFromPoint - * - * @param {Document} doc The document of the range. - * @param {number} x Horizontal position within the current viewport. - * @param {number} y Vertical position within the current viewport. - * - * @return {?Range} The best range for the given point. + * Provide basic detection of platform based on user agent. This is not + * a robust check for browser features or the like. You should only use + * this for non-critical display logic. */ -function caretRangeFromPoint(doc, x, y) { - if (doc.caretRangeFromPoint) { - return doc.caretRangeFromPoint(x, y); +var platform = function platform() { + if (/iPhone|iPad|iPod/i.test(window.navigator.userAgent)) { + return IOS_PLATFORM; + } else if (/Android/i.test(window.navigator.userAgent)) { + return ANDROID_PLATFORM; } - if (!doc.caretPositionFromPoint) { - return null; - } + return UNKNOWN_PLATFORM; +}; +// CONCATENATED MODULE: ./client/mobile-banner/app-icon.js + +var app_icon_AppIcon = function AppIcon() { + return Object(external_wp_element_["createElement"])("svg", { + width: "37", + height: "37", + viewBox: "0 0 92 92", + fill: "none", + xmlns: "http://www.w3.org/2000/svg" + }, Object(external_wp_element_["createElement"])("rect", { + width: "92", + height: "92", + rx: "21.3953", + fill: "#7F54B3" + }), Object(external_wp_element_["createElement"])("path", { + fillRule: "evenodd", + clipRule: "evenodd", + d: "M72.5937 28.043H19.8094C16.4781 28.0459 13.7783 30.7705 13.7754 34.1324V54.4501C13.7783 57.812 16.4781 60.5366 19.8094 60.5395H44.8229L56.2573 66.9607L53.6672 60.5395H72.599C74.2009 60.5402 75.7374 59.8983 76.8702 58.7552C78.0029 57.612 78.639 56.0614 78.6383 54.4447V34.1324C78.6376 32.5157 78.0002 30.9657 76.8664 29.8235C75.7327 28.6814 74.1956 28.0408 72.5937 28.043ZM19.1057 32.4208C18.4658 32.4324 17.8646 32.7359 17.467 33.2482C17.0888 33.7635 16.9404 34.4175 17.058 35.0502C18.5962 45.0986 20.0338 51.8757 21.371 55.3816C21.8779 56.658 22.4896 57.2703 23.2063 57.2185C24.3075 57.1489 25.6263 55.5968 27.1627 52.5621C27.9964 50.8412 29.2602 48.2662 30.9539 44.837C32.3785 49.88 34.309 53.6787 36.7456 56.2331C37.4291 56.9436 38.1204 57.2748 38.8195 57.2266C39.4185 57.1931 39.953 56.8315 40.217 56.2813C40.4753 55.7358 40.5806 55.1278 40.5211 54.5248C40.3516 52.0703 40.5919 48.667 41.2421 44.3149C41.9081 39.8057 42.7523 36.5818 43.7749 34.6432C43.9822 34.2526 44.0733 33.8087 44.037 33.366C44.0039 32.7587 43.7116 32.1969 43.2374 31.829C42.7745 31.4367 42.1799 31.2446 41.5803 31.2935C40.8334 31.3325 40.1682 31.7885 39.8499 32.4797C38.2331 35.5019 37.0812 40.4109 36.3943 47.2068C35.2823 44.2394 34.4509 41.1703 33.9114 38.0412C33.623 36.4613 32.9037 35.7125 31.7536 35.7946C30.9592 35.8589 30.3063 36.3944 29.7819 37.4012L24.0348 48.5643C23.0997 44.6692 22.2205 39.9289 21.3972 34.3433C21.1997 32.9652 20.4358 32.3244 19.1057 32.4208ZM69.9089 34.6877C71.6969 35.0381 73.2407 36.2 74.1186 37.8559C74.9693 39.3247 75.3946 41.1161 75.3946 43.23C75.4148 45.9567 74.7062 48.6357 73.3477 50.9687C71.7778 53.7023 69.7195 55.0691 67.1727 55.0691C66.6933 55.0668 66.2153 55.0128 65.7467 54.9078C63.9584 54.5581 62.4143 53.396 61.5371 51.7396C60.6864 50.2452 60.261 48.4411 60.261 46.3272C60.2357 43.6127 60.945 40.9454 62.3079 38.6295C63.9023 35.8959 65.9607 34.5291 68.4829 34.5291C68.9623 34.5304 69.4402 34.5836 69.9089 34.6877ZM68.7937 49.4848C69.7707 48.5773 70.4399 47.2269 70.8012 45.4337V45.4419C70.9315 44.7826 70.9959 44.1112 70.9933 43.4382C70.986 42.5849 70.8291 41.74 70.5302 40.9452C70.1443 39.901 69.6304 39.3124 68.9884 39.1793C68.0378 38.9643 67.1239 39.5256 66.2469 40.8632C65.5812 41.8393 65.109 42.9432 64.8577 44.1106C64.7276 44.7708 64.6632 45.4432 64.6657 46.1171C64.6739 46.9677 64.8308 47.8096 65.1287 48.6019C65.5146 49.6388 66.0294 50.2274 66.6731 50.3678C67.3169 50.5081 68.0237 50.2138 68.7937 49.4848ZM57.9079 37.8559C57.0291 36.2008 55.4854 35.0392 53.6976 34.6877C53.2279 34.5837 52.749 34.5306 52.2687 34.5291C49.7443 34.5291 47.6856 35.8959 46.0927 38.6295C44.7295 40.9454 44.0201 43.6127 44.0454 46.3272C44.0454 48.4411 44.4699 50.2452 45.319 51.7396C46.1976 53.3949 47.7414 54.5566 49.5294 54.9078C49.999 55.0126 50.4779 55.0667 50.9582 55.0691C53.5055 55.0691 55.5642 53.7023 57.1343 50.9687C58.4922 48.6355 59.2001 45.9565 59.1789 43.23C59.1789 41.1161 58.7544 39.3247 57.9053 37.8559H57.9079ZM54.5903 45.4337C54.2307 47.2269 53.5614 48.5773 52.5825 49.4848C51.8115 50.2065 51.101 50.5017 50.4589 50.3678C49.8169 50.2338 49.3011 49.6461 48.9169 48.6019C48.6181 47.8097 48.4603 46.9678 48.4511 46.1171C48.4495 45.4431 48.5148 44.7707 48.6459 44.1106C48.8971 42.9432 49.3694 41.8393 50.0353 40.8632C50.9124 39.5256 51.8264 38.9643 52.7773 39.1793C53.4193 39.3124 53.9333 39.901 54.3193 40.9452C54.617 41.7404 54.7739 42.585 54.7824 43.4382C54.785 44.1112 54.7207 44.7826 54.5903 45.4419V45.4337Z", + fill: "white" + })); +}; +// EXTERNAL MODULE: ./client/mobile-banner/style.scss +var mobile_banner_style = __webpack_require__(426); + +// CONCATENATED MODULE: ./client/mobile-banner/constants.js +// The Play Store link is defined as an exported constant mainly for the sake of testing the Mobile App Banner. +// It is nearly impossible to fake navigation in JSDOM 16, so exposing this link for mocking allows us to +// avoid triggering a navigation. +var PLAY_STORE_LINK = 'https://play.google.com/store/apps/details?id=com.woocommerce.android'; +var TRACKING_EVENT_NAME = 'wcadmin_mobile_android_banner_click'; +// CONCATENATED MODULE: ./client/mobile-banner/index.js - var point = doc.caretPositionFromPoint(x, y); // If x or y are negative, outside viewport, or there is no text entry node. - // https://developer.mozilla.org/en-US/docs/Web/API/Document/caretRangeFromPoint - if (!point) { - return null; - } - var range = doc.createRange(); - range.setStart(point.offsetNode, point.offset); - range.collapse(true); - return range; -} /** - * Get a collapsed range for a given point. - * Gives the container a temporary high z-index (above any UI). - * This is preferred over getting the UI nodes and set styles there. - * - * @param {Document} doc The document of the range. - * @param {number} x Horizontal position within the current viewport. - * @param {number} y Vertical position within the current viewport. - * @param {Element} container Container in which the range is expected to be found. - * - * @return {?Range} The best range for the given point. + * External dependencies */ -function hiddenCaretRangeFromPoint(doc, x, y, container) { - var originalZIndex = container.style.zIndex; - var originalPosition = container.style.position; // A z-index only works if the element position is not static. - container.style.zIndex = '10000'; - container.style.position = 'relative'; - var range = caretRangeFromPoint(doc, x, y); - container.style.zIndex = originalZIndex; - container.style.position = originalPosition; - return range; -} + /** - * Places the caret at the top or bottom of a given element. - * - * @param {Element} container Focusable element. - * @param {boolean} isReverse True for bottom, false for top. - * @param {DOMRect} [rect] The rectangle to position the caret with. - * @param {boolean} [mayUseScroll=true] True to allow scrolling, false to disallow. + * Internal dependencies */ -function placeCaretAtVerticalEdge(container, isReverse, rect) { - var mayUseScroll = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : true; - - if (!container) { - return; - } - - if (!rect || !container.isContentEditable) { - placeCaretAtHorizontalEdge(container, isReverse); - return; - } // Offset by a buffer half the height of the caret rect. This is needed - // because caretRangeFromPoint may default to the end of the selection if - // offset is too close to the edge. It's unclear how to precisely calculate - // this threshold; it may be the padded area of some combination of line - // height, caret height, and font size. The buffer offset is effectively - // equivalent to a point at half the height of a line of text. - - - var buffer = rect.height / 2; - var editableRect = container.getBoundingClientRect(); - var x = rect.left; - var y = isReverse ? editableRect.bottom - buffer : editableRect.top + buffer; - var ownerDocument = container.ownerDocument; - var defaultView = ownerDocument.defaultView; - var range = hiddenCaretRangeFromPoint(ownerDocument, x, y, container); - - if (!range || !container.contains(range.startContainer)) { - if (mayUseScroll && (!range || !range.startContainer || !range.startContainer.contains(container))) { - // Might be out of view. - // Easier than attempting to calculate manually. - container.scrollIntoView(isReverse); - placeCaretAtVerticalEdge(container, isReverse, rect, false); - return; - } - placeCaretAtHorizontalEdge(container, isReverse); - return; - } - var selection = defaultView.getSelection(); - selection.removeAllRanges(); - selection.addRange(range); - container.focus(); // Editable was already focussed, it goes back to old range... - // This fixes it. - selection.removeAllRanges(); - selection.addRange(range); -} -/** - * Check whether the given element is a text field, where text field is defined - * by the ability to select within the input, or that it is contenteditable. - * - * See: https://html.spec.whatwg.org/#textFieldSelection - * - * @param {HTMLElement} element The HTML element. - * - * @return {boolean} True if the element is an text field, false if not. - */ +var SHOW_APP_BANNER_MODIFIER_CLASS = 'woocommerce-layout__show-app-banner'; +var mobile_banner_MobileAppBanner = function MobileAppBanner(_ref) { + var onInstall = _ref.onInstall, + onDismiss = _ref.onDismiss; + Object(external_wp_element_["useEffect"])(function () { + var layout = document.getElementsByClassName('woocommerce-layout')[0]; -function isTextField(element) { - var nodeName = element.nodeName, - contentEditable = element.contentEditable; - var nonTextInputs = ['button', 'checkbox', 'hidden', 'file', 'radio', 'image', 'range', 'reset', 'submit', 'number']; - return nodeName === 'INPUT' && !nonTextInputs.includes(element.type) || nodeName === 'TEXTAREA' || contentEditable === 'true'; -} -/** - * Check whether the given element is an input field of type number - * and has a valueAsNumber - * - * @param {HTMLElement} element The HTML element. - * - * @return {boolean} True if the element is input and holds a number. - */ + if (platform() === ANDROID_PLATFORM) { + if (layout) { + // This is a hack to allow the mobile banner to work in the context of the header which is + // position fixed. This can be refactored away when we move away from the activity panel + // in future. + layout.classList.add(SHOW_APP_BANNER_MODIFIER_CLASS); + } + } -function isNumberInput(element) { - var nodeName = element.nodeName, - type = element.type, - valueAsNumber = element.valueAsNumber; - return nodeName === 'INPUT' && type === 'number' && !!valueAsNumber; -} -/** - * Check whether the current document has selected text. This applies to ranges - * of text in the document, and not selection inside and